Drug Information| Drug ID:   | NPD3144 |
| Drug Name:   | Zucapsaicin |
| Molecular Formula:   | C18H27NO3 |
| Canonical SMILES:   | COc1cc(CN=C(CCCC/C=CC(C)C)O)ccc1O |
| Standard InCHI:   | "InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6-" |
| Standard InCHIKey:   | YKPUWZUDDOIDPM-VURMDHGXSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | TTD; DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD3144Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC308885 |
| High Similarity | 1.0 | NPC255550 |
| High Similarity | 0.9808 | NPC259193 |
| High Similarity | 0.9808 | NPC121255 |
| High Similarity | 0.9074 | NPC190635 |
| High Similarity | 0.8596 | NPC252079 |
| Intermediate Similarity | 0.8393 | NPC48907 |
| Intermediate Similarity | 0.8364 | NPC6854 |
| Intermediate Similarity | 0.7931 | NPC82196 |
| Intermediate Similarity | 0.7931 | NPC167757 |
| Intermediate Similarity | 0.7593 | NPC285078 |
| Intermediate Similarity | 0.7593 | NPC130595 |
| Intermediate Similarity | 0.7593 | NPC93882 |
| Intermediate Similarity | 0.7593 | NPC255540 |
| Intermediate Similarity | 0.7593 | NPC298277 |
| Intermediate Similarity | 0.75 | NPC218530 |
| Intermediate Similarity | 0.75 | NPC294586 |
| Intermediate Similarity | 0.75 | NPC33414 |
| Intermediate Similarity | 0.7241 | NPC8678 |
| Remote Similarity | 0.6825 | NPC275027 |
| Remote Similarity | 0.5781 | NPC595711 |
| Remote Similarity | 0.5781 | NPC603355 |
| Remote Similarity | 0.5781 | NPC612025 |
| Remote Similarity | 0.5692 | NPC526920 |
| Remote Similarity | 0.5556 | NPC53596 |
| Remote Similarity | 0.5397 | NPC145184 |
| Remote Similarity | 0.5385 | NPC483621 |
| Remote Similarity | 0.5385 | NPC483622 |
| Remote Similarity | 0.5303 | NPC160120 |
| Remote Similarity | 0.5303 | NPC289330 |
| Remote Similarity | 0.5152 | NPC483619 |
| TTD   | DNAP001285 |
| DrugBank   | DB09120 |
| ChEMBL   | CHEMBL313971 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 1548942 |
| ChEBI   | 135952 |
| CAS Number   | 25775-90-0 |
| Molecular Weight   | 305.2 |
| ALogP   | -0.0512 |
| MLogP   | 3 |
| XLogP   | 4.651 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 14 |
| TPSA   | 62.05 |
| RO5 Violation   | 0 |