NPASS Compound

Natural Product: NPC326474

Natural Product ID	NPC326474
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NFZYDZXHKFHPGA-BRDNLJJOSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	5317608
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 143150 0 0 0 0 0 0 0 0999 V2000 6.5020 0.5843 -3.9901 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0916 0.1437 -3.6950 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9020 -1.3173 -3.9411 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2251 -2.2409 -2.8312 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8747 -1.6572 -1.4348 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3346 -2.7312 -0.5476 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8745 -2.5793 -0.3018 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5716 -1.2613 0.3630 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9180 -0.2387 -0.6667 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2717 0.8922 -0.6117 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2299 1.2355 0.3803 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7854 0.1704 1.2985 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1020 -1.1985 0.7767 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2958 -1.4232 -0.4746 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1028 -0.9280 -0.3887 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5473 -0.5907 1.0200 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6594 0.3921 1.6941 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0928 1.8061 1.5853 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1618 2.2100 0.6690 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1519 1.1741 0.2776 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9863 -0.1339 0.9237 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6805 -0.1690 2.2611 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7073 -1.1887 0.0618 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4136 1.7092 0.6835 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2052 1.9965 -0.4146 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6309 1.6358 -0.3373 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3337 2.3319 -1.5308 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2851 2.6128 -2.5811 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2247 3.5395 -2.0449 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1201 3.4181 -0.6732 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3513 4.9119 -2.5383 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3554 5.8931 -1.7814 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4707 5.0957 -3.9086 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8758 3.1599 -3.7275 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8297 3.5744 -1.1319 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9004 0.2919 -0.4467 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8145 -0.1249 0.5164 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0821 -0.5645 -0.2204 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4390 -1.9875 0.1630 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4295 -2.1664 1.6678 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1437 -1.6423 2.2203 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2957 -1.1434 1.2602 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4427 -2.7976 2.9203 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3180 -3.3104 3.9049 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6117 -3.5362 1.9647 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5879 -2.8932 -0.4413 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1568 0.2744 0.0536 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7171 0.0493 3.2096 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9232 -2.3219 1.7433 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9214 -0.5626 -1.7103 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6701 0.5809 -2.2812 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3580 -0.9782 1.5928 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1971 -1.2227 -0.8993 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2783 -1.3676 -1.5407 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3159 -0.6356 0.3354 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5423 -0.2089 0.8864 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9397 -1.0692 2.0857 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4373 -0.8833 2.2112 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7854 0.5617 2.2276 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9103 1.4780 1.4533 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5985 1.0872 1.2963 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5039 1.8930 0.1220 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8263 2.2833 0.3237 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9880 0.9978 3.5554 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8217 -1.4839 3.4142 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3613 -0.5375 3.2424 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1783 0.8455 -4.7159 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0201 -0.2824 -4.4666 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0153 0.9154 -3.0699 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5161 1.4246 -4.7357 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6052 -1.5671 -4.7955 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8917 -1.5508 -4.3979 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5760 -3.1467 -2.9165 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2590 -2.6277 -2.8435 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9576 -2.8795 0.3505 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4473 -3.7094 -1.1077 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4777 -3.4685 0.1593 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3923 -2.5170 -1.3211 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5220 1.6429 -1.3677 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6677 2.0902 0.9721 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3819 1.6346 -0.2645 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4021 0.2949 2.2424 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3455 -2.5396 -0.6510 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7946 -0.9177 -1.3215 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3234 -0.0685 -1.0911 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7601 -1.7457 -0.7491 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5771 -1.5237 1.5953 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4352 2.1309 2.6426 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2476 2.5240 1.4095 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6850 3.1622 1.0328 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6917 2.6024 -0.2902 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1513 1.1098 -0.8479 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4420 0.6995 2.9033 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7922 -0.0823 2.0477 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5723 -1.1515 2.7312 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7739 -1.1862 0.3481 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3552 -2.2177 0.3742 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6310 -0.9932 -1.0033 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6853 1.5837 -1.2926 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1659 2.0677 0.5603 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1462 1.7254 -1.9381 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8756 1.6351 -2.9085 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2411 3.1514 -2.4518 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1654 5.9583 -4.3715 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7372 2.7440 -3.9497 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6164 3.5156 -0.5652 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1221 0.7038 1.1691 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9260 -0.5534 -1.3157 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4650 -2.1774 -0.2112 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2687 -1.6144 2.1484 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3477 -0.9011 3.0251 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2773 -3.5977 2.2008 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5362 -2.4503 3.4556 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0210 -2.6675 4.0981 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7676 -4.0335 1.1112 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1174 -2.4996 -1.1929 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9160 -0.0611 -0.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2409 0.8813 3.7745 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2976 0.0733 3.6575 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3212 -0.8260 3.4153 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5530 -2.0753 2.7337 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2904 -3.1139 1.2359 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8751 -2.8906 1.9776 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2601 -0.9388 -2.5667 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6135 0.7966 -1.6999 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1713 1.5277 -2.4059 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7116 0.0723 1.6687 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7506 -1.1410 2.5388 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2384 -1.6348 1.7508 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3206 -0.4279 0.1188 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6660 -2.1360 1.9293 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9291 -1.4510 1.3877 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8164 0.6472 1.7651 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8576 2.4405 2.0515 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9431 2.8061 -0.2186 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5002 1.0954 -0.6383 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4071 1.9329 -0.3994 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7829 0.4775 3.9002 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2757 -1.0711 4.1287 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5736 -1.0574 3.5379 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3778 0.3779 -5.7048 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1433 0.5558 -4.4397 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3607 1.9227 -4.7247 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 20 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 2 0 31 33 1 0 28 34 1 0 27 35 1 0 26 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 40 45 1 0 39 46 1 0 38 47 1 0 17 48 1 0 13 49 1 0 9 50 1 0 50 51 1 0 8 52 1 0 5 53 1 0 53 54 2 0 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 59 64 1 0 58 65 1 0 57 66 1 0 2 67 1 0 51 2 1 0 50 5 1 0 13 8 1 0 17 12 1 0 21 16 1 0 30 25 1 0 42 37 1 0 61 56 1 0 1 68 1 0 1 69 1 0 1 70 1 0 3 71 1 0 3 72 1 0 4 73 1 0 4 74 1 0 6 75 1 0 6 76 1 0 7 77 1 0 7 78 1 0 10 79 1 0 11 80 1 0 11 81 1 0 12 82 1 0 14 83 1 0 14 84 1 0 15 85 1 0 15 86 1 0 16 87 1 0 18 88 1 0 18 89 1 0 19 90 1 0 19 91 1 0 20 92 1 0 22 93 1 0 22 94 1 0 22 95 1 0 23 96 1 0 23 97 1 0 23 98 1 0 25 99 1 0 26100 1 0 27101 1 0 28102 1 0 29103 1 0 33104 1 0 34105 1 0 35106 1 0 37107 1 0 38108 1 0 39109 1 0 40110 1 0 41111 1 0 43112 1 0 43113 1 0 44114 1 0 45115 1 0 46116 1 0 47117 1 0 48118 1 0 48119 1 0 48120 1 0 49121 1 0 49122 1 0 49123 1 0 50124 1 0 51125 1 0 51126 1 0 52127 1 0 52128 1 0 52129 1 0 56130 1 0 57131 1 0 58132 1 0 59133 1 0 60134 1 0 62135 1 0 62136 1 0 63137 1 0 64138 1 0 65139 1 0 66140 1 0 67141 1 0 67142 1 0 67143 1 0 M END

Standard InCHIKey	NFZYDZXHKFHPGA-BRDNLJJOSA-N
Standard InCHI	InChI=1S/C48H76O19/c1-43(2)14-16-48(42(61)67-40-35(58)31(54)29(52)24(20-50)63-40)17-15-46(6)21(22(48)18-43)8-9-26-45(5)12-11-27(44(3,4)25(45)10-13-47(26,46)7)64-41-37(33(56)32(55)36(65-41)38(59)60)66-39-34(57)30(53)28(51)23(19-49)62-39/h8,22-37,39-41,49-58H,9-20H2,1-7H3,(H,59,60)/t22?,23-,24-,25?,26?,27?,28-,29-,30+,31+,32+,33+,34-,35-,36+,37-,39+,40+,41-,45?,46?,47?,48?/m1/s1
SMILES	CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)C(=O)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)C2C1)C)C(=O)OC8C(C(C(C(O8)CO)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	956.5	Volume:	929.417 ? Van der Waals volume.
Dense:	1.029	LogP:	1.367 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.46 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.342 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	46.0
TPSA:	312.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.084	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.295	Fsp³:	0.917
MCE-18:	176.696 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.065	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.346 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.223	Promiscuous compounds:	0.001

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.429	MDCK Permeability:	-5.036
Pgp-inhibitor:	0.0	Pgp-substrate:	0.063
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.997
20% Bioavailability (F20%):	0.109	30% Bioavailability (F30%):	0.988
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	1.0
Plasma Protein Binding (PPB):	55.546%	Volume Distribution (VD):	-0.357
Fu:	23.879% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.019	BCRP inhibitor:	0.0
BSEP inhibitor:	0.006

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.609	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.069	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.011
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.158

Half-life (T1/2):

3.584

ADMET: Toxicity

hERG Blockers:	0.005	hERG Blockers (10um):	0.062
Human Hepatotoxicity (H-HT):	0.428	Drug-induced Liver Injury (DILI):	0.311
AMES Toxicity:	0.086	Rat Oral Acute Toxicity:	0.096
Maximum Recommended Daily Dose:	0.244	Skin Sensitization:	0.023
Carcinogencity:	0.008	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.081	Ototoxicity:	1.0
Hematotoxicity:	0.015	Drug-induced Nephrotoxicity:	0.065
Genotoxicity:	0.004	RPMI-8226 Immunitoxicity:	0.044
A549 Cytotoxicity:	0.011	Hek293 Cytotoxicity:	0.303
BCF:	0.616 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.353 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.402 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.414 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO15077	Achyranthes bidentata	Species	Amaranthaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11430011]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12350149]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[28006911]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28202328]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29812	Panax quinquefolium	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15077	Achyranthes bidentata	Species	Amaranthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29812	Panax quinquefolium	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO15077	Achyranthes bidentata	Species	Amaranthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO15077	Achyranthes bidentata	Species	Amaranthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO15077	Achyranthes bidentata	Species	Amaranthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29812	Panax quinquefolium	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO30575	Panax bipinnatifidum	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO15077	Achyranthes bidentata	Species	Amaranthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO15077	Achyranthes bidentata	Species	Amaranthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC326474 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21181
0.1-0.2	24047
0.2-0.3	3228
0.3-0.4	721
0.4-0.5	331
0.5-0.6	96
0.6-0.7	73
0.7-0.8	0
0.8-0.85	5
0.85-0.9	1
0.9-0.95	2
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC251768
0.9255	High Similarity	NPC301449
0.9255	High Similarity	NPC601290
0.8913	High Similarity	NPC192791
0.8495	Intermediate Similarity	NPC157868
0.8265	Intermediate Similarity	NPC64715
0.8247	Intermediate Similarity	NPC475591
0.8247	Intermediate Similarity	NPC236870
0.8224	Intermediate Similarity	NPC258617
0.7959	Intermediate Similarity	NPC159309
0.7959	Intermediate Similarity	NPC86222
0.7941	Intermediate Similarity	NPC187290
0.7925	Intermediate Similarity	NPC470218
0.7778	Intermediate Similarity	NPC40775
0.7732	Intermediate Similarity	NPC473884
0.7653	Intermediate Similarity	NPC469946
0.7647	Intermediate Similarity	NPC114484
0.7576	Intermediate Similarity	NPC242840
0.7576	Intermediate Similarity	NPC112352
0.7525	Intermediate Similarity	NPC63159
0.75	Intermediate Similarity	NPC48499
0.7476	Intermediate Similarity	NPC281148
0.7292	Intermediate Similarity	NPC214484
0.7282	Intermediate Similarity	NPC222580
0.7282	Intermediate Similarity	NPC297263
0.72	Intermediate Similarity	NPC472949
0.7172	Intermediate Similarity	NPC235405
0.71	Intermediate Similarity	NPC249848
0.71	Intermediate Similarity	NPC107966
0.7059	Intermediate Similarity	NPC75417
0.7	Intermediate Similarity	NPC475516
0.699	Remote Similarity	NPC30735
0.6944	Remote Similarity	NPC31838
0.6944	Remote Similarity	NPC481078
0.6923	Remote Similarity	NPC10607
0.6923	Remote Similarity	NPC46665
0.6907	Remote Similarity	NPC209894
0.6893	Remote Similarity	NPC223301
0.6893	Remote Similarity	NPC171544
0.6863	Remote Similarity	NPC39211
0.6847	Remote Similarity	NPC79643
0.6814	Remote Similarity	NPC283417
0.6814	Remote Similarity	NPC200049
0.6762	Remote Similarity	NPC480475
0.6759	Remote Similarity	NPC481079
0.6726	Remote Similarity	NPC135904
0.6698	Remote Similarity	NPC235438
0.6698	Remote Similarity	NPC118440
0.6697	Remote Similarity	NPC480473
0.6697	Remote Similarity	NPC480474
0.6604	Remote Similarity	NPC11551
0.66	Remote Similarity	NPC90856
0.6596	Remote Similarity	NPC167383
0.6579	Remote Similarity	NPC123199
0.6545	Remote Similarity	NPC187618
0.6545	Remote Similarity	NPC80986
0.6514	Remote Similarity	NPC114692
0.6514	Remote Similarity	NPC247315
0.6514	Remote Similarity	NPC482728
0.6514	Remote Similarity	NPC104372
0.6481	Remote Similarity	NPC31193
0.6481	Remote Similarity	NPC131469
0.646	Remote Similarity	NPC60557
0.646	Remote Similarity	NPC67857
0.6458	Remote Similarity	NPC237503
0.6422	Remote Similarity	NPC95437
0.6422	Remote Similarity	NPC302887
0.641	Remote Similarity	NPC4749
0.6396	Remote Similarity	NPC120116
0.6396	Remote Similarity	NPC160452
0.6387	Remote Similarity	NPC41061
0.6387	Remote Similarity	NPC227551
0.6381	Remote Similarity	NPC295371
0.6364	Remote Similarity	NPC236657
0.6356	Remote Similarity	NPC21691
0.6346	Remote Similarity	NPC309780
0.6333	Remote Similarity	NPC43550
0.6321	Remote Similarity	NPC475171
0.6296	Remote Similarity	NPC44716
0.6283	Remote Similarity	NPC11242
0.6281	Remote Similarity	NPC305981
0.623	Remote Similarity	NPC261506
0.623	Remote Similarity	NPC4328
0.6218	Remote Similarity	NPC57484
0.6214	Remote Similarity	NPC29069
0.6204	Remote Similarity	NPC160415
0.6204	Remote Similarity	NPC309714
0.6174	Remote Similarity	NPC475287
0.6174	Remote Similarity	NPC313110
0.6132	Remote Similarity	NPC150400
0.6106	Remote Similarity	NPC295823
0.6106	Remote Similarity	NPC174720
0.6106	Remote Similarity	NPC475467
0.6102	Remote Similarity	NPC475160
0.6102	Remote Similarity	NPC473714
0.6098	Remote Similarity	NPC302543
0.6083	Remote Similarity	NPC470518
0.608	Remote Similarity	NPC250247
0.6058	Remote Similarity	NPC164194
0.6036	Remote Similarity	NPC475504
0.6018	Remote Similarity	NPC218954
0.6018	Remote Similarity	NPC477075
0.6016	Remote Similarity	NPC481081
0.6	Remote Similarity	NPC481080
0.5981	Remote Similarity	NPC473373
0.5981	Remote Similarity	NPC127056
0.598	Remote Similarity	NPC128925
0.5966	Remote Similarity	NPC191827
0.5962	Remote Similarity	NPC204458
0.595	Remote Similarity	NPC484061
0.595	Remote Similarity	NPC484062
0.5922	Remote Similarity	NPC480937
0.5905	Remote Similarity	NPC1046
0.5897	Remote Similarity	NPC76972
0.5897	Remote Similarity	NPC469782
0.5897	Remote Similarity	NPC204414
0.5893	Remote Similarity	NPC609763
0.5887	Remote Similarity	NPC236638
0.5887	Remote Similarity	NPC294453
0.5877	Remote Similarity	NPC482737
0.5877	Remote Similarity	NPC23275
0.5877	Remote Similarity	NPC477079
0.5872	Remote Similarity	NPC263756
0.5872	Remote Similarity	NPC213674
0.5872	Remote Similarity	NPC22956
0.5862	Remote Similarity	NPC75287
0.5856	Remote Similarity	NPC164389
0.5833	Remote Similarity	NPC100639
0.5833	Remote Similarity	NPC482748
0.582	Remote Similarity	NPC476068
0.5806	Remote Similarity	NPC65105
0.5776	Remote Similarity	NPC469947
0.5776	Remote Similarity	NPC480948
0.5772	Remote Similarity	NPC265841
0.5758	Remote Similarity	NPC475368
0.5755	Remote Similarity	NPC78046
0.5743	Remote Similarity	NPC606107
0.5741	Remote Similarity	NPC25605
0.5739	Remote Similarity	NPC477076
0.5738	Remote Similarity	NPC329923
0.5738	Remote Similarity	NPC475281
0.5727	Remote Similarity	NPC161674
0.5727	Remote Similarity	NPC80843
0.5726	Remote Similarity	NPC480939
0.5714	Remote Similarity	NPC298034
0.5714	Remote Similarity	NPC71065
0.5714	Remote Similarity	NPC473459
0.569	Remote Similarity	NPC477077
0.569	Remote Similarity	NPC477078
0.5688	Remote Similarity	NPC58448
0.568	Remote Similarity	NPC293330
0.568	Remote Similarity	NPC484059
0.568	Remote Similarity	NPC484060
0.5669	Remote Similarity	NPC70809
0.5664	Remote Similarity	NPC68175
0.566	Remote Similarity	NPC473481
0.5656	Remote Similarity	NPC47995
0.5656	Remote Similarity	NPC488560
0.5641	Remote Similarity	NPC104137
0.5641	Remote Similarity	NPC26626
0.5636	Remote Similarity	NPC488561
0.563	Remote Similarity	NPC300419
0.5625	Remote Similarity	NPC114304
0.5625	Remote Similarity	NPC605226
0.5614	Remote Similarity	NPC257468
0.561	Remote Similarity	NPC82380
0.561	Remote Similarity	NPC244296
0.5593	Remote Similarity	NPC480936
0.5588	Remote Similarity	NPC306746
0.5588	Remote Similarity	NPC199457
0.5586	Remote Similarity	NPC473343
0.5556	Remote Similarity	NPC241909
0.5537	Remote Similarity	NPC165204
0.5534	Remote Similarity	NPC68419
0.5526	Remote Similarity	NPC148417
0.5526	Remote Similarity	NPC482722
0.5526	Remote Similarity	NPC471963
0.552	Remote Similarity	NPC488308
0.5512	Remote Similarity	NPC329657
0.5508	Remote Similarity	NPC36831
0.5504	Remote Similarity	NPC484063
0.5504	Remote Similarity	NPC484064
0.5495	Remote Similarity	NPC470512
0.5492	Remote Similarity	NPC155410
0.5487	Remote Similarity	NPC104071
0.5484	Remote Similarity	NPC181066
0.5484	Remote Similarity	NPC71391
0.5481	Remote Similarity	NPC31839
0.5476	Remote Similarity	NPC271610
0.5476	Remote Similarity	NPC312650
0.547	Remote Similarity	NPC324875
0.547	Remote Similarity	NPC292677
0.5455	Remote Similarity	NPC123522
0.5455	Remote Similarity	NPC139894
0.5455	Remote Similarity	NPC108748
0.5455	Remote Similarity	NPC59804
0.5455	Remote Similarity	NPC482750
0.5439	Remote Similarity	NPC102439
0.5424	Remote Similarity	NPC488564
0.5417	Remote Similarity	NPC25998

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC326474 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6624
0.1-0.2	2452
0.2-0.3	67
0.3-0.4	6
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5175	Remote Similarity	NPD8328	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data