NPASS Compound

Natural Product: NPC309651

Natural Product ID	NPC309651
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	KOQBLQSTXBJTLT-WMZLMIDFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10887654
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 159166 0 0 0 0 0 0 0 0999 V2000 13.1569 1.2214 -2.2290 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7440 0.9378 -2.5895 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9165 0.4494 -1.6737 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4717 0.2169 -0.3249 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5439 0.1889 -2.0593 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1279 0.4156 -3.2365 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5618 -0.3217 -1.2172 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2579 -0.5570 -1.5927 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8143 -1.9868 -1.6992 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4823 -2.0167 -2.3828 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9403 -3.4390 -2.1479 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7485 -1.9168 -3.8911 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4720 -1.0213 -1.9838 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8995 0.2323 -1.3449 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0752 0.7405 -0.2189 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4366 1.8595 -0.3854 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5716 2.5046 0.6550 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9596 1.3584 1.3848 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7478 1.7472 2.2084 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0007 2.6002 3.3778 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1398 2.6019 1.2764 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5351 2.7485 1.8833 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1759 1.3370 1.7901 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4354 0.5107 2.7508 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9591 -0.9270 2.5955 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6876 0.8333 4.1964 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0051 0.4609 2.3795 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8183 -0.5888 3.0748 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9996 -0.8909 2.1705 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8917 0.3607 1.9680 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4089 0.6069 3.3506 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0251 0.0451 1.0746 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1397 -1.4681 1.0275 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4260 0.4200 1.6209 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5109 0.0900 0.6309 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3165 0.3012 -0.8037 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7875 1.7486 -1.0714 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0924 1.9297 -0.6326 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1364 -1.1477 0.9510 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7602 -0.3127 2.7533 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5273 1.4214 1.8410 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1983 1.4452 0.6527 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3106 0.4942 0.3733 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2937 1.2611 -0.5160 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9842 2.3019 0.4115 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8178 3.0810 1.0299 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9221 2.9978 2.4850 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0882 3.2439 3.0102 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9600 2.6973 3.4053 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6409 2.7485 0.5089 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7416 3.1834 -0.3116 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0949 0.5078 -1.2362 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1261 0.7782 -2.6050 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8007 -0.4045 -3.4803 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7429 0.1308 -4.9086 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0345 0.8289 -5.2221 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4693 1.7646 -4.1185 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8746 2.2409 -4.3846 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3039 3.1494 -3.4150 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4407 1.1476 -2.8802 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0615 -0.0497 -5.5286 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5248 -0.8477 -5.8508 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6024 -1.0281 -3.1470 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9855 -0.7154 -0.1598 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4654 -1.8529 0.4907 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1055 -2.8440 -0.4099 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4631 -4.1282 0.3197 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3372 -4.6397 1.1886 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8640 -3.4335 1.9918 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8928 -3.8182 3.0568 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7275 -4.3437 2.5125 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3579 -2.5185 1.0930 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8423 -5.5725 2.0609 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6848 -5.1024 -0.6622 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2913 -2.3405 -0.9302 O 0 0 0 0 0 0 0 0 0 0 0 0 13.2413 1.9279 -1.3890 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7068 1.6962 -3.0723 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6425 0.2598 -1.9925 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4343 1.1463 -3.6159 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3778 -0.4422 -0.4124 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7432 -0.1687 0.4097 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8794 1.1680 0.1217 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1820 -0.1908 -2.6786 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5255 -2.4682 -2.4355 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8924 -2.5944 -0.8038 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8125 -4.1268 -2.3233 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6341 -3.5926 -1.1027 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1698 -3.7157 -2.8774 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3339 -2.7908 -4.4338 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2618 -1.0058 -4.2905 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8390 -1.8783 -4.1098 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6459 -1.5656 -1.4265 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8738 -0.8261 -2.9437 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8886 0.9761 -2.1892 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4869 2.4380 -1.3388 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7673 3.0698 0.1487 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1261 3.2280 1.2768 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4682 0.7674 0.5299 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4400 3.5921 3.3666 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0611 2.9941 3.2982 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7525 2.2176 4.3735 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1483 2.2311 0.2548 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2535 3.6571 1.3518 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0642 3.4663 1.2325 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4836 3.1312 2.8833 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8886 1.0767 0.7495 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0806 -0.7867 2.6556 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6486 -1.4028 1.6727 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7190 -1.4825 3.5262 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6213 1.8811 4.4691 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7268 0.5013 4.4332 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0407 0.1437 4.8030 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0452 0.0628 1.3030 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2151 -1.5385 3.0443 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0557 -0.4032 4.1081 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5260 -1.1250 1.1847 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5155 -1.7122 2.6578 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1819 1.3633 3.4460 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7262 -0.4169 3.7384 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6387 0.8487 4.1141 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4272 -1.7269 2.1020 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0178 -1.8410 0.4818 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2248 -2.0115 0.8342 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4343 1.4709 1.8857 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3599 0.7710 0.9983 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7681 1.9474 -2.1638 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1608 2.4415 -0.4857 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4944 2.7370 -1.0330 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2850 -1.1352 1.9464 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3248 0.2283 3.3634 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4773 1.3149 -0.2245 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9286 0.3046 1.3197 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6542 1.9502 -1.1595 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4706 1.7408 1.2007 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9906 4.1808 0.7736 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8722 3.1316 4.3166 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1885 3.8229 -0.8007 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4852 1.6497 -2.8636 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5973 -1.1656 -3.4533 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9240 0.8964 -4.9250 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8560 1.4874 -6.1182 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7908 2.6334 -4.0821 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5832 1.3810 -4.4712 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8759 2.7802 -5.3545 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4672 2.6409 -2.5920 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6728 0.3655 -6.1937 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0559 -0.6419 -6.6703 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0158 -0.9849 -3.9450 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1222 -1.5383 1.3168 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4024 -3.0965 -1.2405 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3575 -3.9628 0.9485 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5105 -4.9685 0.5615 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7791 -2.9778 2.4376 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3291 -4.5447 3.7879 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6334 -2.9358 3.6603 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4269 -5.1622 2.9793 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0896 -5.9702 2.5614 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8466 -5.5772 -0.9042 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6623 -2.9041 -1.6575 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 10 13 1 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 1 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 24 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 1 30 32 1 0 32 33 1 6 32 34 1 0 34 35 1 0 35 36 1 0 36 37 1 1 37 38 1 0 35 39 1 0 34 40 1 0 23 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 2 0 47 49 1 0 46 50 1 0 45 51 1 0 44 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 57 60 1 0 56 61 1 0 55 62 1 0 54 63 1 0 43 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 69 72 1 0 68 73 1 0 67 74 1 0 66 75 1 0 36 8 1 0 50 42 1 0 60 53 1 0 72 65 1 0 36 14 1 0 32 15 1 0 30 18 1 0 27 19 1 0 1 76 1 0 1 77 1 0 1 78 1 0 2 79 1 0 4 80 1 0 4 81 1 0 4 82 1 0 8 83 1 6 9 84 1 0 9 85 1 0 11 86 1 0 11 87 1 0 11 88 1 0 12 89 1 0 12 90 1 0 12 91 1 0 13 92 1 0 13 93 1 0 14 94 1 6 16 95 1 0 17 96 1 0 17 97 1 0 18 98 1 6 20 99 1 0 20100 1 0 20101 1 0 21102 1 0 21103 1 0 22104 1 0 22105 1 0 23106 1 6 25107 1 0 25108 1 0 25109 1 0 26110 1 0 26111 1 0 26112 1 0 27113 1 6 28114 1 0 28115 1 0 29116 1 0 29117 1 0 31118 1 0 31119 1 0 31120 1 0 33121 1 0 33122 1 0 33123 1 0 34124 1 1 35125 1 1 37126 1 0 37127 1 0 38128 1 0 39129 1 0 40130 1 0 42131 1 6 43132 1 1 44133 1 6 45134 1 1 46135 1 1 49136 1 0 51137 1 0 53138 1 1 54139 1 6 55140 1 1 56141 1 6 57142 1 1 58143 1 0 58144 1 0 59145 1 0 61146 1 0 62147 1 0 63148 1 0 65149 1 1 66150 1 6 67151 1 1 68152 1 6 69153 1 1 70154 1 0 70155 1 0 71156 1 0 73157 1 0 74158 1 0 75159 1 0 M END

Standard InCHIKey	KOQBLQSTXBJTLT-WMZLMIDFSA-N
Standard InCHI	InChI=1S/C53H84O22/c1-10-22(2)44(68)71-30-18-48(3,4)17-24-23-11-12-28-50(7)15-14-29(49(5,6)27(50)13-16-51(28,8)52(23,9)41(64)42(65)53(24,30)21-56)72-47-40(75-46-36(62)34(60)32(58)26(20-55)70-46)38(37(63)39(74-47)43(66)67)73-45-35(61)33(59)31(57)25(19-54)69-45/h10-11,24-42,45-47,54-65H,12-21H2,1-9H3,(H,66,67)/b22-10+/t24-,25+,26+,27-,28+,29-,30-,31-,32+,33-,34-,35+,36+,37-,38-,39-,40+,41-,42+,45-,46-,47+,50-,51+,52-,53+/m0/s1
SMILES	C/C=C(C)/C(=O)O[C@H]1CC(C)(C)C[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)[C@H]([C@H]([C@@]12CO)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20274	Cynanchum formosanum	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20056	Pinus monophylla	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20274	Cynanchum formosanum	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20056	Pinus monophylla	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC309651 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21285
0.1-0.2	23798
0.2-0.3	3669
0.3-0.4	691
0.4-0.5	266
0.5-0.6	89
0.6-0.7	40
0.7-0.8	0
0.8-0.85	2
0.85-0.9	3
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9029	High Similarity	NPC473918
0.8846	High Similarity	NPC277212
0.8846	High Similarity	NPC30279
0.8762	High Similarity	NPC71391
0.8431	Intermediate Similarity	NPC329976
0.8	Intermediate Similarity	NPC605294
0.7679	Intermediate Similarity	NPC178264
0.7658	Intermediate Similarity	NPC46823
0.7589	Intermediate Similarity	NPC192765
0.7544	Intermediate Similarity	NPC225791
0.7478	Intermediate Similarity	NPC484059
0.7478	Intermediate Similarity	NPC484060
0.7456	Intermediate Similarity	NPC265841
0.7368	Intermediate Similarity	NPC484061
0.7368	Intermediate Similarity	NPC484062
0.7353	Intermediate Similarity	NPC603026
0.7345	Intermediate Similarity	NPC47995
0.7273	Intermediate Similarity	NPC25998
0.7105	Intermediate Similarity	NPC602995
0.7054	Intermediate Similarity	NPC609119
0.6964	Remote Similarity	NPC478152
0.6964	Remote Similarity	NPC478151
0.6957	Remote Similarity	NPC264566
0.6838	Remote Similarity	NPC329828
0.6757	Remote Similarity	NPC477075
0.6757	Remote Similarity	NPC477076
0.675	Remote Similarity	NPC476779
0.6724	Remote Similarity	NPC478150
0.6697	Remote Similarity	NPC475591
0.6697	Remote Similarity	NPC236870
0.6696	Remote Similarity	NPC477077
0.6667	Remote Similarity	NPC271610
0.6612	Remote Similarity	NPC484833
0.6606	Remote Similarity	NPC44716
0.6481	Remote Similarity	NPC22956
0.64	Remote Similarity	NPC484063
0.64	Remote Similarity	NPC484064
0.6364	Remote Similarity	NPC605226
0.6348	Remote Similarity	NPC187290
0.6283	Remote Similarity	NPC302887
0.6239	Remote Similarity	NPC470475
0.6207	Remote Similarity	NPC609281
0.6195	Remote Similarity	NPC470913
0.6179	Remote Similarity	NPC476780
0.6129	Remote Similarity	NPC312650
0.6129	Remote Similarity	NPC262796
0.6129	Remote Similarity	NPC45346
0.6121	Remote Similarity	NPC160452
0.6121	Remote Similarity	NPC477078
0.6087	Remote Similarity	NPC470914
0.6048	Remote Similarity	NPC488308
0.6034	Remote Similarity	NPC477079
0.6032	Remote Similarity	NPC475377
0.6032	Remote Similarity	NPC476074
0.6032	Remote Similarity	NPC476777
0.6017	Remote Similarity	NPC480939
0.6016	Remote Similarity	NPC329923
0.6016	Remote Similarity	NPC475281
0.6	Remote Similarity	NPC478155
0.6	Remote Similarity	NPC478154
0.5984	Remote Similarity	NPC283417
0.5984	Remote Similarity	NPC200049
0.5952	Remote Similarity	NPC478153
0.592	Remote Similarity	NPC476774
0.5887	Remote Similarity	NPC301639
0.5887	Remote Similarity	NPC478065
0.584	Remote Similarity	NPC470518
0.5814	Remote Similarity	NPC476775
0.5798	Remote Similarity	NPC469947
0.5798	Remote Similarity	NPC480948
0.5789	Remote Similarity	NPC150893
0.5781	Remote Similarity	NPC329657
0.5772	Remote Similarity	NPC470476
0.5769	Remote Similarity	NPC488309
0.5769	Remote Similarity	NPC329960
0.5763	Remote Similarity	NPC23275
0.576	Remote Similarity	NPC181066
0.5758	Remote Similarity	NPC273668
0.5736	Remote Similarity	NPC302543
0.562	Remote Similarity	NPC606553
0.561	Remote Similarity	NPC478600
0.561	Remote Similarity	NPC478599
0.5606	Remote Similarity	NPC476778
0.5564	Remote Similarity	NPC476776
0.5538	Remote Similarity	NPC110700
0.5492	Remote Similarity	NPC477197
0.547	Remote Similarity	NPC251768
0.5462	Remote Similarity	NPC64715
0.5447	Remote Similarity	NPC107536
0.5447	Remote Similarity	NPC280029
0.5447	Remote Similarity	NPC9470
0.5439	Remote Similarity	NPC109079
0.5431	Remote Similarity	NPC192791
0.5431	Remote Similarity	NPC478066
0.5391	Remote Similarity	NPC475167
0.5391	Remote Similarity	NPC82380
0.5391	Remote Similarity	NPC244296
0.5349	Remote Similarity	NPC473755
0.5349	Remote Similarity	NPC478598
0.5345	Remote Similarity	NPC263756
0.5345	Remote Similarity	NPC213674
0.5339	Remote Similarity	NPC159309
0.5339	Remote Similarity	NPC86222
0.5333	Remote Similarity	NPC79718
0.5317	Remote Similarity	NPC284449
0.5312	Remote Similarity	NPC470912
0.528	Remote Similarity	NPC610461
0.5259	Remote Similarity	NPC472949
0.5259	Remote Similarity	NPC157868
0.525	Remote Similarity	NPC470478
0.5246	Remote Similarity	NPC301449
0.5246	Remote Similarity	NPC601290
0.5231	Remote Similarity	NPC134914
0.5203	Remote Similarity	NPC187618
0.5203	Remote Similarity	NPC477193
0.52	Remote Similarity	NPC472267
0.52	Remote Similarity	NPC115656
0.5185	Remote Similarity	NPC295408
0.5172	Remote Similarity	NPC127056
0.5164	Remote Similarity	NPC281148
0.5164	Remote Similarity	NPC114484
0.5161	Remote Similarity	NPC477194
0.5152	Remote Similarity	NPC475513
0.5152	Remote Similarity	NPC329993
0.5126	Remote Similarity	NPC117714
0.5126	Remote Similarity	NPC30289
0.5122	Remote Similarity	NPC606145
0.512	Remote Similarity	NPC11242
0.512	Remote Similarity	NPC62725
0.5116	Remote Similarity	NPC269484
0.5116	Remote Similarity	NPC97918
0.5115	Remote Similarity	NPC21691
0.5083	Remote Similarity	NPC40775
0.5083	Remote Similarity	NPC10607
0.5083	Remote Similarity	NPC46665
0.5083	Remote Similarity	NPC2370
0.5077	Remote Similarity	NPC252289
0.5077	Remote Similarity	NPC305793
0.5046	Remote Similarity	NPC606107
0.5039	Remote Similarity	NPC607904
0.5039	Remote Similarity	NPC610204
0.5038	Remote Similarity	NPC4749
0.5037	Remote Similarity	NPC173435
0.5037	Remote Similarity	NPC172374
0.5037	Remote Similarity	NPC11577
0.5037	Remote Similarity	NPC141600
0.5037	Remote Similarity	NPC478064
0.5036	Remote Similarity	NPC279915
0.5034	Remote Similarity	NPC477474

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC309651 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6770
0.1-0.2	2316
0.2-0.3	59
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data