NPASS Compound

Natural Product: NPC543112

Natural Product ID	NPC543112
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{S},4~{S},5~{R},6~{R})-6-[[(3~{S},4~{a}~{R},6~{a}~{S},6~{b}~{R},8~{S},8~{a}~{S},12~{a}~{S},14~{a}~{S},14~{b}~{R})-8-hydroxy-4,4,6~{a},6~{b},11,11,14~{b}-heptamethyl-8~{a}-[(2~{S},3~{R},4~{R},5~{S})-3,4,5-trihydroxytetrahydropyran-2-yl]oxycarbonyl-1,2,3,4~{a},5,6,7,8,9,10,12,12~{a},14,14~{a}-tetradecahydropicen-3-yl]oxy]-3,5-dihydroxy-4-[(2~{S},3~{R},4~{R},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-carboxylic acid
IUPAC Name	(2~{S},3~{S},4~{S},5~{R},6~{R})-6-[[(3~{S},4~{a}~{R},6~{a}~{S},6~{b}~{R},8~{S},8~{a}~{S},12~{a}~{S},14~{a}~{S},14~{b}~{R})-8-hydroxy-4,4,6~{a},6~{b},11,11,14~{b}-heptamethyl-8~{a}-[(2~{S},3~{R},4~{R},5~{S})-3,4,5-trihydroxytetrahydropyran-2-yl]oxycarbonyl-1,2,3,4~{a},5,6,7,8,9,10,12,12~{a},14,14~{a}-tetradecahydropicen-3-yl]oxy]-3,5-dihydroxy-4-[(2~{S},3~{R},4~{R},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 140147 0 0 0 0 0 0 0 0999 V2000 7.1680 -3.2494 -0.8072 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7277 -1.9583 -1.4867 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6824 -2.2920 -2.9857 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7556 -0.9292 -1.2338 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2870 0.4757 -1.1809 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9557 0.6514 -0.4564 C 0 0 1 0 0 0 0 0 0 0 0 0 6.1937 0.2250 0.9454 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5287 -0.6115 1.5718 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2586 0.7815 1.6931 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5101 0.3881 3.0206 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5300 1.3883 3.9488 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4071 0.8337 5.2191 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1700 -0.4295 5.4312 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5750 -0.5861 6.7392 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3134 -0.5937 4.4433 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8890 -1.8489 4.5913 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8609 -0.3033 3.0334 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8126 -1.5323 2.3607 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5383 2.0950 -0.4783 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4298 2.7824 -1.3284 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1256 2.4633 -0.6254 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2734 1.5059 -1.4734 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8750 1.6744 -2.8601 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6453 0.2067 -0.8958 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9043 -0.5047 -0.1172 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5620 0.0328 0.2272 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0428 0.6166 -1.0753 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4353 0.5500 -1.1632 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7574 -0.9354 -1.2154 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2124 1.0927 0.0168 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3862 1.9526 -0.3894 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1804 1.4176 -1.5526 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9671 0.3664 -1.1522 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3167 0.6230 -1.2452 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8583 0.8899 0.0465 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9904 1.7050 -0.1157 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8255 1.6976 1.1071 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8838 2.3699 1.1257 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5011 0.9786 2.2513 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8699 1.2069 -1.2639 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6378 1.8861 -2.4439 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5951 -0.2770 -1.3588 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7037 -0.7646 -0.0460 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6792 -1.7642 0.0524 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.7228 -1.3059 0.8601 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1467 -2.2762 1.7709 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.3017 -1.6652 2.5343 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8076 -0.5007 3.1577 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0496 -2.5897 2.7575 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.9899 -1.5523 3.6799 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7230 -2.8279 2.0663 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1316 -3.9706 2.5818 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9994 -2.9811 0.5855 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6399 -4.1682 0.2692 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1557 -0.4633 -1.8192 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2055 -0.3979 -3.2169 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3247 1.1374 -2.7866 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5780 2.3425 -3.7371 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7070 -0.0574 -3.5560 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9210 1.3105 -2.3554 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1561 1.3163 -3.3481 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2966 2.2036 -2.8663 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7993 1.8414 -1.4598 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5030 3.0318 -0.5894 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0261 -0.2484 -1.2031 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3358 -1.6633 -0.9800 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0084 -3.2399 0.2824 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7009 -4.1498 -1.2761 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2699 -3.4120 -0.9623 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3043 -3.3165 -3.0664 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6721 -2.1065 -3.4188 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9561 -1.6392 -3.5083 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3754 -1.1731 -0.3207 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5143 -0.9990 -2.0686 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0824 1.0820 -0.6581 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1858 0.9616 -2.1749 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7573 -0.3985 3.3212 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3561 0.6507 5.5225 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7953 1.5667 5.9852 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4708 -1.2857 5.2135 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5453 -0.7883 6.8545 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0807 0.1581 4.7137 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7238 -1.9144 4.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5902 0.3561 2.5367 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6925 -1.7677 1.9570 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8785 2.5122 0.5265 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2063 3.7308 -1.4305 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6452 2.5282 0.3455 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1349 3.4306 -1.2171 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6695 0.8814 -3.5604 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0004 1.6739 -2.7268 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7366 2.7238 -3.2283 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2230 -1.4407 0.2775 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6161 0.8066 1.0236 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8671 -0.7208 0.5773 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4189 -0.1289 -1.8651 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8981 -1.2357 -0.1253 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1029 -1.5580 -1.5257 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6983 -1.1933 -1.6718 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5988 1.6695 0.7353 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6568 0.2624 0.6406 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1190 1.9322 0.4776 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1260 3.0269 -0.4717 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9191 2.2488 -1.7991 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4374 1.6195 -1.7477 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7381 2.7535 -0.3481 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0112 1.1053 3.1250 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9368 1.3345 -0.9877 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1552 1.4349 -3.1531 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3129 -0.7452 -2.0231 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1472 -1.9940 -0.9290 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5296 -3.1843 1.2636 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1354 -1.3794 1.8810 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6288 -2.3486 3.3690 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1079 0.3137 2.6430 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3620 -3.5027 3.3144 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3502 -1.7797 4.5655 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0641 -1.9451 2.1889 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1663 -3.9061 3.5901 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9913 -3.0526 0.0856 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2723 -4.8976 0.8520 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7822 -1.4294 -1.4665 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7188 -1.1745 -3.5043 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8967 3.1649 -3.5547 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3939 2.0010 -4.7929 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6072 2.6852 -3.7031 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8551 -0.6785 -3.9463 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2321 0.2167 -4.5299 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5000 -0.6909 -3.0692 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9658 2.3996 -1.9852 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5658 0.3292 -3.6400 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2091 1.7853 -4.2862 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9353 3.2476 -2.9253 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0313 2.0799 -3.6526 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2625 3.8554 -0.7030 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5712 3.5710 -0.8041 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6086 2.7801 0.5059 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1527 -0.1168 -2.3328 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6612 -2.3002 -1.6547 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2195 -2.0782 0.0293 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 1 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 6 19 1 0 19 20 1 0 19 21 1 0 21 22 1 0 22 23 1 6 22 24 1 0 24 25 2 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 6 28 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 37 39 1 0 36 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 49 50 1 0 49 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 42 55 1 0 55 56 1 0 32 57 1 0 57 58 1 0 57 59 1 0 57 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 1 24 65 1 0 65 66 1 0 66 2 1 0 65 6 1 0 17 10 1 0 63 22 1 0 63 27 1 0 60 28 1 0 55 34 1 0 53 44 1 0 1 67 1 0 1 68 1 0 1 69 1 0 3 70 1 0 3 71 1 0 3 72 1 0 4 73 1 0 4 74 1 0 5 75 1 0 5 76 1 0 10 77 1 1 12 78 1 0 12 79 1 0 13 80 1 6 14 81 1 0 15 82 1 1 16 83 1 0 17 84 1 6 18 85 1 0 19 86 1 1 20 87 1 0 21 88 1 0 21 89 1 0 23 90 1 0 23 91 1 0 23 92 1 0 25 93 1 0 26 94 1 0 26 95 1 0 27 96 1 6 29 97 1 0 29 98 1 0 29 99 1 0 30100 1 0 30101 1 0 31102 1 0 31103 1 0 32104 1 6 34105 1 6 36106 1 6 39107 1 0 40108 1 1 41109 1 0 42110 1 6 44111 1 6 46112 1 6 47113 1 0 47114 1 0 48115 1 0 49116 1 1 50117 1 0 51118 1 6 52119 1 0 53120 1 6 54121 1 0 55122 1 6 56123 1 0 58124 1 0 58125 1 0 58126 1 0 59127 1 0 59128 1 0 59129 1 0 60130 1 1 61131 1 0 61132 1 0 62133 1 0 62134 1 0 64135 1 0 64136 1 0 64137 1 0 65138 1 6 66139 1 0 66140 1 0 M END

Standard InCHIKey	ZBFWUMXEYXZRLW-XVNHWKHJSA-N
Standard InCHI	InChI=1S/C47H74O19/c1-42(2)14-15-47(41(60)66-38-31(54)28(51)22(49)19-61-38)21(16-42)20-8-9-25-44(5)12-11-27(43(3,4)24(44)10-13-45(25,6)46(20,7)17-26(47)50)63-40-34(57)35(33(56)36(65-40)37(58)59)64-39-32(55)30(53)29(52)23(18-48)62-39/h8,21-36,38-40,48-57H,9-19H2,1-7H3,(H,58,59)/t21-,22-,23+,24-,25-,26-,27-,28+,29-,30+,31+,32+,33-,34+,35-,36-,38-,39-,40+,44-,45-,46-,47-/m0/s1
SMILES	CC1(C)CC[C@@]2(C(=O)O[C@@H]3OC[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)C[C@@]3(C)C(=CC[C@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](C(=O)O)[C@@H](O)[C@H](O[C@@H]7O[C@H](CO)[C@H](O)[C@@H](O)[C@H]7O)[C@H]6O)C(C)(C)[C@@H]5CC[C@@]43C)[C@@H]2C1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	942.48	Volume:	912.121 ? Van der Waals volume.
Dense:	1.033	LogP:	1.195 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.25 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.611 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	46.0
TPSA:	312.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.086	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.378	Fsp³:	0.915
MCE-18:	177.778 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.784	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.171	Promiscuous compounds:	0.125

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.385	MDCK Permeability:	-5.138
Pgp-inhibitor:	0.0	Pgp-substrate:	0.771
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.545
20% Bioavailability (F20%):	0.685	30% Bioavailability (F30%):	0.794
50% Bioavailability (F50%):	0.995

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.979
Plasma Protein Binding (PPB):	71.293%	Volume Distribution (VD):	-0.42
Fu:	21.225% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.995
OATP1B3 inhibitor:	0.623	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.001	CYP3A4-substrate:	0.998
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.154
HLM stability:	0.231 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.028

Half-life (T1/2):

3.426

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.003
Human Hepatotoxicity (H-HT):	0.617	Drug-induced Liver Injury (DILI):	0.743
AMES Toxicity:	0.824	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.006	Skin Sensitization:	1.0
Carcinogencity:	0.056	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.511	Drug-induced Nephrotoxicity:	0.991
Genotoxicity:	0.186	RPMI-8226 Immunitoxicity:	0.131
A549 Cytotoxicity:	0.196	Hek293 Cytotoxicity:	0.062
BCF:	0.593 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.566 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.288 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.138 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO42958	Tragopogon pratensis	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC543112 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20790
0.1-0.2	24434
0.2-0.3	3337
0.3-0.4	712
0.4-0.5	331
0.5-0.6	153
0.6-0.7	36
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9592	High Similarity	NPC11242
0.8692	High Similarity	NPC4749
0.844	Intermediate Similarity	NPC21691
0.8229	Intermediate Similarity	NPC1046
0.7759	Intermediate Similarity	NPC302543
0.7692	Intermediate Similarity	NPC159309
0.7692	Intermediate Similarity	NPC86222
0.7679	Intermediate Similarity	NPC283417
0.7679	Intermediate Similarity	NPC200049
0.7477	Intermediate Similarity	NPC64715
0.7407	Intermediate Similarity	NPC114484
0.6881	Remote Similarity	NPC164389
0.6814	Remote Similarity	NPC477193
0.6807	Remote Similarity	NPC85154
0.6754	Remote Similarity	NPC104137
0.6754	Remote Similarity	NPC26626
0.6754	Remote Similarity	NPC187290
0.6667	Remote Similarity	NPC123522
0.6579	Remote Similarity	NPC301449
0.6579	Remote Similarity	NPC601290
0.6514	Remote Similarity	NPC157868
0.6429	Remote Similarity	NPC44716
0.6423	Remote Similarity	NPC286457
0.6372	Remote Similarity	NPC475591
0.6372	Remote Similarity	NPC236870
0.6364	Remote Similarity	NPC6377
0.6364	Remote Similarity	NPC208381
0.633	Remote Similarity	NPC475516
0.6325	Remote Similarity	NPC477194
0.6293	Remote Similarity	NPC477191
0.624	Remote Similarity	NPC475514
0.6218	Remote Similarity	NPC477196
0.6207	Remote Similarity	NPC281148
0.616	Remote Similarity	NPC265841
0.614	Remote Similarity	NPC40775
0.614	Remote Similarity	NPC251768
0.614	Remote Similarity	NPC488526
0.6136	Remote Similarity	NPC33012
0.6134	Remote Similarity	NPC477195
0.6126	Remote Similarity	NPC480420
0.6124	Remote Similarity	NPC220160
0.6121	Remote Similarity	NPC302887
0.6106	Remote Similarity	NPC192791
0.6102	Remote Similarity	NPC160452
0.6098	Remote Similarity	NPC602995
0.6061	Remote Similarity	NPC8524
0.6032	Remote Similarity	NPC13998
0.5985	Remote Similarity	NPC489209
0.5984	Remote Similarity	NPC470876
0.5965	Remote Similarity	NPC223301
0.5965	Remote Similarity	NPC171544
0.5946	Remote Similarity	NPC603870
0.5932	Remote Similarity	NPC104372
0.5929	Remote Similarity	NPC473884
0.5917	Remote Similarity	NPC481078
0.5913	Remote Similarity	NPC117714
0.5913	Remote Similarity	NPC30289
0.5906	Remote Similarity	NPC473452
0.5906	Remote Similarity	NPC488308
0.5877	Remote Similarity	NPC469946
0.5868	Remote Similarity	NPC480936
0.5859	Remote Similarity	NPC271610
0.5859	Remote Similarity	NPC312650
0.5856	Remote Similarity	NPC475208
0.5847	Remote Similarity	NPC603832
0.5846	Remote Similarity	NPC309223
0.5841	Remote Similarity	NPC114441
0.5839	Remote Similarity	NPC489208
0.5833	Remote Similarity	NPC69811
0.5833	Remote Similarity	NPC477192
0.5826	Remote Similarity	NPC242840
0.5818	Remote Similarity	NPC90856
0.5818	Remote Similarity	NPC214484
0.5789	Remote Similarity	NPC39211
0.5776	Remote Similarity	NPC605226
0.5748	Remote Similarity	NPC481080
0.5734	Remote Similarity	NPC475584
0.5734	Remote Similarity	NPC475152
0.5725	Remote Similarity	NPC476991
0.5724	Remote Similarity	NPC485563
0.5714	Remote Similarity	NPC48499
0.5704	Remote Similarity	NPC475394
0.5702	Remote Similarity	NPC173583
0.5691	Remote Similarity	NPC25998
0.569	Remote Similarity	NPC75417
0.5672	Remote Similarity	NPC102505
0.5672	Remote Similarity	NPC488514
0.5656	Remote Similarity	NPC207738
0.5645	Remote Similarity	NPC609119
0.5639	Remote Similarity	NPC488309
0.5635	Remote Similarity	NPC123199
0.563	Remote Similarity	NPC297263
0.5625	Remote Similarity	NPC478597
0.562	Remote Similarity	NPC481079
0.5614	Remote Similarity	NPC235405
0.561	Remote Similarity	NPC815
0.5606	Remote Similarity	NPC33068
0.5603	Remote Similarity	NPC263756
0.5603	Remote Similarity	NPC213674
0.5593	Remote Similarity	NPC305267
0.5573	Remote Similarity	NPC484059
0.5573	Remote Similarity	NPC484060
0.5573	Remote Similarity	NPC476779
0.5565	Remote Similarity	NPC249848
0.5565	Remote Similarity	NPC107966
0.5556	Remote Similarity	NPC284449
0.5556	Remote Similarity	NPC112352
0.5547	Remote Similarity	NPC25663
0.5546	Remote Similarity	NPC235438
0.5545	Remote Similarity	NPC128925
0.5541	Remote Similarity	NPC23020
0.554	Remote Similarity	NPC475368
0.5538	Remote Similarity	NPC478596
0.5536	Remote Similarity	NPC204458
0.5536	Remote Similarity	NPC238935
0.5528	Remote Similarity	NPC31838
0.5522	Remote Similarity	NPC482010
0.5517	Remote Similarity	NPC295371
0.5512	Remote Similarity	NPC257211
0.5508	Remote Similarity	NPC30735
0.5505	Remote Similarity	NPC31839
0.5495	Remote Similarity	NPC480937
0.5476	Remote Similarity	NPC79643
0.547	Remote Similarity	NPC76497
0.5469	Remote Similarity	NPC470218
0.5462	Remote Similarity	NPC232237
0.5462	Remote Similarity	NPC180550
0.5462	Remote Similarity	NPC35405
0.5455	Remote Similarity	NPC242611
0.5431	Remote Similarity	NPC58448
0.5426	Remote Similarity	NPC488560
0.542	Remote Similarity	NPC476774
0.542	Remote Similarity	NPC476780
0.5417	Remote Similarity	NPC105800
0.5417	Remote Similarity	NPC63159
0.5414	Remote Similarity	NPC481081
0.5413	Remote Similarity	NPC48249
0.5407	Remote Similarity	NPC484063
0.5407	Remote Similarity	NPC484064
0.5407	Remote Similarity	NPC142151
0.5407	Remote Similarity	NPC267694
0.5407	Remote Similarity	NPC51564
0.5403	Remote Similarity	NPC475486
0.5392	Remote Similarity	NPC488520
0.5385	Remote Similarity	NPC71391
0.5385	Remote Similarity	NPC488516
0.5385	Remote Similarity	NPC329828
0.5379	Remote Similarity	NPC258617
0.5373	Remote Similarity	NPC144644
0.5373	Remote Similarity	NPC37860
0.5373	Remote Similarity	NPC170407
0.5366	Remote Similarity	NPC23275
0.536	Remote Similarity	NPC477197
0.5351	Remote Similarity	NPC78046
0.5349	Remote Similarity	NPC475160
0.5349	Remote Similarity	NPC191827
0.5349	Remote Similarity	NPC473714
0.5344	Remote Similarity	NPC484061
0.5344	Remote Similarity	NPC484062
0.5339	Remote Similarity	NPC80843
0.5339	Remote Similarity	NPC475171
0.5339	Remote Similarity	NPC22956
0.5323	Remote Similarity	NPC295823
0.5323	Remote Similarity	NPC174720
0.5323	Remote Similarity	NPC475467
0.5321	Remote Similarity	NPC606107
0.5317	Remote Similarity	NPC470475
0.5317	Remote Similarity	NPC213952
0.5299	Remote Similarity	NPC110700
0.5299	Remote Similarity	NPC476777
0.529	Remote Similarity	NPC51099
0.5288	Remote Similarity	NPC488522
0.5276	Remote Similarity	NPC475287
0.5276	Remote Similarity	NPC610204
0.5271	Remote Similarity	NPC166422
0.5271	Remote Similarity	NPC470476
0.5255	Remote Similarity	NPC250247
0.5246	Remote Similarity	NPC222580
0.5242	Remote Similarity	NPC324875
0.5242	Remote Similarity	NPC292677
0.5242	Remote Similarity	NPC291903
0.5231	Remote Similarity	NPC475140
0.5227	Remote Similarity	NPC470518
0.5227	Remote Similarity	NPC476068
0.5221	Remote Similarity	NPC70809
0.5221	Remote Similarity	NPC209894
0.5221	Remote Similarity	NPC476775
0.5217	Remote Similarity	NPC68767
0.5217	Remote Similarity	NPC293031
0.5217	Remote Similarity	NPC476776
0.5214	Remote Similarity	NPC485562
0.5207	Remote Similarity	NPC11551
0.5207	Remote Similarity	NPC46665
0.5207	Remote Similarity	NPC2370
0.5203	Remote Similarity	NPC79718
0.5197	Remote Similarity	NPC185466
0.5197	Remote Similarity	NPC288205
0.5197	Remote Similarity	NPC51465
0.5191	Remote Similarity	NPC47995
0.5189	Remote Similarity	NPC488524

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC543112 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6463
0.1-0.2	2620
0.2-0.3	62
0.3-0.4	4
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5478	Remote Similarity	NPD8295	Clinical (unspecified phase)

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data