NPASS Compound

Natural Product: NPC515301

Natural Product ID	NPC515301
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{R},3~{R},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-5-[(2~{S},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{S},5~{R},6~{R})-2-[(2~{R},3~{R},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-6-[(1~{R},2~{S},4~{S},5'~{S},6~{R},7~{S},8~{R},9~{S},12~{S},13~{S},16~{S},18~{R})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icosane-6,2'-tetrahydropyran]-16-yl]oxy-5-[(2~{S},3~{R},4~{S},5~{R},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 137145 0 0 0 0 0 0 0 0999 V2000 12.7672 -1.0715 -1.0466 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3613 -1.2711 -0.5252 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0175 -0.1129 0.3888 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5694 -0.2922 0.8060 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7013 -0.2629 -0.4215 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4771 -0.2105 -1.5576 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3473 -1.2675 -1.6557 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8678 -1.3752 -0.5374 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8045 -0.9727 -1.3424 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5287 -1.7530 -1.0587 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5046 -0.6938 -0.8081 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3419 -1.1084 0.0305 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4922 -2.1466 -0.6352 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0540 -1.8207 -0.7868 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3941 -1.1360 0.3668 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.5522 -0.0513 -0.1682 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5430 0.2420 0.9281 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5487 -0.7053 1.0274 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7706 -0.1173 0.8961 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5162 -0.3662 2.0462 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7508 0.2686 2.0228 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8912 -0.7130 2.1860 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8060 -1.4003 3.3959 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9525 1.1227 0.8084 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2941 1.5292 0.7712 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4367 2.8905 0.8524 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.1558 3.1608 2.0407 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0745 4.5164 2.3555 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7604 4.7101 3.6883 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7300 6.0463 4.0888 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7726 5.3546 1.3301 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.1459 5.2241 1.5294 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4235 4.9542 -0.0842 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4954 5.4039 -0.8871 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2575 3.4777 -0.2730 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6739 3.2564 -1.5167 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6579 0.4436 -0.4829 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7812 -0.0684 -1.1141 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5753 -0.6127 -0.3127 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7882 -0.7389 -1.4402 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8078 -2.0279 -1.9644 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5283 -2.5545 -1.8191 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6741 -3.9330 -2.1001 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5281 -4.7482 -1.5989 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8075 -6.0854 -1.9430 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7342 -4.0319 -3.6083 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5424 -3.5912 -4.1460 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9162 -3.3002 -4.1289 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6298 -2.9409 -5.4667 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2987 -2.0720 -3.3819 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6912 -1.9969 -3.3477 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7644 0.3752 2.2239 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6854 0.7796 1.9370 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3927 -0.3632 1.2438 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8551 -1.3145 2.3271 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4848 0.0816 0.3359 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2370 1.2733 0.8322 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5108 1.5546 0.1158 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3469 0.3143 -0.0142 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6896 -0.2007 1.3409 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5094 0.4705 -0.9356 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7819 0.9360 -0.3422 C 0 0 2 0 0 0 0 0 0 0 0 0 8.3677 1.9977 -1.2851 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7958 -0.3477 -1.8815 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1865 -2.0694 -1.3291 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4275 -0.6764 -0.2445 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3153 -2.1979 0.0800 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6928 -0.0615 1.2657 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0460 0.8101 -0.2307 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4913 -1.2927 1.2791 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3453 0.5352 1.5104 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7739 -2.2295 -1.5680 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8404 -1.2838 -2.6436 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0509 -0.9574 -2.4097 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2580 -2.2620 -2.0095 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6224 -2.4443 -0.2176 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1893 -0.1887 -1.7409 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7494 -1.6014 0.9568 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9054 -2.2681 -1.6810 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6057 -3.1643 -0.1950 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8524 -1.2846 -1.7622 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5049 -2.8006 -0.9204 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2101 -1.8020 0.9997 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0010 -0.3311 -1.1197 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0359 0.8837 -0.3349 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0320 1.2387 0.7726 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6382 0.9723 0.7261 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7662 0.9404 2.9032 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8780 -0.2106 2.1788 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9304 -1.4317 1.3187 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9615 -1.9223 3.4391 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3389 2.0671 0.9070 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4747 3.4364 0.9250 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0164 4.8268 2.5016 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1843 4.1542 4.4854 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7797 4.2744 3.7174 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5697 6.2388 4.5372 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4493 6.4083 1.4845 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5873 5.5588 0.7058 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5227 5.4997 -0.4025 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2178 5.4495 -1.8298 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2673 3.0147 -0.2401 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7433 3.5441 -1.5320 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2125 1.2018 -1.1888 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8791 0.2469 -2.0312 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0186 -1.6121 -0.1210 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4765 -2.6397 -1.3225 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6444 -4.2538 -1.6941 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6196 -4.4920 -2.1855 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4065 -4.7231 -0.5179 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9544 -6.6496 -1.1427 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8388 -5.1200 -3.8621 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1384 -4.2717 -4.7193 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7741 -4.0204 -4.2011 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7409 -3.6778 -6.0879 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8652 -1.1740 -3.9071 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0112 -1.9423 -4.2873 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7805 -0.5672 2.7692 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1817 1.1581 2.8836 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7398 1.7349 1.4109 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1668 0.9130 2.9268 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0329 -1.4345 3.0820 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0928 -2.3175 1.9758 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6904 -0.8559 2.9246 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0106 0.3795 -0.6401 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3460 1.2561 1.9564 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5729 2.1721 0.6548 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0534 2.3449 0.6901 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2510 1.9833 -0.8933 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7839 -0.1878 1.9801 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3896 0.4966 1.8221 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0737 -1.2329 1.3619 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1981 1.0560 -1.8241 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7450 1.4095 0.6342 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3322 2.3772 -0.8787 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4899 1.6120 -2.2973 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6398 2.8503 -1.3482 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 6 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 24 37 1 0 37 38 1 0 37 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 17 52 1 0 52 53 1 0 53 54 1 0 54 55 1 1 54 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 1 59 61 1 0 61 62 1 0 62 63 1 0 7 2 1 0 61 9 1 0 62 5 1 0 59 11 1 0 56 12 1 0 54 15 1 0 39 19 1 0 50 41 1 0 35 26 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 1 3 68 1 0 3 69 1 0 4 70 1 0 4 71 1 0 7 72 1 0 7 73 1 0 9 74 1 6 10 75 1 0 10 76 1 0 11 77 1 6 12 78 1 1 13 79 1 0 13 80 1 0 14 81 1 0 14 82 1 0 15 83 1 1 16 84 1 0 16 85 1 0 17 86 1 6 19 87 1 6 21 88 1 1 22 89 1 0 22 90 1 0 23 91 1 0 24 92 1 1 26 93 1 1 28 94 1 1 29 95 1 0 29 96 1 0 30 97 1 0 31 98 1 1 32 99 1 0 33100 1 6 34101 1 0 35102 1 6 36103 1 0 37104 1 6 38105 1 0 39106 1 1 41107 1 1 43108 1 1 44109 1 0 44110 1 0 45111 1 0 46112 1 1 47113 1 0 48114 1 6 49115 1 0 50116 1 6 51117 1 0 52118 1 0 52119 1 0 53120 1 0 53121 1 0 55122 1 0 55123 1 0 55124 1 0 56125 1 6 57126 1 0 57127 1 0 58128 1 0 58129 1 0 60130 1 0 60131 1 0 60132 1 0 61133 1 6 62134 1 1 63135 1 0 63136 1 0 63137 1 0 M END

Standard InCHIKey	OIFAMCXLOMUUDR-RTJAHFEJSA-N
Standard InCHI	InChI=1S/C45H74O18/c1-19-7-12-45(56-18-19)20(2)30-26(63-45)14-25-23-6-5-21-13-22(8-10-43(21,3)24(23)9-11-44(25,30)4)57-42-39(62-41-36(54)34(52)32(50)28(16-47)59-41)37(55)38(29(17-48)60-42)61-40-35(53)33(51)31(49)27(15-46)58-40/h19-42,46-55H,5-18H2,1-4H3/t19-,20-,21+,22-,23+,24-,25-,26-,27+,28+,29+,30-,31-,32-,33-,34-,35+,36+,37-,38-,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](O[C@@H]6O[C@H](CO)[C@H](O[C@@H]7O[C@H](CO)[C@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@H]6O[C@@H]6O[C@H](CO)[C@H](O)[C@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	902.49	Volume:	868.092 ? Van der Waals volume.
Dense:	1.04	LogP:	1.871 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.86 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.623 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.128	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.69	Fsp³:	1.0
MCE-18:	230.667 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.729	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.019 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.317	Promiscuous compounds:	0.034

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.292	MDCK Permeability:	-5.147
Pgp-inhibitor:	0.0	Pgp-substrate:	0.5
PAMPA:	0.995 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.106
20% Bioavailability (F20%):	0.988	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.667
Plasma Protein Binding (PPB):	56.79%	Volume Distribution (VD):	-0.421
Fu:	34.798% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.004
BSEP inhibitor:	0.002

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.045	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.959	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.945
HLM stability:	0.01 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.516

Half-life (T1/2):

2.043

ADMET: Toxicity

hERG Blockers:	0.005	hERG Blockers (10um):	0.013
Human Hepatotoxicity (H-HT):	0.776	Drug-induced Liver Injury (DILI):	0.991
AMES Toxicity:	0.996	Rat Oral Acute Toxicity:	0.015
Maximum Recommended Daily Dose:	0.006	Skin Sensitization:	1.0
Carcinogencity:	0.411	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.005	Ototoxicity:	0.998
Hematotoxicity:	0.929	Drug-induced Nephrotoxicity:	0.929
Genotoxicity:	0.003	RPMI-8226 Immunitoxicity:	0.391
A549 Cytotoxicity:	0.999	Hek293 Cytotoxicity:	0.982
BCF:	1.596 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.395 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.53 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.876 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO17292	Asparagus racemosus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC515301 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28351
0.1-0.2	18401
0.2-0.3	2514
0.3-0.4	344
0.4-0.5	107
0.5-0.6	63
0.6-0.7	44
0.7-0.8	0
0.8-0.85	12
0.85-0.9	1
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9634	High Similarity	NPC6295
0.9268	High Similarity	NPC19400
0.8523	High Similarity	NPC160426
0.8434	Intermediate Similarity	NPC297348
0.8434	Intermediate Similarity	NPC249204
0.8434	Intermediate Similarity	NPC48339
0.8434	Intermediate Similarity	NPC141769
0.8434	Intermediate Similarity	NPC477547
0.8214	Intermediate Similarity	NPC325828
0.8182	Intermediate Similarity	NPC107962
0.809	Intermediate Similarity	NPC485595
0.8046	Intermediate Similarity	NPC206003
0.8046	Intermediate Similarity	NPC473610
0.8023	Intermediate Similarity	NPC477451
0.8	Intermediate Similarity	NPC195297
0.7979	Intermediate Similarity	NPC128572
0.7955	Intermediate Similarity	NPC211354
0.7872	Intermediate Similarity	NPC471464
0.766	Intermediate Similarity	NPC475643
0.7604	Intermediate Similarity	NPC480555
0.7604	Intermediate Similarity	NPC150372
0.75	Intermediate Similarity	NPC234352
0.7447	Intermediate Similarity	NPC475351
0.7363	Intermediate Similarity	NPC107188
0.7292	Intermediate Similarity	NPC470433
0.7292	Intermediate Similarity	NPC46190
0.7292	Intermediate Similarity	NPC171073
0.7172	Intermediate Similarity	NPC97700
0.7172	Intermediate Similarity	NPC184617
0.7172	Intermediate Similarity	NPC30856
0.7143	Intermediate Similarity	NPC250393
0.7019	Intermediate Similarity	NPC480553
0.6961	Remote Similarity	NPC475625
0.6947	Remote Similarity	NPC125324
0.6923	Remote Similarity	NPC294686
0.6869	Remote Similarity	NPC92890
0.6863	Remote Similarity	NPC269297
0.6863	Remote Similarity	NPC222202
0.6827	Remote Similarity	NPC480554
0.6796	Remote Similarity	NPC475333
0.6796	Remote Similarity	NPC224098
0.6796	Remote Similarity	NPC208383
0.6731	Remote Similarity	NPC194207
0.6731	Remote Similarity	NPC22779
0.67	Remote Similarity	NPC248746
0.6698	Remote Similarity	NPC132080
0.6596	Remote Similarity	NPC222731
0.6593	Remote Similarity	NPC485594
0.6476	Remote Similarity	NPC116756
0.6471	Remote Similarity	NPC51172
0.6471	Remote Similarity	NPC49032
0.6452	Remote Similarity	NPC177834
0.6422	Remote Similarity	NPC232054
0.6415	Remote Similarity	NPC232037
0.6396	Remote Similarity	NPC480556
0.6373	Remote Similarity	NPC477809
0.6355	Remote Similarity	NPC470864
0.6321	Remote Similarity	NPC32361
0.6311	Remote Similarity	NPC42171
0.6311	Remote Similarity	NPC274200
0.63	Remote Similarity	NPC113044
0.63	Remote Similarity	NPC283829
0.63	Remote Similarity	NPC161676
0.6286	Remote Similarity	NPC475319
0.6196	Remote Similarity	NPC24960
0.6195	Remote Similarity	NPC224314
0.6176	Remote Similarity	NPC473601
0.617	Remote Similarity	NPC181845
0.6154	Remote Similarity	NPC300557
0.614	Remote Similarity	NPC477808
0.6132	Remote Similarity	NPC115165
0.6091	Remote Similarity	NPC233433
0.6082	Remote Similarity	NPC474399
0.6071	Remote Similarity	NPC470866
0.6019	Remote Similarity	NPC13193
0.6	Remote Similarity	NPC83137
0.5962	Remote Similarity	NPC602423
0.596	Remote Similarity	NPC54619
0.5941	Remote Similarity	NPC470432
0.5941	Remote Similarity	NPC230507
0.59	Remote Similarity	NPC264101
0.5882	Remote Similarity	NPC141433
0.5876	Remote Similarity	NPC291203
0.5876	Remote Similarity	NPC217205
0.587	Remote Similarity	NPC277715
0.5726	Remote Similarity	NPC220836
0.57	Remote Similarity	NPC121453
0.5664	Remote Similarity	NPC477811
0.5636	Remote Similarity	NPC475550
0.5586	Remote Similarity	NPC473518
0.5579	Remote Similarity	NPC473774
0.5579	Remote Similarity	NPC481419
0.5579	Remote Similarity	NPC481417
0.5575	Remote Similarity	NPC476112
0.5575	Remote Similarity	NPC307534
0.5556	Remote Similarity	NPC6806
0.5547	Remote Similarity	NPC481189
0.5545	Remote Similarity	NPC128123
0.5536	Remote Similarity	NPC232611
0.5524	Remote Similarity	NPC14704
0.549	Remote Similarity	NPC306131
0.549	Remote Similarity	NPC200802
0.5487	Remote Similarity	NPC108072
0.547	Remote Similarity	NPC94086
0.547	Remote Similarity	NPC473817
0.5455	Remote Similarity	NPC73243
0.5455	Remote Similarity	NPC244086
0.5455	Remote Similarity	NPC84956
0.5446	Remote Similarity	NPC309278
0.5439	Remote Similarity	NPC470862
0.5433	Remote Similarity	NPC329807
0.5385	Remote Similarity	NPC215408
0.5364	Remote Similarity	NPC475182
0.5364	Remote Similarity	NPC151134
0.5357	Remote Similarity	NPC247037
0.5345	Remote Similarity	NPC31896
0.5333	Remote Similarity	NPC94272
0.5315	Remote Similarity	NPC98018
0.5315	Remote Similarity	NPC284104
0.5315	Remote Similarity	NPC103616
0.5278	Remote Similarity	NPC202898
0.5273	Remote Similarity	NPC124677
0.5267	Remote Similarity	NPC329727
0.5263	Remote Similarity	NPC144790
0.5263	Remote Similarity	NPC149400
0.5258	Remote Similarity	NPC481420
0.5258	Remote Similarity	NPC481421
0.5238	Remote Similarity	NPC481190
0.5233	Remote Similarity	NPC248944
0.5233	Remote Similarity	NPC7479
0.5233	Remote Similarity	NPC257296
0.5221	Remote Similarity	NPC470863
0.5217	Remote Similarity	NPC249265
0.5172	Remote Similarity	NPC23808
0.5172	Remote Similarity	NPC87998
0.514	Remote Similarity	NPC70204
0.5124	Remote Similarity	NPC477807
0.5078	Remote Similarity	NPC330026
0.5041	Remote Similarity	NPC210569

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC515301 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7853
0.1-0.2	1206
0.2-0.3	76
0.3-0.4	10
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8214	Intermediate Similarity	NPD8171	Phase 2
0.6947	Remote Similarity	NPD8170	Phase 2
0.5233	Remote Similarity	NPD6928	Phase 2
0.5155	Remote Similarity	NPD7991	Discontinued

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data