16 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
5 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC50864
Formula: C20H19NO4
Ingredient ID: NPC50864
| Common Name | n.a. |
| IUPAC Name | 2,3,9-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-10-ol |
| Canonical SMILES | COc1cc2c(cc1OC)CCn1c2cc2ccc(=[O+])c(c2c1)OC |
| Standard InCHI | InChI=1S/C20H19NO4/c1-23-18-9-13-6-7-21-11-15-12(4-5-17(22)20(15)25-3)8-16(21)14(13)10-19(18)24-2/h4-5,8-11H,6-7H2,1-3H3/p+1 |
| Standard InCHIKey | VQSYXVWEZATIHL-UHFFFAOYSA-O |
| Ingredient External Links |
PubChem CID: 3083983 ZINC ID: ZINC000014636435 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tinospora capillipes | Tinospora | Menispermaceae | |
| Corydalis turtschaninovii | Corydalis | Papaveraceae |
 |
| Macaranga bicolor | Macaranga | Euphorbiaceae | |
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Epimedium koreanum | Epimedium | Berberidaceae |
 |
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Corydalis ternata | Corydalis | Papaveraceae | |
| Paratinospora sagittata | Paratinospora | Menispermaceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
| Corydalis yanhusuo | Corydalis | Papaveraceae |
|
Ingredient ID: NPC289930
Formula: C38H42N2O6
Ingredient ID: NPC289930
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1cc2CCN([C@H]3c2c(c1OC)Oc1ccc(cc1)C[C@H]1N(C)CCc2c1c(Oc1cc(C3)ccc1)c(OC)c(c2)OC)C |
| Standard InCHI | InChI=1S/C38H42N2O6/c1-39-16-14-25-21-32(42-4)36(44-6)38-33(25)29(39)19-23-10-12-27(13-11-23)45-37-34-26(22-31(41-3)35(37)43-5)15-17-40(2)30(34)20-24-8-7-9-28(18-24)46-38/h7-13,18,21-22,29-30H,14-17,19-20H2,1-6H3/t29-,30-/m1/s1 |
| Standard InCHIKey | YQGUGZPPHKJXNZ-LOYHVIPDSA-N |
| Ingredient External Links |
PubChem CID: 53486320 |
| Plant-Ingredient Association Reference |
Database: TCMID [4460] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cissampelos pareira | Cissampelos | Menispermaceae |
|
| Cyclea racemosa | Cyclea | Menispermaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Stephania delavayi | Stephania | Menispermaceae |
|
Ingredient ID: NPC257084
Formula: C38H42N2O6
Ingredient ID: NPC257084
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c(OC)cc2c3c1Oc1ccc(cc1)C[C@H]1N(C)CCc4c1c(Oc1ccc(C[C@H]3N(CC2)C)cc1)c(c(c4)OC)OC |
| Standard InCHI | InChI=1S/C38H42N2O6/c1-39-17-15-25-21-31(41-3)35(43-5)37-33(25)29(39)19-23-7-11-28(12-8-23)46-38-34-26(22-32(42-4)36(38)44-6)16-18-40(2)30(34)20-24-9-13-27(45-37)14-10-24/h7-14,21-22,29-30H,15-20H2,1-6H3/t29-,30-/m1/s1 |
| Standard InCHIKey | ANOXEUSGZWSCQL-LOYHVIPDSA-N |
| Ingredient External Links |
PubChem CID: 121313 ZINC ID: ZINC000044281044 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
Ingredient ID: NPC248029
Formula: C18H19NO3
Ingredient ID: NPC248029
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c(OC)cc2c3c1C1(C=CC(=O)C=C1)C[C@H]3NCC2 |
| Standard InCHI | InChI=1S/C18H19NO3/c1-21-14-9-11-5-8-19-13-10-18(6-3-12(20)4-7-18)16(15(11)13)17(14)22-2/h3-4,6-7,9,13,19H,5,8,10H2,1-2H3/t13-/m1/s1 |
| Standard InCHIKey | OGJKMZVUJJYWKO-CYBMUJFWSA-N |
| Ingredient External Links |
PubChem CID: 193686 ZINC ID: ZINC000020610265 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Solanum lasiocarpum | Solanum | Solanaceae |
|
| Stephania tetrandra | Stephania | Menispermaceae |
|
| Sinomenium acutum | Sinomenium | Menispermaceae |
|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Fibraurea recisa | Fibraurea | Menispermaceae |
|
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Phoenix dactylifera | Phoenix | Arecaceae |
 |
| Aglaia odorata | Aglaia | Meliaceae |
|
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
Ingredient ID: NPC245618
Formula: C21H21NO5
Ingredient ID: NPC245618
| Common Name | n.a. |
| IUPAC Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-11-ol |
| Canonical SMILES | COC1=C(OC)c2c(=CC1=O)cc1[n+](c2)CCc2c1cc(OC)c(c2)OC |
| Standard InCHI | InChI=1S/C21H21NO5/c1-24-18-9-12-5-6-22-11-15-13(7-16(22)14(12)10-19(18)25-2)8-17(23)21(27-4)20(15)26-3/h7-11H,5-6H2,1-4H3/p+1 |
| Standard InCHIKey | UORJSDWCVYZJLA-UHFFFAOYSA-O |
| Ingredient External Links |
PubChem CID: 46216998 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD73791] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
Ingredient ID: NPC243743
Formula: C20H19NO4
Ingredient ID: NPC243743
| Common Name | n.a. |
| IUPAC Name | 2,3,10-trimethoxy-6,7-dihydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-9-one |
| Canonical SMILES | COC1=CC=c2c(C1=O)c[n+]1c(c2)c2cc(OC)c(cc2CC1)OC |
| Standard InCHI | InChI=1S/C20H19NO4/c1-23-17-5-4-12-8-16-14-10-19(25-3)18(24-2)9-13(14)6-7-21(16)11-15(12)20(17)22/h4-5,8-11H,6-7H2,1-3H3/p+1 |
| Standard InCHIKey | QBUIDYLGKMWNEA-UHFFFAOYSA-O |
| Ingredient External Links |
PubChem CID: 101280139 ZINC ID: ZINC000014636433 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tinospora capillipes | Tinospora | Menispermaceae | |
| Coptis japonica | Coptis | Ranunculaceae |
|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Coptis deltoidea | Coptis | Ranunculaceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Fibraurea recisa | Fibraurea | Menispermaceae |
|
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Paratinospora sagittata | Paratinospora | Menispermaceae | |
| Coptis teeta | Coptis | Ranunculaceae |
|
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
| Coptis chinensis | Coptis | Ranunculaceae |
|
Ingredient ID: NPC232924
Formula: C18H17NO2
Ingredient ID: NPC232924
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CN1CCc2c3[C@H]1Cc1ccccc1c3c1c(c2)OCO1 |
| Standard InCHI | InChI=1S/C18H17NO2/c1-19-7-6-12-9-15-18(21-10-20-15)17-13-5-3-2-4-11(13)8-14(19)16(12)17/h2-5,9,14H,6-8,10H2,1H3/t14-/m1/s1 |
| Standard InCHIKey | JCTYWRARKVGOBK-CQSZACIVSA-N |
| Ingredient External Links |
PubChem CID: 119204 ChEMBL ID: CHEMBL483825 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD101073] Database: NPASS [NPC232924] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Pyrus bourgaeana | Pyrus | Rosaceae |
|
| Pinus edulis | Pinus | Pinaceae |
|
| Baccharis truncata | Baccharis | Asteraceae | |
| Ononis viscosa | Ononis | Fabaceae | |
| Cuphea hyssopifolia | Cuphea | Lythraceae |
|
| Magnolia obovata | Magnolia | Magnoliaceae |
|
| Holarrhena floribunda | Holarrhena | Apocynaceae |
|
| Farfugium japonicum | Farfugium | Asteraceae |
|
| Sedum sarmentosum | Sedum | Crassulaceae |
|
| Salvia broussonetii | Salvia | Lamiaceae | |
| Eria rigida | Eria | Orchidaceae | |
| Gynoxys verrucosa | Gynoxys | Asteraceae | |
| Triunia erythrocarpa | Triunia | Proteaceae | |
| Chloranthus fortunei | Chloranthus | Chloranthaceae | |
| Sandoricum koetjape | Sandoricum | Meliaceae |
|
| Suaeda maritima | Suaeda | Chenopodiaceae |
|
| Pedicularis rex | Pedicularis | Orobanchaceae | |
| Euphorbia palustris | Euphorbia | Euphorbiaceae |
|
| Benincasa hispida | Benincasa | Cucurbitaceae |
|
| Sorbus torminalis | Sorbus | Rosaceae |
|
| Sphaerophysa salsula | Sphaerophysa | Fabaceae | |
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Euphorbia characias subsp. wulfenii | Euphorbia | Euphorbiaceae |
|
| Doronicum grandiflorum | Doronicum | Asteraceae | |
| Oxytropis lanata | Oxytropis | Fabaceae | |
| Populus balsamifera | Populus | Salicaceae |
|
| Strychnos gossweileri | Strychnos | Loganiaceae | |
| Leibnitzia anandria | Leibnitzia | Asteraceae |
|
| Lithocarpus haipinii | Lithocarpus | Fagaceae | |
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Centaurea benedicta | Centaurea | Asteraceae |
|
| Posidonia oceanica | Posidonia | Posidoniaceae | |
| Chuquiraga erinacea | Chuquiraga | Asteraceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
 |
| Alpinia flabellata | Alpinia | Zingiberaceae |
|
| Fouquieria diguetii | Fouquieria | Fouquieriaceae | |
| Magnolia officinalis | Magnolia | Magnoliaceae |
|
| Euphorbia pithyusa | Euphorbia | Euphorbiaceae | |
| Ardisia hortorum | Ardisia | Primulaceae |
|
| Fritillaria hupehensis | Fritillaria | Liliaceae |
|
| Angelica japonica | Angelica | Apiaceae |
|
| Lathyrus latifolius | Lathyrus | Fabaceae |
|
| Pterocarpus erinaceus | Pterocarpus | Fabaceae |
|
Ingredient ID: NPC218652
Formula: C19H21NO3
Ingredient ID: NPC218652
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c(OC)cc2c3c1C1(C=CC(=O)C=C1)C[C@@H]3N(CC2)C |
| Standard InCHI | InChI=1S/C19H21NO3/c1-20-9-6-12-10-15(22-2)18(23-3)17-16(12)14(20)11-19(17)7-4-13(21)5-8-19/h4-5,7-8,10,14H,6,9,11H2,1-3H3/t14-/m0/s1 |
| Standard InCHIKey | WUYQEGNOQLRQAQ-AWEZNQCLSA-N |
| Ingredient External Links |
PubChem CID: 793841 |
| Plant-Ingredient Association Reference |
Database: TCMID [33625] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Baccharis grandicapitulata | Baccharis | Asteraceae | |
| Renealmia alpinia | Renealmia | Zingiberaceae |
|
| Morella pensylvanica | Morella | Myricaceae | |
| Delphinium giraldii | Delphinium | Ranunculaceae |
|
| Stellaria media | Stellaria | Caryophyllaceae |
|
| Curcuma aeruginosa | Curcuma | Zingiberaceae |
|
| Piper brachystachyum | Piper | Piperaceae |
|
| Tephroseris kirilowii | Tephroseris | Asteraceae |
|
| Senecio congestus | Senecio | Asteraceae |
|
| Papaver pseudocanescens | Papaver | Papaveraceae | |
| Sideritis dasygnaphala | Sideritis | Lamiaceae | |
| Gutierrezia dracunculoides | Gutierrezia | Asteraceae | |
| Psidium acutangulum | Psidium | Myrtaceae |
|
| Beesia calthifolia | Beesia | Ranunculaceae | |
| Bursera kerberi | Bursera | Burseraceae | |
| Helenium integrifolium | Helenium | Asteraceae | |
| Rhododendron mucronulatum | Rhododendron | Ericaceae |
|
| Euonymus fortunei | Euonymus | Celastraceae |
|
| Phlomis crinita | Phlomis | Lamiaceae |
|
| Crotalaria stolzii | Crotalaria | Fabaceae | |
| Selinum libanotis | Selinum | Apiaceae | |
| Melampodium leucanthum | Melampodium | Asteraceae | |
| Clerodendrum trichotomum | Clerodendrum | Lamiaceae |
|
| Juniperus scopulorum | Juniperus | Cupressaceae |
|
| Clinacanthus nutans | Clinacanthus | Acanthaceae |
|
| Alstonia angustiloba | Alstonia | Apocynaceae | |
| Lasianthaea podocephala | Lasianthaea | Asteraceae | |
| Eucalyptus albens | Eucalyptus | Myrtaceae | |
| Annona cherimola | Annona | Annonaceae |
|
| Pellacalyx axillaris | Pellacalyx | Rhizophoraceae | |
| Boschniakia rossica | Boschniakia | Orobanchaceae |
|
| Stephania glabra | Stephania | Menispermaceae |
|
| Coffea liberica var. dewevrei | Coffea | Rubiaceae |
|
| Botrychium ternatum | Botrychium | Ophioglossaceae |
|
| Lupinus cosentinii | Lupinus | Fabaceae | |
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Hedysarum gmelini | Hedysarum | Fabaceae | |
| Euploca racemosa | Euploca | Heliotropiaceae | |
| Artemisia pectinata | Artemisia | Asteraceae | |
| Zephyranthes flava | Zephyranthes | Amaryllidaceae |
Ingredient ID: NPC210437
Formula: C21H25NO4
Ingredient ID: NPC210437
| Common Name | Tetrahydropalmatine |
| IUPAC Name | (13aS)-2,3,9,10-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| Canonical SMILES | COc1cc2CCN3[C@H](c2cc1OC)Cc1c(C3)c(OC)c(cc1)OC |
| Standard InCHI | InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-/m0/s1 |
| Standard InCHIKey | AEQDJSLRWYMAQI-KRWDZBQOSA-N |
| Ingredient External Links |
PubChem CID: 72301 ZINC ID: ZINC000019535049 ChEMBL ID: CHEMBL487182 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC210437] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Coptis japonica | Coptis | Ranunculaceae |
|
| Corydalis turtschaninovii | Corydalis | Papaveraceae |
|
| Corydalis decumbens | Corydalis | Papaveraceae |
|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Stephania pierrei | Stephania | Menispermaceae |
|
| Phellodendron chinense | Phellodendron | Rutaceae |
|
| Coptis deltoidea | Coptis | Ranunculaceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Fibraurea recisa | Fibraurea | Menispermaceae |
|
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Phellodendron amurense | Phellodendron | Rutaceae |
|
| Corydalis ternata | Corydalis | Papaveraceae | |
| Phellodendron chinese | Phellodendron | Rutaceae | |
| Corydalis tuberosa | Corydalis | Papaveraceae |
|
| Coptis teeta | Coptis | Ranunculaceae |
|
| Dovyalis hebecarpa | Dovyalis | Salicaceae |
|
| Lycopodium chinense | Lycopodium | Lycopodiaceae | |
| Ixeris repens | Ixeris | Asteraceae |
|
| Eremophila oppositifolia | Eremophila | Scrophulariaceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
| Taxillus yadoriki | Taxillus | Loranthaceae | |
| Corydalis rhizoma | Corydalis | Papaveraceae | |
| Coptis chinensis | Coptis | Ranunculaceae |
|
| Corydalis yanhusuo | Corydalis | Papaveraceae |
|
| Stephania delavayi | Stephania | Menispermaceae |
|
Ingredient ID: NPC204131
Formula: C37H40N2O6
Ingredient ID: NPC204131
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c(OC)cc2c3c1Oc1ccc(cc1)C[C@H]1N(C)CCc4c1c(Oc1ccc(C[C@H]3NCC2)cc1)c(c(c4)OC)OC |
| Standard InCHI | InChI=1S/C37H40N2O6/c1-39-17-15-25-21-31(41-3)35(43-5)37-33(25)29(39)19-23-8-12-26(13-9-23)44-36-32-24(20-30(40-2)34(36)42-4)14-16-38-28(32)18-22-6-10-27(45-37)11-7-22/h6-13,20-21,28-29,38H,14-19H2,1-5H3/t28-,29-/m1/s1 |
| Standard InCHIKey | ZYKGNXPEWXZKGA-FQLXRVMXSA-N |
| Ingredient External Links |
PubChem CID: 21582963 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD161348] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
Ingredient ID: NPC189266
Formula: C19H21NO4
Ingredient ID: NPC189266
| Common Name | Stepholidine |
| IUPAC Name | (13aS)-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol |
| Canonical SMILES | COc1cc2CCN3[C@H](c2cc1O)Cc1c(C3)c(OC)c(cc1)O |
| Standard InCHI | InChI=1S/C19H21NO4/c1-23-18-8-12-5-6-20-10-14-11(3-4-16(21)19(14)24-2)7-15(20)13(12)9-17(18)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1 |
| Standard InCHIKey | JKPISQIIWUONPB-HNNXBMFYSA-N |
| Ingredient External Links |
PubChem CID: 6917970 ZINC ID: ZINC000022066528 ChEMBL ID: CHEMBL487387 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC189266] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sinomenium acutum | Sinomenium | Menispermaceae |
|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Menispermum dauricum | Menispermum | Menispermaceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Fibraurea recisa | Fibraurea | Menispermaceae |
|
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
| Polyalthia longifolia var. pendula | Monoon | Annonaceae | |
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Stephania delavayi | Stephania | Menispermaceae |
|
Ingredient ID: NPC188920
Formula: C3H6OS
Ingredient ID: NPC188920
| Common Name | n.a. |
| IUPAC Name | 1-sulfinylpropane |
| Canonical SMILES | CCC=S=O |
| Standard InCHI | InChI=1S/C3H6OS/c1-2-3-5-4/h3H,2H2,1H3 |
| Standard InCHIKey | BAZSXBOAXJLRNH-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 441491 ZINC ID: ZINC000004658604 |
| Plant-Ingredient Association Reference |
Database: TCMID [31845] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Allium cepa | Allium | Amaryllidaceae |
|
| Stephania glabra | Stephania | Menispermaceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
Ingredient ID: NPC16452
Formula: C21H22NO4
Ingredient ID: NPC16452
| Common Name | Palmitine |
| IUPAC Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| Canonical SMILES | COc1cc2CC[n+]3c(c2cc1OC)cc1c(c3)c(OC)c(cc1)OC |
| Standard InCHI | InChI=1S/C21H22NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-12H,7-8H2,1-4H3/q+1 |
| Standard InCHIKey | QUCQEUCGKKTEBI-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 19009 ZINC ID: ZINC000000608233 ChEMBL ID: CHEMBL206106 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC16452] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tinospora capillipes | Tinospora | Menispermaceae | |
| Chrysanthemum myconis | Chrysanthemum | Asteraceae | |
| Acnistus arborescens | Acnistus | Solanaceae |
|
| Pinus koraiensis | Pinus | Pinaceae |
|
| Euphorbia fortissima | Euphorbia | Euphorbiaceae |
|
| Berberis fortunei | Berberis | Berberidaceae |
|
| Theobroma speciosum | Theobroma | Malvaceae |
|
| Stephania tetrandra | Stephania | Menispermaceae |
|
| Thalictrum atriplex | Thalictrum | Ranunculaceae | |
| Thalictrum foliolosum | Thalictrum | Ranunculaceae |
|
| Coptis japonica | Coptis | Ranunculaceae |
|
| Corydalis turtschaninovii | Corydalis | Papaveraceae |
|
| Corydalis decumbens | Corydalis | Papaveraceae |
|
| Androsace septentrionalis | Androsace | Primulaceae | |
| Dunaliella salina | Dunaliella | Dunaliellaceae |
|
| Garcinia paucinervis | Garcinia | Clusiaceae |
|
| Thalictrum glandulosissimum | Thalictrum | Ranunculaceae | |
| Isodon wikstroemioides | Isodon | Lamiaceae | |
| Calocephalus knappii | Calocephalus | Asteraceae | |
| Trifolium dubium | Trifolium | Fabaceae |
|
| Thalictrum petaloideum | Thalictrum | Ranunculaceae | |
| Macaranga bicolor | Macaranga | Euphorbiaceae | |
| Berberis amurensis | Berberis | Berberidaceae |
|
| Magnolia biondii | Magnolia | Magnoliaceae |
|
| Berberis thunbergii | Berberis | Berberidaceae |
|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Jateorhiza palmata | Jateorhiza | Menispermaceae |
|
| Panax quinquefolius | Panax | Araliaceae |
|
| Thalictrum minus var. hypoleucum | Thalictrum | Ranunculaceae |
|
| Thalictrum faberi | Thalictrum | Ranunculaceae | |
| Thalictrum simplex | Thalictrum | Ranunculaceae |
|
| Pilosocereus chrysacanthus | Pilosocereus | Cactaceae |
|
| Hylomecon japonica | Hylomecon | Papaveraceae |
|
| Phellodendron chinense | Phellodendron | Rutaceae |
|
| Coptis omeiensis | Coptis | Ranunculaceae |
|
| Coptis deltoidea | Coptis | Ranunculaceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Epimedium koreanum | Epimedium | Berberidaceae |
|
| Fibraurea recisa | Fibraurea | Menispermaceae |
|
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Coptis teetoides | Coptis | Ranunculaceae | |
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Phellodendron amurense | Phellodendron | Rutaceae |
|
| Corydalis ternata | Corydalis | Papaveraceae | |
| Plectranthus ernstii | Plectranthus | Lamiaceae | |
| Acorus calamus | Acorus | Acoraceae |
|
| Paratinospora sagittata | Paratinospora | Menispermaceae | |
| Thalictrum microgynum | Thalictrum | Ranunculaceae |
|
| Phellodendron chinese | Phellodendron | Rutaceae | |
| Cussonia racemosa | Cussonia | Araliaceae | |
| Corydalis remota | Corydalis | Papaveraceae | |
| Coptis teeta | Coptis | Ranunculaceae |
|
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
| Berberis japonica | Berberis | Berberidaceae | |
| Coptis chinensis | Coptis | Ranunculaceae |
|
| Astragalus trojanus | Astragalus | Fabaceae |
|
| Annona glabra | Annona | Annonaceae |
|
| Aloe saponaria | Aloe | Asphodelaceae |
|
| Artocarpus incisa | Artocarpus | Moraceae |
|
| Ligularia nelumbifolia | Ligularia | Asteraceae |
|
| Corydalis yanhusuo | Corydalis | Papaveraceae |
|
| Berberis oblonga | Berberis | Berberidaceae |
|
Ingredient ID: NPC118804
Formula: C19H21NO3
Ingredient ID: NPC118804
| Common Name | Pronuciferine |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1c(OC)cc2c3c1C1(C=CC(=O)C=C1)C[C@H]3N(CC2)C |
| Standard InCHI | InChI=1S/C19H21NO3/c1-20-9-6-12-10-15(22-2)18(23-3)17-16(12)14(20)11-19(17)7-4-13(21)5-8-19/h4-5,7-8,10,14H,6,9,11H2,1-3H3/t14-/m1/s1 |
| Standard InCHIKey | WUYQEGNOQLRQAQ-CQSZACIVSA-N |
| Ingredient External Links |
PubChem CID: 200480 ChEMBL ID: CHEMBL237766 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD77561] Database: NPASS [NPC118804] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Sphaerophysa salsula | Sphaerophysa | Fabaceae | |
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Euphorbia characias subsp. wulfenii | Euphorbia | Euphorbiaceae |
|
| Doronicum grandiflorum | Doronicum | Asteraceae | |
| Oxytropis lanata | Oxytropis | Fabaceae | |
| Populus balsamifera | Populus | Salicaceae |
|
| Strychnos gossweileri | Strychnos | Loganiaceae | |
| Leibnitzia anandria | Leibnitzia | Asteraceae |
|
| Lithocarpus haipinii | Lithocarpus | Fagaceae | |
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Ardisia hortorum | Ardisia | Primulaceae |
|
Ingredient ID: NPC112206
Formula: C19H17NO4
Ingredient ID: NPC112206
| Common Name | n.a. |
| IUPAC Name | 3,9-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,10-diol |
| Canonical SMILES | COc1cc2CC[n+]3c(c2cc1O)cc1c(c3)c(OC)c(cc1)O |
| Standard InCHI | InChI=1S/C19H17NO4/c1-23-18-8-12-5-6-20-10-14-11(3-4-16(21)19(14)24-2)7-15(20)13(12)9-17(18)22/h3-4,7-10H,5-6H2,1-2H3,(H-,21,22)/p+1 |
| Standard InCHIKey | BENXORZPKXUGMY-UHFFFAOYSA-O |
| Ingredient External Links |
PubChem CID: 10358881 ZINC ID: ZINC000014636436 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC112206] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Tinospora capillipes | Tinospora | Menispermaceae | |
| Stephania tetrandra | Stephania | Menispermaceae |
|
| Sinomenium acutum | Sinomenium | Menispermaceae |
|
| Corydalis turtschaninovii | Corydalis | Papaveraceae |
|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Fibraurea recisa | Fibraurea | Menispermaceae |
|
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Polyalthia nemoralis | Polyalthia | Annonaceae |
|
| Corydalis ternata | Corydalis | Papaveraceae | |
| Paratinospora sagittata | Paratinospora | Menispermaceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
| Corydalis yanhusuo | Corydalis | Papaveraceae |
|
Ingredient ID: NPC106295
Formula: C21H25NO4
Ingredient ID: NPC106295
| Common Name | n.a. |
| IUPAC Name | (13aR)-2,3,9,10-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| Canonical SMILES | COc1cc2CCN3[C@@H](c2cc1OC)Cc1c(C3)c(OC)c(cc1)OC |
| Standard InCHI | InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-/m1/s1 |
| Standard InCHIKey | AEQDJSLRWYMAQI-QGZVFWFLSA-N |
| Ingredient External Links |
PubChem CID: 969488 ZINC ID: ZINC000019535046 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC106295] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Coptis japonica | Coptis | Ranunculaceae |
|
| Corydalis turtschaninovii | Corydalis | Papaveraceae |
|
| Corydalis decumbens | Corydalis | Papaveraceae |
|
| Passiflora coccinea | Passiflora | Passifloraceae |
|
| Phellodendron chinense | Phellodendron | Rutaceae |
|
| Coptis deltoidea | Coptis | Ranunculaceae |
|
| Horsfieldia iryaghedhi | Horsfieldia | Myristicaceae | |
| Fibraurea recisa | Fibraurea | Menispermaceae |
|
| Karwinskia subcordata | Karwinskia | Rhamnaceae | |
| Medicago hispida | Medicago | Fabaceae |
|
| Maytenus octogona | Maytenus | Celastraceae | |
| Agathosma bisulca | Agathosma | Rutaceae | |
| Stephania glabra | Stephania | Menispermaceae |
|
| Brickellia dentata | Brickellia | Asteraceae | |
| Hymenoxys ivesiana | Hymenoxys | Asteraceae | |
| Phellodendron amurense | Phellodendron | Rutaceae |
|
| Corydalis ternata | Corydalis | Papaveraceae | |
| Phellodendron chinese | Phellodendron | Rutaceae | |
| Corydalis tuberosa | Corydalis | Papaveraceae |
|
| Coptis teeta | Coptis | Ranunculaceae |
|
| Dovyalis hebecarpa | Dovyalis | Salicaceae |
|
| Lycopodium chinense | Lycopodium | Lycopodiaceae | |
| Ixeris repens | Ixeris | Asteraceae |
|
| Eremophila oppositifolia | Eremophila | Scrophulariaceae | |
| Achyrocline satureioides | Achyrocline | Asteraceae |
|
| Taxillus yadoriki | Taxillus | Loranthaceae | |
| Corydalis rhizoma | Corydalis | Papaveraceae | |
| Coptis chinensis | Coptis | Ranunculaceae |
|
| Corydalis yanhusuo | Corydalis | Papaveraceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC106295 | C21H25NO4 | 355.1783583 | 0.0968 | 3.22 | 2.548 | 1 | 0 | 40.16 | 8 | 4 | 26 | 0 | |
| NPC112206 | C19H17NO4 | 324.1235831 | -2.2009 | 3 | 1.931 | 0 | 2 | 62.8 | 6 | 4 | 24 | 0 | |
| NPC118804 | C19H21NO3 | Pronuciferine | 311.15 | 0.3797 | 3.11 | 1.662 | 2 | 0 | 38.77 | 5 | 4 | 23 | 0 |
| NPC16452 | C21H22NO4 | Palmitine | 352.15 | -1.3839 | 3.22 | 2.969 | 0 | 0 | 40.8 | 8 | 4 | 26 | 0 |
| NPC188920 | C3H6OS | 1-sulfinylpropane | 90.01393581 | -0.1063 | 1.57 | 0.842 | 1 | 0 | 17.07 | 1 | 0 | 5 | 0 |
| NPC189266 | C19H21NO4 | Stepholidine | 327.15 | -0.7202 | 3 | 1.51 | 1 | 2 | 62.16 | 6 | 4 | 24 | 0 |
| NPC204131 | C37H40N2O6 | 608.288637 | -0.2619 | 4.65 | 5.859 | 8 | 1 | 70.65 | 4 | 6 | 45 | 1 | |
| NPC210437 | C21H25NO4 | Tetrahydropalmatine | 355.18 | 0.0968 | 3.22 | 2.548 | 1 | 0 | 40.16 | 8 | 4 | 26 | 0 |
| NPC218652 | C19H21NO3 | 311.1521435 | 0.3797 | 3.11 | 1.662 | 2 | 0 | 38.77 | 2 | 4 | 23 | 0 | |
| NPC232924 | C18H17NO2 | 279.13 | 0.092 | 3.11 | 3.896 | 1 | 0 | 21.7 | 1 | 5 | 21 | 0 | |
| NPC243743 | C20H19NO4 | 2,3,10-trimethoxy-6,7-dihydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-9-one | 338.1392331 | -1.5305 | 3.11 | 1.692 | 2 | 1 | 49.2 | 3 | 4 | 25 | 0 |
| NPC245618 | C21H21NO5 | 368.1497978 | -2.1358 | 3.11 | 1.932 | 6 | 1 | 58.43 | 4 | 4 | 27 | 0 | |
| NPC248029 | C18H19NO3 | 297.1364935 | -0.1562 | 3 | 1.423 | 2 | 1 | 47.56 | 2 | 4 | 22 | 0 | |
| NPC257084 | C38H42N2O6 | 622.3042871 | 0.274 | 4.76 | 6.098 | 2 | 0 | 61.86 | 4 | 6 | 46 | 1 | |
| NPC289930 | C38H42N2O6 | 622.3042871 | 0.274 | 4.76 | 6.309 | 2 | 0 | 61.86 | 4 | 6 | 46 | 1 | |
| NPC50864 | C20H19NO4 | 2,3,9-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-10-ol | 338.1392331 | 0.071 | 3.11 | 2.169 | 2 | 1 | 30.93 | 3 | 4 | 25 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
