Molecular Weight:   | 284.1 |
Volume:   | 299.545 |
LogP:   | 3.395 |
LogD:   | 3.553 |
LogS:   | -3.402 |
# Rotatable Bonds:   | 6 |
TPSA:   | 66.76 |
# H-Bond Aceptor:   | 4 |
# H-Bond Donor:   | 2 |
# Rings:   | 2 |
# Heavy Atoms:   | 4 |
QED Drug-Likeness Score:   | 0.503 |
Synthetic Accessibility Score:   | 1.962 |
Fsp3:   | 0.118 |
Lipinski Rule-of-5:   | Accepted |
Pfizer Rule:   | Rejected |
GSK Rule:   | Accepted |
BMS Rule:   | 0 |
Golden Triangle Rule:   | Accepted |
Chelating Alert:   | 1 |
PAINS Alert:   | 1 |
Caco-2 Permeability:   | -4.846 |
MDCK Permeability:   | 2.1245603420538828e-05 |
Pgp-inhibitor:   | 0.017 |
Pgp-substrate:   | 0.003 |
Human Intestinal Absorption (HIA):   | 0.027 |
20% Bioavailability (F20%):   | 0.755 |
30% Bioavailability (F30%):   | 0.965 |
Blood-Brain-Barrier Penetration (BBB):   | 0.176 |
Plasma Protein Binding (PPB):   | 98.0585708618164% |
Volume Distribution (VD):   | 0.472 |
Pgp-substrate:   | 1.5687897205352783% |
CYP1A2-inhibitor:   | 0.982 |
CYP1A2-substrate:   | 0.122 |
CYP2C19-inhibitor:   | 0.952 |
CYP2C19-substrate:   | 0.069 |
CYP2C9-inhibitor:   | 0.87 |
CYP2C9-substrate:   | 0.922 |
CYP2D6-inhibitor:   | 0.943 |
CYP2D6-substrate:   | 0.85 |
CYP3A4-inhibitor:   | 0.576 |
CYP3A4-substrate:   | 0.242 |
Clearance (CL):   | 15.691 |
Half-life (T1/2):   | 0.924 |
hERG Blockers:   | 0.104 |
Human Hepatotoxicity (H-HT):   | 0.079 |
Drug-inuced Liver Injury (DILI):   | 0.031 |
AMES Toxicity:   | 0.594 |
Rat Oral Acute Toxicity:   | 0.152 |
Maximum Recommended Daily Dose:   | 0.428 |
Skin Sensitization:   | 0.962 |
Carcinogencity:   | 0.182 |
Eye Corrosion:   | 0.01 |
Eye Irritation:   | 0.902 |
Respiratory Toxicity:   | 0.127 |
Natural Product ID:   | NPC263386 |
Common Name*:   | Caffeic Acid Phenethyl Ester |
IUPAC Name:   | 2-phenylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
Synonyms:   | Caffeic Acid Phenethyl Ester; Phenethyl 3-(3,4-Dihydroxyphenyl)Acrylate; Phenethyl Caffeate; Trans-Caffeic Acid Phenethyl Ester |
Standard InCHIKey:   | SWUARLUWKZWEBQ-VQHVLOKHSA-N |
Standard InCHI:   | InChI=1S/C17H16O4/c18-15-8-6-14(12-16(15)19)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-9,12,18-19H,10-11H2/b9-7+ |
SMILES:   | c1ccc(cc1)CCOC(=O)/C=C/c1ccc(c(c1)O)O |
Synthetic Gene Cluster:   | n.a. |
ChEMBL Identifier:   | CHEMBL319244 |
PubChem CID:   |
5281787 |
Chemical Classification**:   |
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
---|---|---|---|---|---|---|---|---|
NPO21072 | Rhododendron dauricum | Species | Ericaceae | Eukaryota | n.a. | whole plant | n.a. | DOI[10.1007/BF02329610] |
NPO32948 | propolis | Genus | Rhytismataceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[10757720] |
NPO32539 | chinese propolis | Species | Rhytismataceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12027739] |
NPO33467 | taiwanese propolis | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[12713401] |
NPO21072 | Rhododendron dauricum | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[15270561] |
NPO32948 | propolis | Genus | Rhytismataceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[1593279] |
NPO12006 | Apis mellifera | Species | Apidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17548953] |
NPO32948 | propolis | Genus | Rhytismataceae | Eukaryota | n.a. | China | n.a. |
PMID[19278239] |
NPO32948 | propolis | Genus | Rhytismataceae | Eukaryota | n.a. | Ywar Taw village, Shan State of Myanmar | 2006-Dec |
PMID[19572611] |
NPO13379 | Schizanthus tricolor | Species | Solanaceae | Eukaryota | Aerial parts | n.a. | n.a. |
PMID[20166702] |
NPO11266 | Garcinia cambogia | Species | Clusiaceae | Eukaryota | n.a. | exocarp | n.a. |
PMID[21114277] |
NPO13379 | Schizanthus tricolor | Species | Solanaceae | Eukaryota | n.a. | aerial part | n.a. |
PMID[21171571] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | n.a. | bark | n.a. |
PMID[21875098] |
NPO12006 | Apis mellifera | Species | Apidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[24675423] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[24868863] |
NPO12006 | Apis mellifera | Species | Apidae | Eukaryota | n.a. | Bako, Ethiopia |
PMID[24926420] |
|
NPO12006 | Apis mellifera | Species | Apidae | Eukaryota | n.a. | Enemore, Ethiopia |
PMID[24926420] |
|
NPO12006 | Apis mellifera | Species | Apidae | Eukaryota | n.a. | Gedo, Ethiopia |
PMID[24926420] |
|
NPO12006 | Apis mellifera | Species | Apidae | Eukaryota | n.a. | Holleta, Ethiopia |
PMID[24926420] |
|
NPO33094 | korean propolis | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[24928402] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25089845] |
NPO40162 | Hoya kerrii | Species | Apocynaceae | Eukaryota | Stems | n.a. | n.a. |
PMID[28561586] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | Twigs | n.a. | n.a. |
PMID[28682072] |
NPO3013 | Clathria basilana | Species | Microcionidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29094598] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | Twigs | n.a. | n.a. |
PMID[29883114] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | Bark | n.a. | n.a. | Database[FooDB] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
NPO7541 | Ormosia hosiei | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO11266 | Garcinia cambogia | Species | Clusiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO21072 | Rhododendron dauricum | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO13473 | Anodendron affine | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO12006 | Apis mellifera | Species | Apidae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO11842 | Petasites laevigatus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | n.a. | n.a. | Database[Phenol-Explorer] | |
NPO7541 | Ormosia hosiei | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO13473 | Anodendron affine | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO11842 | Petasites laevigatus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO11266 | Garcinia cambogia | Species | Clusiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO8300 | Apis mellifera ligustica | Species | Apidae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO21072 | Rhododendron dauricum | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO21072 | Rhododendron dauricum | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
NPO12006 | Apis mellifera | Species | Apidae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
NPO7541 | Ormosia hosiei | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
NPO21072 | Rhododendron dauricum | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
NPO11266 | Garcinia cambogia | Species | Clusiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO13876 | Cedrela salvadorensis | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO13473 | Anodendron affine | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO5280 | Rubia tetragona | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO9569 | Licaria chrysophylla | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO12006 | Apis mellifera | Species | Apidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO14369 | Pocillopora eydouxi | Species | Pocilloporidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO8255 | Cinnamomum aromaticum | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO4700 | Pertusaria truncata | Species | Pertusariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO13379 | Schizanthus tricolor | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO12521 | Sphaeranthus confertifolius | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO7541 | Ormosia hosiei | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO3013 | Clathria basilana | Species | Microcionidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO11842 | Petasites laevigatus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO14470 | Polypodium decumanum | Species | Polypodiidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO14169 | Acrocarpia paniculata | Species | Sargassaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO13669 | Hertia cheirifolia | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO13178 | Ornithoglossum viride | Species | Colchicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO21072 | Rhododendron dauricum | Species | Ericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Organism ID | NP ID | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
---|
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
---|---|---|---|---|---|---|---|---|
NPT12 | Individual Protein | Human immunodeficiency virus type 1 integrase | Human immunodeficiency virus 1 | IC50 | = | 7000.0 | nM | PMID[537182] |
NPT12 | Individual Protein | Human immunodeficiency virus type 1 integrase | Human immunodeficiency virus 1 | IC50 | = | 42000.0 | nM | PMID[537183] |
NPT12 | Individual Protein | Human immunodeficiency virus type 1 integrase | Human immunodeficiency virus 1 | IC50 | = | 10000.0 | nM | PMID[537183] |
NPT12 | Individual Protein | Human immunodeficiency virus type 1 integrase | Human immunodeficiency virus 1 | IC50 | = | 7079.46 | nM | PMID[537186] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 86.89 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 71.17 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 69.14 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 146.2 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 147.15 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 160.43 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 150.18 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 122.08 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 128.4 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 120.18 | % | PMID[537188] |
NPT2891 | Cell Line | H4 | Homo sapiens | Activity | = | 106.53 | % | PMID[537188] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Ratio EC50 | = | 23.41 | n.a. | PMID[537189] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | EC50 | = | 4518.0 | nM | PMID[537189] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | EC50 | = | 193.0 | nM | PMID[537189] |
NPT30 | Individual Protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 58000.0 | nM | PMID[537192] |
NPT31 | Individual Protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 82000.0 | nM | PMID[537192] |
NPT12 | Individual Protein | Human immunodeficiency virus type 1 integrase | Human immunodeficiency virus 1 | IC50 | > | 100000.0 | nM | PMID[537194] |
NPT181 | Cell Line | Bel-7402 | Homo sapiens | IC50 | = | 5500.0 | nM | PMID[537194] |
NPT83 | Cell Line | MCF7 | Homo sapiens | IC50 | = | 26700.0 | nM | PMID[537194] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | = | 83600.0 | nM | PMID[537194] |
NPT453 | Cell Line | HT-1080 | Homo sapiens | EC50 | = | 9500.0 | nM | PMID[537195] |
NPT81 | Cell Line | A549 | Homo sapiens | EC50 | = | 27900.0 | nM | PMID[537195] |
NPT165 | Cell Line | HeLa | Homo sapiens | EC50 | = | 2360.0 | nM | PMID[537195] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 1.5 | % | PMID[537197] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 70.2 | % | PMID[537197] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Activity | = | 1.5 | % | PMID[537198] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Activity | = | 70.2 | % | PMID[537198] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Activity | = | 1.5 | % | PMID[537199] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Activity | = | 70.2 | % | PMID[537199] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Activity | = | 2.5 | % | PMID[537200] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Activity | = | 67.2 | % | PMID[537200] |
NPT165 | Cell Line | HeLa | Homo sapiens | IC50 | = | 0.068 | ug.mL-1 | PMID[537203] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 1.5 | % | PMID[537204] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 70.2 | % | PMID[537204] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 1.5 | % | PMID[537205] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 70.2 | % | PMID[537205] |
NPT116 | Cell Line | HL-60 | Homo sapiens | IC50 | = | 9800.0 | nM | PMID[537206] |
NPT165 | Cell Line | HeLa | Homo sapiens | IC50 | = | 8800.0 | nM | PMID[537206] |
NPT3887 | Cell Line | CNE | Homo sapiens | IC50 | = | 54000.0 | nM | PMID[537206] |
NPT306 | Cell Line | PC-3 | Homo sapiens | IC50 | = | 91000.0 | nM | PMID[537206] |
NPT111 | Cell Line | K562 | Homo sapiens | IC50 | = | 46000.0 | nM | PMID[537206] |
NPT91 | Cell Line | KB | Homo sapiens | IC50 | = | 45200.0 | nM | PMID[537206] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | = | 26800.0 | nM | PMID[537206] |
NPT547 | Cell Line | BGC-823 | Homo sapiens | IC50 | = | 19300.0 | nM | PMID[537206] |
NPT737 | Cell Line | HUVEC | Homo sapiens | EC50 | = | 8000.0 | nM | PMID[537207] |
NPT483 | Individual Protein | Prelamin-A/C | Homo sapiens | Potency | = | 2818.4 | nM | PMID[537210] |
NPT149 | Individual Protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 19952.6 | nM | PMID[537211] |
NPT48 | Individual Protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 19952.6 | nM | PMID[537210] |
NPT48 | Individual Protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 25118.9 | nM | PMID[537211] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | = | 5011.9 | nM | PMID[537210] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 11220.2 | nM | PMID[537210] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 12589.3 | nM | PMID[537213] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 15848.9 | nM | PMID[537211] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 6309.6 | nM | PMID[537210] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 3162.3 | nM | PMID[537213] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 12589.3 | nM | PMID[537211] |
NPT531 | Individual Protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 35481.3 | nM | PMID[537211] |
NPT531 | Individual Protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 10000.0 | nM | PMID[537214] |
NPT53 | Individual Protein | 4'-phosphopantetheinyl transferase ffp | Bacillus subtilis | Potency | = | 79432.8 | nM | PMID[537213] |
NPT53 | Individual Protein | 4'-phosphopantetheinyl transferase ffp | Bacillus subtilis | Potency | = | 50118.7 | nM | PMID[537211] |
NPT53 | Individual Protein | 4'-phosphopantetheinyl transferase ffp | Bacillus subtilis | Potency | = | 56234.1 | nM | PMID[537214] |
NPT483 | Individual Protein | Prelamin-A/C | Homo sapiens | Potency | = | 5623.4 | nM | PMID[537210] |
NPT54 | Individual Protein | Nonstructural protein 1 | Influenza A virus | Potency | = | 5011.9 | nM | PMID[537210] |
NPT442 | Individual Protein | Ferritin light chain | Equus caballus | Potency | = | 31622.8 | nM | PMID[537211] |
NPT442 | Individual Protein | Ferritin light chain | Equus caballus | Potency | = | 19952.6 | nM | PMID[537213] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 7943.3 | nM | PMID[537210] |
NPT1119 | Individual Protein | Arachidonate 12-lipoxygenase | Homo sapiens | Potency | = | 28183.8 | nM | PMID[537211] |
NPT55 | Individual Protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 17740.7 | nM | PMID[537211] |
NPT55 | Individual Protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 15811.4 | nM | PMID[537214] |
NPT58 | Individual Protein | Bloom syndrome protein | Homo sapiens | Potency | = | 28183.8 | nM | PMID[537210] |
NPT531 | Individual Protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 8912.5 | nM | PMID[537211] |
NPT151 | Individual Protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 39810.7 | nM | PMID[537211] |
NPT151 | Individual Protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 14125.4 | nM | PMID[537210] |
NPT109 | Individual Protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 31622.8 | nM | PMID[537211] |
NPT10 | Individual Protein | Geminin | Homo sapiens | Potency | = | 4466.8 | nM | PMID[537210] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 20587.8 | nM | PMID[537212] |
NPT532 | Individual Protein | Lysine-specific demethylase 4A | Homo sapiens | Potency | n.a. | 89125.1 | nM | PMID[537215] |
NPT5 | Individual Protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 3981.1 | nM | PMID[537213] |
NPT5 | Individual Protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 3548.1 | nM | PMID[537210] |
NPT5 | Individual Protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 21192.3 | nM | PMID[537212] |
NPT62 | Individual Protein | 6-phospho-1-fructokinase | Trypanosoma brucei | Potency | n.a. | 33807.8 | nM | PMID[537212] |
NPT135 | Individual Protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 44668.4 | nM | PMID[537212] |
NPT1139 | Individual Protein | Arachidonate 15-lipoxygenase, type II | Homo sapiens | Potency | n.a. | 10000.0 | nM | PMID[537211] |
NPT64 | Individual Protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 18348.9 | nM | PMID[537212] |
NPT242 | Individual Protein | Dopamine D1 receptor | Homo sapiens | Potency | n.a. | 22387.2 | nM | PMID[537212] |
NPT10 | Individual Protein | Geminin | Homo sapiens | Potency | n.a. | 18356.4 | nM | PMID[537210] |
NPT65 | Cell Line | HepG2 | Homo sapiens | Potency | n.a. | 17782.8 | nM | PMID[537215] |
NPT71 | Cell Line | HEK293 | Homo sapiens | Potency | n.a. | 8196.1 | nM | PMID[537212] |
NPT519 | Cell Line | SH-SY5Y | Homo sapiens | Potency | n.a. | 15848.9 | nM | PMID[537212] |
NPT444 | Individual Protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 56234.1 | nM | PMID[537212] |
NPT444 | Individual Protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 44668.4 | nM | PMID[537211] |
NPT228 | Individual Protein | Norepinephrine transporter | Homo sapiens | IC50 | = | 3787.0 | nM | PMID[537221] |
NPT228 | Individual Protein | Norepinephrine transporter | Homo sapiens | Ki | = | 3756.0 | nM | PMID[537221] |
NPT30 | Individual Protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 833.0 | nM | PMID[537221] |
NPT108 | Individual Protein | Estrogen receptor alpha | Homo sapiens | IC50 | = | 7912.0 | nM | PMID[537221] |
NPT108 | Individual Protein | Estrogen receptor alpha | Homo sapiens | Ki | = | 2260.0 | nM | PMID[537221] |
NPT282 | Individual Protein | MAP kinase ERK2 | Homo sapiens | IC50 | = | 686.0 | nM | PMID[537221] |
NPT285 | Individual Protein | Epidermal growth factor receptor erbB1 | Homo sapiens | IC50 | = | 1005.0 | nM | PMID[537221] |
NPT14 | Individual Protein | Tyrosine-protein kinase FYN | Homo sapiens | IC50 | = | 4214.0 | nM | PMID[537221] |
NPT286 | Individual Protein | Receptor protein-tyrosine kinase erbB-2 | Homo sapiens | IC50 | = | 1329.0 | nM | PMID[537221] |
NPT13 | Individual Protein | Tyrosine-protein kinase LCK | Homo sapiens | IC50 | = | 2887.0 | nM | PMID[537221] |
NPT41 | Individual Protein | Aldose reductase | Homo sapiens | IC50 | = | 570.0 | nM | PMID[537222] |
NPT1270 | Individual Protein | Aldo-keto reductase family 1 member B10 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[537222] |
NPT1270 | Individual Protein | Aldo-keto reductase family 1 member B10 | Homo sapiens | Ki | = | 46.0 | nM | PMID[537222] |
NPT165 | Cell Line | HeLa | Homo sapiens | LD50 | = | 56.0 | uM | PMID[537222] |
NPT2971 | Individual Protein | DNA dC->dU-editing enzyme APOBEC-3F | Homo sapiens | Potency | n.a. | 6309.6 | nM | PMID[537215] |
NPT3504 | Individual Protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 1700.0 | nM | PMID[537224] |
NPT3506 | Individual Protein | Aldo-keto reductase family 1 member C4 | Homo sapiens | IC50 | = | 2300.0 | nM | PMID[537224] |
NPT3505 | Individual Protein | Aldo-keto reductase family 1 member C1 | Homo sapiens | IC50 | = | 13000.0 | nM | PMID[537224] |
NPT3507 | Individual Protein | Aldo-keto reductase family 1 member C2 | Homo sapiens | IC50 | = | 6000.0 | nM | PMID[537224] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 5.4 | % | PMID[537225] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 45.7 | % | PMID[537225] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 98.4 | % | PMID[537225] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Inhibition | = | 100.3 | % | PMID[537225] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Activity | = | 76.4 | % | PMID[537225] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | Activity | = | 15.6 | % | PMID[537225] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | IC50 | = | 3800.0 | nM | PMID[537225] |
NPT10 | Individual Protein | Geminin | Homo sapiens | Potency | n.a. | 4610.9 | nM | PMID[537215] |
NPT100 | Individual Protein | Glutaminase kidney isoform, mitochondrial | Homo sapiens | Potency | n.a. | 35481.3 | nM | PMID[537215] |
NPT478 | Individual Protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 15848.9 | nM | PMID[537212] |
NPT478 | Individual Protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 7943.3 | nM | PMID[537215] |
NPT101 | Individual Protein | Glucagon-like peptide 1 receptor | Homo sapiens | Potency | n.a. | 11220.2 | nM | PMID[537215] |
NPT152 | Individual Protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 14125.4 | nM | PMID[537215] |
NPT66 | Individual Protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | -8.88 | % | PMID[537226] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 1032.3 | nM | PMID[537215] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 3264.3 | nM | PMID[537211] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 2818.4 | nM | PMID[537213] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 2238.7 | nM | PMID[537213] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 1458.1 | nM | PMID[537215] |
NPT160 | Individual Protein | TAR DNA-binding protein 43 | Homo sapiens | Potency | n.a. | 15848.9 | nM | PMID[537215] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 2592.9 | nM | PMID[537211] |
NPT34 | Cell Line | BV-2 | Mus musculus | IC50 | = | 6400.0 | nM | PMID[537227] |
NPT34 | Cell Line | BV-2 | Mus musculus | Activity | > | 90.0 | % | PMID[537229] |
NPT34 | Cell Line | BV-2 | Mus musculus | IC50 | = | 6400.0 | nM | PMID[537229] |
NPT306 | Cell Line | PC-3 | Homo sapiens | IC50 | = | 51400.0 | nM | PMID[537230] |
NPT858 | Cell Line | LNCaP | Homo sapiens | IC50 | = | 6200.0 | nM | PMID[537230] |
NPT858 | Cell Line | LNCaP | Homo sapiens | FC | = | 5.0 | n.a. | PMID[537230] |
NPT858 | Cell Line | LNCaP | Homo sapiens | IC50 | = | 33700.0 | nM | PMID[537230] |
NPT104 | Individual Protein | Cerebroside-sulfatase | Homo sapiens | Potency | n.a. | 33807.8 | nM | PMID[537212] |
NPT49 | Individual Protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 17782.8 | nM | PMID[537214] |
NPT2245 | Cell Line | SiHa | Homo sapiens | IC50 | = | 66920.0 | nM | PMID[537235] |
NPT165 | Cell Line | HeLa | Homo sapiens | IC50 | = | 37980.0 | nM | PMID[537235] |
NPT2609 | Cell Line | BeWo | Homo sapiens | IC50 | = | 2960.0 | nM | PMID[537235] |
NPT65 | Cell Line | HepG2 | Homo sapiens | IC50 | = | 40870.0 | nM | PMID[537235] |
NPT1120 | Individual Protein | Pancreatic triacylglycerol lipase | Sus scrofa | ED50 | = | 10.0 | uM | PMID[537237] |
NPT1120 | Individual Protein | Pancreatic triacylglycerol lipase | Sus scrofa | Inhibition | = | 62.0 | % | PMID[537237] |
NPT1305 | Individual Protein | Voltage-dependent L-type calcium channel subunit alpha-1C | Cavia porcellus | IC50 | = | 1100.0 | nM | PMID[537238] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | = | 9720.0 | nM | PMID[537239] |
NPT5559 | Individual Protein | Potassium channel subfamily K member 2 | Homo sapiens | FC | = | 6.5 | n.a. | PMID[537240] |
NPT4853 | Individual Protein | Lymphocyte antigen 96 | Homo sapiens | Inhibition | = | 25.3 | % | PMID[537246] |
NPT113 | Cell Line | RAW264.7 | Mus musculus | IC50 | = | 9300.0 | nM | PMID[537247] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | = | 10000.0 | nM | PMID[537249] |
NPT681 | Cell Line | PC-12 | Rattus norvegicus | IC50 | = | 2000.0 | nM | PMID[537253] |
NPT681 | Cell Line | PC-12 | Rattus norvegicus | Activity | = | 85.1 | % | PMID[537253] |
NPT66 | Individual Protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 35.0 | % | PMID[537254] |
NPT1216 | Cell Line | FaDu | Homo sapiens | EC50 | = | 12100.0 | nM | PMID[537254] |
NPT179 | Cell Line | A2780 | Homo sapiens | EC50 | = | 3500.0 | nM | PMID[537254] |
NPT139 | Cell Line | HT-29 | Homo sapiens | EC50 | > | 30000.0 | nM | PMID[537254] |
NPT83 | Cell Line | MCF7 | Homo sapiens | EC50 | = | 12100.0 | nM | PMID[537254] |
NPT763 | Cell Line | SW-1736 | Homo sapiens | EC50 | = | 4700.0 | nM | PMID[537254] |
NPT886 | Cell Line | NIH3T3 | Mus musculus | EC50 | = | 21400.0 | nM | PMID[537254] |
NPT570 | Individual Protein | Arachidonate 5-lipoxygenase | Homo sapiens | IC50 | = | 970.0 | nM | PMID[537255] |
NPT401 | Cell Line | 786-0 | Homo sapiens | IC50 | = | 26800.0 | nM | PMID[537255] |
NPT401 | Cell Line | 786-0 | Homo sapiens | IC50 | = | 43800.0 | nM | PMID[537255] |
NPT1270 | Individual Protein | Aldo-keto reductase family 1 member B10 | Homo sapiens | IC50 | = | 390.0 | nM | PMID[537261] |
NPT41 | Individual Protein | Aldose reductase | Homo sapiens | IC50 | = | 3560.0 | nM | PMID[537261] |
NPT3506 | Individual Protein | Aldo-keto reductase family 1 member C4 | Homo sapiens | IC50 | = | 8250.0 | nM | PMID[537261] |
NPT3504 | Individual Protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 3710.0 | nM | PMID[537261] |
NPT3505 | Individual Protein | Aldo-keto reductase family 1 member C1 | Homo sapiens | IC50 | = | 29240.0 | nM | PMID[537261] |
NPT3507 | Individual Protein | Aldo-keto reductase family 1 member C2 | Homo sapiens | IC50 | = | 25760.0 | nM | PMID[537261] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | = | 80000.0 | nM | PMID[537263] |
NPT744 | Cell Line | IMR-32 | Homo sapiens | IC50 | = | 5000.0 | nM | PMID[537263] |
NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | -1.9 | % | PMID[537184] |
NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 25.5 | % | PMID[537184] |
NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 97.5 | % | PMID[537184] |
NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 104.1 | % | PMID[537184] |
NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 103.5 | % | PMID[537184] |
NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 4000.0 | nM | PMID[537184] |
NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 40000.0 | nM | PMID[537185] |
NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 15000.0 | nM | PMID[537187] |
NPT339 | Organism | Influenza A virus H3N2 | Influenza A virus H3N2 | MIC | = | 25.0 | ug.mL-1 | PMID[537190] |
NPT1453 | Organism | Influenza A virus (A/PR/8/34(H1N1)) | Influenza A virus (A/Puerto Rico/8/1934(H1N1)) | MIC | = | 50.0 | ug.mL-1 | PMID[537190] |
NPT27 | Others | Unspecified | Activity | = | 50.0 | ug ml-1 | PMID[537190] | |
NPT2 | Others | Unspecified | Inhibition | = | 3.8 | % | PMID[537191] | |
NPT27 | Others | Unspecified | Activity | = | 103.8 | % | PMID[537191] | |
NPT2 | Others | Unspecified | Inhibition | = | 1.4 | % | PMID[537191] | |
NPT27 | Others | Unspecified | Activity | = | 121.1 | % | PMID[537191] | |
NPT2 | Others | Unspecified | Inhibition | = | 68.2 | % | PMID[537191] | |
NPT27 | Others | Unspecified | Activity | = | 101.3 | % | PMID[537191] | |
NPT2 | Others | Unspecified | Inhibition | = | 93.7 | % | PMID[537191] | |
NPT27 | Others | Unspecified | Activity | = | 138.4 | % | PMID[537191] | |
NPT2 | Others | Unspecified | Inhibition | = | 99.6 | % | PMID[537191] | |
NPT27 | Others | Unspecified | Activity | = | 22.1 | % | PMID[537191] | |
NPT2 | Others | Unspecified | IC50 | = | 15000.0 | nM | PMID[537191] | |
NPT1 | Others | Radical scavenging activity | Activity | = | 39.1 | % | PMID[537193] | |
NPT1 | Others | Radical scavenging activity | Activity | = | 85.5 | % | PMID[537193] | |
NPT1 | Others | Radical scavenging activity | Activity | = | 98.5 | % | PMID[537193] | |
NPT1 | Others | Radical scavenging activity | Activity | = | 99.8 | % | PMID[537193] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 44600.0 | nM | PMID[537194] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | EC50 | = | 6790.0 | nM | PMID[537195] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | EC50 | = | 300.0 | nM | PMID[537195] |
NPT20763 | CELL-LINE | J774.1 | Mus musculus | IC50 | = | 4800.0 | nM | PMID[537196] |
NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 27.5 | % | PMID[537201] |
NPT35 | Others | n.a. | LogP | = | 3.36 | n.a. | PMID[537201] | |
NPT2 | Others | Unspecified | Inhibition | = | 6.0 | % | PMID[537202] | |
NPT2 | Others | Unspecified | Inhibition | = | 44.0 | % | PMID[537202] | |
NPT2 | Others | Unspecified | Inhibition | = | 86.0 | % | PMID[537202] | |
NPT2 | Others | Unspecified | Inhibition | = | 100.0 | % | PMID[537202] | |
NPT2 | Others | Unspecified | IC50 | = | 11000.0 | nM | PMID[537202] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 14500.0 | nM | PMID[537206] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 42600.0 | nM | PMID[537206] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 9900.0 | nM | PMID[537206] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 25500.0 | nM | PMID[537206] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 10000.0 | nM | PMID[537209] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 6309.57 | nM | PMID[537209] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 12589.25 | nM | PMID[537209] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 5011.87 | nM | PMID[537209] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 7943.28 | nM | PMID[537209] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | Potency | = | 11220.2 | nM | PMID[537210] |
NPT2 | Others | Unspecified | Potency | = | 35481.3 | nM | PMID[537210] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | Potency | = | 10000.0 | nM | PMID[537210] |
NPT2 | Others | Unspecified | Potency | = | 631.0 | nM | PMID[537211] | |
NPT2 | Others | Unspecified | Potency | = | 1258.9 | nM | PMID[537210] | |
NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Potency | = | 2592.9 | nM | PMID[537212] |
NPT93 | Individual Protein | Survival motor neuron protein | Homo sapiens | Potency | = | 17782.8 | nM | PMID[537213] |
NPT93 | Individual Protein | Survival motor neuron protein | Homo sapiens | Potency | = | 15848.9 | nM | PMID[537210] |
NPT93 | Individual Protein | Survival motor neuron protein | Homo sapiens | Potency | = | 15848.9 | nM | PMID[537211] |
NPT940 | Individual Protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 656.1 | nM | PMID[537212] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | Potency | = | 5011.9 | nM | PMID[537210] |
NPT794 | Individual Protein | Endonuclease 4 | Escherichia coli K-12 | Potency | = | 25118.9 | nM | PMID[537210] |
NPT94 | Individual Protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 39810.7 | nM | PMID[537213] |
NPT94 | Individual Protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 25118.9 | nM | PMID[537211] |
NPT796 | Individual Protein | Peripheral myelin protein 22 | Homo sapiens | Potency | = | 37933.0 | nM | PMID[537210] |
NPT792 | Individual Protein | Arachidonate 15-lipoxygenase | Homo sapiens | Potency | = | 501.2 | nM | PMID[537211] |
NPT940 | Individual Protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 3288.5 | nM | PMID[537212] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | Potency | = | 6309.6 | nM | PMID[537210] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | Potency | = | 12589.3 | nM | PMID[537210] |
NPT197 | Protein-Protein Interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 15848.9 | nM | PMID[537211] |
NPT197 | Protein-Protein Interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 17782.8 | nM | PMID[537210] |
NPT197 | Protein-Protein Interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 25118.9 | nM | PMID[537214] |
NPT940 | Individual Protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 9268.3 | nM | PMID[537212] |
NPT2 | Others | Unspecified | EC50 | = | 890.0 | nM | PMID[537215] | |
NPT2 | Others | Unspecified | EC50 | > | 80000.0 | nM | PMID[537215] | |
NPT800 | Individual Protein | M-phase phosphoprotein 8 | Homo sapiens | Potency | n.a. | 37685.8 | nM | PMID[537212] |
NPT800 | Individual Protein | M-phase phosphoprotein 8 | Homo sapiens | Potency | n.a. | 39810.7 | nM | PMID[537210] |
NPT2 | Others | Unspecified | Potency | n.a. | 8199.5 | nM | PMID[537212] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 18526.0 | nM | PMID[537210] |
NPT533 | Protein-Protein Interaction | Runt-related transcription factor 1/Core-binding factor subunit beta | Homo sapiens | Potency | n.a. | 14125.4 | nM | PMID[537213] |
NPT27 | Others | Unspecified | Activity | = | 65.0 | % | PMID[537216] | |
NPT21702 | PROTEIN-PROTEIN INTERACTION | Importin subunit beta-1/Snurportin-1 | Homo sapiens | Potency | n.a. | 35481.3 | nM | PMID[537215] |
NPT7 | Individual Protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 223.9 | nM | PMID[537210] |
NPT888 | Individual Protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 18492.7 | nM | PMID[537212] |
NPT9 | Individual Protein | DNA polymerase eta | Homo sapiens | Potency | n.a. | 44668.4 | nM | PMID[537210] |
NPT2 | Others | Unspecified | Potency | n.a. | 891.3 | nM | PMID[537215] | |
NPT698 | Individual Protein | Regulator of G-protein signaling 4 | Homo sapiens | Potency | n.a. | 751.2 | nM | PMID[537212] |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[537217] | |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[537218] | |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[537214] | |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[537211] | |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[537219] | |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[537220] | |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[537215] | |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[537213] | |
NPT2 | Others | Unspecified | Potency | n.a. | 10000.0 | nM | PMID[537210] | |
NPT68 | Individual Protein | Aldose reductase | Rattus norvegicus | IC50 | = | 1414.0 | nM | PMID[537221] |
NPT2 | Others | Unspecified | Ratio IC50 | = | 7.0 | n.a. | PMID[537222] | |
NPT2 | Others | Unspecified | AC50 | > | 70000.0 | nM | PMID[537223] | |
NPT888 | Individual Protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 12589.3 | nM | PMID[537215] |
NPT888 | Individual Protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 10000.0 | nM | PMID[537211] |
NPT888 | Individual Protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 7943.3 | nM | PMID[537213] |
NPT888 | Individual Protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 3689.8 | nM | PMID[537212] |
NPT888 | Individual Protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 10000.0 | nM | PMID[537214] |
NPT2 | Others | Unspecified | AC50 | = | 877.0 | nM | PMID[537223] | |
NPT2 | Others | Unspecified | AC50 | = | 1110.0 | nM | PMID[537223] | |
NPT2 | Others | Unspecified | Potency | n.a. | 7943.3 | nM | PMID[537215] | |
NPT755 | Individual Protein | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Homo sapiens | Potency | n.a. | 89125.1 | nM | PMID[537215] |
NPT67 | Individual Protein | Cholinesterase | Equus caballus | Inhibition | = | 17.69 | % | PMID[537226] |
NPT2 | Others | Unspecified | Potency | n.a. | 20596.2 | nM | PMID[537215] | |
NPT861 | Individual Protein | Isocitrate dehydrogenase [NADP] cytoplasmic | Homo sapiens | Potency | n.a. | 18356.4 | nM | PMID[537215] |
NPT920 | Individual Protein | Alpha-synuclein | Homo sapiens | Potency | n.a. | 5173.5 | nM | PMID[537212] |
NPT920 | Individual Protein | Alpha-synuclein | Homo sapiens | Potency | n.a. | 3162.3 | nM | PMID[537215] |
NPT1 | Others | Radical scavenging activity | IC50 | = | 12100.0 | nM | PMID[537227] | |
NPT1 | Others | Radical scavenging activity | Inhibition | = | 6.0 | % | PMID[537229] | |
NPT1 | Others | Radical scavenging activity | Inhibition | = | 15.9 | % | PMID[537229] | |
NPT1 | Others | Radical scavenging activity | Inhibition | = | 39.6 | % | PMID[537229] | |
NPT1 | Others | Radical scavenging activity | Inhibition | = | 55.0 | % | PMID[537229] | |
NPT1 | Others | Radical scavenging activity | Inhibition | = | 66.7 | % | PMID[537229] | |
NPT27 | Others | Unspecified | permeability | = | 1.8 | ucm/s | PMID[537229] | |
NPT1 | Others | Radical scavenging activity | IC50 | = | 12100.0 | nM | PMID[537229] | |
NPT1 | Others | Radical scavenging activity | IC50 | = | 16500.0 | nM | PMID[537230] | |
NPT72 | Individual Protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 143.51 | % | PMID[537231] |
NPT73 | Individual Protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 254.02 | % | PMID[537231] |
NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 13.9 | % | PMID[537232] |
NPT2 | Others | Unspecified | Potency | n.a. | 17782.8 | nM | PMID[537214] | |
NPT2 | Others | Unspecified | Potency | n.a. | 14125.4 | nM | PMID[537213] | |
NPT2 | Others | Unspecified | Potency | n.a. | 28183.8 | nM | PMID[537215] | |
NPT2 | Others | Unspecified | Potency | n.a. | 29092.9 | nM | PMID[537212] | |
NPT2 | Others | Unspecified | Potency | n.a. | 14125.4 | nM | PMID[537214] | |
NPT2 | Others | Unspecified | Potency | n.a. | 25118.9 | nM | PMID[537213] | |
NPT2 | Others | Unspecified | Potency | n.a. | 1000.0 | nM | PMID[537212] | |
NPT1 | Others | Radical scavenging activity | IC50 | = | 12100.0 | nM | PMID[537233] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 6400.0 | nM | PMID[537233] |
NPT35 | Others | n.a. | permeability | = | 1.8 | ucm/s | PMID[537233] | |
NPT2 | Others | Unspecified | Ratio IC50 | = | 0.46 | n.a. | PMID[537234] | |
NPT2 | Others | Unspecified | Ratio IC50 | = | 6.3 | n.a. | PMID[537234] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 16650.0 | nM | PMID[537235] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 14260.0 | nM | PMID[537235] |
NPT77 | Individual Protein | Transthyretin | Homo sapiens | Inhibition | < | 20.0 | % | PMID[537236] |
NPT77 | Individual Protein | Transthyretin | Homo sapiens | EC50 | = | 8600.0 | nM | PMID[537236] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | Inhibition | = | 24.0 | % | PMID[537237] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | Inhibition | = | 11.0 | % | PMID[537237] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 11350.0 | nM | PMID[537239] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 10150.0 | nM | PMID[537239] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 10680.0 | nM | PMID[537239] |
NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 10.0 | % | PMID[537241] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 33000.0 | nM | PMID[537242] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 47500.0 | nM | PMID[537242] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 16000.0 | nM | PMID[537242] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 28800.0 | nM | PMID[537242] |
NPT792 | Individual Protein | Arachidonate 15-lipoxygenase | Homo sapiens | IC50 | = | 130.0 | nM | PMID[537243] |
NPT78 | Individual Protein | Beta amyloid A4 protein | Homo sapiens | EC50 | = | 8410.0 | nM | PMID[537244] |
NPT2 | Others | Unspecified | Inhibition | < | 10.0 | % | PMID[537244] | |
NPT2 | Others | Unspecified | Inhibition | = | 62.0 | % | PMID[537244] | |
NPT35 | Others | n.a. | Inhibition | = | 35.0 | % | PMID[537244] | |
NPT35 | Others | n.a. | Inhibition | = | 51.0 | % | PMID[537244] | |
NPT22036 | CELL-LINE | HL | Homo sapiens | Activity | = | 46.0 | % | PMID[537245] |
NPT21752 | CELL-LINE | Peritoneal macrophage cells | n.a. | IC50 | = | 4310.0 | nM | PMID[537246] |
NPT2 | Others | Unspecified | IC50 | = | 10000.0 | nM | PMID[537249] | |
NPT2 | Others | Unspecified | Ratio IC50 | = | 10.0 | n.a. | PMID[537249] | |
NPT530 | Organism | Caenorhabditis elegans | Caenorhabditis elegans | Activity | = | 15.0 | % | PMID[537249] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 9.48 | % | PMID[537250] |
NPT2 | Others | Unspecified | Inhibition | = | 17.0 | % | PMID[537252] | |
NPT35 | Others | n.a. | EC50 | = | 14600.0 | nM | PMID[537253] | |
NPT2 | Others | Unspecified | IC50 | = | 6000.0 | nM | PMID[537253] | |
NPT2 | Others | Unspecified | Activity | > | 90.0 | % | PMID[537253] | |
NPT2 | Others | Unspecified | Activity | = | 69.3 | % | PMID[537253] | |
NPT35 | Others | n.a. | Peff | = | 1.91 | 10'-6 cm/s | PMID[537253] | |
NPT67 | Individual Protein | Cholinesterase | Equus caballus | Inhibition | = | 32.38 | % | PMID[537254] |
NPT35 | Others | n.a. | IC50 | = | 18200.0 | nM | PMID[537255] | |
NPT25963 | CELL-LINE | RCC4 | Homo sapiens | IC50 | = | 14000.0 | nM | PMID[537255] |
NPT2 | Others | Unspecified | IC50 | = | 19800.0 | nM | PMID[537255] | |
NPT2 | Others | Unspecified | IC50 | = | 12600.0 | nM | PMID[537255] | |
NPT2 | Others | Unspecified | Ratio IC50 | = | 2.1 | n.a. | PMID[537255] | |
NPT35 | Others | n.a. | permeability | = | 6.1 | 10'-6 cm/s | PMID[537256] | |
NPT20556 | SINGLE PROTEIN | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 7.06 | % | PMID[537257] |
NPT20556 | SINGLE PROTEIN | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 9.97 | % | PMID[537258] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.33 | % | PMID[537259] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.09 | % | PMID[537260] |
NPT683 | Individual Protein | Aldehyde reductase | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[537261] |
NPT888 | Individual Protein | 78 kDa glucose-regulated protein | Homo sapiens | RBA | = | 98.0 | % | PMID[537262] |
NPT2 | Others | Unspecified | GI | = | 38.7 | % | PMID[537263] | |
NPT2 | Others | Unspecified | GI | = | 59.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 71.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 3.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 9.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 17.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 51.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 4.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 15.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 31.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 26.0 | % | PMID[537263] | |
NPT2 | Others | Unspecified | IC50 | = | 37500.0 | nM | PMID[537263] | |
NPT2 | Others | Unspecified | IC50 | = | 17800.0 | nM | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 25.8 | % | PMID[537263] | |
NPT2 | Others | Unspecified | Activity | = | 41.0 | % | PMID[537263] | |
NPT27491 | CELL-LINE | RCC4/VHL | Homo sapiens | IC50 | = | 29100.0 | nM | PMID[537255] |
NPT27492 | CELL-LINE | JJN-3 | Homo sapiens | IC50 | = | 30000.0 | nM | PMID[537263] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC263386 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Natural Product ID |
---|---|---|
1.0 | High Similarity | NPC141791 |
0.9823 | High Similarity | NPC470848 |
0.9823 | High Similarity | NPC470849 |
0.9737 | High Similarity | NPC147654 |
0.9732 | High Similarity | NPC275519 |
0.9558 | High Similarity | NPC309434 |
0.9558 | High Similarity | NPC203124 |
0.9381 | High Similarity | NPC281277 |
0.9375 | High Similarity | NPC33749 |
0.9375 | High Similarity | NPC328593 |
0.9375 | High Similarity | NPC261453 |
0.9328 | High Similarity | NPC120225 |
0.9328 | High Similarity | NPC213552 |
0.9298 | High Similarity | NPC610 |
0.9298 | High Similarity | NPC175799 |
0.9298 | High Similarity | NPC200988 |
0.9298 | High Similarity | NPC145023 |
0.9292 | High Similarity | NPC474967 |
0.9292 | High Similarity | NPC233669 |
0.9286 | High Similarity | NPC95381 |
0.9244 | High Similarity | NPC289459 |
0.9217 | High Similarity | NPC86198 |
0.9204 | High Similarity | NPC217472 |
0.9189 | High Similarity | NPC183700 |
0.916 | High Similarity | NPC288945 |
0.916 | High Similarity | NPC246704 |
0.9138 | High Similarity | NPC70084 |
0.9138 | High Similarity | NPC470215 |
0.9138 | High Similarity | NPC470214 |
0.9138 | High Similarity | NPC109371 |
0.9107 | High Similarity | NPC297657 |
0.9107 | High Similarity | NPC226250 |
0.9098 | High Similarity | NPC83062 |
0.9027 | High Similarity | NPC131530 |
0.9008 | High Similarity | NPC118584 |
0.9 | High Similarity | NPC146886 |
0.9 | High Similarity | NPC60517 |
0.9 | High Similarity | NPC20443 |
0.8966 | High Similarity | NPC65791 |
0.8966 | High Similarity | NPC278652 |
0.8952 | High Similarity | NPC198388 |
0.8926 | High Similarity | NPC67951 |
0.8919 | High Similarity | NPC260952 |
0.8917 | High Similarity | NPC285345 |
0.8917 | High Similarity | NPC212541 |
0.8908 | High Similarity | NPC472271 |
0.888 | High Similarity | NPC18074 |
0.888 | High Similarity | NPC61 |
0.888 | High Similarity | NPC25581 |
0.888 | High Similarity | NPC5419 |
0.8862 | High Similarity | NPC110313 |
0.8839 | High Similarity | NPC206341 |
0.8829 | High Similarity | NPC1075 |
0.8829 | High Similarity | NPC1786 |
0.8829 | High Similarity | NPC294902 |
0.8824 | High Similarity | NPC204466 |
0.881 | High Similarity | NPC155209 |
0.881 | High Similarity | NPC168799 |
0.88 | High Similarity | NPC318799 |
0.879 | High Similarity | NPC30174 |
0.8783 | High Similarity | NPC264558 |
0.877 | High Similarity | NPC87113 |
0.877 | High Similarity | NPC197832 |
0.876 | High Similarity | NPC306100 |
0.875 | High Similarity | NPC70752 |
0.874 | High Similarity | NPC287597 |
0.874 | High Similarity | NPC34293 |
0.874 | High Similarity | NPC135127 |
0.874 | High Similarity | NPC106406 |
0.874 | High Similarity | NPC886 |
0.8739 | High Similarity | NPC202474 |
0.872 | High Similarity | NPC329344 |
0.872 | High Similarity | NPC237506 |
0.872 | High Similarity | NPC32626 |
0.872 | High Similarity | NPC217052 |
0.8718 | High Similarity | NPC61062 |
0.8718 | High Similarity | NPC277394 |
0.8718 | High Similarity | NPC299252 |
0.871 | High Similarity | NPC478215 |
0.8696 | High Similarity | NPC51698 |
0.8689 | High Similarity | NPC85565 |
0.8684 | High Similarity | NPC120982 |
0.8684 | High Similarity | NPC226401 |
0.8684 | High Similarity | NPC147634 |
0.8684 | High Similarity | NPC174096 |
0.8684 | High Similarity | NPC79793 |
0.8667 | High Similarity | NPC14007 |
0.8667 | High Similarity | NPC269843 |
0.8667 | High Similarity | NPC60962 |
0.8667 | High Similarity | NPC224814 |
0.8667 | High Similarity | NPC189844 |
0.8667 | High Similarity | NPC109083 |
0.8655 | High Similarity | NPC241634 |
0.864 | High Similarity | NPC241354 |
0.8609 | High Similarity | NPC187583 |
0.8609 | High Similarity | NPC257430 |
0.8609 | High Similarity | NPC179002 |
0.8607 | High Similarity | NPC224208 |
0.8607 | High Similarity | NPC474275 |
0.8605 | High Similarity | NPC120852 |
0.8605 | High Similarity | NPC471664 |
0.8605 | High Similarity | NPC471665 |
0.8605 | High Similarity | NPC90431 |
0.8596 | High Similarity | NPC62258 |
0.8596 | High Similarity | NPC55617 |
0.8596 | High Similarity | NPC79543 |
0.8583 | High Similarity | NPC2058 |
0.8571 | High Similarity | NPC272471 |
0.8571 | High Similarity | NPC107588 |
0.8571 | High Similarity | NPC277460 |
0.8571 | High Similarity | NPC70744 |
0.8571 | High Similarity | NPC137537 |
0.8571 | High Similarity | NPC164706 |
0.8538 | High Similarity | NPC126206 |
0.8538 | High Similarity | NPC67349 |
0.8538 | High Similarity | NPC78363 |
0.8538 | High Similarity | NPC279676 |
0.8538 | High Similarity | NPC260425 |
0.8537 | High Similarity | NPC469568 |
0.8525 | High Similarity | NPC86900 |
0.8496 | Intermediate Similarity | NPC19149 |
0.8492 | Intermediate Similarity | NPC477294 |
0.8492 | Intermediate Similarity | NPC229784 |
0.8492 | Intermediate Similarity | NPC477293 |
0.8492 | Intermediate Similarity | NPC477300 |
0.8482 | Intermediate Similarity | NPC471511 |
0.848 | Intermediate Similarity | NPC123722 |
0.848 | Intermediate Similarity | NPC123228 |
0.848 | Intermediate Similarity | NPC476873 |
0.848 | Intermediate Similarity | NPC151167 |
0.848 | Intermediate Similarity | NPC5018 |
0.848 | Intermediate Similarity | NPC276466 |
0.8473 | Intermediate Similarity | NPC205195 |
0.8473 | Intermediate Similarity | NPC89105 |
0.8473 | Intermediate Similarity | NPC197316 |
0.8473 | Intermediate Similarity | NPC472350 |
0.8473 | Intermediate Similarity | NPC171134 |
0.8473 | Intermediate Similarity | NPC321184 |
0.8473 | Intermediate Similarity | NPC321638 |
0.8473 | Intermediate Similarity | NPC284409 |
0.8473 | Intermediate Similarity | NPC476383 |
0.8473 | Intermediate Similarity | NPC81515 |
0.8473 | Intermediate Similarity | NPC328273 |
0.8473 | Intermediate Similarity | NPC64141 |
0.8473 | Intermediate Similarity | NPC68092 |
0.8468 | Intermediate Similarity | NPC280767 |
0.8462 | Intermediate Similarity | NPC471872 |
0.8462 | Intermediate Similarity | NPC154485 |
0.8462 | Intermediate Similarity | NPC148969 |
0.8462 | Intermediate Similarity | NPC476699 |
0.8455 | Intermediate Similarity | NPC106659 |
0.8455 | Intermediate Similarity | NPC18984 |
0.8455 | Intermediate Similarity | NPC229084 |
0.8455 | Intermediate Similarity | NPC160900 |
0.845 | Intermediate Similarity | NPC248150 |
0.8435 | Intermediate Similarity | NPC254833 |
0.8435 | Intermediate Similarity | NPC228343 |
0.8425 | Intermediate Similarity | NPC285361 |
0.8417 | Intermediate Similarity | NPC470626 |
0.8413 | Intermediate Similarity | NPC167463 |
0.8413 | Intermediate Similarity | NPC46192 |
0.8413 | Intermediate Similarity | NPC232880 |
0.8409 | Intermediate Similarity | NPC475530 |
0.8409 | Intermediate Similarity | NPC106055 |
0.8409 | Intermediate Similarity | NPC288452 |
0.8409 | Intermediate Similarity | NPC179505 |
0.8409 | Intermediate Similarity | NPC156709 |
0.8409 | Intermediate Similarity | NPC471875 |
0.8409 | Intermediate Similarity | NPC473799 |
0.8409 | Intermediate Similarity | NPC110699 |
0.8409 | Intermediate Similarity | NPC289690 |
0.8403 | Intermediate Similarity | NPC128249 |
0.84 | Intermediate Similarity | NPC84076 |
0.84 | Intermediate Similarity | NPC90128 |
0.84 | Intermediate Similarity | NPC475695 |
0.84 | Intermediate Similarity | NPC303680 |
0.84 | Intermediate Similarity | NPC179777 |
0.8397 | Intermediate Similarity | NPC471152 |
0.8393 | Intermediate Similarity | NPC304638 |
0.839 | Intermediate Similarity | NPC120280 |
0.8385 | Intermediate Similarity | NPC476870 |
0.8378 | Intermediate Similarity | NPC223393 |
0.8372 | Intermediate Similarity | NPC475468 |
0.8362 | Intermediate Similarity | NPC222084 |
0.8362 | Intermediate Similarity | NPC63345 |
0.8361 | Intermediate Similarity | NPC98305 |
0.8361 | Intermediate Similarity | NPC207613 |
0.8359 | Intermediate Similarity | NPC219677 |
0.8347 | Intermediate Similarity | NPC37858 |
0.8346 | Intermediate Similarity | NPC47471 |
0.8346 | Intermediate Similarity | NPC64111 |
0.8346 | Intermediate Similarity | NPC476385 |
0.8346 | Intermediate Similarity | NPC134405 |
0.8346 | Intermediate Similarity | NPC208536 |
0.8346 | Intermediate Similarity | NPC476377 |
0.8346 | Intermediate Similarity | NPC94810 |
0.8346 | Intermediate Similarity | NPC304622 |
0.8346 | Intermediate Similarity | NPC38473 |
0.8333 | Intermediate Similarity | NPC293619 |
0.8333 | Intermediate Similarity | NPC76032 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC263386 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Drug ID | Developmental Stage |
---|---|---|---|
0.8473 | Intermediate Similarity | NPD7266 | Discontinued |
0.8455 | Intermediate Similarity | NPD4379 | Clinical (unspecified phase) |
0.8435 | Intermediate Similarity | NPD3022 | Approved |
0.8435 | Intermediate Similarity | NPD3021 | Approved |
0.8148 | Intermediate Similarity | NPD8166 | Discontinued |
0.8088 | Intermediate Similarity | NPD6190 | Approved |
0.7983 | Intermediate Similarity | NPD228 | Approved |
0.7886 | Intermediate Similarity | NPD5536 | Phase 2 |
0.7879 | Intermediate Similarity | NPD4060 | Phase 1 |
0.782 | Intermediate Similarity | NPD230 | Phase 1 |
0.7817 | Intermediate Similarity | NPD3455 | Phase 2 |
0.7797 | Intermediate Similarity | NPD1358 | Approved |
0.7786 | Intermediate Similarity | NPD3027 | Phase 3 |
0.7768 | Intermediate Similarity | NPD2933 | Approved |
0.7768 | Intermediate Similarity | NPD2934 | Approved |
0.7712 | Intermediate Similarity | NPD3134 | Approved |
0.7705 | Intermediate Similarity | NPD5283 | Phase 1 |
0.7699 | Intermediate Similarity | NPD2860 | Approved |
0.7699 | Intermediate Similarity | NPD2859 | Approved |
0.7652 | Intermediate Similarity | NPD3020 | Approved |
0.7638 | Intermediate Similarity | NPD3496 | Discontinued |
0.7612 | Intermediate Similarity | NPD826 | Approved |
0.7612 | Intermediate Similarity | NPD825 | Approved |
0.7559 | Intermediate Similarity | NPD4626 | Approved |
0.754 | Intermediate Similarity | NPD9545 | Approved |
0.7519 | Intermediate Similarity | NPD7095 | Approved |
0.75 | Intermediate Similarity | NPD9494 | Approved |
0.7481 | Intermediate Similarity | NPD1613 | Approved |
0.7481 | Intermediate Similarity | NPD1612 | Clinical (unspecified phase) |
0.748 | Intermediate Similarity | NPD5691 | Approved |
0.748 | Intermediate Similarity | NPD5535 | Approved |
0.7465 | Intermediate Similarity | NPD6143 | Clinical (unspecified phase) |
0.7464 | Intermediate Similarity | NPD2935 | Discontinued |
0.7463 | Intermediate Similarity | NPD3764 | Approved |
0.7444 | Intermediate Similarity | NPD1529 | Clinical (unspecified phase) |
0.7426 | Intermediate Similarity | NPD4340 | Discontinued |
0.7426 | Intermediate Similarity | NPD555 | Phase 2 |
0.7402 | Intermediate Similarity | NPD1894 | Discontinued |
0.7385 | Intermediate Similarity | NPD9269 | Phase 2 |
0.7383 | Intermediate Similarity | NPD4868 | Clinical (unspecified phase) |
0.7379 | Intermediate Similarity | NPD1653 | Approved |
0.7376 | Intermediate Similarity | NPD4628 | Phase 3 |
0.7368 | Intermediate Similarity | NPD5736 | Approved |
0.7368 | Intermediate Similarity | NPD1530 | Clinical (unspecified phase) |
0.7364 | Intermediate Similarity | NPD3847 | Discontinued |
0.7353 | Intermediate Similarity | NPD943 | Approved |
0.7339 | Intermediate Similarity | NPD9377 | Approved |
0.7339 | Intermediate Similarity | NPD9379 | Approved |
0.7333 | Intermediate Similarity | NPD6798 | Discontinued |
0.7308 | Intermediate Similarity | NPD1535 | Discovery |
0.7299 | Intermediate Similarity | NPD6355 | Discontinued |
0.7295 | Intermediate Similarity | NPD2684 | Approved |
0.7293 | Intermediate Similarity | NPD257 | Approved |
0.7293 | Intermediate Similarity | NPD258 | Approved |
0.7288 | Intermediate Similarity | NPD1242 | Phase 1 |
0.7286 | Intermediate Similarity | NPD2029 | Clinical (unspecified phase) |
0.7279 | Intermediate Similarity | NPD6233 | Phase 2 |
0.7279 | Intermediate Similarity | NPD4062 | Phase 3 |
0.7279 | Intermediate Similarity | NPD259 | Phase 1 |
0.7273 | Intermediate Similarity | NPD5311 | Approved |
0.7273 | Intermediate Similarity | NPD5310 | Approved |
0.7273 | Intermediate Similarity | NPD968 | Approved |
0.7254 | Intermediate Similarity | NPD4110 | Phase 3 |
0.7254 | Intermediate Similarity | NPD4109 | Clinical (unspecified phase) |
0.7252 | Intermediate Similarity | NPD1481 | Phase 2 |
0.7239 | Intermediate Similarity | NPD9569 | Approved |
0.7226 | Intermediate Similarity | NPD3620 | Phase 2 |
0.7226 | Intermediate Similarity | NPD3619 | Clinical (unspecified phase) |
0.7226 | Intermediate Similarity | NPD3061 | Approved |
0.7226 | Intermediate Similarity | NPD3062 | Approved |
0.7226 | Intermediate Similarity | NPD3059 | Approved |
0.7218 | Intermediate Similarity | NPD3055 | Approved |
0.7218 | Intermediate Similarity | NPD3053 | Approved |
0.7209 | Intermediate Similarity | NPD5585 | Approved |
0.7209 | Intermediate Similarity | NPD1357 | Approved |
0.72 | Intermediate Similarity | NPD7843 | Approved |
0.7197 | Intermediate Similarity | NPD3600 | Clinical (unspecified phase) |
0.7177 | Intermediate Similarity | NPD9280 | Clinical (unspecified phase) |
0.7176 | Intermediate Similarity | NPD422 | Phase 1 |
0.7165 | Intermediate Similarity | NPD4198 | Discontinued |
0.7165 | Intermediate Similarity | NPD7157 | Approved |
0.7164 | Intermediate Similarity | NPD6584 | Phase 3 |
0.7155 | Intermediate Similarity | NPD1432 | Clinical (unspecified phase) |
0.7154 | Intermediate Similarity | NPD9384 | Approved |
0.7154 | Intermediate Similarity | NPD9381 | Approved |
0.7153 | Intermediate Similarity | NPD6663 | Approved |
0.7152 | Intermediate Similarity | NPD3882 | Suspended |
0.7143 | Intermediate Similarity | NPD1283 | Approved |
0.7133 | Intermediate Similarity | NPD2393 | Clinical (unspecified phase) |
0.7122 | Intermediate Similarity | NPD5314 | Approved |
0.7111 | Intermediate Similarity | NPD2861 | Phase 2 |
0.7109 | Intermediate Similarity | NPD9493 | Approved |
0.7103 | Intermediate Similarity | NPD1511 | Approved |
0.7101 | Intermediate Similarity | NPD4140 | Approved |
0.7101 | Intermediate Similarity | NPD1558 | Phase 1 |
0.7094 | Intermediate Similarity | NPD844 | Approved |
0.709 | Intermediate Similarity | NPD2797 | Approved |
0.709 | Intermediate Similarity | NPD1203 | Approved |
0.708 | Intermediate Similarity | NPD6859 | Clinical (unspecified phase) |
0.7077 | Intermediate Similarity | NPD9268 | Approved |
0.7073 | Intermediate Similarity | NPD9265 | Clinical (unspecified phase) |
0.7067 | Intermediate Similarity | NPD1934 | Approved |
0.7063 | Intermediate Similarity | NPD7421 | Clinical (unspecified phase) |
0.705 | Intermediate Similarity | NPD447 | Suspended |
0.7049 | Intermediate Similarity | NPD9697 | Approved |
0.7045 | Intermediate Similarity | NPD3705 | Approved |
0.7045 | Intermediate Similarity | NPD3092 | Approved |
0.7031 | Intermediate Similarity | NPD6671 | Approved |
0.7029 | Intermediate Similarity | NPD2674 | Phase 3 |
0.7023 | Intermediate Similarity | NPD6516 | Phase 2 |
0.7023 | Intermediate Similarity | NPD5846 | Approved |
0.7023 | Intermediate Similarity | NPD1778 | Approved |
0.7021 | Intermediate Similarity | NPD2799 | Discontinued |
0.702 | Intermediate Similarity | NPD2801 | Approved |
0.7015 | Intermediate Similarity | NPD3225 | Approved |
0.7008 | Intermediate Similarity | NPD1241 | Discontinued |
0.7007 | Intermediate Similarity | NPD1512 | Approved |
0.7007 | Intermediate Similarity | NPD5163 | Phase 2 |
0.7007 | Intermediate Similarity | NPD9537 | Phase 1 |
0.7007 | Intermediate Similarity | NPD9536 | Phase 1 |
0.7 | Intermediate Similarity | NPD3091 | Approved |
0.7 | Intermediate Similarity | NPD6653 | Approved |
0.7 | Intermediate Similarity | NPD3028 | Approved |
0.7 | Intermediate Similarity | NPD1548 | Phase 1 |
0.6992 | Remote Similarity | NPD2337 | Clinical (unspecified phase) |
0.6992 | Remote Similarity | NPD1608 | Approved |
0.6978 | Remote Similarity | NPD2979 | Phase 3 |
0.6974 | Remote Similarity | NPD3817 | Phase 2 |
0.6972 | Remote Similarity | NPD6032 | Approved |
0.6972 | Remote Similarity | NPD9570 | Approved |
0.6964 | Remote Similarity | NPD111 | Approved |
0.6963 | Remote Similarity | NPD1164 | Approved |
0.6963 | Remote Similarity | NPD3094 | Phase 2 |
0.6957 | Remote Similarity | NPD2028 | Clinical (unspecified phase) |
0.6957 | Remote Similarity | NPD3268 | Approved |
0.6953 | Remote Similarity | NPD2629 | Approved |
0.6948 | Remote Similarity | NPD6234 | Discontinued |
0.6944 | Remote Similarity | NPD3060 | Approved |
0.694 | Remote Similarity | NPD2982 | Phase 2 |
0.694 | Remote Similarity | NPD9622 | Approved |
0.694 | Remote Similarity | NPD4359 | Approved |
0.694 | Remote Similarity | NPD6583 | Phase 3 |
0.694 | Remote Similarity | NPD2983 | Phase 2 |
0.694 | Remote Similarity | NPD6582 | Phase 2 |
0.6934 | Remote Similarity | NPD2614 | Approved |
0.6934 | Remote Similarity | NPD6832 | Phase 2 |
0.6934 | Remote Similarity | NPD4908 | Phase 1 |
0.6934 | Remote Similarity | NPD5752 | Clinical (unspecified phase) |
0.6929 | Remote Similarity | NPD275 | Approved |
0.6929 | Remote Similarity | NPD274 | Approved |
0.6923 | Remote Similarity | NPD5762 | Approved |
0.6923 | Remote Similarity | NPD5763 | Approved |
0.6918 | Remote Similarity | NPD7440 | Discontinued |
0.6917 | Remote Similarity | NPD1281 | Approved |
0.6917 | Remote Similarity | NPD1238 | Approved |
0.6917 | Remote Similarity | NPD1610 | Phase 2 |
0.6897 | Remote Similarity | NPD3750 | Approved |
0.6894 | Remote Similarity | NPD3019 | Approved |
0.6894 | Remote Similarity | NPD2932 | Approved |
0.6892 | Remote Similarity | NPD6273 | Approved |
0.6891 | Remote Similarity | NPD288 | Approved |
0.6887 | Remote Similarity | NPD6386 | Approved |
0.6887 | Remote Similarity | NPD6385 | Approved |
0.6875 | Remote Similarity | NPD4534 | Discontinued |
0.6875 | Remote Similarity | NPD5958 | Discontinued |
0.6871 | Remote Similarity | NPD6799 | Approved |
0.6871 | Remote Similarity | NPD4357 | Discontinued |
0.6866 | Remote Similarity | NPD2235 | Phase 2 |
0.6866 | Remote Similarity | NPD2231 | Phase 2 |
0.6866 | Remote Similarity | NPD2981 | Phase 2 |
0.6861 | Remote Similarity | NPD3018 | Phase 2 |
0.686 | Remote Similarity | NPD289 | Clinical (unspecified phase) |
0.6855 | Remote Similarity | NPD3818 | Discontinued |
0.6853 | Remote Similarity | NPD5408 | Approved |
0.6853 | Remote Similarity | NPD5405 | Approved |
0.6853 | Remote Similarity | NPD2438 | Suspended |
0.6853 | Remote Similarity | NPD5406 | Approved |
0.6853 | Remote Similarity | NPD5404 | Approved |
0.6853 | Remote Similarity | NPD1551 | Phase 2 |
0.685 | Remote Similarity | NPD969 | Suspended |
0.6846 | Remote Similarity | NPD694 | Clinical (unspecified phase) |
0.6846 | Remote Similarity | NPD6980 | Clinical (unspecified phase) |
0.6835 | Remote Similarity | NPD3145 | Approved |
0.6835 | Remote Similarity | NPD4907 | Clinical (unspecified phase) |
0.6835 | Remote Similarity | NPD2313 | Discontinued |
0.6835 | Remote Similarity | NPD3144 | Approved |
0.6832 | Remote Similarity | NPD7993 | Clinical (unspecified phase) |
0.6831 | Remote Similarity | NPD4978 | Clinical (unspecified phase) |
0.6831 | Remote Similarity | NPD7097 | Phase 1 |
0.6829 | Remote Similarity | NPD5909 | Discontinued |
0.6828 | Remote Similarity | NPD4162 | Approved |
0.6825 | Remote Similarity | NPD5451 | Approved |
0.6824 | Remote Similarity | NPD3536 | Discontinued |
0.6824 | Remote Similarity | NPD4160 | Clinical (unspecified phase) |
0.6824 | Remote Similarity | NPD7422 | Clinical (unspecified phase) |
0.6818 | Remote Similarity | NPD1651 | Approved |
0.6809 | Remote Similarity | NPD1899 | Clinical (unspecified phase) |
0.6809 | Remote Similarity | NPD1933 | Approved |
0.6803 | Remote Similarity | NPD940 | Approved |
0.6803 | Remote Similarity | NPD846 | Approved |
Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.