NPASS drugs

Drug Information

Drug ID:	NPD2981
Drug Name:	Fosbretabulin Disodium
Molecular Formula:	C18H21O8P.2Na
Canonical SMILES:	COc1cc(/C=Cc2ccc(c(c2)OP(=O)([O-])[O-])OC)cc(c1OC)OC.[Na+].[Na+]
Standard InCHI:	"InChI=1S/C18H21O8P.2Na/c1-22-14-8-7-12(9-15(14)26-27(19,20)21)5-6-13-10-16(23-2)18(25-4)17(11-13)24-3;;/h5-11H,1-4H3,(H2,19,20,21);;/q;2*+1/p-2/b6-5-;;"
Standard InCHIKey:	VXNQMUVMEIGUJW-XNOMRPDFSA-L
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2981

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	148128
0.1-0.2	56052
0.2-0.3	6962
0.3-0.4	510
0.4-0.5	72
0.5-0.6	6
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6389	NPC497315
Remote Similarity	0.6053	NPC123948
Remote Similarity	0.6053	NPC96122
Remote Similarity	0.6053	NPC577180
Remote Similarity	0.6053	NPC602655
Remote Similarity	0.5476	NPC262253
Remote Similarity	0.5476	NPC550260
Remote Similarity	0.5476	NPC606778
Remote Similarity	0.5278	NPC517005
Remote Similarity	0.5116	NPC474565
Remote Similarity	0.5116	NPC550797

Drug Structure

NPD2981 OpenBabel08211702562D 29 28 0 0 0 0 0 0 0 0999 V2000 0.6340 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2942 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5622 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4282 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9641 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9641 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0981 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2321 -7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2321 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8301 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0981 -5.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8301 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3660 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3660 -5.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5622 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5622 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5000 -4.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 1.5000 -3.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 0.5000 -4.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -7.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4282 -4.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6962 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4282 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -4.0000 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 -3.0148 -3.8411 0.0000 Na 0 3 0 0 0 15 0 0 0 0 0 0 10.2942 -0.5000 0.0000 Na 0 3 0 0 0 15 0 0 0 0 0 0 1 22 1 0 0 0 0 2 23 1 0 0 0 0 3 24 1 0 0 0 0 4 25 1 0 0 0 0 5 6 2 0 0 0 0 5 12 1 0 0 0 0 6 13 1 0 0 0 0 7 8 2 0 0 0 0 7 12 1 0 0 0 0 8 14 1 0 0 0 0 9 12 2 0 0 0 0 9 15 1 0 0 0 0 10 13 2 0 0 0 0 10 16 1 0 0 0 0 11 13 1 0 0 0 0 11 17 2 0 0 0 0 14 15 2 0 0 0 0 14 22 1 0 0 0 0 15 26 1 0 0 0 0 16 18 2 0 0 0 0 16 23 1 0 0 0 0 17 18 1 0 0 0 0 17 24 1 0 0 0 0 18 25 1 0 0 0 0 19 27 1 0 0 0 0 20 27 1 0 0 0 0 21 27 2 0 0 0 0 26 27 1 0 0 0 0 M CHG 4 19 -1 20 -1 28 1 29 1 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	394.08
ALogP	-1.4911
MLogP	2.45
XLogP	2.146
HDA	3
HBD	0
Rotatable Bonds	14
TPSA	119.15
RO5 Violation	0