NPASS drugs

Drug Information

Drug ID:	NPD3092
Drug Name:	Estriol
Molecular Formula:	C18H24O3
Canonical SMILES:	Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1C[C@H]([C@@H]2O)O)C
Standard InCHI:	"InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17+,18+/m1/s1"
Standard InCHIKey:	PROQIPRRNZUXQM-ZXXIGWHRSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD3092

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	93374
0.1-0.2	113912
0.2-0.3	4301
0.3-0.4	96
0.4-0.5	15
0.5-0.6	18
0.6-0.7	11
0.7-0.8	7
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	6

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC77569
High Similarity	1.0	NPC214224
High Similarity	1.0	NPC142198
High Similarity	1.0	NPC324264
High Similarity	1.0	NPC603451
High Similarity	1.0	NPC609551
Intermediate Similarity	0.7143	NPC48342
Intermediate Similarity	0.7143	NPC294638
Intermediate Similarity	0.7143	NPC328831
Intermediate Similarity	0.7143	NPC164649
Intermediate Similarity	0.7143	NPC290287
Intermediate Similarity	0.7143	NPC601860
Intermediate Similarity	0.7143	NPC609599
Remote Similarity	0.6667	NPC319905
Remote Similarity	0.65	NPC30491
Remote Similarity	0.65	NPC262936
Remote Similarity	0.65	NPC529167
Remote Similarity	0.6316	NPC322753
Remote Similarity	0.6	NPC190501
Remote Similarity	0.6	NPC318552
Remote Similarity	0.6	NPC144109
Remote Similarity	0.6	NPC114161
Remote Similarity	0.6	NPC542506
Remote Similarity	0.6	NPC611728
Remote Similarity	0.5968	NPC99734
Remote Similarity	0.5968	NPC611911
Remote Similarity	0.5902	NPC271867
Remote Similarity	0.5902	NPC137249
Remote Similarity	0.5902	NPC129330
Remote Similarity	0.5833	NPC328504
Remote Similarity	0.5806	NPC325928
Remote Similarity	0.5806	NPC72232
Remote Similarity	0.5735	NPC122548
Remote Similarity	0.5714	NPC319149
Remote Similarity	0.5625	NPC68723
Remote Similarity	0.5625	NPC265677
Remote Similarity	0.5246	NPC321402
Remote Similarity	0.5217	NPC493312
Remote Similarity	0.5143	NPC592590
Remote Similarity	0.5085	NPC85543
Remote Similarity	0.5079	NPC475166
Remote Similarity	0.5079	NPC566485

Drug Structure

NPD3092 OpenBabel08211702562D 24 27 0 0 1 0 0 0 0 0999 V2000 -0.0003 1.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6857 -2.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2114 -1.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8431 -2.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3694 -0.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6848 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8423 0.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3699 -2.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6834 -0.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5280 -2.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2116 -2.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5277 -1.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6851 -0.9716 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8428 -1.4582 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0003 -0.9721 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6837 -0.0005 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8426 0.4861 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0538 -2.9157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5255 0.4849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8431 1.4578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6249 -2.1289 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0962 -0.3016 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7311 1.8525 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 4 1 0 0 0 0 2 10 1 0 0 0 0 3 5 1 0 0 0 0 3 11 2 0 0 0 0 5 12 2 0 0 0 0 6 7 1 0 0 0 0 7 18 1 0 0 0 0 8 10 2 0 0 0 0 8 11 1 0 0 0 0 9 15 1 0 0 0 0 9 16 1 0 0 0 0 10 12 1 0 0 0 0 11 19 1 0 0 0 0 12 13 1 0 0 0 0 13 6 1 6 0 0 0 13 14 1 0 0 0 0 14 4 1 1 0 0 0 14 15 1 0 0 0 0 15 18 1 6 0 0 0 16 17 1 0 0 0 0 16 20 1 1 0 0 0 17 18 1 6 0 0 0 17 21 1 0 0 0 0 18 1 1 6 0 0 0 19 22 1 0 0 0 0 20 23 1 0 0 0 0 21 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB006272; DAP001019
DrugBank	DB04573
ChEMBL	CHEMBL193482
IUPHAR/BPS	2821
PharmaGKB	PA164769104
KEGG Drug	D00185
PubChem CID	5756
ChEBI	27974
CAS Number	50-27-1

Drug Properties

Molecular Weight	288.17
ALogP	-0.6926
MLogP	3.11
XLogP	4.045
HDA	2
HBD	3
Rotatable Bonds	4
TPSA	60.69
RO5 Violation	0