NPASS Compound

Natural Product: NPC164456

Natural Product ID	NPC164456
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NQUMPFSQDYUTGM-JFCDPDKUSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	6325126
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 145152 0 0 0 0 0 0 0 0999 V2000 -6.6527 2.3353 -3.6457 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5718 1.7416 -2.2551 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6974 2.9024 -1.2889 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6849 0.7529 -2.1002 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1581 -0.6347 -2.1689 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1671 -0.9502 -1.0907 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1380 0.1301 -1.0041 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1918 1.1161 -2.1329 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7625 -0.3323 -0.7873 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9939 0.3189 0.0314 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5826 -0.0490 0.3455 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3725 -1.5523 0.1646 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0299 -1.8579 0.5321 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0332 -3.2161 1.2435 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5145 -0.8642 1.5748 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9768 -1.0477 1.9250 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7331 -0.7415 0.6540 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4035 -1.7568 -0.3643 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0650 -3.0721 0.0897 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1011 -1.4657 -1.6969 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9376 -1.9547 -0.6419 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5203 -1.1085 -1.8040 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9132 -1.0310 -2.1198 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8246 -1.8882 -1.2135 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5908 -3.3049 -1.6729 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2490 -1.5652 -1.4723 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3799 -1.4115 -2.9610 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1997 -2.5781 -0.8921 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6189 -2.3578 -1.2636 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9800 -2.8517 -2.5255 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0862 -0.7067 0.8784 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6224 0.5872 0.6822 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3113 0.9806 1.9788 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7281 0.4625 2.0184 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5214 1.2065 0.9477 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5501 1.5360 -0.1647 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3318 1.5551 -1.4610 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4964 1.8117 -2.5536 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5949 0.5304 -0.3081 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5688 0.3882 0.5049 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7864 1.0037 0.7202 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6426 0.2167 1.6971 C 0 0 1 0 0 0 0 0 0 0 0 0 11.6740 -0.6162 0.9635 C 0 0 2 0 0 0 0 0 0 0 0 0 12.5946 0.2916 0.2107 C 0 0 1 0 0 0 0 0 0 0 0 0 11.8090 1.4748 -0.2922 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4207 2.0540 -1.5540 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2452 1.1156 -2.5687 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4661 1.2243 -0.4756 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6227 0.7732 1.0368 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1056 -1.6053 0.1984 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2428 1.0946 2.5735 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8105 -0.8854 1.7350 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3000 2.3592 2.1000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9491 -1.0152 0.1744 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0776 -2.0606 0.8628 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5751 0.1076 0.6502 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3347 0.1513 1.8558 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7119 0.9952 2.8940 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6999 1.2603 4.0070 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9469 1.9304 3.4565 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1664 1.5242 2.0125 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8651 2.6759 1.1059 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4098 2.3609 -0.1555 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6532 0.3176 1.6639 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0288 1.4666 4.1983 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1437 2.0821 4.9863 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6200 0.2860 3.4299 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0480 3.2639 -3.6942 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3743 1.5855 -4.4090 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7123 2.6390 -3.8204 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7403 3.2398 -1.1819 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2372 2.6583 -0.3115 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1148 3.7807 -1.6803 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4363 0.8818 -2.9678 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3305 0.9594 -1.2252 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7223 -0.7902 -3.1920 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0591 -1.3334 -2.0797 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4811 0.7781 -0.1161 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5298 1.9820 -1.8171 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8066 0.8008 -3.0897 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3790 1.1995 0.5340 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9576 0.5891 -0.2459 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5122 0.1054 1.4654 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0351 -2.0164 0.9567 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6237 -3.2004 2.1803 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4643 -4.0068 0.6122 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0110 -3.4743 1.5811 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1205 -0.9673 2.4712 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4663 0.1833 1.2317 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2157 -0.2167 2.6337 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2285 -1.9726 2.4203 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4209 0.2898 0.3607 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0095 -3.8262 -0.7112 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7335 -3.4002 1.0664 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1608 -2.8126 0.1818 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8529 -0.5047 -2.1274 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2023 -1.5312 -1.4524 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9469 -2.3420 -2.3864 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9111 -3.0254 -0.9906 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9332 -0.0710 -1.6083 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1431 -1.4585 -2.6808 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3483 -0.0134 -2.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0300 -1.3546 -3.1980 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8198 -3.3714 -2.5067 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4708 -3.7482 -2.2353 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4118 -4.0267 -0.8729 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8181 -2.2311 -3.5133 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3721 -1.4724 -3.3808 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8651 -0.4944 -3.3007 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1600 -2.4208 0.2362 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9643 -3.6220 -1.0120 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1799 -3.0836 -0.5852 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8755 -3.8439 -2.5378 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8241 1.2936 0.3949 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7603 0.5116 2.8426 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1249 0.7251 3.0344 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9408 2.1442 1.3402 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1018 2.5467 -0.0717 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8050 0.5714 -1.6363 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1597 2.3069 -1.4247 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1040 2.1406 -3.2777 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5974 1.9924 1.1809 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9858 -0.4561 2.2533 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2857 -1.1245 1.7537 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0310 -0.3026 -0.6275 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8825 2.2756 0.4911 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4976 2.2318 -1.4318 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9087 2.9999 -1.7766 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3605 1.5799 -3.4423 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4977 0.7035 0.5566 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4522 -1.6266 -0.7335 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7032 0.6437 3.3221 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4281 -1.4597 2.4384 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0104 2.7036 2.7006 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2289 -0.9307 2.2485 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3644 2.0037 2.5595 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0144 0.2986 4.4559 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9208 3.0297 3.5502 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3121 1.3980 1.9067 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4661 3.5369 1.4754 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8235 2.9517 0.9888 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2083 2.8755 -0.3668 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7107 1.0185 3.6449 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9035 2.4916 5.4747 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8327 -0.0181 4.3311 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 29 30 1 0 17 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 36 39 1 0 35 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 43 50 1 0 42 51 1 0 34 52 1 0 33 53 1 0 6 54 1 0 54 55 2 0 54 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 61 64 1 0 60 65 1 0 59 66 1 0 58 67 1 0 8 2 1 0 26 9 1 0 39 32 1 0 48 41 1 0 64 57 1 0 29 6 1 0 24 12 1 0 21 13 1 0 1 68 1 0 1 69 1 0 1 70 1 0 3 71 1 0 3 72 1 0 3 73 1 0 4 74 1 0 4 75 1 0 5 76 1 0 5 77 1 0 7 78 1 0 8 79 1 0 8 80 1 0 10 81 1 0 11 82 1 0 11 83 1 0 12 84 1 0 14 85 1 0 14 86 1 0 14 87 1 0 15 88 1 0 15 89 1 0 16 90 1 0 16 91 1 0 17 92 1 0 19 93 1 0 19 94 1 0 19 95 1 0 20 96 1 0 20 97 1 0 20 98 1 0 21 99 1 0 22100 1 0 22101 1 0 23102 1 0 23103 1 0 25104 1 0 25105 1 0 25106 1 0 27107 1 0 27108 1 0 27109 1 0 28110 1 0 28111 1 0 29112 1 0 30113 1 0 32114 1 6 33115 1 1 34116 1 1 35117 1 1 36118 1 1 37119 1 0 37120 1 0 38121 1 0 41122 1 1 42123 1 1 43124 1 1 44125 1 6 45126 1 1 46127 1 0 46128 1 0 47129 1 0 49130 1 0 50131 1 0 51132 1 0 52133 1 0 53134 1 0 57135 1 1 58136 1 6 59137 1 1 60138 1 6 61139 1 1 62140 1 0 62141 1 0 63142 1 0 65143 1 0 66144 1 0 67145 1 0 M END

Standard InCHIKey	NQUMPFSQDYUTGM-JFCDPDKUSA-N
Standard InCHI	InChI=1S/C48H78O19/c1-43(2)14-15-48(42(61)67-41-36(59)33(56)31(54)24(19-50)63-41)22(16-43)21-8-9-27-45(5)12-11-29(44(3,4)26(45)10-13-46(27,6)47(21,7)17-28(48)52)65-39-37(60)34(57)38(25(20-51)64-39)66-40-35(58)32(55)30(53)23(18-49)62-40/h8,22-41,49-60H,9-20H2,1-7H3/t22?,23-,24-,25-,26?,27?,28?,29?,30-,31-,32+,33+,34-,35-,36-,37-,38+,39+,40+,41+,45?,46?,47?,48?/m1/s1
SMILES	CC1(C)CCC2(C(C1)C1=CCC3C4(C)CCC(C(C)(C)C4CCC3(C)C1(C)CC2O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	958.51	Volume:	932.053 ? Van der Waals volume.
Dense:	1.028	LogP:	1.53 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.243 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.285 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	45.0
TPSA:	315.21 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	12.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.076	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.362	Fsp³:	0.938
MCE-18:	176.172 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.836	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.071 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.157	Promiscuous compounds:	0.002

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.222	MDCK Permeability:	-5.119
Pgp-inhibitor:	0.0	Pgp-substrate:	0.004
PAMPA:	0.996 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.974
20% Bioavailability (F20%):	0.062	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.029	MRP1:	0.926
Plasma Protein Binding (PPB):	59.711%	Volume Distribution (VD):	-0.297
Fu:	25.819% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.003	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.913
HLM stability:	0.675 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.074

Half-life (T1/2):

3.703

ADMET: Toxicity

hERG Blockers:	0.002	hERG Blockers (10um):	0.005
Human Hepatotoxicity (H-HT):	0.681	Drug-induced Liver Injury (DILI):	0.881
AMES Toxicity:	0.986	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.023	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	1.0
Hematotoxicity:	0.582	Drug-induced Nephrotoxicity:	0.889
Genotoxicity:	0.026	RPMI-8226 Immunitoxicity:	0.19
A549 Cytotoxicity:	0.963	Hek293 Cytotoxicity:	0.55
BCF:	1.6 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.264 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.892 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.883 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20295	Eclipta prostrata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15546	Herba ecliptae prostratae	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20295	Eclipta prostrata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO15546	Herba ecliptae prostratae	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[TCMID]
NPO20295	Eclipta prostrata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO20295	Eclipta prostrata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO20295	Eclipta prostrata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20295	Eclipta prostrata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC164456 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20587
0.1-0.2	23955
0.2-0.3	3781
0.3-0.4	903
0.4-0.5	408
0.5-0.6	121
0.6-0.7	67
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8295	Intermediate Similarity	NPC1046
0.7664	Intermediate Similarity	NPC475514
0.7525	Intermediate Similarity	NPC104137
0.7525	Intermediate Similarity	NPC26626
0.7347	Intermediate Similarity	NPC164389
0.73	Intermediate Similarity	NPC64715
0.7168	Intermediate Similarity	NPC220160
0.7091	Intermediate Similarity	NPC286457
0.7083	Intermediate Similarity	NPC235405
0.7075	Intermediate Similarity	NPC123522
0.701	Intermediate Similarity	NPC249848
0.701	Intermediate Similarity	NPC107966
0.6952	Remote Similarity	NPC11242
0.6909	Remote Similarity	NPC85154
0.6875	Remote Similarity	NPC475208
0.6875	Remote Similarity	NPC470876
0.6842	Remote Similarity	NPC214484
0.6765	Remote Similarity	NPC235438
0.6727	Remote Similarity	NPC283417
0.6727	Remote Similarity	NPC200049
0.67	Remote Similarity	NPC76497
0.6604	Remote Similarity	NPC295823
0.6604	Remote Similarity	NPC174720
0.6604	Remote Similarity	NPC475467
0.66	Remote Similarity	NPC39211
0.6577	Remote Similarity	NPC475160
0.6577	Remote Similarity	NPC473714
0.6569	Remote Similarity	NPC30735
0.6566	Remote Similarity	NPC475516
0.6549	Remote Similarity	NPC21691
0.6531	Remote Similarity	NPC48499
0.6495	Remote Similarity	NPC238935
0.6491	Remote Similarity	NPC473452
0.646	Remote Similarity	NPC4749
0.646	Remote Similarity	NPC481080
0.641	Remote Similarity	NPC302543
0.6404	Remote Similarity	NPC476068
0.6383	Remote Similarity	NPC48249
0.6346	Remote Similarity	NPC305267
0.6339	Remote Similarity	NPC135904
0.6311	Remote Similarity	NPC223301
0.6311	Remote Similarity	NPC171544
0.6281	Remote Similarity	NPC489209
0.6262	Remote Similarity	NPC281148
0.625	Remote Similarity	NPC488520
0.625	Remote Similarity	NPC117714
0.625	Remote Similarity	NPC30289
0.619	Remote Similarity	NPC40775
0.619	Remote Similarity	NPC10607
0.619	Remote Similarity	NPC488526
0.619	Remote Similarity	NPC46665
0.619	Remote Similarity	NPC2370
0.6182	Remote Similarity	NPC815
0.6132	Remote Similarity	NPC148417
0.6132	Remote Similarity	NPC475591
0.6132	Remote Similarity	NPC236870
0.6117	Remote Similarity	NPC157868
0.6111	Remote Similarity	NPC104372
0.6111	Remote Similarity	NPC488522
0.6087	Remote Similarity	NPC488560
0.6071	Remote Similarity	NPC60557
0.6071	Remote Similarity	NPC475287
0.6071	Remote Similarity	NPC67857
0.6068	Remote Similarity	NPC13998
0.6058	Remote Similarity	NPC469946
0.6038	Remote Similarity	NPC44716
0.6038	Remote Similarity	NPC159309
0.6038	Remote Similarity	NPC86222
0.6019	Remote Similarity	NPC480420
0.6017	Remote Similarity	NPC41061
0.6017	Remote Similarity	NPC227551
0.6017	Remote Similarity	NPC258617
0.6	Remote Similarity	NPC192791
0.6	Remote Similarity	NPC90856
0.6	Remote Similarity	NPC241909
0.6	Remote Similarity	NPC237503
0.6	Remote Similarity	NPC80986
0.6	Remote Similarity	NPC69811
0.6	Remote Similarity	NPC112352
0.5984	Remote Similarity	NPC489208
0.5978	Remote Similarity	NPC488524
0.5966	Remote Similarity	NPC43550
0.5957	Remote Similarity	NPC167383
0.5946	Remote Similarity	NPC187290
0.5926	Remote Similarity	NPC222580
0.592	Remote Similarity	NPC33012
0.5917	Remote Similarity	NPC305981
0.5905	Remote Similarity	NPC263756
0.5905	Remote Similarity	NPC213674
0.5888	Remote Similarity	NPC251768
0.5868	Remote Similarity	NPC261506
0.5868	Remote Similarity	NPC309223
0.5868	Remote Similarity	NPC4328
0.5859	Remote Similarity	NPC128925
0.5854	Remote Similarity	NPC250247
0.584	Remote Similarity	NPC8524
0.5833	Remote Similarity	NPC63159
0.5818	Remote Similarity	NPC114484
0.5794	Remote Similarity	NPC104071
0.578	Remote Similarity	NPC297263
0.5776	Remote Similarity	NPC475209
0.5741	Remote Similarity	NPC102439
0.5739	Remote Similarity	NPC192600
0.5726	Remote Similarity	NPC100639
0.5714	Remote Similarity	NPC57484
0.5686	Remote Similarity	NPC204458
0.568	Remote Similarity	NPC102505
0.568	Remote Similarity	NPC488514
0.5664	Remote Similarity	NPC207738
0.5664	Remote Similarity	NPC31838
0.566	Remote Similarity	NPC295371
0.5657	Remote Similarity	NPC31839
0.5656	Remote Similarity	NPC236638
0.5656	Remote Similarity	NPC294453
0.5645	Remote Similarity	NPC482010
0.5625	Remote Similarity	NPC301449
0.5625	Remote Similarity	NPC481079
0.5625	Remote Similarity	NPC601290
0.5586	Remote Similarity	NPC302887
0.5575	Remote Similarity	NPC160452
0.5566	Remote Similarity	NPC58448
0.5566	Remote Similarity	NPC173583
0.5546	Remote Similarity	NPC25663
0.5546	Remote Similarity	NPC47995
0.5526	Remote Similarity	NPC481078
0.5517	Remote Similarity	NPC76972
0.5517	Remote Similarity	NPC469782
0.5517	Remote Similarity	NPC204414
0.5514	Remote Similarity	NPC473884
0.5508	Remote Similarity	NPC155410
0.5505	Remote Similarity	NPC605226
0.549	Remote Similarity	NPC209894
0.5484	Remote Similarity	NPC144644
0.5484	Remote Similarity	NPC37860
0.5484	Remote Similarity	NPC170407
0.5481	Remote Similarity	NPC78046
0.5481	Remote Similarity	NPC29069
0.5455	Remote Similarity	NPC232237
0.5455	Remote Similarity	NPC606107
0.5447	Remote Similarity	NPC65105
0.5437	Remote Similarity	NPC161434
0.5431	Remote Similarity	NPC25998
0.5413	Remote Similarity	NPC242840
0.5405	Remote Similarity	NPC105800
0.5403	Remote Similarity	NPC481081
0.5385	Remote Similarity	NPC473481
0.5385	Remote Similarity	NPC609119
0.5368	Remote Similarity	NPC475394
0.536	Remote Similarity	NPC298034
0.536	Remote Similarity	NPC71065
0.5339	Remote Similarity	NPC79643
0.5333	Remote Similarity	NPC480423
0.5333	Remote Similarity	NPC470218
0.5333	Remote Similarity	NPC488519
0.5321	Remote Similarity	NPC161674
0.5319	Remote Similarity	NPC23020
0.5315	Remote Similarity	NPC480475
0.5312	Remote Similarity	NPC68767
0.5312	Remote Similarity	NPC293031
0.5304	Remote Similarity	NPC470477
0.53	Remote Similarity	NPC306746
0.5294	Remote Similarity	NPC165204
0.529	Remote Similarity	NPC475584
0.529	Remote Similarity	NPC475152
0.5278	Remote Similarity	NPC473373
0.5278	Remote Similarity	NPC150400
0.5273	Remote Similarity	NPC75417
0.5268	Remote Similarity	NPC68175
0.5263	Remote Similarity	NPC86368
0.5254	Remote Similarity	NPC610204
0.525	Remote Similarity	NPC123199
0.5243	Remote Similarity	NPC256798
0.5238	Remote Similarity	NPC476991
0.5207	Remote Similarity	NPC602995
0.5203	Remote Similarity	NPC237191
0.5197	Remote Similarity	NPC70809
0.5185	Remote Similarity	NPC108748
0.5175	Remote Similarity	NPC471435
0.5175	Remote Similarity	NPC471434
0.5169	Remote Similarity	NPC185466
0.5164	Remote Similarity	NPC473918
0.5161	Remote Similarity	NPC265841
0.5159	Remote Similarity	NPC136768
0.5159	Remote Similarity	NPC202828
0.5159	Remote Similarity	NPC119592
0.5149	Remote Similarity	NPC475177
0.5149	Remote Similarity	NPC199457
0.5147	Remote Similarity	NPC484830
0.5143	Remote Similarity	NPC480951
0.5124	Remote Similarity	NPC251263
0.5122	Remote Similarity	NPC329828
0.5102	Remote Similarity	NPC191763
0.5098	Remote Similarity	NPC68419
0.5098	Remote Similarity	NPC604133
0.5094	Remote Similarity	NPC189884
0.5094	Remote Similarity	NPC138334
0.5093	Remote Similarity	NPC203354
0.5089	Remote Similarity	NPC160415
0.5088	Remote Similarity	NPC123796
0.5079	Remote Similarity	NPC484059

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC164456 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7359
0.1-0.2	1709
0.2-0.3	72
0.3-0.4	10
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data