Drug Information| Drug ID:   | NPD2982 |
| Drug Name:   | Fosbretabulin Tromethamine |
| Molecular Formula:   | C18H21O8P.C4H11NO3 |
| Canonical SMILES:   | OCC(CO)(CO)N.COc1cc(/C=Cc2ccc(c(c2)OP(=O)(O)O)OC)cc(c1OC)OC |
| Standard InCHI:   | "InChI=1S/C18H21O8P.C4H11NO3/c1-22-14-8-7-12(9-15(14)26-27(19,20)21)5-6-13-10-16(23-2)18(25-4)17(11-13)24-3;5-4(1-6,2-7)3-8/h5-11H,1-4H3,(H2,19,20,21);6-8H,1-3,5H2/b6-5-;" |
| Standard InCHIKey:   | FIDMEHCRMLKKPZ-YSMBQZINSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2982Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5227 | NPC497315 |
| Remote Similarity | 0.5208 | NPC262253 |
| Remote Similarity | 0.5208 | NPC550260 |
| Remote Similarity | 0.5208 | NPC606778 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 396.1 |
| ALogP   | -0.1355 |
| MLogP   | 2.45 |
| XLogP   | 2.146 |
| HDA   | 3 |
| HBD   | 2 |
| Rotatable Bonds   | 14 |
| TPSA   | 113.49 |
| RO5 Violation   | 0 |