Drug Information| Drug ID:   | NPD3018 |
| Drug Name:   | OXI-4503 |
| Molecular Formula:   | C18H22O12P2 |
| Canonical SMILES:   | COc1cc(/C=Cc2ccc(c(c2OP(=O)(O)O)OP(=O)(O)O)OC)cc(c1OC)OC |
| Standard InCHI:   | "InChI=1S/C18H22O12P2/c1-25-13-8-7-12(16(29-31(19,20)21)18(13)30-32(22,23)24)6-5-11-9-14(26-2)17(28-4)15(10-11)27-3/h5-10H,1-4H3,(H2,19,20,21)(H2,22,23,24)/b6-5-" |
| Standard InCHIKey:   | GSOXMQLWUDQTNT-WAYWQWQTSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD3018Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6304 | NPC474623 |
| Remote Similarity | 0.6304 | NPC474651 |
| Remote Similarity | 0.6304 | NPC587645 |
| Remote Similarity | 0.5918 | NPC474597 |
| Remote Similarity | 0.5918 | NPC547950 |
| Remote Similarity | 0.5116 | NPC497315 |
| TTD   | DNCL002273 |
| DrugBank   | DB05143 |
| ChEMBL   | CHEMBL1205402 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 56841628 |
| ChEBI   | |
| CAS Number   | 288847-35-8 |
| Molecular Weight   | 492.06 |
| ALogP   | -0.5316 |
| MLogP   | 1.9 |
| XLogP   | -0.257 |
| HDA   | 6 |
| HBD   | 4 |
| Rotatable Bonds   | 18 |
| TPSA   | 190.06 |
| RO5 Violation   | 0 |