Drug Information| Drug ID:   | NPD6799 |
| Drug Name:   | |
| Molecular Formula:   | C27H30O6 |
| Canonical SMILES:   | OC(=O)COc1cc(OCC=C(C)C)ccc1C(=O)/C=C/c1ccc(cc1)OCC=C(C)C |
| Standard InCHI:   | "InChI=1S/C27H30O6/c1-19(2)13-15-31-22-8-5-21(6-9-22)7-12-25(28)24-11-10-23(32-16-14-20(3)4)17-26(24)33-18-27(29)30/h5-14,17H,15-16,18H2,1-4H3,(H,29,30)/b12-7+" |
| Standard InCHIKey:   | GFWRVVCDTLRWPK-KPKJPENVSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD6799Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5323 | NPC533649 |
| Remote Similarity | 0.5179 | NPC176930 |
| Remote Similarity | 0.5179 | NPC584517 |
| Remote Similarity | 0.5179 | NPC602047 |
| Remote Similarity | 0.5094 | NPC164958 |
| Remote Similarity | 0.5094 | NPC60555 |
| Remote Similarity | 0.5094 | NPC581965 |
| Remote Similarity | 0.5091 | NPC201747 |
| Remote Similarity | 0.5091 | NPC598484 |
| TTD   | DNAP001564 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 5282219 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 450.2 |
| ALogP   | 2.329 |
| MLogP   | 3.77 |
| XLogP   | 5.676 |
| HDA   | 3 |
| HBD   | 1 |
| Rotatable Bonds   | 17 |
| TPSA   | 82.06 |
| RO5 Violation   | 2 |