Drug Information| Drug ID:   | NPD2614 |
| Drug Name:   | |
| Molecular Formula:   | C17H23NO4 |
| Canonical SMILES:   | NC[C@@H]1CC[C@H](CC1)C(=O)Oc1ccc(cc1)CCC(=O)O |
| Standard InCHI:   | "InChI=1S/C17H23NO4/c18-11-13-1-6-14(7-2-13)17(21)22-15-8-3-12(4-9-15)5-10-16(19)20/h3-4,8-9,13-14H,1-2,5-7,10-11,18H2,(H,19,20)/t13-,14-" |
| Standard InCHIKey:   | FHRSHSOEWXUORL-HDJSIYSDSA-N |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD2614Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 305.16 |
| ALogP   | -0.4004 |
| MLogP   | 2.78 |
| XLogP   | 2.749 |
| HDA   | 4 |
| HBD   | 2 |
| Rotatable Bonds   | 9 |
| TPSA   | 89.62 |
| RO5 Violation   | 0 |