23 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
11 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC83032
Formula: C5H13N
Ingredient ID: NPC83032
| Common Name | n.a. |
| IUPAC Name | 3-methylbutan-1-amine |
| Canonical SMILES | NCCC(C)C |
| Standard InCHI | InChI=1S/C5H13N/c1-5(2)3-4-6/h5H,3-4,6H2,1-2H3 |
| Standard InCHIKey | BMFVGAAISNGQNM-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 7894 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD28737] Database: NPASS [NPC83032] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
  |
| Cornus officinalis | Cornus | Cornaceae |
 |
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Rosa rugosa | Rosa | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
 |
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC40511
Formula: C3H7N3O2
Ingredient ID: NPC40511
| Common Name | Guanidino Acetate |
| IUPAC Name | 2-[[amino(azaniumyl)methylidene]amino]acetate |
| Canonical SMILES | NC(=N)NCC(=O)O |
| Standard InCHI | InChI=1S/C3H7N3O2/c4-3(5)6-1-2(7)8/h1H2,(H,7,8)(H4,4,5,6) |
| Standard InCHIKey | BPMFZUMJYQTVII-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 4546993;3946848;763 ChEMBL ID: CHEMBL281593 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD21080] Database: NPASS [NPC40511] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC309330
Formula: C4H12N2
Ingredient ID: NPC309330
| Common Name | Putrescine |
| IUPAC Name | butane-1,4-diamine |
| Canonical SMILES | NCCCCN |
| Standard InCHI | InChI=1S/C4H12N2/c5-3-1-2-4-6/h1-6H2 |
| Standard InCHIKey | KIDHWZJUCRJVML-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 1045 ChEMBL ID: CHEMBL46257 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD29175] Database: NPASS [NPC309330] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Capparis masaikai | Capparis | Capparaceae |
|
| Nectandra pichurim | Nectandra | Lauraceae |
|
| Hordeum vulgare | Hordeum | Poaceae |
|
| Pityrogramma tartarea | Pityrogramma | Pteridaceae | |
| Phyllanthus emblica | Phyllanthus | Phyllanthaceae |
|
| Panax ginseng | Panax | Araliaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Chlamydomonas reinhardtii | Chlamydomonas | Chlamydomonadaceae | |
| Canavalia gladiata | Canavalia | Fabaceae |
|
| Glycine max | Glycine | Fabaceae |
|
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC30289
Formula: C47H78O16
Ingredient ID: NPC30289
| Common Name | n.a. |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5R,6R)-2-[[(3S,4aR,6aR,6bS,8S,8aS,12aS,14aR,14bR)-8-hydroxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)C[C@@H]([C@@]2([C@H]3CC(C)(C)CC2)C)O)C)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C47H78O16/c1-42(2)15-16-44(5)23(17-42)22-9-10-28-45(6)13-12-30(43(3,4)27(45)11-14-46(28,7)47(22,8)18-29(44)51)61-41-38(63-40-36(57)34(55)32(53)25(19-48)59-40)37(33(54)26(20-49)60-41)62-39-35(56)31(52)24(50)21-58-39/h9,23-41,48-57H,10-21H2,1-8H3/t23-,24-,25+,26+,27-,28+,29-,30-,31-,32+,33+,34-,35+,36+,37-,38+,39-,40-,41-,44-,45-,46+,47+/m0/s1 |
| Standard InCHIKey | DCXLHBGAGGUFMT-IVMZQGOASA-N |
| Ingredient External Links |
PubChem CID: 21575020 |
| Plant-Ingredient Association Reference |
PMID: 14987059 Database: NPASS [NPC30289] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Nephelium maingayi | Nephelium | Sapindaceae |
|
Ingredient ID: NPC265319
Formula: C2H7N
Ingredient ID: NPC265319
| Common Name | n.a. |
| IUPAC Name | ethanamine |
| Canonical SMILES | CCN |
| Standard InCHI | InChI=1S/C2H7N/c1-2-3/h2-3H2,1H3 |
| Standard InCHIKey | QUSNBJAOOMFDIB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 6341 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD187516] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC263756
Formula: C46H76O15
Ingredient ID: NPC263756
| Common Name | n.a. |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2S,3R,4S,5R)-2-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-hydroxy-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](OC[C@H]([C@@H]2O[C@@H]2OC[C@@H]([C@@H]([C@H]2O)O)O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)CC2)CO)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C46H76O15/c1-41(2)14-16-46(22-48)17-15-44(6)23(24(46)18-41)8-9-29-43(5)12-11-30(42(3,4)28(43)10-13-45(29,44)7)59-40-37(61-39-35(55)33(53)32(52)27(19-47)58-39)36(26(50)21-57-40)60-38-34(54)31(51)25(49)20-56-38/h8,24-40,47-55H,9-22H2,1-7H3/t24-,25-,26+,27+,28-,29+,30-,31-,32+,33-,34+,35+,36-,37+,38-,39-,40-,43-,44+,45+,46+/m0/s1 |
| Standard InCHIKey | JBHHSGRRSOLJHT-NSAGBCCDSA-N |
| Ingredient External Links |
PubChem CID: 21575015 |
| Plant-Ingredient Association Reference |
PMID: 14987059 Database: NPASS [NPC263756] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Nephelium maingayi | Nephelium | Sapindaceae |
|
Ingredient ID: NPC256133
Formula: C48H80O17
Ingredient ID: NPC256133
| Common Name | n.a. |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5R,6R)-2-[[(3S,4aR,6R,6aR,6bR,8aS,12aS,14aR,14bS)-8a-(hydroxymethyl)-6-methoxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)C[C@H]([C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)CC2)CO)C)OC)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C48H80O17/c1-43(2)13-15-48(22-51)16-14-46(6)23(24(48)18-43)9-10-28-45(5)12-11-30(44(3,4)29(45)17-31(59-8)47(28,46)7)63-42-39(65-41-37(58)35(56)33(54)26(19-49)61-41)38(34(55)27(20-50)62-42)64-40-36(57)32(53)25(52)21-60-40/h9,24-42,49-58H,10-22H2,1-8H3/t24-,25-,26+,27+,28+,29-,30-,31+,32-,33+,34+,35-,36+,37+,38-,39+,40-,41-,42-,45+,46+,47-,48+/m0/s1 |
| Standard InCHIKey | PSMYLMVERYGQNX-VVDIZRGUSA-N |
| Ingredient External Links |
PubChem CID: 21575018 |
| Plant-Ingredient Association Reference |
PMID: 14987059 Database: NPASS [NPC256133] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Nephelium maingayi | Nephelium | Sapindaceae |
|
Ingredient ID: NPC246534
Formula: C3H9N
Ingredient ID: NPC246534
| Common Name | Trimethylammonium |
| IUPAC Name | N,N-dimethylmethanamine |
| Canonical SMILES | CN(C)C |
| Standard InCHI | InChI=1S/C3H9N/c1-4(2)3/h1-3H3 |
| Standard InCHIKey | GETQZCLCWQTVFV-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 1146 ChEMBL ID: CHEMBL439723 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD179586] Database: NPASS [NPC246534] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Ligusticum chuanxiong | Ligusticum | Apiaceae |
|
| Asarum sieboldii | Asarum | Aristolochiaceae |
|
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC243319
Formula: C6H6N2O2
Ingredient ID: NPC243319
| Common Name | (E)-3-(1H-Imidazol-5-Yl)Prop-2-Enoic Acid |
| IUPAC Name | (E)-3-(1H-imidazol-5-yl)prop-2-enoic acid |
| Canonical SMILES | OC(=O)/C=C/c1cnc[nH]1 |
| Standard InCHI | InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10)/b2-1+ |
| Standard InCHIKey | LOIYMIARKYCTBW-OWOJBTEDSA-N |
| Ingredient External Links |
PubChem CID: 736715 ChEMBL ID: CHEMBL1236602 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD160594] Database: NPASS [NPC243319] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC237812
Formula: C6H9N3O2
Ingredient ID: NPC237812
| Common Name | Histidine |
| IUPAC Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid |
| Canonical SMILES | N[C@H](C(=O)O)Cc1cnc[nH]1 |
| Standard InCHI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1 |
| Standard InCHIKey | HNDVDQJCIGZPNO-YFKPBYRVSA-N |
| Ingredient External Links |
PubChem CID: 6274;6971009 ChEMBL ID: CHEMBL17962 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD182729] Database: NPASS [NPC237812] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Cornus officinalis | Cornus | Cornaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Shorea uliginosa | Shorea | Dipterocarpaceae | |
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Sonchus microcarpus | Sonchus | Asteraceae | |
| Codonopsis pilosula | Codonopsis | Campanulaceae |
|
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Santalum album | Santalum | Santalaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Pinellia ternata | Pinellia | Araceae |
|
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Atractylodes macrocephala koidz | Atractylodes | Asteraceae | |
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Brassica juncea | Brassica | Brassicaceae |
|
| Lilium hansonii | Lilium | Liliaceae |
|
| Chlamydomonas reinhardtii | Chlamydomonas | Chlamydomonadaceae | |
| Arum ternatum thunb | Arum | Araceae | |
| Allium sativum | Allium | Amaryllidaceae |
|
| Sinapis alba | Sinapis | Brassicaceae |
|
| Trigonella foenum-graecum | Trigonella | Fabaceae |
|
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
| Strychnos diplotricha | Strychnos | Loganiaceae |
|
Ingredient ID: NPC226453
Formula: C6H14N4O2
Ingredient ID: NPC226453
| Common Name | Arginine |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneazaniumyl)pentanoate |
| Canonical SMILES | NC(=N)NCCC[C@@H](C(=O)O)N |
| Standard InCHI | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 |
| Standard InCHIKey | ODKSFYDXXFIFQN-BYPYZUCNSA-N |
| Ingredient External Links |
PubChem CID: 28782;6322 ChEMBL ID: CHEMBL1485 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD20394] Database: NPASS [NPC226453] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Shuteria involucrata var. vestita | Shuteria | Fabaceae | |
| Euphorbia kamerunica | Euphorbia | Euphorbiaceae |
|
| Balanophora harlandii | Balanophora | Balanophoraceae | |
| Eria foetida | Eria | Orchidaceae | |
| Persea kusanoi | Persea | Lauraceae | |
| Agave aurea | Agave | Asparagaceae | |
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Encephalartos altensteinii | Encephalartos | Zamiaceae |
|
| Shorea uliginosa | Shorea | Dipterocarpaceae | |
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Cupressus lawsoniana | Cupressus | Cupressaceae | |
| Crinum erubescens | Crinum | Amaryllidaceae | |
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Sonchus microcarpus | Sonchus | Asteraceae | |
| Pentzia incana | Pentzia | Asteraceae | |
| Kobresia nepalensis | Kobresia | Cyperaceae |
|
| Pronephrium triphyllum | Pronephrium | Thelypteridaceae | |
| Polemonium caeruleum | Polemonium | Polemoniaceae |
|
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Santalum album | Santalum | Santalaceae |
|
| Excoecaria oppositifolia | Excoecaria | Euphorbiaceae |
|
| Grindelia acutifolia | Grindelia | Asteraceae | |
| Cephalotaxus fortunei | Cephalotaxus | Taxaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Prangos pabularia | Prangos | Apiaceae |
|
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Trifolium subterraneum | Trifolium | Fabaceae |
|
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Euphorbia marginata | Euphorbia | Euphorbiaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Emilia sonchifolia | Emilia | Asteraceae |
|
| Crataegus davisii | Crataegus | Rosaceae | |
| Gardenia collinsae | Gardenia | Rubiaceae | |
| Callistemon viminalis | Callistemon | Myrtaceae | |
| Pausinystalia mayumbensis | Pausinystalia | Rubiaceae | |
| Ajuga spectabilis | Ajuga | Lamiaceae | |
| Cissus pallidiflorus | Cissus | Vitaceae | |
| Ursinia abrotanifolia | Ursinia | Asteraceae | |
| Selliguea feei | Selliguea | Polypodiaceae | |
| Jungermannia hyalina | Jungermannia | Jungermanniaceae | |
| Melampodium heterophyllum | Melampodium | Asteraceae | |
| Simaba multiflora | Simaba | Simaroubaceae | |
| Baphia nitida | Baphia | Fabaceae |
|
| Litsea pulchella | Litsea | Lauraceae | |
| Astragalus tragacantha | Astragalus | Fabaceae | |
| Teucrium oxylepis | Teucrium | Lamiaceae | |
| Ligularia muliensis | Ligularia | Asteraceae | |
| Alstroemeria revoluta | Alstroemeria | Alstroemeriaceae |
|
| Marrubium alysson | Marrubium | Lamiaceae | |
| Achillea macrophylla | Achillea | Asteraceae | |
| Strychnos ledermannii | Strychnos | Loganiaceae | |
| Nuphar lutea | Nuphar | Nymphaeaceae |
|
| Eupatorium havanense | Eupatorium | Asteraceae | |
| Atractylodes macrocephala koidz | Atractylodes | Asteraceae | |
| Croton megistocarpus | Croton | Euphorbiaceae | |
| Euphorbia biglandulosa | Euphorbia | Euphorbiaceae | |
| Platymiscium floribundum | Platymiscium | Fabaceae | |
| Hedysarum multijugum maxim | Hedysarum | Fabaceae | |
| Mallotus philippensis | Mallotus | Euphorbiaceae |
|
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Caesalpinia crista | Guilandina | Fabaceae |
|
| Litsea aciculata | Litsea | Lauraceae | |
| Vigna radiata | Vigna | Fabaceae |
|
| Gymnosporia senegalensis | Gymnosporia | Celastraceae |
|
| Coleus frederici | Coleus | Lamiaceae | |
| Brassica juncea | Brassica | Brassicaceae |
|
| Libanotis intermedia | Libanotis | Apiaceae | |
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Lupinus cosentinii | Lupinus | Fabaceae | |
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Stevia chamaedrys | Stevia | Asteraceae | |
| Lilium hansonii | Lilium | Liliaceae |
|
| Geranium sibiricum | Geranium | Geraniaceae |
|
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Baphicacanthus cusia | Baphicacanthus | Acanthaceae |
|
| Lagerstroemia indica | Lagerstroemia | Lythraceae |
|
| Arum ternatum thunb | Arum | Araceae | |
| Viburnum davidii | Viburnum | Adoxaceae | |
| Agathosma scaberula | Agathosma | Rutaceae | |
| Senecio isatideus | Senecio | Asteraceae | |
| Sinapis alba | Sinapis | Brassicaceae |
|
| Trigonella foenum-graecum | Trigonella | Fabaceae |
|
| Trillium camschatcense | Trillium | Melanthiaceae | |
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
| Strychnos diplotricha | Strychnos | Loganiaceae |
|
| Cichorium intybus | Cichorium | Asteraceae |
|
Ingredient ID: NPC226340
Formula: C2H7N
Ingredient ID: NPC226340
| Common Name | n.a. |
| IUPAC Name | N-methylmethanamine |
| Canonical SMILES | CNC |
| Standard InCHI | InChI=1S/C2H7N/c1-3-2/h3H,1-2H3 |
| Standard InCHIKey | ROSDSFDQCJNGOL-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 674 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD188213] Database: NPASS [NPC226340] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC213674
Formula: C47H78O16
Ingredient ID: NPC213674
| Common Name | n.a. |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5R,6R)-2-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)CC2)CO)C)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C47H78O16/c1-42(2)14-16-47(22-50)17-15-45(6)23(24(47)18-42)8-9-29-44(5)12-11-30(43(3,4)28(44)10-13-46(29,45)7)61-41-38(63-40-36(57)34(55)32(53)26(19-48)59-40)37(33(54)27(20-49)60-41)62-39-35(56)31(52)25(51)21-58-39/h8,24-41,48-57H,9-22H2,1-7H3/t24-,25-,26+,27+,28-,29+,30-,31-,32+,33+,34-,35+,36+,37-,38+,39-,40-,41-,44-,45+,46+,47+/m0/s1 |
| Standard InCHIKey | ZNXFYOPHFLYZEY-XXUZLFQDSA-N |
| Ingredient External Links |
PubChem CID: 21575016 |
| Plant-Ingredient Association Reference |
PMID: 14987059 Database: NPASS [NPC213674] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Nephelium maingayi | Nephelium | Sapindaceae |
|
Ingredient ID: NPC20535
Formula: CH5N3
Ingredient ID: NPC20535
| Common Name | Guanidine |
| IUPAC Name | guanidine |
| Canonical SMILES | NC(=N)N |
| Standard InCHI | InChI=1S/CH5N3/c2-1(3)4/h(H5,2,3,4) |
| Standard InCHIKey | ZRALSGWEFCBTJO-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 3520 ChEMBL ID: CHEMBL821 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD127699] Database: NPASS [NPC20535] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Phellodendron chinense | Phellodendron | Rutaceae |
|
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC174020
Formula: C6H8N2O3
Ingredient ID: NPC174020
| Common Name | n.a. |
| IUPAC Name | (2S)-2-hydroxy-3-(1H-imidazol-5-yl)propanoic acid |
| Canonical SMILES | O[C@H](C(=O)O)Cc1cnc[nH]1 |
| Standard InCHI | InChI=1S/C6H8N2O3/c9-5(6(10)11)1-4-2-7-3-8-4/h2-3,5,9H,1H2,(H,7,8)(H,10,11)/t5-/m0/s1 |
| Standard InCHIKey | ACZFBYCNAVEFLC-YFKPBYRVSA-N |
| Ingredient External Links |
PubChem CID: 440129 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD166298] Database: NPASS [NPC174020] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC173583
Formula: C43H70O12
Ingredient ID: NPC173583
| Common Name | n.a. |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(2S,3R,4S,5R)-2-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,5-dihydroxyoxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| Canonical SMILES | OC[C@]12CC[C@@]3(C(=CC[C@H]4[C@@]3(C)CC[C@@H]3[C@]4(C)CC[C@@H](C3(C)C)O[C@@H]3OC[C@H]([C@@H]([C@H]3O)O[C@@H]3O[C@H](COC(=O)C)[C@H]([C@@H]([C@H]3O)O)O)O)[C@@H]2CC(CC1)(C)C)C |
| Standard InCHI | InChI=1S/C43H70O12/c1-23(45)51-21-27-31(47)32(48)33(49)37(53-27)55-35-26(46)20-52-36(34(35)50)54-30-12-13-40(6)28(39(30,4)5)11-14-42(8)29(40)10-9-24-25-19-38(2,3)15-17-43(25,22-44)18-16-41(24,42)7/h9,25-37,44,46-50H,10-22H2,1-8H3/t25-,26+,27+,28-,29+,30-,31+,32-,33+,34+,35-,36-,37-,40-,41+,42+,43+/m0/s1 |
| Standard InCHIKey | VNRAJKRWKFXCIO-XTEZVFGGSA-N |
| Ingredient External Links |
PubChem CID: 21575017 |
| Plant-Ingredient Association Reference |
PMID: 14987059 Database: NPASS [NPC173583] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Nephelium maingayi | Nephelium | Sapindaceae |
|
Ingredient ID: NPC163099
Formula: C5H14N4
Ingredient ID: NPC163099
| Common Name | Agmatine |
| IUPAC Name | 2-(4-aminobutyl)guanidine |
| Canonical SMILES | NCCCCNC(=N)N |
| Standard InCHI | InChI=1S/C5H14N4/c6-3-1-2-4-9-5(7)8/h1-4,6H2,(H4,7,8,9) |
| Standard InCHIKey | QYPPJABKJHAVHS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 199 ChEMBL ID: CHEMBL58343 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD44169] Database: NPASS [NPC163099] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Capparis masaikai | Capparis | Capparaceae |
|
| Nectandra pichurim | Nectandra | Lauraceae |
|
| Pityrogramma tartarea | Pityrogramma | Pteridaceae | |
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC15566
Formula: C5H6N2O2
Ingredient ID: NPC15566
| Common Name | Imidazole Acetic Acid |
| IUPAC Name | 2-(1H-imidazol-5-yl)acetic acid |
| Canonical SMILES | OC(=O)Cc1cnc[nH]1 |
| Standard InCHI | InChI=1S/C5H6N2O2/c8-5(9)1-4-2-6-3-7-4/h2-3H,1H2,(H,6,7)(H,8,9) |
| Standard InCHIKey | PRJKNHOMHKJCEJ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 96215;28305488 ChEMBL ID: CHEMBL784 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD48228] Database: NPASS [NPC15566] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC13625
Formula: C3H9N
Ingredient ID: NPC13625
| Common Name | n.a. |
| IUPAC Name | propan-1-amine |
| Canonical SMILES | CCCN |
| Standard InCHI | InChI=1S/C3H9N/c1-2-3-4/h2-4H2,1H3 |
| Standard InCHIKey | WGYKZJWCGVVSQN-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 7852 ZINC ID: ZINC000016052656 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Citrus japonica | Citrus | Rutaceae |
|
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Ingredient ID: NPC136014
Formula: C5H14NO
Ingredient ID: NPC136014
| Common Name | Choline |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium |
| Canonical SMILES | OCC[N+](C)(C)C |
| Standard InCHI | InChI=1S/C5H14NO/c1-6(2,3)4-5-7/h7H,4-5H2,1-3H3/q+1 |
| Standard InCHIKey | OEYIOHPDSNJKLS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 305 ChEMBL ID: CHEMBL920 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD68255] Database: NPASS [NPC136014] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Chrozophora prostrata | Chrozophora | Euphorbiaceae |
|
| Orthosphenia mexicana | Orthosphenia | Celastraceae | |
| Eupatorium gracile | Eupatorium | Asteraceae |
|
| Aristolochia maxima | Aristolochia | Aristolochiaceae |
|
| Passiflora incarnata | Passiflora | Passifloraceae |
|
| Chelidonium majus | Chelidonium | Papaveraceae |
|
| Alstonia muelleriana | Alstonia | Apocynaceae | |
| Betula mandshurica | Betula | Betulaceae |
|
| Dacrydium cupressinum | Dacrydium | Podocarpaceae |
|
| Achillea collina | Achillea | Asteraceae | |
| Mikania obtusata | Mikania | Asteraceae | |
| Trigonella grandiflora | Trigonella | Fabaceae | |
| Baccharis megapotamica | Baccharis | Asteraceae | |
| Nicotiana undulata | Nicotiana | Solanaceae | |
| Jasminum officinale | Jasminum | Oleaceae |
|
| Changium smyrnioides | Changium | Apiaceae |
|
| Alstonia deplanchei | Alstonia | Apocynaceae | |
| Coptis japonica | Coptis | Ranunculaceae |
|
| Bergenia purpurascens | Bergenia | Saxifragaceae |
|
| Stevia mercedensis | Stevia | Asteraceae | |
| Artemisia cina | Artemisia | Asteraceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Senecio latifolius | Senecio | Asteraceae | |
| Bupleurum scorzonerifolium | Bupleurum | Apiaceae |
|
| Flemingia congesta | Flemingia | Fabaceae |
|
| Senecio rivularis | Senecio | Asteraceae |
|
| Polygala myrtifolia | Polygala | Polygalaceae | |
| Ficus simplicissima | Ficus | Moraceae |
|
| Theobroma cacao | Theobroma | Malvaceae |
|
| Quercus dentata | Quercus | Fagaceae |
|
| Ligularia platyglossa | Ligularia | Asteraceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Aconitum pseudohuiliense | Aconitum | Ranunculaceae |
|
| Rhodiola krylovii | Rhodiola | Crassulaceae | |
| Erigeron crispus | Erigeron | Asteraceae | |
| Rapanea myricoides | Rapanea | Primulaceae | |
| Marrubium supinum | Marrubium | Lamiaceae |
|
| Crataegus sinaica | Crataegus | Rosaceae |
|
| Cacalia bicolor | Cacalia | Asteraceae | |
| Ceratozamia fuscoviridis | Ceratozamia | Zamiaceae | |
| Styrax perkinsiae | Styrax | Styracaceae | |
| Malus asiatica | Malus | Rosaceae |
|
| Krameria parvifolia | Krameria | Krameriaceae | |
| Haplophyllum dauricum | Haplophyllum | Rutaceae | |
| Solanum elaeagnifolium | Solanum | Solanaceae |
|
| Aesculus turbinata | Aesculus | Hippocastanaceae |
|
| Argyreia speciosa | Argyreia | Convolvulaceae |
|
| Artemisia vachanica | Artemisia | Asteraceae | |
| Lasiocephalus ovatus | Lasiocephalus | Asteraceae | |
| Montrouziera sphaeroidea | Montrouziera | Clusiaceae | |
| Thuja standishii | Thuja | Cupressaceae |
|
| Cotoneaster orbicularis | Cotoneaster | Rosaceae | |
| Bischofia trifoliata | Bischofia | Phyllanthaceae | |
| Vernonia profuga | Vernonia | Asteraceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Pimpinella saxifraga | Pimpinella | Apiaceae |
|
| Caragana tibetica | Caragana | Fabaceae |
|
| Macrotyloma axillare | Macrotyloma | Fabaceae | |
| Trigonostemon reidioides | Trigonostemon | Euphorbiaceae |
|
| Artocarpus styracifolius | Artocarpus | Moraceae |
|
| Euphorbia ferganensis | Euphorbia | Euphorbiaceae | |
| Arachniodes dimorphophylla | Arachniodes | Dryopteridaceae | |
| Oreosolen wattii | Oreosolen | Scrophulariaceae | |
| Discaria crenata | Discaria | Rhamnaceae | |
| Tripolium pannonicum | Tripolium | Asteraceae | |
| Swertia chinensis | Swertia | Gentianaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Forsythia giraldiana | Forsythia | Oleaceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Dorstenia mannii | Dorstenia | Moraceae |
|
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Coreopsis nodosa | Coreopsis | Asteraceae | |
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Melilotus officinalis | Melilotus | Fabaceae |
|
| Arabidopsis thaliana | Arabidopsis | Brassicaceae |
|
| Uvaria calamistrata | Uvaria | Annonaceae |
|
| Verbesina rupestris | Verbesina | Asteraceae | |
| Tropaeolum speciosum | Tropaeolum | Tropaeolaceae | |
| Coptis deltoidea | Coptis | Ranunculaceae |
|
| Haematococcus lacustris | Haematococcus | Haematococcaceae | |
| Alnus alnobetula | Alnus | Betulaceae | |
| Asteriscus graveolens | Asteriscus | Asteraceae | |
| Aloe microstigma | Aloe | Asphodelaceae | |
| Xanthium strumarium | Xanthium | Asteraceae |
|
| Solanum bahamense | Solanum | Solanaceae | |
| Swinglea glutinosa | Swinglea | Rutaceae |
|
| Mallotus philippensis | Mallotus | Euphorbiaceae |
|
| Euphorbia hirta | Euphorbia | Euphorbiaceae |
|
| Citrus glauca | Citrus | Rutaceae |
|
| Tinospora smilacina | Tinospora | Menispermaceae |
|
| Carapichea ipecacuanha | Carapichea | Rubiaceae |
|
| Sarcomelicope argyrophylla | Sarcomelicope | Rutaceae | |
| Isodon rubescens | Isodon | Lamiaceae | |
| Cullen corylifolium | Cullen | Fabaceae |
|
| Coleus frederici | Coleus | Lamiaceae | |
| Brassica juncea | Brassica | Brassicaceae |
|
| Coptis teeta | Coptis | Ranunculaceae |
|
| Libanotis intermedia | Libanotis | Apiaceae | |
| Strychnos tabascana | Strychnos | Loganiaceae | |
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Bupleurum falcatum | Bupleurum | Apiaceae |
|
| Relhania pumila | Relhania | Asteraceae | |
| Critonia quadrangularis | Critonia | Asteraceae | |
| Glycine tomentella | Glycine | Fabaceae |
|
| Tussilago farfara | Tussilago | Asteraceae |
|
| Coptis chinensis | Coptis | Ranunculaceae |
|
| Oxyanthus speciosus | Oxyanthus | Rubiaceae |
|
| Vatica diospyroides | Vatica | Dipterocarpaceae | |
| Panax schinseng | Panax | Araliaceae | |
| Citrus aurantium | Citrus | Rutaceae |
|
| Cannabis sativa | Cannabis | Cannabaceae |
|
| Codium decorticatum | Codium | Codiaceae | |
| Rheum tanguticum | Rheum | Polygonaceae |
|
| Sinapis alba | Sinapis | Brassicaceae |
|
| Senecio paludaffinis | Senecio | Asteraceae | |
| Pithecellobium clypearia | Pithecellobium | Fabaceae |
|
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
| Metalasia bolusii | Metalasia | Asteraceae | |
| Aconitum sachalinense | Aconitum | Ranunculaceae |
|
| Annona rensoniana | Annona | Annonaceae | |
| Papaver somniferum | Papaver | Papaveraceae |
|
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Centrosema pascuorum | Centrosema | Fabaceae |
Ingredient ID: NPC117714
Formula: C46H76O15
Ingredient ID: NPC117714
| Common Name | n.a. |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2S,3R,4S,5R)-2-[[(3S,4aR,6aR,6bS,8S,8aS,12aS,14aR,14bR)-8-hydroxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-hydroxy-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](OC[C@H]([C@@H]2O[C@@H]2OC[C@@H]([C@@H]([C@H]2O)O)O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)C[C@@H]([C@@]2([C@H]3CC(C)(C)CC2)C)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C46H76O15/c1-41(2)15-16-43(5)23(17-41)22-9-10-28-44(6)13-12-30(42(3,4)27(44)11-14-45(28,7)46(22,8)18-29(43)50)59-40-37(61-39-35(55)33(53)32(52)26(19-47)58-39)36(25(49)21-57-40)60-38-34(54)31(51)24(48)20-56-38/h9,23-40,47-55H,10-21H2,1-8H3/t23-,24-,25+,26+,27-,28+,29-,30-,31-,32+,33-,34+,35+,36-,37+,38-,39-,40-,43-,44-,45+,46+/m0/s1 |
| Standard InCHIKey | OHNDWYDTYQVTSN-TZNBZXACSA-N |
| Ingredient External Links |
PubChem CID: 21575019 |
| Plant-Ingredient Association Reference |
PMID: 14987059 Database: NPASS [NPC117714] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Nephelium maingayi | Nephelium | Sapindaceae |
|
Ingredient ID: NPC112890
Formula: C6H14N2O2
Ingredient ID: NPC112890
| Common Name | n.a. |
| IUPAC Name | (2S)-6-amino-2-azaniumylhexanoate |
| Canonical SMILES | NCCCC[C@@H](C(=O)O)N |
| Standard InCHI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| Standard InCHIKey | KDXKERNSBIXSRK-YFKPBYRVSA-N |
| Ingredient External Links |
PubChem CID: 5962; 71774817; 122198194 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD39006] Database: NPASS [NPC112890] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Cistanche deserticola | Cistanche | Orobanchaceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Ficus simplicissima | Ficus | Moraceae |
|
| Shorea uliginosa | Shorea | Dipterocarpaceae | |
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Morus bombycis | Morus | Moraceae |
|
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Sonchus microcarpus | Sonchus | Asteraceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Santalum album | Santalum | Santalaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Atractylodes macrocephala koidz | Atractylodes | Asteraceae | |
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Vigna radiata | Vigna | Fabaceae |
|
| Morus alba | Morus | Moraceae |
|
| Brassica juncea | Brassica | Brassicaceae |
|
| Aesculus chinensis | Aesculus | Sapindaceae |
|
| Lilium hansonii | Lilium | Liliaceae |
|
| Chlamydomonas reinhardtii | Chlamydomonas | Chlamydomonadaceae | |
| Arum ternatum thunb | Arum | Araceae | |
| Allium sativum | Allium | Amaryllidaceae |
|
| Sinapis alba | Sinapis | Brassicaceae |
|
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
| Strychnos diplotricha | Strychnos | Loganiaceae |
|
Ingredient ID: NPC111132
Formula: C5H9N3
Ingredient ID: NPC111132
| Common Name | Histamine |
| IUPAC Name | 2-(1H-imidazol-5-yl)ethanamine |
| Canonical SMILES | NCCc1cnc[nH]1 |
| Standard InCHI | InChI=1S/C5H9N3/c6-2-1-5-3-7-4-8-5/h3-4H,1-2,6H2,(H,7,8) |
| Standard InCHIKey | NTYJJOPFIAHURM-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 774 ChEMBL ID: CHEMBL90 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD123961] Database: NPASS [NPC111132] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Prunus dulcis | Prunus | Rosaceae |
|
| Chelidonium majus | Chelidonium | Papaveraceae |
|
| Pyrus pyraster | Pyrus | Rosaceae |
|
| Spinacia oleracea | Spinacia | Chenopodiaceae |
|
| Dichrostachys cinerea | Dichrostachys | Fabaceae |
|
| Astragalus oxyphysus | Astragalus | Fabaceae | |
| Hydrodictyon reticulatum | Hydrodictyon | Hydrodictyaceae |
|
| Senecio candollei | Senecio | Asteraceae | |
| Polyscias scutellaria | Polyscias | Araliaceae |
|
| Centaurea glastifolia | Centaurea | Asteraceae | |
| Grindelia havardii | Grindelia | Asteraceae | |
| Nephelium maingayi | Nephelium | Sapindaceae |
|
| Galanthus nivalis | Galanthus | Amaryllidaceae |
|
| Euphorbia armena | Euphorbia | Euphorbiaceae | |
| Urtica dioica | Urtica | Urticaceae |
|
| Cuscuta reflexa | Cuscuta | Convolvulaceae |
|
| Plantago depressa | Plantago | Plantaginaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC111132 | C5H9N3 | Histamine | 111.08 | -1.4467 | 1.68 | -0.453 | 3 | 2 | 54.7 | 3 | 1 | 8 | 0 |
| NPC112890 | C6H14N2O2 | 146.1055277 | -2.7491 | 1.68 | -2.949 | 4 | 3 | 89.34 | 8 | 0 | 10 | 0 | |
| NPC117714 | C46H76O15 | 868.5184217 | -1.7808 | 4.87 | 5.343 | 15 | 9 | 237.45 | 24 | 8 | 61 | 3 | |
| NPC136014 | C5H14NO | Choline | 104.11 | -1.5741 | 1.79 | -0.837 | 1 | 1 | 20.23 | 6 | 0 | 7 | 0 |
| NPC13625 | C3H9N | propan-1-amine | 59.07349929 | -0.975 | 1.68 | 0.215 | 1 | 1 | 26.02 | 1 | 0 | 4 | 0 |
| NPC15566 | C5H6N2O2 | Imidazole Acetic Acid | 126.04 | -0.6254 | 1.57 | -0.066 | 4 | 2 | 65.98 | 3 | 1 | 9 | 0 |
| NPC163099 | C5H14N4 | Agmatine | 130.12 | -1.7722 | 1.57 | -0.243 | 4 | 4 | 87.92 | 7 | 0 | 9 | 0 |
| NPC173583 | C43H70O12 | 778.4867277 | -0.6831 | 4.87 | 6.839 | 12 | 6 | 184.6 | 22 | 7 | 55 | 3 | |
| NPC174020 | C6H8N2O3 | 156.0534921 | -1.022 | 1.57 | -0.472 | 5 | 3 | 86.21 | 5 | 1 | 11 | 0 | |
| NPC20535 | CH5N3 | Guanidine | 59.05 | -0.4695 | 1.24 | -0.646 | 3 | 3 | 75.89 | 2 | 0 | 4 | 0 |
| NPC213674 | C47H78O16 | 898.5289864 | -2.8091 | 4.87 | 5.42 | 16 | 10 | 257.68 | 26 | 8 | 63 | 3 | |
| NPC226340 | C2H7N | 45.05784922 | -0.2158 | 1.57 | -0.176 | 1 | 1 | 12.03 | 2 | 0 | 3 | 0 | |
| NPC226453 | C6H14N4O2 | Arginine | 174.11 | -2.1807 | 1.46 | -2.924 | 6 | 5 | 125.22 | 9 | 0 | 12 | 0 |
| NPC237812 | C6H9N3O2 | Histidine | 155.07 | -1.3116 | 1.57 | -3.134 | 5 | 3 | 92 | 5 | 1 | 11 | 0 |
| NPC243319 | C6H6N2O2 | (E)-3-(1H-Imidazol-5-Yl)Prop-2-Enoic Acid | 138.04 | -0.2991 | 1.68 | 0.121 | 4 | 2 | 65.98 | 3 | 1 | 10 | 0 |
| NPC246534 | C3H9N | Trimethylammonium | 59.07 | 0.3201 | 1.68 | 0.063 | 1 | 0 | 3.24 | 3 | 0 | 4 | 0 |
| NPC256133 | C48H80O17 | 928.5395511 | -2.9737 | 4.87 | 3.643 | 17 | 10 | 266.91 | 28 | 8 | 65 | 2 | |
| NPC263756 | C46H76O15 | 868.5184217 | -2.2984 | 4.87 | 5.663 | 15 | 9 | 237.45 | 24 | 8 | 61 | 3 | |
| NPC265319 | C2H7N | ethanamine | 45.05784922 | -0.3972 | 1.57 | -0.143 | 1 | 1 | 26.02 | 0 | 0 | 3 | 0 |
| NPC30289 | C47H78O16 | 898.5289864 | -2.2915 | 4.87 | 5.1 | 16 | 10 | 257.68 | 26 | 8 | 63 | 3 | |
| NPC309330 | C4H12N2 | Putrescine | 88.1 | -2.0526 | 1.68 | -0.626 | 2 | 2 | 52.04 | 5 | 0 | 6 | 0 |
| NPC40511 | C3H7N3O2 | Guanidino Acetate | 117.05 | -0.9111 | 1.24 | -2.967 | 5 | 4 | 99.2 | 5 | 0 | 8 | 0 |
| NPC83032 | C5H13N | 87.10479942 | -0.4534 | 1.9 | 1.292 | 1 | 1 | 26.02 | 5 | 0 | 6 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
