Drug Information| Drug ID:   | NPD4908 |
| Drug Name:   | NV-196 |
| Molecular Formula:   | C22H20O4 |
| Canonical SMILES:   | COc1ccc(cc1)[C@@H]1[C@@H](COc2c1ccc(c2)O)c1ccc(cc1)O |
| Standard InCHI:   | "InChI=1S/C22H20O4/c1-25-18-9-4-15(5-10-18)22-19-11-8-17(24)12-21(19)26-13-20(22)14-2-6-16(23)7-3-14/h2-12,20,22-24H,13H2,1H3/t20-,22-/m0/s1" |
| Standard InCHIKey:   | KQCJZAUNKSGEFM-UNMCSNQZSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4908Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5441 | NPC588372 |
| Remote Similarity | 0.5441 | NPC591309 |
| Remote Similarity | 0.5172 | NPC202981 |
| Remote Similarity | 0.5172 | NPC488571 |
| Remote Similarity | 0.5172 | NPC479545 |
| Remote Similarity | 0.5143 | NPC500301 |
| Remote Similarity | 0.5143 | NPC513347 |
| Molecular Weight   | 348.14 |
| ALogP   | -1.4225 |
| MLogP   | 3.44 |
| XLogP   | 4.686 |
| HDA   | 0 |
| HBD   | 2 |
| Rotatable Bonds   | 6 |
| TPSA   | 58.92 |
| RO5 Violation   | 0 |