NPASS drugs

Drug Information

Drug ID:	NPD5736
Drug Name:	Estradiol Valerate
Molecular Formula:	C23H32O3
Canonical SMILES:	CCCCC(=O)O[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)O
Standard InCHI:	"InChI=1S/C23H32O3/c1-3-4-5-22(25)26-21-11-10-20-19-8-6-15-14-16(24)7-9-17(15)18(19)12-13-23(20,21)2/h7,9,14,18-21,24H,3-6,8,10-13H2,1-2H3/t18-,19-,20+,21+,23+/m1/s1"
Standard InCHIKey:	RSEPBGGWRJCQGY-RBRWEJTLSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5736

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	33464
0.1-0.2	165868
0.2-0.3	12225
0.3-0.4	137
0.4-0.5	14
0.5-0.6	24
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.5672	NPC322753
Remote Similarity	0.5652	NPC190501
Remote Similarity	0.5652	NPC318552
Remote Similarity	0.5652	NPC144109
Remote Similarity	0.5652	NPC114161
Remote Similarity	0.5652	NPC611728
Remote Similarity	0.5429	NPC48342
Remote Similarity	0.5429	NPC294638
Remote Similarity	0.5429	NPC328831
Remote Similarity	0.5429	NPC164649
Remote Similarity	0.5429	NPC290287
Remote Similarity	0.5429	NPC542506
Remote Similarity	0.5429	NPC601860
Remote Similarity	0.5429	NPC609599
Remote Similarity	0.5352	NPC271867
Remote Similarity	0.5352	NPC137249
Remote Similarity	0.5352	NPC129330
Remote Similarity	0.5278	NPC72232
Remote Similarity	0.5205	NPC30491
Remote Similarity	0.5205	NPC262936
Remote Similarity	0.5205	NPC319149
Remote Similarity	0.5205	NPC529167
Remote Similarity	0.5135	NPC68723
Remote Similarity	0.5135	NPC265677

Drug Structure

NPD5736 OpenBabel08211708292D 27 30 0 0 1 0 0 0 0 0999 V2000 -4.6587 2.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 1.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7054 2.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0538 2.7926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1005 2.5906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6905 -2.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2233 -1.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8455 -2.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3789 -0.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6882 -0.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6884 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6896 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8447 0.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3795 -2.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5351 -2.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2236 -2.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5349 -1.4619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6899 -0.9744 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8452 -1.4624 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0003 -0.9749 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8450 0.4875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7988 1.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0681 -2.9240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4504 0.9394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8455 1.4620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9123 -2.4361 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 22 1 0 0 0 0 6 8 1 0 0 0 0 6 15 1 0 0 0 0 7 9 1 0 0 0 0 7 16 2 0 0 0 0 9 17 2 0 0 0 0 10 11 1 0 0 0 0 10 20 1 0 0 0 0 11 21 1 0 0 0 0 12 13 1 0 0 0 0 13 23 1 0 0 0 0 14 15 2 0 0 0 0 14 16 1 0 0 0 0 15 17 1 0 0 0 0 16 24 1 0 0 0 0 17 18 1 0 0 0 0 18 12 1 6 0 0 0 18 19 1 0 0 0 0 19 8 1 1 0 0 0 19 20 1 0 0 0 0 20 23 1 6 0 0 0 21 23 1 6 0 0 0 21 26 1 0 0 0 0 22 25 2 0 0 0 0 22 26 1 0 0 0 0 23 2 1 6 0 0 0 24 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS	7655
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	356.24
ALogP	-0.5906
MLogP	3.66
XLogP	6.777
HDA	2
HBD	1
Rotatable Bonds	8
TPSA	46.53
RO5 Violation	1