NPASS Compound

Natural Product: NPC515030

Natural Product ID	NPC515030
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(25R)-5beta-spirostan-3beta-ol 3-O-{beta-D-glucopyranosyl-(1â†’2)-[alpha-L-arabinopyranosyl-(1â†’6)]-beta- D-glucopyranoside}
IUPAC Name	(3~{R},4~{S},5~{S},6~{R})-2-[(3~{R},4~{S},5~{S},6~{R})-4,5-dihydroxy-2-[(1~{R},2~{S},4~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-6-[[(3~{S},4~{R},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxymethyl]tetrahydropyran-3-yl]oxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 133141 0 0 0 0 0 0 0 0999 V2000 10.6562 -1.2700 2.6686 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8651 -0.8986 1.1982 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7551 0.5692 0.9460 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3551 1.0792 0.7918 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5153 0.0629 0.0918 C 0 0 1 0 0 0 0 0 0 0 0 0 9.2121 -0.9229 -0.5711 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9530 -1.6884 0.3031 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6134 -0.5662 0.9680 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6559 -1.1381 0.1818 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2915 -1.2721 0.8728 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3520 -0.7569 -0.1509 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0169 -0.2803 0.3429 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2397 -1.5237 0.7887 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9242 -1.1310 1.3395 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5252 0.2620 1.0203 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9811 0.4428 1.2156 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7814 -0.4311 0.2541 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0223 0.1777 0.1403 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0704 -0.5279 0.6579 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6754 0.1351 1.6497 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5755 1.1203 1.4083 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5769 1.2488 2.5576 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4972 2.2258 2.4438 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0687 3.5354 2.4005 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3817 4.1808 3.6365 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6703 5.3973 3.5455 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6257 6.3411 2.8105 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9876 7.4868 2.4091 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3030 5.5974 1.7113 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4338 6.4331 0.6081 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5643 4.3493 1.2553 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5141 3.6207 0.5055 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2323 1.1072 0.0869 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9457 2.3011 -0.6312 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9849 -0.0121 -0.8537 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2417 -0.6159 -1.1020 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0327 -1.0717 -0.3916 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2753 -1.6000 -1.4042 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3914 -2.9477 -1.6171 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1486 -3.5483 -1.3929 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2717 -4.9169 -1.1837 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9793 -5.6454 -1.4786 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2078 -7.0072 -1.2387 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3824 -5.5225 -2.0040 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5482 -5.7270 -1.2322 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6666 -4.7370 -3.2530 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7385 -5.0550 -4.2622 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7860 -3.2555 -3.0419 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0845 -2.8367 -3.3357 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0495 -0.5505 -1.0379 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1763 0.6633 -1.3233 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9227 0.8406 -0.2820 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0052 2.3789 -0.1165 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2274 0.3099 -0.7693 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9916 1.2980 -1.6013 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3892 0.8586 -1.9271 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1195 0.4446 -0.6728 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1716 1.5077 0.3702 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4540 -0.1815 -0.9715 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6216 0.7362 -0.9514 C 0 0 2 0 0 0 0 0 0 0 0 0 8.3696 0.6968 -2.2941 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0643 -2.2309 2.6664 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0260 -0.5319 3.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6180 -1.4814 3.1843 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9253 -1.1953 0.9714 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3673 0.8081 0.0342 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2583 1.0905 1.7885 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3856 2.0230 0.1727 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9362 1.3831 1.7783 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5403 -2.4231 -0.3086 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2589 -2.2809 0.9457 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9677 -2.1464 -0.1672 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0774 -2.3595 1.0295 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2648 -0.8100 1.8548 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2472 -1.5354 -0.9433 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1538 0.3388 1.2264 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1530 -2.2444 -0.0589 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8826 -2.0562 1.5501 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0334 -1.1715 2.4743 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1175 -1.8807 1.1554 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9551 0.9311 1.8347 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2298 1.4791 0.9976 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1902 0.1635 2.2723 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8186 -1.4260 0.7387 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6139 -1.4720 1.0957 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9747 2.0825 1.4760 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0844 0.2783 2.7455 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0030 1.4297 3.5153 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9604 3.5409 2.4055 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7724 5.3050 2.8954 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4053 5.7580 4.5408 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3598 6.6524 3.6114 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2335 7.6530 3.0564 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3487 5.3363 2.0354 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2998 6.2567 0.1604 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7811 4.6678 0.5405 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2681 3.3279 1.0963 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3495 1.2205 0.2891 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2700 2.1476 -1.5420 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6547 0.3783 -1.8720 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3058 -0.7435 -2.0729 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6382 -1.9020 0.0470 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0952 -3.4565 -0.9415 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5146 -5.0875 -0.1168 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7337 -5.5631 -2.5628 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1538 -5.3072 -0.8297 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6888 -7.1426 -0.3776 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0519 -6.5326 -2.3187 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3975 -6.5062 -0.6718 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6524 -5.1152 -3.6562 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0997 -4.8611 -5.1666 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0505 -2.7705 -3.7498 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4758 -3.4215 -4.0313 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7279 -0.6250 -1.9231 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3920 -1.4370 -1.1177 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8120 1.5436 -1.4068 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2890 0.4715 -2.3101 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0942 2.8907 -1.0791 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0972 2.7466 0.3850 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8977 2.6209 0.4909 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9670 -0.5621 -1.4546 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0007 2.3185 -1.1745 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4477 1.3785 -2.5751 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8970 1.6635 -2.4728 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3946 -0.0256 -2.6026 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1264 1.9245 0.4624 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4172 1.1522 1.3705 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7908 2.3836 0.1389 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3486 -0.7443 -1.9282 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4420 1.7845 -0.7567 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1351 1.6200 -2.8930 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4505 0.7345 -2.0463 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0487 -0.2066 -2.8132 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 6 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 21 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 17 50 1 0 50 51 1 0 51 52 1 0 52 53 1 1 52 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 1 57 59 1 0 59 60 1 0 60 61 1 0 7 2 1 0 59 9 1 0 60 5 1 0 57 11 1 0 54 12 1 0 52 15 1 0 37 19 1 0 48 39 1 0 31 24 1 0 1 62 1 0 1 63 1 0 1 64 1 0 2 65 1 0 3 66 1 0 3 67 1 0 4 68 1 0 4 69 1 0 7 70 1 0 7 71 1 0 9 72 1 6 10 73 1 0 10 74 1 0 11 75 1 6 12 76 1 1 13 77 1 0 13 78 1 0 14 79 1 0 14 80 1 0 15 81 1 1 16 82 1 0 16 83 1 0 17 84 1 1 19 85 1 0 21 86 1 6 22 87 1 0 22 88 1 0 24 89 1 0 26 90 1 0 26 91 1 0 27 92 1 1 28 93 1 0 29 94 1 1 30 95 1 0 31 96 1 6 32 97 1 0 33 98 1 1 34 99 1 0 35100 1 6 36101 1 0 37102 1 1 39103 1 0 41104 1 1 42105 1 0 42106 1 0 43107 1 0 44108 1 6 45109 1 0 46110 1 6 47111 1 0 48112 1 6 49113 1 0 50114 1 0 50115 1 0 51116 1 0 51117 1 0 53118 1 0 53119 1 0 53120 1 0 54121 1 6 55122 1 0 55123 1 0 56124 1 0 56125 1 0 58126 1 0 58127 1 0 58128 1 0 59129 1 6 60130 1 1 61131 1 0 61132 1 0 61133 1 0 M END

Standard InCHIKey	HHWRCNJOZBSQCB-BUSPWNDQSA-N
Standard InCHI	InChI=1S/C44H72O17/c1-19-7-12-44(56-16-19)20(2)30-27(61-44)14-25-23-6-5-21-13-22(8-10-42(21,3)24(23)9-11-43(25,30)4)57-41-38(60-40-37(53)34(50)32(48)28(15-45)58-40)35(51)33(49)29(59-41)18-55-39-36(52)31(47)26(46)17-54-39/h19-41,45-53H,5-18H2,1-4H3/t19?,20-,21+,22-,23+,24-,25-,26+,27-,28+,29+,30-,31+,32+,33+,34-,35-,36-,37+,38+,39?,40?,41?,42-,43-,44+/m0/s1
SMILES	CC1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](OC6O[C@H](COC7OC[C@@H](O)[C@@H](O)[C@@H]7O)[C@@H](O)[C@H](O)[C@H]6OC6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	872.48	Volume:	842.006 ? Van der Waals volume.
Dense:	1.036	LogP:	1.804 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.8 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.695 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.145	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.654	Fsp³:	1.0
MCE-18:	227.955 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.699	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.019 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.219	Promiscuous compounds:	0.004

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.175	MDCK Permeability:	-5.01
Pgp-inhibitor:	0.0	Pgp-substrate:	0.872
PAMPA:	0.997 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.024	30% Bioavailability (F30%):	0.885
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.006
Plasma Protein Binding (PPB):	53.78%	Volume Distribution (VD):	-0.407
Fu:	33.734% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.045
BSEP inhibitor:	0.671

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.972	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.162
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.117

Half-life (T1/2):

3.483

ADMET: Toxicity

hERG Blockers:	0.025	hERG Blockers (10um):	0.17
Human Hepatotoxicity (H-HT):	0.482	Drug-induced Liver Injury (DILI):	0.813
AMES Toxicity:	0.426	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.023	Skin Sensitization:	1.0
Carcinogencity:	0.047	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.996
Hematotoxicity:	0.038	Drug-induced Nephrotoxicity:	0.666
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.141
A549 Cytotoxicity:	0.105	Hek293 Cytotoxicity:	0.633
BCF:	1.805 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.469 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.734 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.963 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO15006	Asparagus africanus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9358645]
NPO15006	Asparagus africanus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15006	Asparagus africanus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC515030 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26707
0.1-0.2	19672
0.2-0.3	2641
0.3-0.4	584
0.4-0.5	129
0.5-0.6	64
0.6-0.7	35
0.7-0.8	0
0.8-0.85	7
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9176	High Similarity	NPC211354
0.8372	Intermediate Similarity	NPC297348
0.8372	Intermediate Similarity	NPC249204
0.8372	Intermediate Similarity	NPC48339
0.8372	Intermediate Similarity	NPC141769
0.8372	Intermediate Similarity	NPC477547
0.8316	Intermediate Similarity	NPC128572
0.8161	Intermediate Similarity	NPC177834
0.7978	Intermediate Similarity	NPC477451
0.7684	Intermediate Similarity	NPC160426
0.7604	Intermediate Similarity	NPC475351
0.7553	Intermediate Similarity	NPC107962
0.7292	Intermediate Similarity	NPC6295
0.7282	Intermediate Similarity	NPC475625
0.7158	Intermediate Similarity	NPC107188
0.7129	Intermediate Similarity	NPC471464
0.7128	Intermediate Similarity	NPC250393
0.7097	Intermediate Similarity	NPC234352
0.7053	Intermediate Similarity	NPC206003
0.7053	Intermediate Similarity	NPC473610
0.699	Remote Similarity	NPC97700
0.699	Remote Similarity	NPC30856
0.6989	Remote Similarity	NPC325828
0.6979	Remote Similarity	NPC19400
0.6931	Remote Similarity	NPC475643
0.6915	Remote Similarity	NPC294686
0.6837	Remote Similarity	NPC215408
0.6796	Remote Similarity	NPC51172
0.6796	Remote Similarity	NPC49032
0.6735	Remote Similarity	NPC264101
0.6697	Remote Similarity	NPC132080
0.6598	Remote Similarity	NPC222731
0.6449	Remote Similarity	NPC475319
0.6422	Remote Similarity	NPC232037
0.6381	Remote Similarity	NPC92890
0.6346	Remote Similarity	NPC473601
0.633	Remote Similarity	NPC116756
0.6311	Remote Similarity	NPC113044
0.6311	Remote Similarity	NPC283829
0.6311	Remote Similarity	NPC161676
0.6275	Remote Similarity	NPC125324
0.625	Remote Similarity	NPC485594
0.6204	Remote Similarity	NPC184617
0.6139	Remote Similarity	NPC54619
0.6117	Remote Similarity	NPC485595
0.61	Remote Similarity	NPC474399
0.6087	Remote Similarity	NPC470866
0.6061	Remote Similarity	NPC291203
0.6061	Remote Similarity	NPC217205
0.6058	Remote Similarity	NPC195297
0.6038	Remote Similarity	NPC202898
0.6036	Remote Similarity	NPC475333
0.6036	Remote Similarity	NPC224098
0.6036	Remote Similarity	NPC208383
0.6	Remote Similarity	NPC115165
0.5965	Remote Similarity	NPC233433
0.5926	Remote Similarity	NPC477809
0.5905	Remote Similarity	NPC141433
0.5876	Remote Similarity	NPC24960
0.5859	Remote Similarity	NPC181845
0.5847	Remote Similarity	NPC480556
0.5818	Remote Similarity	NPC480555
0.5818	Remote Similarity	NPC150372
0.5814	Remote Similarity	NPC481189
0.5789	Remote Similarity	NPC108072
0.575	Remote Similarity	NPC220836
0.5739	Remote Similarity	NPC83137
0.5728	Remote Similarity	NPC128123
0.5726	Remote Similarity	NPC232054
0.5703	Remote Similarity	NPC329807
0.5676	Remote Similarity	NPC151134
0.5652	Remote Similarity	NPC470864
0.5612	Remote Similarity	NPC481418
0.5603	Remote Similarity	NPC476112
0.5603	Remote Similarity	NPC307534
0.5586	Remote Similarity	NPC274200
0.5567	Remote Similarity	NPC277715
0.5556	Remote Similarity	NPC480553
0.5545	Remote Similarity	NPC470433
0.5545	Remote Similarity	NPC46190
0.5545	Remote Similarity	NPC171073
0.553	Remote Similarity	NPC329727
0.5524	Remote Similarity	NPC306131
0.5524	Remote Similarity	NPC200802
0.55	Remote Similarity	NPC94086
0.55	Remote Similarity	NPC473817
0.5478	Remote Similarity	NPC473518
0.5469	Remote Similarity	NPC330026
0.5463	Remote Similarity	NPC70204
0.5446	Remote Similarity	NPC300557
0.5431	Remote Similarity	NPC232611
0.5385	Remote Similarity	NPC480554
0.5306	Remote Similarity	NPC88962
0.53	Remote Similarity	NPC473774
0.53	Remote Similarity	NPC481419
0.53	Remote Similarity	NPC481417
0.5299	Remote Similarity	NPC194207
0.5299	Remote Similarity	NPC22779
0.5273	Remote Similarity	NPC14704
0.5268	Remote Similarity	NPC602423
0.5259	Remote Similarity	NPC269297
0.5259	Remote Similarity	NPC222202
0.525	Remote Similarity	NPC31896
0.5217	Remote Similarity	NPC98018
0.5217	Remote Similarity	NPC284104
0.5217	Remote Similarity	NPC103616
0.5149	Remote Similarity	NPC329820
0.5138	Remote Similarity	NPC485601
0.512	Remote Similarity	NPC477808
0.5091	Remote Similarity	NPC470432
0.5091	Remote Similarity	NPC230507
0.5088	Remote Similarity	NPC248746
0.5086	Remote Similarity	NPC294129
0.5079	Remote Similarity	NPC210569
0.5041	Remote Similarity	NPC84111
0.5041	Remote Similarity	NPC287483
0.5041	Remote Similarity	NPC470865
0.504	Remote Similarity	NPC224314
0.5038	Remote Similarity	NPC481190

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC515030 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7732
0.1-0.2	1348
0.2-0.3	60
0.3-0.4	6
0.4-0.5	2
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6989	Remote Similarity	NPD8171	Phase 2
0.5962	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data