Drug Information| Drug ID:   | NPD9377 |
| Drug Name:   | Dopamine Hydrochloride |
| Molecular Formula:   | C8H11NO2.ClH |
| Canonical SMILES:   | NCCc1ccc(c(c1)O)O.Cl |
| Standard InCHI:   | "InChI=1S/C8H11NO2.ClH/c9-4-3-6-1-2-7(10)8(11)5-6;/h1-2,5,10-11H,3-4,9H2;1H" |
| Standard InCHIKey:   | CTENFNNZBMHDDG-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9377Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9583 | NPC146422 |
| High Similarity | 0.9583 | NPC608431 |
| Intermediate Similarity | 0.7 | NPC85276 |
| Intermediate Similarity | 0.7 | NPC608236 |
| Remote Similarity | 0.6296 | NPC170509 |
| Remote Similarity | 0.6071 | NPC125732 |
| Remote Similarity | 0.6071 | NPC322228 |
| Remote Similarity | 0.6071 | NPC109955 |
| Remote Similarity | 0.6071 | NPC611220 |
| Remote Similarity | 0.6 | NPC68055 |
| Remote Similarity | 0.6 | NPC327951 |
| Remote Similarity | 0.6 | NPC607857 |
| Remote Similarity | 0.5667 | NPC12278 |
| Remote Similarity | 0.5667 | NPC602394 |
| Remote Similarity | 0.5484 | NPC228343 |
| Remote Similarity | 0.5484 | NPC307696 |
| Remote Similarity | 0.5484 | NPC565062 |
| Remote Similarity | 0.5484 | NPC602157 |
| Remote Similarity | 0.5455 | NPC481350 |
| Remote Similarity | 0.5455 | NPC59387 |
| Remote Similarity | 0.5455 | NPC509225 |
| Remote Similarity | 0.5455 | NPC551007 |
| Remote Similarity | 0.5152 | NPC284157 |
| Remote Similarity | 0.5152 | NPC110764 |
| Remote Similarity | 0.5152 | NPC268032 |
| Remote Similarity | 0.5152 | NPC527580 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 153.08 |
| ALogP   | -1.4033 |
| MLogP   | 2.01 |
| XLogP   | 0.57 |
| HDA   | 1 |
| HBD   | 3 |
| Rotatable Bonds   | 5 |
| TPSA   | 66.48 |
| RO5 Violation   | 0 |