NPASS drugs

Drug Information

Drug ID:	NPD1529
Drug Name:
Molecular Formula:	C15H11O6
Canonical SMILES:	Oc1cc(O)c2c(c1)[o+]c(c(c2)O)c1ccc(c(c1)O)O
Standard InCHI:	"InChI=1S/C15H11O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-6,16-20H/q+1"
Standard InCHIKey:	JHIVGRFLVWGSMI-UHFFFAOYSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD1529

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	179150
0.1-0.2	31584
0.2-0.3	829
0.3-0.4	133
0.4-0.5	18
0.5-0.6	11
0.6-0.7	9
0.7-0.8	4
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC46274
High Similarity	0.9722	NPC608792
Intermediate Similarity	0.7895	NPC190454
Intermediate Similarity	0.7692	NPC5447
Intermediate Similarity	0.7692	NPC609332
Intermediate Similarity	0.75	NPC601833
Remote Similarity	0.6429	NPC508582
Remote Similarity	0.6429	NPC578454
Remote Similarity	0.6429	NPC601663
Remote Similarity	0.6429	NPC602237
Remote Similarity	0.6279	NPC573080
Remote Similarity	0.6222	NPC250432
Remote Similarity	0.6122	NPC86655
Remote Similarity	0.6047	NPC538251
Remote Similarity	0.6	NPC489875
Remote Similarity	0.5625	NPC226331
Remote Similarity	0.5625	NPC127624
Remote Similarity	0.551	NPC292198
Remote Similarity	0.551	NPC554051
Remote Similarity	0.551	NPC608257
Remote Similarity	0.5333	NPC535376
Remote Similarity	0.5333	NPC586832
Remote Similarity	0.5333	NPC595643
Remote Similarity	0.5227	NPC586445
Remote Similarity	0.5217	NPC516795
Remote Similarity	0.5217	NPC527617

Drug Structure

NPD1529 OpenBabel08211701082D 26 28 0 0 0 0 0 0 0 0999 V2000 -1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 -2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 3.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 7 1 0 0 0 0 2 10 1 0 0 0 0 3 7 2 0 0 0 0 3 12 1 0 0 0 0 4 8 1 0 0 0 0 4 11 2 0 0 0 0 5 8 2 0 0 0 0 5 14 1 0 0 0 0 6 9 2 0 0 0 0 6 13 1 0 0 0 0 7 15 1 0 0 0 0 8 16 1 0 0 0 0 9 11 1 0 0 0 0 9 14 1 0 0 0 0 10 12 2 0 0 0 0 10 17 1 0 0 0 0 11 18 1 0 0 0 0 12 19 1 0 0 0 0 13 15 2 0 0 0 0 13 20 1 0 0 0 0 14 21 2 0 0 0 0 15 21 1 0 0 0 0 16 22 1 0 0 0 0 17 23 1 0 0 0 0 18 24 1 0 0 0 0 19 25 1 0 0 0 0 20 26 1 0 0 0 0 M CHG 1 21 1 M END $$$$

External Identifiers

TTD	DIB016752
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	68247
ChEBI
CAS Number

Drug Properties

Molecular Weight	288.06
ALogP	-2.3015
MLogP	2.45
XLogP	0.742
HDA	1
HBD	6
Rotatable Bonds	6
TPSA	101.15
RO5 Violation	1