Drug Information| Drug ID:   | NPD3028 |
| Drug Name:   | Diethylstilbestrol Diphosphate |
| Molecular Formula:   | C18H22O8P2 |
| Canonical SMILES:   | CC/C(=C(c1ccc(cc1)OP(=O)(O)O)/CC)/c1ccc(cc1)OP(=O)(O)O |
| Standard InCHI:   | "InChI=1S/C18H22O8P2/c1-3-17(13-5-9-15(10-6-13)25-27(19,20)21)18(4-2)14-7-11-16(12-8-14)26-28(22,23)24/h5-12H,3-4H2,1-2H3,(H2,19,20,21)(H2,22,23,24)/b18-17+" |
| Standard InCHIKey:   | NLORYLAYLIXTID-ISLYRVAYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3028Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNAP001648 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 3032325 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 428.08 |
| ALogP   | -0.1018 |
| MLogP   | 2.34 |
| XLogP   | 3.204 |
| HDA   | 6 |
| HBD   | 4 |
| Rotatable Bonds   | 14 |
| TPSA   | 153.14 |
| RO5 Violation   | 0 |