Drug Information| Drug ID:   | NPD9384 |
| Drug Name:   | (-)-Noradrenaline; Norepinephrine |
| Molecular Formula:   | C8H11NO3 |
| Canonical SMILES:   | NC[C@@H](c1ccc(c(c1)O)O)O |
| Standard InCHI:   | "InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m0/s1" |
| Standard InCHIKey:   | SFLSHLFXELFNJZ-QMMMGPOBSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD9384Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC118522 |
| High Similarity | 1.0 | NPC115627 |
| High Similarity | 1.0 | NPC169207 |
| High Similarity | 1.0 | NPC599811 |
| High Similarity | 1.0 | NPC602688 |
| Intermediate Similarity | 0.7333 | NPC323775 |
| Intermediate Similarity | 0.7333 | NPC236347 |
| Intermediate Similarity | 0.7333 | NPC599888 |
| Intermediate Similarity | 0.7333 | NPC611709 |
| Intermediate Similarity | 0.7059 | NPC141126 |
| Remote Similarity | 0.6667 | NPC483291 |
| Remote Similarity | 0.6667 | NPC611998 |
| Remote Similarity | 0.6429 | NPC290566 |
| Remote Similarity | 0.6429 | NPC145638 |
| Remote Similarity | 0.6429 | NPC602477 |
| Remote Similarity | 0.6429 | NPC609790 |
| Remote Similarity | 0.6429 | NPC611792 |
| Remote Similarity | 0.6207 | NPC84225 |
| Remote Similarity | 0.5806 | NPC325793 |
| Remote Similarity | 0.5294 | NPC120866 |
| Remote Similarity | 0.5172 | NPC215351 |
| Remote Similarity | 0.5172 | NPC20142 |
| Remote Similarity | 0.5172 | NPC136407 |
| Remote Similarity | 0.5161 | NPC146422 |
| Remote Similarity | 0.5161 | NPC608431 |
| TTD   | DNC001034; DAP000016 |
| DrugBank   | DB00368 |
| ChEMBL   | CHEMBL1437 |
| IUPHAR/BPS   | 505 |
| PharmaGKB   | PA450649 |
| KEGG Drug   | D00076 |
| PubChem CID   | 439260 |
| ChEBI   | 18357 |
| CAS Number   | 51-41-2 |
| Molecular Weight   | 169.07 |
| ALogP   | -2.1696 |
| MLogP   | 1.9 |
| XLogP   | -0.46 |
| HDA   | 2 |
| HBD   | 4 |
| Rotatable Bonds   | 6 |
| TPSA   | 86.71 |
| RO5 Violation   | 0 |