Drug Information| Drug ID:   | NPD5314 |
| Drug Name:   | Hexoprenaline |
| Molecular Formula:   | C22H32N2O6 |
| Canonical SMILES:   | OC(c1ccc(c(c1)O)O)CNCCCCCCNCC(c1ccc(c(c1)O)O)O |
| Standard InCHI:   | "InChI=1S/C22H32N2O6/c25-17-7-5-15(11-19(17)27)21(29)13-23-9-3-1-2-4-10-24-14-22(30)16-6-8-18(26)20(28)12-16/h5-8,11-12,21-30H,1-4,9-10,13-14H2" |
| Standard InCHIKey:   | OXLZNBCNGJWPRV-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD5314Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6579 | NPC323775 |
| Remote Similarity | 0.6579 | NPC236347 |
| Remote Similarity | 0.6579 | NPC599888 |
| Remote Similarity | 0.6579 | NPC611709 |
| Remote Similarity | 0.6098 | NPC483291 |
| Remote Similarity | 0.6098 | NPC611998 |
| Remote Similarity | 0.5946 | NPC118522 |
| Remote Similarity | 0.5946 | NPC115627 |
| Remote Similarity | 0.5946 | NPC169207 |
| Remote Similarity | 0.5946 | NPC599811 |
| Remote Similarity | 0.5946 | NPC602688 |
| Remote Similarity | 0.5778 | NPC130592 |
| TTD   | |
| DrugBank   | DB08957 |
| ChEMBL   | CHEMBL1589896 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   | 3215-70-1 |
| Molecular Weight   | 420.23 |
| ALogP   | -4.809 |
| MLogP   | 3 |
| XLogP   | 1.082 |
| HDA   | 4 |
| HBD   | 8 |
| Rotatable Bonds   | 19 |
| TPSA   | 145.44 |
| RO5 Violation   | 2 |