Drug Information| Drug ID:   | NPD1548 |
| Drug Name:   | Idronoxil |
| Molecular Formula:   | C15H12O3 |
| Canonical SMILES:   | Oc1ccc(cc1)C1=Cc2c(OC1)cc(cc2)O |
| Standard InCHI:   | "InChI=1S/C15H12O3/c16-13-4-1-10(2-5-13)12-7-11-3-6-14(17)8-15(11)18-9-12/h1-8,16-17H,9H2" |
| Standard InCHIKey:   | ZZUBHVMHNVYXRR-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1548Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC74821 |
| Intermediate Similarity | 0.7442 | NPC191903 |
| Intermediate Similarity | 0.7111 | NPC275804 |
| Remote Similarity | 0.6531 | NPC530522 |
| Remote Similarity | 0.6531 | NPC592530 |
| Remote Similarity | 0.64 | NPC168059 |
| Remote Similarity | 0.64 | NPC46245 |
| Remote Similarity | 0.64 | NPC98752 |
| Remote Similarity | 0.6275 | NPC101804 |
| Remote Similarity | 0.6275 | NPC515253 |
| Remote Similarity | 0.6275 | NPC593256 |
| Remote Similarity | 0.6111 | NPC542932 |
| Remote Similarity | 0.5517 | NPC112117 |
| Remote Similarity | 0.5424 | NPC134360 |
| Remote Similarity | 0.5424 | NPC520755 |
| Remote Similarity | 0.5333 | NPC215437 |
| Remote Similarity | 0.5333 | NPC542745 |
| Remote Similarity | 0.5172 | NPC183196 |
| TTD   | DCL000196 |
| DrugBank   | DB04915 |
| ChEMBL   | CHEMBL1957038 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 219100 |
| ChEBI   | |
| CAS Number   | 81267-65-4 |
| Molecular Weight   | 240.08 |
| ALogP   | -0.7909 |
| MLogP   | 2.78 |
| XLogP   | 2.635 |
| HDA   | 0 |
| HBD   | 2 |
| Rotatable Bonds   | 3 |
| TPSA   | 49.69 |
| RO5 Violation   | 0 |