Drug Information| Drug ID:   | NPD9697 |
| Drug Name:   | Coumarin |
| Molecular Formula:   | C9H6O2 |
| Canonical SMILES:   | O=c1ccc2c(o1)cccc2 |
| Standard InCHI:   | InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| Standard InCHIKey:   | ZYGHJZDHTFUPRJ-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9697Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC139891 |
| High Similarity | 1.0 | NPC609619 |
| Remote Similarity | 0.5526 | NPC163398 |
| Remote Similarity | 0.5526 | NPC593826 |
| Remote Similarity | 0.5526 | NPC602683 |
| Remote Similarity | 0.5526 | NPC607919 |
| Remote Similarity | 0.5385 | NPC87563 |
| Remote Similarity | 0.5385 | NPC605956 |
| Remote Similarity | 0.5385 | NPC600881 |
| Remote Similarity | 0.5263 | NPC605075 |
| Remote Similarity | 0.5263 | NPC247553 |
| Remote Similarity | 0.5263 | NPC542680 |
| Remote Similarity | 0.5263 | NPC604111 |
| Remote Similarity | 0.5263 | NPC605972 |
| Remote Similarity | 0.525 | NPC128633 |
| Remote Similarity | 0.525 | NPC602990 |
| Remote Similarity | 0.5128 | NPC526838 |
| Remote Similarity | 0.5128 | NPC552432 |
| Remote Similarity | 0.5128 | NPC604368 |
| TTD   | |
| DrugBank   | DB04665 |
| ChEMBL   | CHEMBL6466 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA134521193 |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | 28794 |
| CAS Number   | 91-64-5 |
| Molecular Weight   | 146.04 |
| ALogP   | 0.27 |
| MLogP   | 2.23 |
| XLogP   | 2.706 |
| HDA   | 1 |
| HBD   | 0 |
| Rotatable Bonds   | 0 |
| TPSA   | 26.3 |
| RO5 Violation   | 0 |