NPASS drugs

Drug Information

Drug ID:	NPD4140
Drug Name:	Estradiol Acetate
Molecular Formula:	C20H26O3
Canonical SMILES:	CC(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C
Standard InCHI:	"InChI=1S/C20H26O3/c1-12(21)23-14-4-6-15-13(11-14)3-5-17-16(15)9-10-20(2)18(17)7-8-19(20)22/h4,6,11,16-19,22H,3,5,7-10H2,1-2H3/t16-,17-,18+,19+,20+/m1/s1"
Standard InCHIKey:	FHXBMXJMKMWVRG-SLHNCBLASA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4140

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	41428
0.1-0.2	164864
0.2-0.3	5334
0.3-0.4	61
0.4-0.5	27
0.5-0.6	12
0.6-0.7	13
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6716	NPC89650
Remote Similarity	0.6667	NPC220771
Remote Similarity	0.6562	NPC324822
Remote Similarity	0.6533	NPC327694
Remote Similarity	0.6406	NPC321502
Remote Similarity	0.6406	NPC611227
Remote Similarity	0.619	NPC48342
Remote Similarity	0.619	NPC294638
Remote Similarity	0.619	NPC328831
Remote Similarity	0.619	NPC164649
Remote Similarity	0.619	NPC290287
Remote Similarity	0.619	NPC601860
Remote Similarity	0.619	NPC609599
Remote Similarity	0.5968	NPC321402
Remote Similarity	0.5606	NPC498325
Remote Similarity	0.5526	NPC534262
Remote Similarity	0.5522	NPC33900
Remote Similarity	0.5522	NPC575904
Remote Similarity	0.519	NPC485507
Remote Similarity	0.519	NPC506406
Remote Similarity	0.5122	NPC95990
Remote Similarity	0.5122	NPC317896
Remote Similarity	0.5122	NPC497979
Remote Similarity	0.5063	NPC493067
Remote Similarity	0.506	NPC318472

Drug Structure

NPD4140 OpenBabel08211704332D 24 27 0 0 1 0 0 0 0 0999 V2000 6.5115 -2.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 1.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6856 -2.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2112 -1.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8431 -2.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3693 -0.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6833 -0.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6836 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6848 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8423 0.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3698 -2.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5394 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5279 -2.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2115 -2.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5276 -1.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6851 -0.9716 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8428 -1.4582 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0003 -0.9721 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8425 0.4861 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0529 -1.2317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8431 1.4578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0536 -2.9156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5656 2.1075 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 1 0 0 0 0 3 5 1 0 0 0 0 3 13 1 0 0 0 0 4 6 1 0 0 0 0 4 14 2 0 0 0 0 6 15 2 0 0 0 0 7 8 1 0 0 0 0 7 18 1 0 0 0 0 8 19 1 0 0 0 0 9 10 1 0 0 0 0 10 20 1 0 0 0 0 11 13 2 0 0 0 0 11 14 1 0 0 0 0 12 21 2 0 0 0 0 12 23 1 0 0 0 0 13 15 1 0 0 0 0 14 23 1 0 0 0 0 15 16 1 0 0 0 0 16 9 1 6 0 0 0 16 17 1 0 0 0 0 17 5 1 1 0 0 0 17 18 1 0 0 0 0 18 20 1 6 0 0 0 19 20 1 6 0 0 0 19 22 1 0 0 0 0 20 2 1 6 0 0 0 22 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	314.19
ALogP	-0.0908
MLogP	3.33
XLogP	5.386
HDA	2
HBD	1
Rotatable Bonds	5
TPSA	46.53
RO5 Violation	1