NPASS drugs

Drug Information

Drug ID:	NPD3019
Drug Name:	Estrone
Molecular Formula:	C18H22O2
Canonical SMILES:	Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CCC2=O)C
Standard InCHI:	InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-16,19H,2,4,6-9H2,1H3/t14-,15-,16+,18+/m1/s1
Standard InCHIKey:	DNXHEGUUPJUMQT-CBZIJGRNSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD3019

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	188
0.1-0.2	1124
0.2-0.3	1541
0.3-0.4	4138
0.4-0.5	7642
0.5-0.6	7132
0.6-0.7	7465
0.7-0.8	1460
0.8-0.85	150
0.85-0.9	33
0.9-0.95	11
0.95-1	6

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC190501
High Similarity	1.0	NPC318552
High Similarity	0.9561	NPC79933
High Similarity	0.9561	NPC31296
High Similarity	0.9561	NPC258366
High Similarity	0.9561	NPC473974
High Similarity	0.9407	NPC15127
High Similarity	0.9391	NPC42657
High Similarity	0.9333	NPC262936
High Similarity	0.9333	NPC30491

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD3019 OpenBabel08211702562D 21 24 0 0 1 0 0 0 0 0999 V2000 -0.0003 1.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6774 -2.9028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1907 -1.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8390 -2.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3529 -0.9664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6751 -0.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6754 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6766 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8382 0.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3534 -2.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5156 -2.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1910 -2.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5153 -1.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6769 -0.9669 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8387 -1.4511 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0003 -0.9674 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8384 0.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0291 -2.9015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8390 1.4837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5124 -2.0634 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 4 1 0 0 0 0 2 11 1 0 0 0 0 3 5 1 0 0 0 0 3 12 2 0 0 0 0 5 13 2 0 0 0 0 6 7 1 0 0 0 0 6 16 1 0 0 0 0 7 17 1 0 0 0 0 8 9 1 0 0 0 0 9 18 1 0 0 0 0 10 11 2 0 0 0 0 10 12 1 0 0 0 0 11 13 1 0 0 0 0 12 19 1 0 0 0 0 13 14 1 0 0 0 0 14 8 1 6 0 0 0 14 15 1 0 0 0 0 15 4 1 1 0 0 0 15 16 1 0 0 0 0 16 18 1 6 0 0 0 17 18 1 0 0 0 0 17 20 2 0 0 0 0 18 1 1 6 0 0 0 19 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001020
DrugBank	DB00655
ChEMBL	CHEMBL1405
IUPHAR/BPS	2818
PharmaGKB	PA449512
KEGG Drug	D00067
PubChem CID	5870
ChEBI	17263
CAS Number	53-16-7

Drug Properties

Molecular Weight	270.16
ALogP	0.0998
MLogP	3.22
XLogP	4.039
HDA	1
HBD	1
Rotatable Bonds	2
TPSA	37.3
RO5 Violation	0