Drug Information| Drug ID:   | NPD257 |
| Drug Name:   | Methyldopa (Racemic) |
| Molecular Formula:   | C10H13NO4 |
| Canonical SMILES:   | OC(=O)C(Cc1ccc(c(c1)O)O)(N)C |
| Standard InCHI:   | "InChI=1S/C10H13NO4/c1-10(11,9(14)15)5-6-2-3-7(12)8(13)4-6/h2-4,12-13H,5,11H2,1H3,(H,14,15)" |
| Standard InCHIKey:   | CJCSPKMFHVPWAR-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD257Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC321561 |
| High Similarity | 1.0 | NPC611679 |
| Remote Similarity | 0.6316 | NPC161593 |
| Remote Similarity | 0.6316 | NPC145888 |
| Remote Similarity | 0.6316 | NPC16031 |
| Remote Similarity | 0.6316 | NPC611403 |
| Remote Similarity | 0.6053 | NPC222084 |
| Remote Similarity | 0.5897 | NPC63126 |
| Remote Similarity | 0.5897 | NPC263994 |
| Remote Similarity | 0.5897 | NPC117193 |
| Remote Similarity | 0.5897 | NPC606688 |
| Remote Similarity | 0.5897 | NPC608696 |
| Remote Similarity | 0.5476 | NPC98044 |
| Remote Similarity | 0.5455 | NPC170509 |
| Remote Similarity | 0.5455 | NPC519450 |
| Remote Similarity | 0.5349 | NPC562172 |
| Remote Similarity | 0.5128 | NPC326270 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 211.08 |
| ALogP   | -1.4345 |
| MLogP   | 2.01 |
| XLogP   | -2.001 |
| HDA   | 3 |
| HBD   | 4 |
| Rotatable Bonds   | 8 |
| TPSA   | 103.78 |
| RO5 Violation   | 0 |