NPASS Compound

Natural Product: NPC267338

Natural Product ID	NPC267338
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	PPWWANBMWAQXLQ-TWGQJFIHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	102500449
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 123129 0 0 0 0 0 0 0 0999 V2000 -7.9686 -1.7766 -1.4989 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6696 -0.2996 -1.6648 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1416 0.1090 -3.0406 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1855 -0.0503 -1.4668 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0021 0.2161 0.0115 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5920 0.0963 0.4605 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2818 -0.8912 1.2733 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9271 -1.1379 1.8021 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9639 -0.3043 1.0457 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5136 -0.4769 1.4712 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2327 -0.0035 2.8391 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2639 -1.9807 1.4284 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1793 -2.3265 1.5358 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0848 -1.6126 0.5526 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7356 -0.1879 0.3266 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5707 0.6864 1.2157 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1780 0.1329 -1.1149 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2710 0.1199 0.3652 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0033 1.5741 0.1248 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3497 2.0590 0.3984 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3826 1.1228 0.8836 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9282 1.6702 2.2118 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6245 1.1029 -0.0427 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1108 0.5819 -1.3755 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1836 2.4569 -0.2350 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5942 2.7001 0.0689 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4733 1.5646 0.4230 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7223 1.5329 1.9260 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8661 1.7440 -0.1977 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4715 0.4454 -0.6393 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7482 2.3338 0.7056 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3921 -1.6592 1.0538 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2269 -2.4489 0.2882 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5407 -1.8229 0.0471 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5875 -2.8699 -0.3419 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9039 -4.1478 -0.7586 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0803 -4.6052 0.4141 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9888 -5.1943 1.4646 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7998 -6.1110 1.1903 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9707 -4.7515 2.7797 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3383 -3.6510 1.0186 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0749 -4.0331 -1.8498 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3685 -3.2048 0.7649 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5465 -0.7521 -0.7979 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1347 0.4042 -0.3516 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3824 0.7247 -1.1710 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0819 1.4127 -2.4629 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2439 2.6485 -2.2621 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6790 2.6528 -0.8578 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6098 3.7283 -0.7075 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2820 3.8932 0.6248 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2686 1.4437 -0.4192 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0736 3.7581 -2.3939 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3858 0.5267 -3.3040 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1958 1.5378 -0.3964 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1619 -2.1829 -0.8208 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9616 -1.9304 -1.0748 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8137 -2.2814 -2.4723 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6713 -0.7193 -3.5606 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2368 0.4007 -3.6300 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8128 0.9739 -3.0417 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6663 -0.9920 -1.7027 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9261 0.7994 -2.0965 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6613 -0.5289 0.5235 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0963 -1.5757 1.5741 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8662 -1.1059 2.8967 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6947 -2.2154 1.5442 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9713 -0.7301 -0.0086 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0743 -0.3760 3.4989 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0915 1.0813 2.9582 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6400 -0.5993 3.2434 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7689 -2.3938 2.3268 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6580 -2.4099 0.4787 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5946 -2.2608 2.5732 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2345 -3.4339 1.3067 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0698 -2.2126 -0.3823 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7622 1.6791 0.7465 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1736 0.8944 2.2030 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5697 0.2240 1.3524 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2873 0.0767 -1.7605 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6591 1.1312 -1.1582 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9136 -0.6037 -1.4820 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1306 -0.3966 -0.5694 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7814 2.1352 0.7090 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3232 1.7804 -0.9417 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7510 2.5299 -0.5540 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2650 2.9726 1.0673 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0152 0.9200 2.9878 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2387 2.4715 2.6110 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9016 2.1658 2.1065 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3315 -0.4689 -1.5454 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0220 0.7406 -1.4925 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5644 1.1564 -2.2369 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9696 2.8285 -1.2853 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5528 3.1732 0.3773 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7103 3.4647 0.9000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1041 3.2424 -0.7881 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6963 2.5840 2.3055 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9600 0.9695 2.4633 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7243 1.1063 2.1309 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7890 2.4355 -1.0523 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4521 0.6973 -1.0975 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7128 -0.2201 0.2203 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3838 1.6715 1.0669 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6349 -2.7508 -0.6006 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9458 -1.4284 1.0077 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2882 -2.4878 -1.0932 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6957 -4.9237 -0.9069 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4259 -5.4674 0.1104 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3407 -5.2629 3.5635 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9590 -4.9165 -2.2629 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1402 -2.5864 1.5192 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5158 0.3406 0.6899 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9841 -0.2097 -1.3288 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9911 1.6981 -3.0245 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4418 2.7368 -3.0093 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5118 3.0184 -0.1845 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9417 4.6701 -1.1953 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7136 3.3606 -1.2583 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0719 3.6079 1.1670 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7260 3.7782 -1.6434 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0130 -0.2266 -3.5274 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0759 1.7009 -0.8061 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 1 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 15 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 1 21 23 1 0 23 24 1 6 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 27 29 1 0 29 30 1 0 29 31 1 0 14 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 37 41 1 0 36 42 1 0 35 43 1 0 34 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 48 53 1 0 47 54 1 0 46 55 1 0 30 2 1 0 41 33 1 0 52 45 1 0 27 5 1 0 23 6 1 0 21 9 1 0 18 10 1 0 1 56 1 0 1 57 1 0 1 58 1 0 3 59 1 0 3 60 1 0 3 61 1 0 4 62 1 0 4 63 1 0 5 64 1 1 7 65 1 0 8 66 1 0 8 67 1 0 9 68 1 6 11 69 1 0 11 70 1 0 11 71 1 0 12 72 1 0 12 73 1 0 13 74 1 0 13 75 1 0 14 76 1 6 16 77 1 0 16 78 1 0 16 79 1 0 17 80 1 0 17 81 1 0 17 82 1 0 18 83 1 6 19 84 1 0 19 85 1 0 20 86 1 0 20 87 1 0 22 88 1 0 22 89 1 0 22 90 1 0 24 91 1 0 24 92 1 0 24 93 1 0 25 94 1 0 25 95 1 0 26 96 1 0 26 97 1 0 28 98 1 0 28 99 1 0 28100 1 0 29101 1 6 30102 1 0 30103 1 0 31104 1 0 33105 1 6 34106 1 1 35107 1 6 36108 1 6 37109 1 6 40110 1 0 42111 1 0 43112 1 0 45113 1 1 46114 1 6 47115 1 6 48116 1 6 49117 1 1 50118 1 0 50119 1 0 51120 1 0 53121 1 0 54122 1 0 55123 1 0 M END

Standard InCHIKey	PPWWANBMWAQXLQ-TWGQJFIHSA-N
Standard InCHI	InChI=1S/C42H68O13/c1-37(2)17-21-20-9-10-24-40(6)13-12-26(38(3,4)23(40)11-14-42(24,8)41(20,7)16-15-39(21,5)25(44)18-37)53-36-33(30(48)29(47)32(54-36)34(50)51)55-35-31(49)28(46)27(45)22(19-43)52-35/h9,21-33,35-36,43-49H,10-19H2,1-8H3,(H,50,51)/t21-,22+,23-,24+,25+,26-,27+,28-,29-,30-,31+,32-,33+,35-,36+,39+,40-,41+,42+/m0/s1
SMILES	CC1(C)C[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C)[C@@H](C1)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	780.47	Volume:	784.093 ? Van der Waals volume.
Dense:	0.995	LogP:	2.737 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.911 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.726 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	39.0
TPSA:	215.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	8.0	Rings:	7.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.144	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.818	Fsp³:	0.929
MCE-18:	153.481 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.847	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.028 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.219	Promiscuous compounds:	0.121

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.949	MDCK Permeability:	-5.168
Pgp-inhibitor:	0.0	Pgp-substrate:	0.101
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.074
20% Bioavailability (F20%):	0.336	30% Bioavailability (F30%):	0.672
50% Bioavailability (F50%):	0.993

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.961
Plasma Protein Binding (PPB):	77.501%	Volume Distribution (VD):	-0.57
Fu:	15.562% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.961	BCRP inhibitor:	0.002
BSEP inhibitor:	0.026

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.009
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.347

Half-life (T1/2):

2.523

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.007
Human Hepatotoxicity (H-HT):	0.588	Drug-induced Liver Injury (DILI):	0.862
AMES Toxicity:	0.546	Rat Oral Acute Toxicity:	0.014
Maximum Recommended Daily Dose:	0.016	Skin Sensitization:	0.999
Carcinogencity:	0.306	Eye Corrosion:	0.0
Eye Irritation:	0.014	Respiratory Toxicity:	0.008
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.991
Hematotoxicity:	0.442	Drug-induced Nephrotoxicity:	0.99
Genotoxicity:	0.649	RPMI-8226 Immunitoxicity:	0.065
A549 Cytotoxicity:	0.155	Hek293 Cytotoxicity:	0.128
BCF:	0.781 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.392 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.913 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.087 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8707.1	Pueraria montana var. lobata	Varieties	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8707.1	Pueraria montana var. lobata	Varieties	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8707.1	Pueraria montana var. lobata	Varieties	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO8707.1	Pueraria montana var. lobata	Varieties	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC267338 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22353
0.1-0.2	23064
0.2-0.3	3051
0.3-0.4	760
0.4-0.5	372
0.5-0.6	159
0.6-0.7	32
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8602	High Similarity	NPC118440
0.8144	Intermediate Similarity	NPC236657
0.7732	Intermediate Similarity	NPC251768
0.7525	Intermediate Similarity	NPC218954
0.75	Intermediate Similarity	NPC64715
0.732	Intermediate Similarity	NPC472949
0.7184	Intermediate Similarity	NPC301449
0.7184	Intermediate Similarity	NPC601290
0.7065	Intermediate Similarity	NPC224121
0.6923	Remote Similarity	NPC114692
0.6832	Remote Similarity	NPC192791
0.6827	Remote Similarity	NPC95437
0.6731	Remote Similarity	NPC131469
0.6667	Remote Similarity	NPC302887
0.6636	Remote Similarity	NPC187618
0.6634	Remote Similarity	NPC157868
0.66	Remote Similarity	NPC309780
0.6481	Remote Similarity	NPC120116
0.6481	Remote Similarity	NPC160452
0.6466	Remote Similarity	NPC258617
0.6408	Remote Similarity	NPC482717
0.6381	Remote Similarity	NPC44716
0.6321	Remote Similarity	NPC475591
0.6321	Remote Similarity	NPC236870
0.6293	Remote Similarity	NPC470518
0.625	Remote Similarity	NPC313110
0.6226	Remote Similarity	NPC159309
0.6226	Remote Similarity	NPC86222
0.6174	Remote Similarity	NPC283417
0.6174	Remote Similarity	NPC470218
0.6174	Remote Similarity	NPC200049
0.6139	Remote Similarity	NPC164194
0.6132	Remote Similarity	NPC117714
0.6132	Remote Similarity	NPC30289
0.6132	Remote Similarity	NPC605226
0.6126	Remote Similarity	NPC187290
0.6075	Remote Similarity	NPC40775
0.6058	Remote Similarity	NPC482748
0.6038	Remote Similarity	NPC75417
0.6	Remote Similarity	NPC473884
0.6	Remote Similarity	NPC114484
0.5979	Remote Similarity	NPC606107
0.5966	Remote Similarity	NPC265841
0.5946	Remote Similarity	NPC23275
0.5946	Remote Similarity	NPC477075
0.5943	Remote Similarity	NPC22956
0.5932	Remote Similarity	NPC4749
0.5905	Remote Similarity	NPC127056
0.5888	Remote Similarity	NPC242840
0.5882	Remote Similarity	NPC21691
0.5859	Remote Similarity	NPC31839
0.5856	Remote Similarity	NPC281148
0.5856	Remote Similarity	NPC247315
0.5856	Remote Similarity	NPC482728
0.5842	Remote Similarity	NPC480937
0.581	Remote Similarity	NPC25605
0.5804	Remote Similarity	NPC482737
0.5798	Remote Similarity	NPC82380
0.5798	Remote Similarity	NPC244296
0.5794	Remote Similarity	NPC80843
0.5794	Remote Similarity	NPC469946
0.5789	Remote Similarity	NPC11242
0.5769	Remote Similarity	NPC48499
0.5741	Remote Similarity	NPC112352
0.5738	Remote Similarity	NPC484059
0.5738	Remote Similarity	NPC484060
0.5727	Remote Similarity	NPC482722
0.5727	Remote Similarity	NPC63159
0.5727	Remote Similarity	NPC471963
0.5702	Remote Similarity	NPC469947
0.5702	Remote Similarity	NPC488308
0.5702	Remote Similarity	NPC480948
0.5701	Remote Similarity	NPC470512
0.5688	Remote Similarity	NPC114304
0.5676	Remote Similarity	NPC222580
0.5667	Remote Similarity	NPC329923
0.5667	Remote Similarity	NPC475281
0.5664	Remote Similarity	NPC477076
0.5664	Remote Similarity	NPC477079
0.5656	Remote Similarity	NPC271610
0.5656	Remote Similarity	NPC312650
0.5652	Remote Similarity	NPC480939
0.5652	Remote Similarity	NPC480936
0.5636	Remote Similarity	NPC164389
0.562	Remote Similarity	NPC484061
0.562	Remote Similarity	NPC484062
0.5614	Remote Similarity	NPC477077
0.5614	Remote Similarity	NPC477078
0.5603	Remote Similarity	NPC25998
0.5603	Remote Similarity	NPC471962
0.5583	Remote Similarity	NPC47995
0.5577	Remote Similarity	NPC214484
0.5556	Remote Similarity	NPC484063
0.5556	Remote Similarity	NPC484064
0.5556	Remote Similarity	NPC488561
0.5556	Remote Similarity	NPC603026
0.5556	Remote Similarity	NPC609119
0.5556	Remote Similarity	NPC610204
0.5545	Remote Similarity	NPC286347
0.5536	Remote Similarity	NPC257468
0.5536	Remote Similarity	NPC297263
0.5526	Remote Similarity	NPC481079
0.5524	Remote Similarity	NPC1046
0.552	Remote Similarity	NPC302543
0.552	Remote Similarity	NPC11577
0.552	Remote Similarity	NPC141600
0.5514	Remote Similarity	NPC235405
0.5514	Remote Similarity	NPC482750
0.5505	Remote Similarity	NPC263756
0.5505	Remote Similarity	NPC213674
0.5505	Remote Similarity	NPC475171
0.55	Remote Similarity	NPC602995
0.5495	Remote Similarity	NPC173859
0.5495	Remote Similarity	NPC11551
0.5495	Remote Similarity	NPC148603
0.5463	Remote Similarity	NPC249848
0.5463	Remote Similarity	NPC109079
0.5463	Remote Similarity	NPC107966
0.5462	Remote Similarity	NPC284449
0.544	Remote Similarity	NPC329657
0.5433	Remote Similarity	NPC488309
0.5431	Remote Similarity	NPC104137
0.5431	Remote Similarity	NPC31838
0.5431	Remote Similarity	NPC26626
0.5413	Remote Similarity	NPC39211
0.541	Remote Similarity	NPC71391
0.5405	Remote Similarity	NPC30735
0.54	Remote Similarity	NPC204407
0.5398	Remote Similarity	NPC31193
0.5391	Remote Similarity	NPC324875
0.5391	Remote Similarity	NPC292677
0.5391	Remote Similarity	NPC291903
0.5391	Remote Similarity	NPC606145
0.5378	Remote Similarity	NPC151543
0.5372	Remote Similarity	NPC475140
0.537	Remote Similarity	NPC475516
0.537	Remote Similarity	NPC59804
0.5364	Remote Similarity	NPC76497
0.536	Remote Similarity	NPC476779
0.5357	Remote Similarity	NPC480475
0.5345	Remote Similarity	NPC488564
0.5345	Remote Similarity	NPC480473
0.5345	Remote Similarity	NPC480474
0.5339	Remote Similarity	NPC472267
0.5339	Remote Similarity	NPC107536
0.5339	Remote Similarity	NPC475119
0.5339	Remote Similarity	NPC115656
0.5339	Remote Similarity	NPC280029
0.5339	Remote Similarity	NPC9470
0.5339	Remote Similarity	NPC288205
0.5339	Remote Similarity	NPC51465
0.5328	Remote Similarity	NPC277212
0.5328	Remote Similarity	NPC30279
0.5315	Remote Similarity	NPC223301
0.5315	Remote Similarity	NPC171544
0.531	Remote Similarity	NPC235438
0.5304	Remote Similarity	NPC482740
0.5299	Remote Similarity	NPC475486
0.5299	Remote Similarity	NPC481078
0.5294	Remote Similarity	NPC252657
0.5294	Remote Similarity	NPC88311
0.5294	Remote Similarity	NPC473824
0.5289	Remote Similarity	NPC482736
0.5289	Remote Similarity	NPC482738
0.5285	Remote Similarity	NPC181066
0.5285	Remote Similarity	NPC329828
0.5283	Remote Similarity	NPC90856
0.5278	Remote Similarity	NPC12288
0.5273	Remote Similarity	NPC482751
0.5263	Remote Similarity	NPC123796
0.525	Remote Similarity	NPC123522
0.525	Remote Similarity	NPC79643
0.5229	Remote Similarity	NPC56713
0.5225	Remote Similarity	NPC482747
0.5225	Remote Similarity	NPC202666
0.5225	Remote Similarity	NPC471961
0.5225	Remote Similarity	NPC242015
0.5221	Remote Similarity	NPC10607
0.5221	Remote Similarity	NPC46665
0.5221	Remote Similarity	NPC180550
0.5221	Remote Similarity	NPC2370
0.5221	Remote Similarity	NPC35405
0.5217	Remote Similarity	NPC471435
0.5217	Remote Similarity	NPC471434
0.5217	Remote Similarity	NPC79718
0.5217	Remote Similarity	NPC262199
0.5217	Remote Similarity	NPC119794
0.5214	Remote Similarity	NPC470477
0.52	Remote Similarity	NPC476774
0.52	Remote Similarity	NPC476780
0.5196	Remote Similarity	NPC57362
0.5189	Remote Similarity	NPC480943
0.5182	Remote Similarity	NPC114441
0.5175	Remote Similarity	NPC482729
0.5175	Remote Similarity	NPC482742
0.5172	Remote Similarity	NPC104372
0.5169	Remote Similarity	NPC207738
0.5167	Remote Similarity	NPC475287
0.5167	Remote Similarity	NPC607904
0.5167	Remote Similarity	NPC610461

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC267338 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6787
0.1-0.2	2287
0.2-0.3	68
0.3-0.4	5
0.4-0.5	2
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5225	Remote Similarity	NPD8328	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data