Drug Information| Drug ID:   | NPD7422 |
| Drug Name:   | |
| Molecular Formula:   | C30H30O8 |
| Canonical SMILES:   | O=Cc1c(O)c(O)c(c2c1c(O)c(c(c2)C)c1c(C)cc2c(c1O)c(C=O)c(c(c2C(C)C)O)O)C(C)C |
| Standard InCHI:   | "InChI=1S/C30H30O8/c1-11(2)19-15-7-13(5)21(27(35)23(15)17(9-31)25(33)29(19)37)22-14(6)8-16-20(12(3)4)30(38)26(34)18(10-32)24(16)28(22)36/h7-12,33-38H,1-6H3" |
| Standard InCHIKey:   | QBKSWRVVCFFDOT-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7422Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC68441 |
| High Similarity | 1.0 | NPC611885 |
| Intermediate Similarity | 0.75 | NPC207725 |
| Intermediate Similarity | 0.75 | NPC94269 |
| Remote Similarity | 0.6136 | NPC141368 |
| Remote Similarity | 0.6042 | NPC141574 |
| Molecular Weight   | 518.19 |
| ALogP   | -0.7168 |
| MLogP   | 3.88 |
| XLogP   | 5.51 |
| HDA   | 2 |
| HBD   | 6 |
| Rotatable Bonds   | 17 |
| TPSA   | 155.52 |
| RO5 Violation   | 2 |