Drug Information| Drug ID:   | NPD3059 |
| Drug Name:   | Arbutamine Hydrochloride |
| Molecular Formula:   | C18H23NO4.ClH |
| Canonical SMILES:   | Oc1ccc(cc1)CCCCNC[C@@H](c1ccc(c(c1)O)O)O.Cl |
| Standard InCHI:   | "InChI=1S/C18H23NO4.ClH/c20-15-7-4-13(5-8-15)3-1-2-10-19-12-18(23)14-6-9-16(21)17(22)11-14;/h4-9,11,18-23H,1-3,10,12H2;1H/t18-;/m0./s1" |
| Standard InCHIKey:   | ATBUNPBAFFCFKY-FERBBOLQSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3059Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5208 | NPC323775 |
| Remote Similarity | 0.5208 | NPC236347 |
| Remote Similarity | 0.5208 | NPC599888 |
| Remote Similarity | 0.5208 | NPC611709 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 317.16 |
| ALogP   | -2.8024 |
| MLogP   | 2.89 |
| XLogP   | 2.738 |
| HDA   | 2 |
| HBD   | 5 |
| Rotatable Bonds   | 12 |
| TPSA   | 92.95 |
| RO5 Violation   | 0 |