NPASS Compound

Natural Product: NPC477344

Natural Product ID	NPC477344
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Tyrianthin 6
IUPAC Name	[(2R,3S,4R,5R,6S)-6-[[(1S,3R,4S,5S,6R,8S,10R,11S,12S,13R,15R,29R,30S,31S,33R)-33-butanoyloxy-4,5,11,12-tetrahydroxy-6-(hydroxymethyl)-13,31-dimethyl-27-oxo-17-pentyl-2,7,9,14,16,28,32-heptaoxatetracyclo[27.3.1.03,8.010,15]tritriacontan-30-yl]oxy]-4,5-dihydroxy-2-methyloxan-3-yl] 2-methylbutanoate
Synonyms	Tyrianthin 6
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	16216154
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 154158 0 0 0 0 0 0 0 0999 V2000 -12.1640 2.7230 1.8940 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6842 2.7120 1.5684 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0431 1.4808 2.1518 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5581 1.4395 1.8533 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3116 1.4259 0.3914 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8560 1.3789 -0.0193 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1900 2.5931 0.5312 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7265 2.7039 0.1349 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5277 2.9353 -1.3450 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0397 2.8285 -1.5997 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2313 3.7523 -0.7459 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7346 3.5310 -0.9662 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2468 3.8926 -2.3140 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1598 3.5280 -2.6410 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2266 3.9330 -1.6804 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0963 3.0866 -0.4412 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0702 3.6160 0.6844 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0013 1.7234 -0.5188 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8537 0.7893 0.4873 C 0 0 2 0 0 0 0 0 0 0 0 0 3.0443 0.0120 0.9164 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4969 -1.0434 1.9223 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2035 -0.7807 2.2916 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2902 -0.9400 1.2533 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8361 -0.2933 0.0030 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5938 -1.1630 -0.8030 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4182 -1.3428 -2.1451 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5143 -0.6849 -2.7187 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2961 -2.2989 -2.8580 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9951 -2.3584 -4.3352 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9315 -3.3562 -4.9757 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8775 -0.3182 1.5912 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9251 -1.1082 1.9855 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5874 -2.1128 3.0335 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6215 -3.5346 2.6326 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1601 -3.8021 1.2602 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2217 -2.9230 1.0542 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6232 -1.6729 0.7755 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6023 -0.8274 0.2671 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6312 -1.4404 -0.3805 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2280 -1.9375 -1.7774 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3726 -2.8711 -2.1968 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6988 -2.1579 -2.1067 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8951 -1.5176 -0.9098 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8561 -0.5878 -0.6193 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2468 0.1999 0.4139 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7756 -3.2152 -2.2338 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1753 -3.2540 -3.5045 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0551 -2.6344 -1.7941 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7718 -5.2079 1.2447 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7062 -5.2412 2.2850 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3495 -4.1540 2.7002 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3612 -1.9532 4.2017 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7771 -2.4387 1.4737 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9493 0.8316 1.5887 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2544 0.6040 1.1887 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9234 1.8899 0.8262 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2778 1.5034 0.2067 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9890 0.6825 1.2584 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1499 -0.4929 1.6312 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9912 0.0212 2.2546 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8847 -1.3126 2.6653 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2951 0.3320 0.8627 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4591 0.7257 1.4706 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3895 1.4603 2.4671 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7857 0.2754 0.9384 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8575 0.8725 1.8066 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9635 0.8117 -0.4835 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2757 0.3837 -1.0534 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0293 2.6428 -0.0657 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2126 2.7114 -0.0057 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.7518 2.0464 1.2408 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3687 2.5776 2.9564 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5335 3.7623 1.6477 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6361 2.6859 0.4490 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2418 3.6245 1.9878 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5702 0.6006 1.7552 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2038 1.5059 3.2613 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1851 0.4668 2.2710 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0817 2.2526 2.4243 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6897 2.4088 -0.0222 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9178 0.6476 -0.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8410 1.3996 -1.1156 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3210 2.7430 1.6115 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6963 3.4795 0.0444 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3556 3.6032 0.6995 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2247 1.7882 0.4680 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0696 2.2367 -1.9921 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8563 3.9801 -1.5882 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8522 3.0049 -2.6958 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7411 1.7838 -1.3533 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3942 3.4883 0.3243 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5172 4.8076 -0.8682 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2774 4.2352 -0.1990 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5391 2.5145 -0.6379 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4026 4.9955 -2.5265 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9138 3.3746 -3.0785 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4184 3.8791 -3.6932 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2135 2.3962 -2.7642 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0423 4.9928 -1.3926 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2408 3.8963 -2.1028 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3879 1.2064 1.4193 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5191 -0.6039 0.1476 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1137 -0.8881 2.8488 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1289 -2.0068 0.9945 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0834 0.2037 -0.6211 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1931 -3.3122 -2.3986 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3412 -1.9683 -2.6982 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2654 -1.3504 -4.7656 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9428 -2.5133 -4.5611 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5928 -3.6439 -5.9881 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0282 -4.2063 -4.2814 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9480 -2.8976 -5.1201 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6794 -0.4036 2.4527 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5351 -1.8875 3.3792 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2491 -4.1476 3.3458 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4092 -3.7669 0.4635 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8265 -1.8865 0.0227 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9772 -2.3080 0.2438 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2554 -1.0365 -2.4340 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3898 -3.7092 -1.4836 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8074 -1.4182 -2.9195 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6449 0.0023 -1.5344 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7779 -2.8092 -2.3603 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4748 -3.8818 -3.0880 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6894 -3.8767 -1.3217 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4211 -4.2179 -3.5984 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1884 -3.5152 -2.2300 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9968 -5.9767 1.3552 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2736 -5.3158 0.2651 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4137 -5.9308 2.1234 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1491 -3.8031 3.4968 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4581 -0.9808 4.4120 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5289 -2.4765 0.6305 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8762 -3.0210 1.1988 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2690 -3.0558 2.2809 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3293 -0.1196 0.3779 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1777 2.4416 1.7805 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0287 0.9322 -0.7097 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0893 1.3333 2.1517 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8615 -1.1229 0.7657 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9556 -1.4546 2.3887 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4128 -2.3197 2.7934 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8609 -0.8435 3.6698 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7836 -0.8146 0.9417 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4977 1.8869 2.1410 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9589 0.2683 2.7195 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8143 0.9518 1.2359 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8424 1.9200 -0.4959 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1538 0.3942 -1.1031 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5077 -0.6226 -0.6968 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0710 1.1393 -0.8506 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1826 0.3207 -2.1624 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5915 3.4384 0.3103 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8112 3.4406 0.5448 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 29 30 1 0 23 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 42 46 1 0 41 47 1 0 40 48 1 0 35 49 1 0 49 50 1 0 34 51 1 0 33 52 1 0 21 53 1 0 20 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 59 61 1 0 58 62 1 0 62 63 1 0 63 64 2 0 63 65 1 0 65 66 1 0 65 67 1 0 67 68 1 0 57 69 1 0 56 70 1 0 45 6 1 0 24 19 1 0 37 32 1 0 44 39 1 0 60 55 1 0 1 71 1 0 1 72 1 0 1 73 1 0 2 74 1 0 2 75 1 0 3 76 1 0 3 77 1 0 4 78 1 0 4 79 1 0 5 80 1 0 5 81 1 0 6 82 1 0 7 83 1 0 7 84 1 0 8 85 1 0 8 86 1 0 9 87 1 0 9 88 1 0 10 89 1 0 10 90 1 0 11 91 1 0 11 92 1 0 12 93 1 0 12 94 1 0 13 95 1 0 13 96 1 0 14 97 1 0 14 98 1 0 15 99 1 0 15100 1 0 19101 1 1 20102 1 6 21103 1 1 23104 1 6 24105 1 6 28106 1 0 28107 1 0 29108 1 0 29109 1 0 30110 1 0 30111 1 0 30112 1 0 32113 1 1 33114 1 1 34115 1 1 35116 1 6 37117 1 6 39118 1 1 40119 1 6 41120 1 1 42121 1 6 44122 1 6 46123 1 0 46124 1 0 46125 1 0 47126 1 0 48127 1 0 49128 1 0 49129 1 0 50130 1 0 51131 1 0 52132 1 0 53133 1 0 53134 1 0 53135 1 0 55136 1 6 56137 1 1 57138 1 6 58139 1 1 59140 1 6 61141 1 0 61142 1 0 61143 1 0 65144 1 0 66145 1 0 66146 1 0 66147 1 0 67148 1 0 67149 1 0 68150 1 0 68151 1 0 68152 1 0 69153 1 0 70154 1 0 M END

Standard InCHIKey	SRKLMZZXYWBRGB-UCVWQDRLSA-N
Standard InCHI	InChI=1S/C49H84O21/c1-8-11-17-21-29-22-18-15-13-12-14-16-19-23-32(52)65-43-40(68-46-38(58)37(57)39(27(6)61-46)67-45(59)25(4)10-3)28(7)62-49(44(43)66-31(51)20-9-2)70-42-36(56)34(54)30(24-50)64-48(42)69-41-35(55)33(53)26(5)60-47(41)63-29/h25-30,33-44,46-50,53-58H,8-24H2,1-7H3/t25?,26-,27-,28+,29?,30-,33-,34-,35+,36+,37-,38-,39-,40+,41-,42-,43-,44-,46+,47+,48+,49+/m1/s1
SMILES	CCCCCC1CCCCCCCCCC(=O)O[C@@H]2[C@H]([C@@H](O[C@H]([C@@H]2OC(=O)CCC)O[C@@H]3[C@H]([C@@H]([C@H](O[C@H]3O[C@@H]4[C@H]([C@@H]([C@H](O[C@H]4O1)C)O)O)CO)O)O)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C)OC(=O)C(C)CC)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1008.55	Volume:	989.963 ? Van der Waals volume.
Dense:	1.019	LogP:	3.623 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.384 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.12 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	45.0
TPSA:	294.35 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	7.0	Rings:	5.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.079	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.416	Fsp³:	0.939
MCE-18:	105.263 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.973	Fluc inhibitor:	0.289 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.003 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.473	Promiscuous compounds:	0.188

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.59	MDCK Permeability:	-4.974
Pgp-inhibitor:	0.001	Pgp-substrate:	0.797
PAMPA:	0.474 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.638
20% Bioavailability (F20%):	0.11	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.77	MRP1:	0.925
Plasma Protein Binding (PPB):	86.643%	Volume Distribution (VD):	-0.224
Fu:	9.224% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.996
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.004
BSEP inhibitor:	0.652

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.058
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.985
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.999
HLM stability:	1.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.832

Half-life (T1/2):

2.823

ADMET: Toxicity

hERG Blockers:	0.015	hERG Blockers (10um):	0.092
Human Hepatotoxicity (H-HT):	0.676	Drug-induced Liver Injury (DILI):	0.998
AMES Toxicity:	0.9	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.999
Hematotoxicity:	0.688	Drug-induced Nephrotoxicity:	0.982
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.572
A549 Cytotoxicity:	0.993	Hek293 Cytotoxicity:	0.362
BCF:	0.463 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.283 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.011 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.043 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	roots	n.a.	n.a.	PMID[17309299]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	Roots	states of Puebla, Morelos, and Distrito Federal, Mexico	2000-2005	PMID[18826278]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	2

Activity Type	# Activity
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT32	Organism	Mus musculus	Mus musculus	Activity	=	88	%	PMID[17309299]
NPT32	Organism	Mus musculus	Mus musculus	Activity	=	33.33	%	PMID[17309299]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477344 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21400
0.1-0.2	24940
0.2-0.3	3289
0.3-0.4	95
0.4-0.5	16
0.5-0.6	30
0.6-0.7	49
0.7-0.8	0
0.8-0.85	4
0.85-0.9	2
0.9-0.95	2
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9583	High Similarity	NPC478734
0.9324	High Similarity	NPC478733
0.9079	High Similarity	NPC297768
0.8608	High Similarity	NPC238264
0.8608	High Similarity	NPC477345
0.8171	Intermediate Similarity	NPC183888
0.8171	Intermediate Similarity	NPC224953
0.8052	Intermediate Similarity	NPC22742
0.8052	Intermediate Similarity	NPC477346
0.7952	Intermediate Similarity	NPC184915
0.7952	Intermediate Similarity	NPC259294
0.7952	Intermediate Similarity	NPC126685
0.7838	Intermediate Similarity	NPC606819
0.7765	Intermediate Similarity	NPC44782
0.7711	Intermediate Similarity	NPC483170
0.7711	Intermediate Similarity	NPC476087
0.7711	Intermediate Similarity	NPC475667
0.7619	Intermediate Similarity	NPC478732
0.759	Intermediate Similarity	NPC307400
0.759	Intermediate Similarity	NPC27289
0.759	Intermediate Similarity	NPC119583
0.7529	Intermediate Similarity	NPC475270
0.7529	Intermediate Similarity	NPC475327
0.7439	Intermediate Similarity	NPC109887
0.7416	Intermediate Similarity	NPC475241
0.7412	Intermediate Similarity	NPC115013
0.7403	Intermediate Similarity	NPC477350
0.7381	Intermediate Similarity	NPC143421
0.7317	Intermediate Similarity	NPC477326
0.7262	Intermediate Similarity	NPC477319
0.7241	Intermediate Similarity	NPC123204
0.7209	Intermediate Similarity	NPC290012
0.7176	Intermediate Similarity	NPC472204
0.7108	Intermediate Similarity	NPC600446
0.7108	Intermediate Similarity	NPC605013
0.7079	Intermediate Similarity	NPC475164
0.7059	Intermediate Similarity	NPC472205
0.7045	Intermediate Similarity	NPC472200
0.7011	Intermediate Similarity	NPC478731
0.6988	Remote Similarity	NPC89843
0.6977	Remote Similarity	NPC478730
0.6941	Remote Similarity	NPC146992
0.6941	Remote Similarity	NPC85759
0.6941	Remote Similarity	NPC267592
0.6818	Remote Similarity	NPC169345
0.6813	Remote Similarity	NPC473605
0.6813	Remote Similarity	NPC475375
0.6786	Remote Similarity	NPC477331
0.6782	Remote Similarity	NPC294748
0.6747	Remote Similarity	NPC113745
0.6747	Remote Similarity	NPC477349
0.6747	Remote Similarity	NPC477320
0.6747	Remote Similarity	NPC477323
0.6747	Remote Similarity	NPC477325
0.6747	Remote Similarity	NPC609436
0.6707	Remote Similarity	NPC281563
0.6667	Remote Similarity	NPC604005
0.6667	Remote Similarity	NPC605014
0.6629	Remote Similarity	NPC238056
0.6517	Remote Similarity	NPC478726
0.6484	Remote Similarity	NPC475525
0.6484	Remote Similarity	NPC475540
0.6477	Remote Similarity	NPC173328
0.6465	Remote Similarity	NPC290276
0.6444	Remote Similarity	NPC477317
0.6444	Remote Similarity	NPC477318
0.6413	Remote Similarity	NPC476066
0.6413	Remote Similarity	NPC477347
0.6364	Remote Similarity	NPC479061
0.6322	Remote Similarity	NPC479059
0.63	Remote Similarity	NPC611287
0.6292	Remote Similarity	NPC479060
0.6275	Remote Similarity	NPC600721
0.6275	Remote Similarity	NPC605872
0.6265	Remote Similarity	NPC146380
0.6222	Remote Similarity	NPC186992
0.6211	Remote Similarity	NPC477348
0.618	Remote Similarity	NPC478725
0.6136	Remote Similarity	NPC158302
0.6098	Remote Similarity	NPC478729
0.6078	Remote Similarity	NPC600672
0.6078	Remote Similarity	NPC610996
0.6036	Remote Similarity	NPC147032
0.6027	Remote Similarity	NPC206823
0.6023	Remote Similarity	NPC477332
0.6	Remote Similarity	NPC478722
0.6	Remote Similarity	NPC478728
0.6	Remote Similarity	NPC477330
0.5943	Remote Similarity	NPC472352
0.5938	Remote Similarity	NPC478727
0.5934	Remote Similarity	NPC479058
0.5934	Remote Similarity	NPC478723
0.5934	Remote Similarity	NPC478724
0.5842	Remote Similarity	NPC77651
0.5833	Remote Similarity	NPC471024
0.5825	Remote Similarity	NPC10121
0.5825	Remote Similarity	NPC198918
0.5825	Remote Similarity	NPC10883
0.5824	Remote Similarity	NPC60849
0.5814	Remote Similarity	NPC477328
0.5747	Remote Similarity	NPC477329
0.5743	Remote Similarity	NPC35338
0.5743	Remote Similarity	NPC204214
0.5743	Remote Similarity	NPC92283
0.5701	Remote Similarity	NPC600940
0.5701	Remote Similarity	NPC610997
0.5686	Remote Similarity	NPC28069
0.5588	Remote Similarity	NPC63404
0.5567	Remote Similarity	NPC269318
0.5421	Remote Similarity	NPC471025
0.5364	Remote Similarity	NPC471026
0.5341	Remote Similarity	NPC475425
0.534	Remote Similarity	NPC124878
0.534	Remote Similarity	NPC231888
0.5306	Remote Similarity	NPC163409
0.5106	Remote Similarity	NPC216883
0.5104	Remote Similarity	NPC476781
0.5051	Remote Similarity	NPC479057

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477344 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7221
0.1-0.2	1848
0.2-0.3	80
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data