Drug Information| Drug ID:   | NPD9269 |
| Drug Name:   | Gallic Acid |
| Molecular Formula:   | C7H6O5 |
| Canonical SMILES:   | OC(=O)c1cc(O)c(c(c1)O)O |
| Standard InCHI:   | "InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12)" |
| Standard InCHIKey:   | LNTHITQWFMADLM-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9269Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC225710 |
| High Similarity | 1.0 | NPC605902 |
| Remote Similarity | 0.6296 | NPC156654 |
| Remote Similarity | 0.6296 | NPC608564 |
| Remote Similarity | 0.6154 | NPC98543 |
| Remote Similarity | 0.5862 | NPC571606 |
| Remote Similarity | 0.5667 | NPC43696 |
| Remote Similarity | 0.5667 | NPC579617 |
| Remote Similarity | 0.5667 | NPC607976 |
| Remote Similarity | 0.5484 | NPC588389 |
| Remote Similarity | 0.5312 | NPC533436 |
| Remote Similarity | 0.5172 | NPC187913 |
| Remote Similarity | 0.5161 | NPC95679 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 170.02 |
| ALogP   | -1.6207 |
| MLogP   | 1.68 |
| XLogP   | 0.002 |
| HDA   | 2 |
| HBD   | 4 |
| Rotatable Bonds   | 5 |
| TPSA   | 97.99 |
| RO5 Violation   | 0 |