NPASS drugs

Drug Information

Drug ID:	NPD6663
Drug Name:	Estradiol Cypionate
Molecular Formula:	C26H36O3
Canonical SMILES:	O=C(O[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)O)CCC1CCCC1
Standard InCHI:	"InChI=1S/C26H36O3/c1-26-15-14-21-20-10-8-19(27)16-18(20)7-9-22(21)23(26)11-12-24(26)29-25(28)13-6-17-4-2-3-5-17/h8,10,16-17,21-24,27H,2-7,9,11-15H2,1H3/t21-,22-,23+,24+,26+/m1/s1"
Standard InCHIKey:	UOACKFBJUYNSLK-XRKIENNPSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD6663

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	37242
0.1-0.2	165445
0.2-0.3	8917
0.3-0.4	94
0.4-0.5	20
0.5-0.6	18
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.5652	NPC322753
Remote Similarity	0.5417	NPC190501
Remote Similarity	0.5417	NPC318552
Remote Similarity	0.5417	NPC144109
Remote Similarity	0.5417	NPC114161
Remote Similarity	0.5417	NPC611728
Remote Similarity	0.527	NPC72232
Remote Similarity	0.5205	NPC48342
Remote Similarity	0.5205	NPC294638
Remote Similarity	0.5205	NPC328831
Remote Similarity	0.5205	NPC164649
Remote Similarity	0.5205	NPC290287
Remote Similarity	0.5205	NPC542506
Remote Similarity	0.5205	NPC601860
Remote Similarity	0.5205	NPC609599
Remote Similarity	0.5135	NPC271867
Remote Similarity	0.5135	NPC137249
Remote Similarity	0.5135	NPC129330

Drug Structure

NPD6663 OpenBabel08211710072D 30 34 0 0 1 0 0 0 0 0999 V2000 -0.8781 0.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2378 -1.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1869 -0.9725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3252 -2.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2429 -0.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7342 -1.5897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3888 0.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3883 2.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5415 -0.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5412 2.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.9555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8468 -1.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2021 -0.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8474 1.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2359 1.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7103 -1.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3888 0.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2356 2.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5415 1.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6942 0.9788 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6941 0.0003 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8468 -0.4889 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8473 -0.4892 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2260 -0.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0824 2.9345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7820 -1.6914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6939 -0.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4328 3.8475 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 17 1 0 0 0 0 5 17 1 0 0 0 0 6 13 1 0 0 0 0 6 17 1 0 0 0 0 7 9 1 0 0 0 0 7 18 1 0 0 0 0 8 10 1 0 0 0 0 8 19 2 0 0 0 0 10 20 2 0 0 0 0 11 12 1 0 0 0 0 11 23 1 0 0 0 0 12 24 1 0 0 0 0 13 25 1 0 0 0 0 14 15 1 0 0 0 0 15 26 1 0 0 0 0 16 18 2 0 0 0 0 16 19 1 0 0 0 0 18 20 1 0 0 0 0 19 27 1 0 0 0 0 20 21 1 0 0 0 0 21 14 1 6 0 0 0 21 22 1 0 0 0 0 22 9 1 1 0 0 0 22 23 1 0 0 0 0 23 26 1 6 0 0 0 24 26 1 6 0 0 0 24 29 1 0 0 0 0 25 28 2 0 0 0 0 25 29 1 0 0 0 0 26 1 1 6 0 0 0 27 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	396.27
ALogP	-0.1812
MLogP	3.99
XLogP	8.083
HDA	2
HBD	1
Rotatable Bonds	7
TPSA	46.53
RO5 Violation	1