NPASS drugs

Drug Information

Drug ID:	NPD6273
Drug Name:	Estradiol Benzoate
Molecular Formula:	C25H28O3
Canonical SMILES:	O=C(c1ccccc1)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C
Standard InCHI:	"InChI=1S/C25H28O3/c1-25-14-13-20-19-10-8-18(28-24(27)16-5-3-2-4-6-16)15-17(19)7-9-21(20)22(25)11-12-23(25)26/h2-6,8,10,15,20-23,26H,7,9,11-14H2,1H3/t20-,21-,22+,23+,25+/m1/s1"
Standard InCHIKey:	UYIFTLBWAOGQBI-BZDYCCQFSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD6273

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	46572
0.1-0.2	160088
0.2-0.3	4997
0.3-0.4	49
0.4-0.5	17
0.5-0.6	13
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6301	NPC89650
Remote Similarity	0.6173	NPC327694
Remote Similarity	0.5915	NPC324822
Remote Similarity	0.5775	NPC321502
Remote Similarity	0.5775	NPC611227
Remote Similarity	0.5571	NPC48342
Remote Similarity	0.5571	NPC294638
Remote Similarity	0.5571	NPC328831
Remote Similarity	0.5571	NPC164649
Remote Similarity	0.5571	NPC290287
Remote Similarity	0.5571	NPC601860
Remote Similarity	0.5571	NPC609599
Remote Similarity	0.5362	NPC321402
Remote Similarity	0.5068	NPC498325
Remote Similarity	0.5057	NPC317896

Drug Structure

NPD6273 OpenBabel08211709092D 29 33 0 0 1 0 0 0 0 0999 V2000 -0.0003 1.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4646 -3.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6186 -4.3950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4642 -2.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7722 -3.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6178 -2.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6942 -2.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2326 -1.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8474 -2.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3864 -0.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6919 -0.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6922 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6933 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8465 0.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3869 -2.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7717 -2.9297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5407 -2.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2329 -2.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5404 -1.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6936 -0.9765 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8471 -1.4656 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0003 -0.9770 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8468 0.4886 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9253 -2.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8474 1.4652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9249 -1.4644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0793 -2.9304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8028 1.6677 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 6 2 0 0 0 0 5 16 2 0 0 0 0 6 16 1 0 0 0 0 7 9 1 0 0 0 0 7 17 1 0 0 0 0 8 10 1 0 0 0 0 8 18 2 0 0 0 0 10 19 2 0 0 0 0 11 12 1 0 0 0 0 11 22 1 0 0 0 0 12 23 1 0 0 0 0 13 14 1 0 0 0 0 14 25 1 0 0 0 0 15 17 2 0 0 0 0 15 18 1 0 0 0 0 16 24 1 0 0 0 0 17 19 1 0 0 0 0 18 28 1 0 0 0 0 19 20 1 0 0 0 0 20 13 1 6 0 0 0 20 21 1 0 0 0 0 21 9 1 1 0 0 0 21 22 1 0 0 0 0 22 25 1 6 0 0 0 23 25 1 6 0 0 0 23 26 1 0 0 0 0 24 27 2 0 0 0 0 24 28 1 0 0 0 0 25 1 1 6 0 0 0 26 29 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	376.2
ALogP	-0.1007
MLogP	3.88
XLogP	8.132
HDA	2
HBD	1
Rotatable Bonds	5
TPSA	46.53
RO5 Violation	1