13 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
6 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC80710
Formula: C16H12O5
Ingredient ID: NPC80710
| Common Name | Calycosin |
| IUPAC Name | 7-hydroxy-3-(3-hydroxy-4-methoxyphenyl)chromen-4-one |
| Canonical SMILES | COc1ccc(cc1O)c1coc2c(c1=O)ccc(c2)O |
| Standard InCHI | InChI=1S/C16H12O5/c1-20-14-5-2-9(6-13(14)18)12-8-21-15-7-10(17)3-4-11(15)16(12)19/h2-8,17-18H,1H3 |
| Standard InCHIKey | ZZAJQOPSWWVMBI-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5280448 ZINC ID: ZINC000006018563 ChEMBL ID: CHEMBL241608 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC80710] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Mitracarpus scaber | Mitracarpus | Rubiaceae | |
| Abies pinsapo var. marocana | Abies | Pinaceae | |
| Triclisia subcordata | Triclisia | Menispermaceae | |
| Aspilia parvifolia | Aspilia | Asteraceae | |
| Erysimum leptophyllum | Erysimum | Brassicaceae | |
| Psorothamnus arborescens | Psorothamnus | Fabaceae | |
| Chondrodendron tomentosum | Chondrodendron | Menispermaceae |
  |
| Haplophyllum obtusifolium | Haplophyllum | Rutaceae | |
| Myroxylon peruiferum | Myroxylon | Fabaceae | |
| Corydalis densiflora | Corydalis | Papaveraceae | |
| Schleichera trijuga | Schleichera | Sapindaceae |
|
| Syzygium polycephaloides | Syzygium | Myrtaceae |
|
| Euphrasia genargentea | Euphrasia | Orobanchaceae | |
| Craibiodendron yunnanense | Craibiodendron | Ericaceae | |
| Napoleonaea vogelii | Napoleonaea | Lecythidaceae |
|
| Persea kusanoi | Persea | Lauraceae | |
| Dalbergia parviflora | Dalbergia | Fabaceae |
|
| Xanthorhiza simplicissima | Xanthorhiza | Ranunculaceae |
|
| Mabea fistulifera | Mabea | Euphorbiaceae | |
| Angelica sinensis | Angelica | Apiaceae |
|
| Barringtonia acutangula | Barringtonia | Lecythidaceae |
|
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Embelia ribes | Embelia | Primulaceae |
|
| Glycyrrhiza | Glycyrrhiza | Fabaceae |
|
| Astragalus adsurgens | Astragalus | Fabaceae | |
| Piper regnellii | Piper | Piperaceae |
|
| Desmodium canadense | Desmodium | Fabaceae | |
| Gymnocalycium schickendantzii | Gymnocalycium | Cactaceae | |
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Onopordum acanthium | Onopordum | Asteraceae |
|
| Pancratium sickenbergeri | Pancratium | Amaryllidaceae | |
| Andira inermis | Andira | Fabaceae |
|
| Centaurea maculosa | Centaurea | Asteraceae | |
| Ephedra sinica | Ephedra | Ephedraceae |
|
| Plathymenia reticulata | Plathymenia | Fabaceae | |
| Asimina parviflora | Asimina | Annonaceae |
|
| Pteridium esculentum | Pteridium | Dennstaedtiaceae |
|
| Esenbeckia leiocarpa | Esenbeckia | Rutaceae | |
| Sophora flavescens | Sophora | Fabaceae |
|
| Hypericum styphelioides | Hypericum | Hypericaceae | |
| Artemisia anomala | Artemisia | Asteraceae |
|
| Jasminum sambac | Jasminum | Oleaceae |
|
| Vellozia nanuzae | Vellozia | Velloziaceae | |
| Baccharis neglecta | Baccharis | Asteraceae | |
| Atraphaxis spinosa | Atraphaxis | Polygonaceae |
|
| Embelia schimperi | Embelia | Primulaceae |
|
| Callerya cinerea | Callerya | Fabaceae |
|
| Epilobium hirsutum | Epilobium | Onagraceae |
|
| Astragalus complanatus | Astragalus | Fabaceae |
|
| Lythrum salicaria | Lythrum | Lythraceae |
|
| Simarouba glauca | Simarouba | Simaroubaceae |
|
| Erythrina melanacantha | Erythrina | Fabaceae |
|
| Monsonia senegalensis | Monsonia | Geraniaceae |
|
| Clerodendrum bungei | Clerodendrum | Lamiaceae |
|
| Lemaireocereus longispinus | Lemaireocereus | Cactaceae | |
| Eria anomala | Eria | Orchidaceae | |
| Embelia parviflora | Embelia | Primulaceae |
|
| Dactylorhiza viridis | Dactylorhiza | Orchidaceae | |
| Euphorbia nematocypha | Euphorbia | Euphorbiaceae |
|
| Pterolobium hexapetalum | Pterolobium | Fabaceae |
|
| Abelia chinensis | Abelia | Caprifoliaceae | |
| Diospyros assimilis | Diospyros | Ebenaceae |
|
| Faramea salicifolia | Faramea | Rubiaceae | |
| Trifolium pratense | Trifolium | Fabaceae |
  |
| Croton megistocarpus | Croton | Euphorbiaceae | |
| Vernonia fagifolia | Vernonia | Asteraceae | |
| Cordia leucocephala | Cordia | Cordiaceae | |
| Diplopterygium glaucum | Diplopterygium | Gleicheniaceae | |
| Sophora moorcroftiana | Sophora | Fabaceae |
|
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Hedysarum multijugum maxim | Hedysarum | Fabaceae | |
| Sophora secundiflora | Sophora | Fabaceae |
|
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Erycibe expansa | Erycibe | Convolvulaceae |
|
| Glycine soja | Glycine | Fabaceae |
|
| Bowdichia virgilioides | Bowdichia | Fabaceae |
|
| Maytenus chuchuhuasha | Maytenus | Celastraceae | |
| Dorstenia dinklagei | Dorstenia | Moraceae | |
| Croton zehntneri | Croton | Euphorbiaceae | |
| Oxytropis falcata | Oxytropis | Fabaceae | |
| Helichrysum tenuifolium | Helichrysum | Asteraceae | |
| Bowdichia nitida | Bowdichia | Fabaceae | |
| Sapium haematospermum | Sapium | Euphorbiaceae |
|
| Khaya grandifoliola | Khaya | Meliaceae |
|
| Angelica acutiloba | Angelica | Apiaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Solanum lanceolatum | Solanum | Solanaceae |
|
| Morella rubra | Morella | Myricaceae | |
| Bryonia alba | Bryonia | Cucurbitaceae |
|
| Viburnum erubescens | Viburnum | Adoxaceae |
|
| Geranium sibiricum | Geranium | Geraniaceae |
|
| Remirea maritima | Remirea | Cyperaceae | |
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Baphicacanthus cusia | Baphicacanthus | Acanthaceae |
|
| Lagerstroemia indica | Lagerstroemia | Lythraceae |
|
| Arnica mollis | Arnica | Asteraceae | |
| Dalbergia congestiflora | Dalbergia | Fabaceae |
|
| Croton gratissimus | Croton | Euphorbiaceae |
|
| Wikstroemia viridiflora | Wikstroemia | Thymelaeaceae |
|
| Brassica carinata | Brassica | Brassicaceae |
|
| Hedysarum polybotrys | Hedysarum | Fabaceae |
|
| Ranunculus asiaticus | Ranunculus | Ranunculaceae | |
| Eurycoma harmandiana | Eurycoma | Simaroubaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Eucalyptus resinifera | Eucalyptus | Myrtaceae |
|
| Senecio isatideus | Senecio | Asteraceae | |
| Sinapis alba | Sinapis | Brassicaceae |
|
| Schultesia guianensis | Schultesia | Gentianaceae | |
| Trigonella foenum-graecum | Trigonella | Fabaceae |
|
| Carpha glomerata | Carpha | Cyperaceae | |
| Cyanostegia angustifolia | Cyanostegia | Lamiaceae | |
| Orthosiphon spicatus | Orthosiphon | Lamiaceae |
|
| Lysimachia fordiana | Lysimachia | Primulaceae | |
| Ampelocera edentula | Ampelocera | Ulmaceae | |
| Ixeris debilis | Ixeris | Asteraceae | |
| Abies excelsa | Abies | Pinaceae |
Ingredient ID: NPC57601
Formula: C15H10O3
Ingredient ID: NPC57601
| Common Name | 7-Hydroxyflavone |
| IUPAC Name | 7-hydroxy-2-phenylchromen-4-one |
| Canonical SMILES | Oc1ccc2c(c1)oc(cc2=O)c1ccccc1 |
| Standard InCHI | InChI=1S/C15H10O3/c16-11-6-7-12-13(17)9-14(18-15(12)8-11)10-4-2-1-3-5-10/h1-9,16H |
| Standard InCHIKey | MQGPSCMMNJKMHQ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281894 ZINC ID: ZINC000005934541 ChEMBL ID: CHEMBL276915 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC57601] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Jasminum sambac | Jasminum | Oleaceae |
|
Ingredient ID: NPC325497
Formula: C17H22O2
Ingredient ID: NPC325497
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=CC(OC(=O)c1ccccc1)(CCC=C(C)C)C |
| Standard InCHI | InChI=1S/C17H22O2/c1-5-17(4,13-9-10-14(2)3)19-16(18)15-11-7-6-8-12-15/h5-8,10-12H,1,9,13H2,2-4H3 |
| Standard InCHIKey | BTJXBZZBBNNTOV-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC325497] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Jasminum sambac | Jasminum | Oleaceae |
|
Ingredient ID: NPC307174
Formula: C11H8O3
Ingredient ID: NPC307174
| Common Name | Ramentaceone |
| IUPAC Name | 5-hydroxy-7-methylnaphthalene-1,4-dione |
| Canonical SMILES | Cc1cc(O)c2c(c1)C(=O)C=CC2=O |
| Standard InCHI | InChI=1S/C11H8O3/c1-6-4-7-8(12)2-3-9(13)11(7)10(14)5-6/h2-5,14H,1H3 |
| Standard InCHIKey | OZUSCVSONBBWOR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 26905 ZINC ID: ZINC000000899749 ChEMBL ID: CHEMBL430853 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC307174] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Diospyros maritima | Diospyros | Ebenaceae |
|
| Jasminum sambac | Jasminum | Oleaceae |
|
Ingredient ID: NPC303522
Formula: C12H14O3
Ingredient ID: NPC303522
| Common Name | Eugenyl Acetate |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) acetate |
| Canonical SMILES | C=CCc1ccc(c(c1)OC)OC(=O)C |
| Standard InCHI | InChI=1S/C12H14O3/c1-4-5-10-6-7-11(15-9(2)13)12(8-10)14-3/h4,6-8H,1,5H2,2-3H3 |
| Standard InCHIKey | SCCDQYPEOIRVGX-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 7136 ZINC ID: ZINC000000393900 ChEMBL ID: CHEMBL108299 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC303522] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper attenuatum | Piper | Piperaceae |
|
| Artemisia jacutica | Artemisia | Asteraceae | |
| Bersama abyssinica | Bersama | Melianthaceae |
|
| Aconitum sajanense | Aconitum | Ranunculaceae | |
| Strychnos triplinervia | Strychnos | Loganiaceae |
|
| Jasminum sambac | Jasminum | Oleaceae |
|
| Zingiber officinale | Zingiber | Zingiberaceae |
|
| Laurus nobilis | Laurus | Lauraceae |
|
| Eugenia caryopyhllata | Eugenia | Myrtaceae | |
| Syzygium aromaticum | Syzygium | Myrtaceae |
|
| Cassia jahnii | Cassia | Fabaceae | |
| Alpinia galanga | Alpinia | Zingiberaceae |
|
| Avrainvillea rawsonii | Avrainvillea | Udoteaceae | |
| Damnacanthus major | Damnacanthus | Rubiaceae | |
| Stauntonia hexaphylla | Stauntonia | Lardizabalaceae |
|
| Rubus sanctus | Rubus | Rosaceae |
|
Ingredient ID: NPC295985
Formula: C41H68O14
Ingredient ID: NPC295985
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2C[C@H]3[C@]4([C@@]5([C@H]2C(C)(C)[C@H](CC5)O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O)O)C4)CC[C@]2([C@@]3(C)C[C@@H]([C@@H]2[C@@]2(C)CC[C@@H](C(O2)(C)C)O)O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C41H68O14/c1-35(2)25(54-33-29(49)26(46)20(44)17-51-33)9-11-41-18-40(41)13-12-37(5)31(39(7)10-8-24(45)36(3,4)55-39)19(43)15-38(37,6)23(40)14-21(32(35)41)52-34-30(50)28(48)27(47)22(16-42)53-34/h19-34,42-50H,8-18H2,1-7H3/t19-,20+,21-,22+,23+,24-,25-,26-,27+,28-,29+,30+,31-,32+,33-,34+,37+,38-,39+,40-,41+/m0/s1 |
| Standard InCHIKey | MSEFXJHDXJYSIH-AJQSDSOLSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD100793] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Jasminum sambac | Jasminum | Oleaceae |
|
Ingredient ID: NPC283178
Formula: C11H16O
Ingredient ID: NPC283178
| Common Name | n.a. |
| IUPAC Name | 3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one |
| Canonical SMILES | CC/C=C/CC1=C(C)CCC1=O |
| Standard InCHI | InChI=1S/C11H16O/c1-3-4-5-6-10-9(2)7-8-11(10)12/h4-5H,3,6-8H2,1-2H3/b5-4+ |
| Standard InCHIKey | XMLSXPIVAXONDL-SNAWJCMRSA-N |
| Ingredient External Links |
PubChem CID: 1549019 |
| Plant-Ingredient Association Reference |
Database: TCMID [23113] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Artemisia apiacea | Artemisia | Asteraceae |
|
| Jasminum officinale | Jasminum | Oleaceae |
|
| Mentha canadensis | Mentha | Lamiaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Mosla chinensis | Mosla | Lamiaceae |
|
| Jasminum sambac | Jasminum | Oleaceae |
|
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
| Jasminum grandiflorum | Jasminum | Oleaceae |
|
| Mentha arvensis | Mentha | Lamiaceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Rheedia acuminata | Rheedia | Clusiaceae |
|
| Acacia aulacocarpa | Acacia | Fabaceae | |
| Aspidosperma subincanum | Aspidosperma | Apocynaceae |
|
| Hypericum perforatum | Hypericum | Hypericaceae |
|
| Ardisia neriifolia | Ardisia | Primulaceae | |
| Psiadia dentata | Psiadia | Asteraceae | |
| Peritassa compta | Peritassa | Celastraceae | |
| Eupatorium argentinum | Eupatorium | Asteraceae | |
| Cryptocarya aschersoniana | Cryptocarya | Lauraceae | |
| Juniperus brevifolia | Juniperus | Cupressaceae | |
| Guatteria boliviana | Guatteria | Annonaceae | |
| Camellia sinensis | Camellia | Theaceae |
|
| Anemone flaccida | Anemone | Ranunculaceae |
|
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
Ingredient ID: NPC264537
Formula: C17H22O2
Ingredient ID: NPC264537
| Common Name | n.a. |
| IUPAC Name | 2-(3,7-dimethylocta-1,6-dien-3-yl)benzoate |
| Canonical SMILES | C=CC(c1ccccc1C(=O)[O-])(CCC=C(C)C)C |
| Standard InCHI | InChI=1S/C17H22O2/c1-5-17(4,12-8-9-13(2)3)15-11-7-6-10-14(15)16(18)19/h5-7,9-11H,1,8,12H2,2-4H3,(H,18,19)/p-1 |
| Standard InCHIKey | DAODSZQJYHPURC-UHFFFAOYSA-M |
| Ingredient External Links |
PubChem CID: 22447367 |
| Plant-Ingredient Association Reference |
Database: TCMID [12845] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Citrus medica | Citrus | Rutaceae |
|
| Juglans regia | Juglans | Juglandaceae |
|
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Jasminum sambac | Jasminum | Oleaceae |
|
| Zanthoxylum simulans | Zanthoxylum | Rutaceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Citrus limon | Citrus | Rutaceae |
|
| Magnolia officinalis | Magnolia | Magnoliaceae |
|
Ingredient ID: NPC154728
Formula: C13H20O3
Ingredient ID: NPC154728
| Common Name | n.a. |
| IUPAC Name | methyl 2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
| Canonical SMILES | CC/C=CC[C@@H]1[C@H](CCC1=O)CC(=O)OC |
| Standard InCHI | InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3/b5-4-/t10-,11-/m1/s1 |
| Standard InCHIKey | GEWDNTWNSAZUDX-WQMVXFAESA-N |
| Ingredient External Links |
PubChem CID: 5281929 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC154728] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Mosla chinensis | Mosla | Lamiaceae |
|
| Michelia alba | Michelia | Magnoliaceae |
|
| Jasminum sambac | Jasminum | Oleaceae |
|
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
Ingredient ID: NPC147686
Formula: C15H12O4
Ingredient ID: NPC147686
| Common Name | Liquirtigenin |
| IUPAC Name | (2S)-7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| Canonical SMILES | Oc1ccc(cc1)[C@@H]1CC(=O)c2c(O1)cc(cc2)O |
| Standard InCHI | InChI=1S/C15H12O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-7,14,16-17H,8H2/t14-/m0/s1 |
| Standard InCHIKey | FURUXTVZLHCCNA-AWEZNQCLSA-N |
| Ingredient External Links |
PubChem CID: 114829 ChEMBL ID: CHEMBL252642 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD115156] Database: NPASS [NPC147686] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Mitracarpus scaber | Mitracarpus | Rubiaceae | |
| Abies pinsapo var. marocana | Abies | Pinaceae | |
| Teucrium betonicum | Teucrium | Lamiaceae | |
| Euphrasia genargentea | Euphrasia | Orobanchaceae | |
| Helichrysum asperum | Helichrysum | Asteraceae |
|
| Dalbergia parviflora | Dalbergia | Fabaceae |
|
| Dioscorea nipponica | Dioscorea | Dioscoreaceae |
|
| Xanthorhiza simplicissima | Xanthorhiza | Ranunculaceae |
|
| Glycyrrhiza | Glycyrrhiza | Fabaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Searsia leptodictya | Searsia | Anacardiaceae |
|
| Lophopetalum toxicum | Lophopetalum | Celastraceae | |
| Jasminum sambac | Jasminum | Oleaceae |
|
| Anthoceros punctatus | Anthoceros | Anthocerotaceae | |
| Dactylorhiza viridis | Dactylorhiza | Orchidaceae | |
| Elaeocarpus sphaericus | Elaeocarpus | Elaeocarpaceae |
|
| Pterolobium hexapetalum | Pterolobium | Fabaceae |
|
| Panax notoginseng | Panax | Araliaceae |
|
| Lupinus holosericeus | Lupinus | Fabaceae | |
| Cinchona officinalis | Cinchona | Rubiaceae |
|
| Datura wrightii | Datura | Solanaceae | |
| Polygonatum cyrtonema | Polygonatum | Asparagaceae |
|
| Angelica hirsutiflora | Angelica | Apiaceae | |
| Clausena suffruticosa | Clausena | Rutaceae | |
| Lysimachia christinae | Lysimachia | Primulaceae |
|
| Diplopterygium glaucum | Diplopterygium | Gleicheniaceae | |
| Platymiscium floribundum | Platymiscium | Fabaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Glycine soja | Glycine | Fabaceae |
|
| Maytenus chuchuhuasha | Maytenus | Celastraceae | |
| Dorstenia dinklagei | Dorstenia | Moraceae | |
| Croton zehntneri | Croton | Euphorbiaceae | |
| Oxytropis falcata | Oxytropis | Fabaceae | |
| Sapium haematospermum | Sapium | Euphorbiaceae |
|
| Polygonatum kingianum | Polygonatum | Asparagaceae |
|
| Angelica acutiloba | Angelica | Apiaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Solanum lanceolatum | Solanum | Solanaceae |
|
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Bryonia alba | Bryonia | Cucurbitaceae |
|
| Viburnum erubescens | Viburnum | Adoxaceae |
|
| Remirea maritima | Remirea | Cyperaceae | |
| Arnica mollis | Arnica | Asteraceae | |
| Daemonorops draco | Daemonorops | Arecaceae |
|
| Croton gratissimus | Croton | Euphorbiaceae |
|
| Wikstroemia viridiflora | Wikstroemia | Thymelaeaceae |
|
| Polygonatum falcatum | Polygonatum | Asparagaceae |
|
| Brassica carinata | Brassica | Brassicaceae |
|
| Turpinia arguta | Turpinia | Staphyleaceae | |
| Hedysarum polybotrys | Hedysarum | Fabaceae |
|
| Ranunculus asiaticus | Ranunculus | Ranunculaceae | |
| Eurycoma harmandiana | Eurycoma | Simaroubaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Eucalyptus resinifera | Eucalyptus | Myrtaceae |
|
| Sinapis alba | Sinapis | Brassicaceae |
|
| Carpha glomerata | Carpha | Cyperaceae | |
| Cyanostegia angustifolia | Cyanostegia | Lamiaceae | |
| Orthosiphon spicatus | Orthosiphon | Lamiaceae |
|
| Lysimachia fordiana | Lysimachia | Primulaceae | |
| Ampelocera edentula | Ampelocera | Ulmaceae | |
| Ixeris debilis | Ixeris | Asteraceae | |
| Polygonatum sibiricum | Polygonatum | Asparagaceae |
|
| Abies excelsa | Abies | Pinaceae |
Ingredient ID: NPC140840
Formula: C15H10O5
Ingredient ID: NPC140840
| Common Name | Sulfuretin |
| IUPAC Name | (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| Canonical SMILES | Oc1ccc2c(c1)O/C(=Cc1ccc(c(c1)O)O)/C2=O |
| Standard InCHI | InChI=1S/C15H10O5/c16-9-2-3-10-13(7-9)20-14(15(10)19)6-8-1-4-11(17)12(18)5-8/h1-7,16-18H/b14-6- |
| Standard InCHIKey | RGNXWPVNPFAADO-NSIKDUERSA-N |
| Ingredient External Links |
PubChem CID: 5281295 ZINC ID: ZINC000000897736 ChEMBL ID: CHEMBL490355 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC140840] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Albizia julibrissin | Albizia | Fabaceae |
|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Jasminum sambac | Jasminum | Oleaceae |
|
| Toxicodendron vernicifluum | Toxicodendron | Anacardiaceae |
|
| Dipteryx odorata | Dipteryx | Fabaceae |
|
Ingredient ID: NPC111876
Formula: C12H18O3
Ingredient ID: NPC111876
| Common Name | n.a. |
| IUPAC Name | 2-[(1R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
| Canonical SMILES | CC/C=CCC1[C@H](CCC1=O)CC(=O)[O-] |
| Standard InCHI | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/p-1/b4-3-/t9-,10?/m1/s1 |
| Standard InCHIKey | ZNJFBWYDHIGLCU-WLXIIPMDSA-M |
| Ingredient External Links |
PubChem CID: 25245750 |
| Plant-Ingredient Association Reference |
Database: TCMID [30104] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Jasminum officinale | Jasminum | Oleaceae |
|
| Jasminum sambac | Jasminum | Oleaceae |
|
| Camellia sinensis | Camellia | Theaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC111876 | C12H18O3 | 2-[(1R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate | 209.1177694 | -1.0135 | 2.45 | 1.337 | 3 | 0 | 57.2 | 5 | 1 | 15 | 0 |
| NPC140840 | C15H10O5 | Sulfuretin | 270.05 | -1.7778 | 2.56 | 2.329 | 1 | 3 | 86.99 | 4 | 3 | 20 | 0 |
| NPC147686 | C15H12O4 | Liquirtigenin | 256.07 | -1.3541 | 2.67 | 1.86 | 1 | 2 | 66.76 | 3 | 3 | 19 | 0 |
| NPC154728 | C13H20O3 | 224.1412445 | -0.0847 | 2.56 | 2.139 | 3 | 0 | 43.37 | 8 | 1 | 16 | 0 | |
| NPC264537 | C17H22O2 | 2-(3,7-dimethylocta-1,6-dien-3-yl)benzoate | 257.1541549 | 1.9363 | 3.11 | 6.123 | 2 | 0 | 40.13 | 6 | 1 | 19 | 1 |
| NPC283178 | C11H16O | 3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one | 164.1201151 | 1.1043 | 2.56 | 2.324 | 1 | 0 | 17.07 | 3 | 1 | 12 | 0 |
| NPC295985 | C41H68O14 | 784.4609069 | -3.3674 | 4.43 | 3.326 | 14 | 9 | 228.22 | 6 | 8 | 55 | 2 | |
| NPC303522 | C12H14O3 | Eugenyl Acetate | 206.09 | 0.8957 | 2.45 | 3.224 | 1 | 0 | 35.53 | 7 | 1 | 15 | 0 |
| NPC307174 | C11H8O3 | Ramentaceone | 188.05 | -0.0915 | 2.34 | 0.898 | 2 | 1 | 54.37 | 2 | 2 | 14 | 0 |
| NPC325497 | C17H22O2 | 258.16 | 2.8384 | 3.11 | 5.954 | 2 | 0 | 26.3 | 10 | 1 | 19 | 1 | |
| NPC57601 | C15H10O3 | 7-Hydroxyflavone | 238.06 | -0.9639 | 2.78 | 4.126 | 1 | 1 | 46.53 | 2 | 3 | 18 | 0 |
| NPC80710 | C16H12O5 | Calycosin | 284.07 | -1.6391 | 2.67 | 2.031 | 1 | 2 | 75.99 | 5 | 3 | 21 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
