Drug Information| Drug ID:   | NPD4628 |
| Drug Name:   | Lifibrol |
| Molecular Formula:   | C21H26O4 |
| Canonical SMILES:   | OC(COc1ccc(cc1)C(=O)O)CCc1ccc(cc1)C(C)(C)C |
| Standard InCHI:   | "InChI=1S/C21H26O4/c1-21(2,3)17-9-4-15(5-10-17)6-11-18(22)14-25-19-12-7-16(8-13-19)20(23)24/h4-5,7-10,12-13,18,22H,6,11,14H2,1-3H3,(H,23,24)" |
| Standard InCHIKey:   | LNXBEIZREVRNTF-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4628Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5849 | NPC530288 |
| Remote Similarity | 0.5185 | NPC104854 |
| Remote Similarity | 0.5185 | NPC570361 |
| Remote Similarity | 0.5179 | NPC475254 |
| Remote Similarity | 0.5179 | NPC574582 |
| Molecular Weight   | 342.18 |
| ALogP   | 0.4376 |
| MLogP   | 3.33 |
| XLogP   | 7.18 |
| HDA   | 3 |
| HBD   | 2 |
| Rotatable Bonds   | 13 |
| TPSA   | 66.76 |
| RO5 Violation   | 1 |