Drug Information| Drug ID:   | NPD2674 |
| Drug Name:   | Nonivamide |
| Molecular Formula:   | C17H27NO3 |
| Canonical SMILES:   | CCCCCCCCC(=NCc1ccc(c(c1)OC)O)O |
| Standard InCHI:   | "InChI=1S/C17H27NO3/c1-3-4-5-6-7-8-9-17(20)18-13-14-10-11-15(19)16(12-14)21-2/h10-12,19H,3-9,13H2,1-2H3,(H,18,20)" |
| Standard InCHIKey:   | RGOVYLWUIBMPGK-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2674Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC285078 |
| High Similarity | 1.0 | NPC130595 |
| High Similarity | 1.0 | NPC93882 |
| High Similarity | 1.0 | NPC255540 |
| High Similarity | 1.0 | NPC298277 |
| High Similarity | 0.88 | NPC6854 |
| High Similarity | 0.8571 | NPC218530 |
| High Similarity | 0.8571 | NPC294586 |
| High Similarity | 0.8571 | NPC33414 |
| Intermediate Similarity | 0.8302 | NPC82196 |
| Intermediate Similarity | 0.8235 | NPC8678 |
| Intermediate Similarity | 0.7778 | NPC259193 |
| Intermediate Similarity | 0.7778 | NPC121255 |
| Intermediate Similarity | 0.7636 | NPC167757 |
| Intermediate Similarity | 0.7593 | NPC308885 |
| Intermediate Similarity | 0.7593 | NPC255550 |
| Intermediate Similarity | 0.7455 | NPC190635 |
| Intermediate Similarity | 0.7455 | NPC48907 |
| Intermediate Similarity | 0.7069 | NPC252079 |
| Remote Similarity | 0.6471 | NPC74427 |
| Remote Similarity | 0.6346 | NPC471308 |
| Remote Similarity | 0.6346 | NPC483618 |
| Remote Similarity | 0.6346 | NPC17388 |
| Remote Similarity | 0.6071 | NPC145184 |
| Remote Similarity | 0.569 | NPC53596 |
| Remote Similarity | 0.551 | NPC471307 |
| Remote Similarity | 0.551 | NPC78041 |
| Remote Similarity | 0.551 | NPC141139 |
| Remote Similarity | 0.55 | NPC483621 |
| Remote Similarity | 0.541 | NPC289330 |
| Remote Similarity | 0.5231 | NPC275027 |
| Remote Similarity | 0.5172 | NPC547117 |
| Remote Similarity | 0.5172 | NPC605032 |
| Remote Similarity | 0.5172 | NPC607816 |
| Remote Similarity | 0.5172 | NPC611860 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 293.2 |
| ALogP   | -2.4482 |
| MLogP   | 2.89 |
| XLogP   | 4.663 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 14 |
| TPSA   | 62.05 |
| RO5 Violation   | 0 |