Drug Information| Drug ID:   | NPD8261 |
| Drug Name:   | Org-2766 |
| Molecular Formula:   | C40H55N9O11S |
| Canonical SMILES:   | NCCCC[C@H](C(=N[C@H](C(=O)O)Cc1ccccc1)O)N=C([C@@H](N=C([C@@H](N=C([C@@H](N=C([C@H](CCS(=O)(=O)C)N)O)CCC(=O)O)O)Cc1[nH]cnc1)O)Cc1ccccc1)O |
| Standard InCHI:   | "InChI=1S/C40H55N9O11S/c1-61(59,60)19-17-28(42)35(52)45-30(15-16-34(50)51)37(54)48-32(22-27-23-43-24-44-27)39(56)47-31(20-25-10-4-2-5-11-25)38(55)46-29(14-8-9-18-41)36(53)49-33(40(57)58)21-26-12-6-3-7-13-26/h2-7,10-13,23-24,28-33H,8-9,14-22,41-42H2,1H3,(H,43,44)(H,45,52)(H,46,55)(H,47,56)(H,48,54)(H,49,53)(H,50,51)(H,57,58)/t28-,29+,30-,31-,32-,33-/m0/s1" |
| Standard InCHIKey:   | QUCFVNGGGFLOES-ACQYNFKHSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD8261Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5294 | NPC479133 |
| Remote Similarity | 0.5252 | NPC479135 |
| Remote Similarity | 0.5208 | NPC479130 |
| Remote Similarity | 0.5208 | NPC479129 |
| Remote Similarity | 0.518 | NPC479132 |
| Remote Similarity | 0.5109 | NPC481270 |
| Molecular Weight   | 869.37 |
| ALogP   | -5.0749 |
| MLogP   | 3.55 |
| XLogP   | 1.886 |
| HDA   | 20 |
| HBD   | 10 |
| Rotatable Bonds   | 37 |
| TPSA   | 360.79 |
| RO5 Violation   | 3 |