NPASS drugs

Drug Information

Drug ID:	NPD4359
Drug Name:	Permethrin
Molecular Formula:	C21H20Cl2O3
Canonical SMILES:	ClC(=CC1C(C1(C)C)C(=O)OCc1cccc(c1)Oc1ccccc1)Cl
Standard InCHI:	"InChI=1S/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3"
Standard InCHIKey:	RLLPVAHGXHCWKJ-UHFFFAOYSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4359

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	90964
0.1-0.2	119647
0.2-0.3	1093
0.3-0.4	27
0.4-0.5	4
0.5-0.6	0
0.6-0.7	2
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC320287
High Similarity	1.0	NPC611687
Intermediate Similarity	0.7755	NPC234956
Remote Similarity	0.6491	NPC322552
Remote Similarity	0.6491	NPC251849

Drug Structure

NPD4359 OpenBabel08211705262D 26 28 0 0 1 0 0 0 0 0999 V2000 -1.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7942 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9282 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7942 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5981 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0622 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9282 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3301 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -1.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0622 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -0.8660 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -0.3660 -2.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3660 -3.3660 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -1.2321 -1.8660 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1962 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 21 1 0 0 0 0 2 21 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 8 1 0 0 0 0 5 9 2 0 0 0 0 6 7 2 0 0 0 0 6 10 1 0 0 0 0 7 14 1 0 0 0 0 8 15 2 0 0 0 0 9 15 1 0 0 0 0 10 16 2 0 0 0 0 11 14 2 0 0 0 0 11 16 1 0 0 0 0 12 17 1 0 0 0 0 12 18 2 0 0 0 0 13 14 1 0 0 0 0 13 25 1 0 0 0 0 15 26 1 0 0 0 0 16 26 1 0 0 0 0 17 19 1 0 0 0 0 17 21 1 0 0 0 0 18 22 1 0 0 0 0 18 23 1 0 0 0 0 19 20 1 0 0 0 0 19 21 1 0 0 0 0 20 24 2 0 0 0 0 20 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001235
DrugBank	DB04930
ChEMBL	CHEMBL1525
IUPHAR/BPS
PharmaGKB	PA164743137
KEGG Drug	D05443
PubChem CID	40326
ChEBI	34911
CAS Number	52645-53-1

Drug Properties

Molecular Weight	390.08
ALogP	1.8533
MLogP	3.22
XLogP	7.313
HDA	2
HBD	0
Rotatable Bonds	11
TPSA	35.53
RO5 Violation	1