NPASS Compound

Natural Product: NPC89843

Natural Product ID	NPC89843
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Murucoidin I
IUPAC Name	n.a.
Synonyms	Murucoidin I
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL494855
PubChem CID	11506286
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 162167 0 0 0 0 0 0 0 0999 V2000 4.3177 4.6488 -0.1653 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6623 4.6117 -1.6312 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5721 3.2554 -2.2477 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5209 2.2587 -1.5636 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3745 0.9469 -2.2507 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1882 -0.1913 -1.6874 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6188 0.1792 -1.7706 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6601 -0.6763 -1.1451 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0503 -0.4844 0.2529 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0063 -0.5644 1.3434 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6414 -0.3584 2.6845 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8210 -0.4267 3.9025 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5890 0.4374 3.9622 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4633 -0.2121 3.2789 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2332 0.6482 3.0343 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2812 -0.2163 2.3021 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5263 -1.4365 2.2537 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1555 0.1864 1.6585 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2886 -0.6218 0.9435 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9525 -1.7208 0.1463 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9584 -1.2182 -0.6223 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8528 -2.0285 -1.2154 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2479 -2.0218 -0.5438 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7634 -0.7924 -0.6101 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0040 -2.9096 -1.3491 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7339 -4.2263 -0.9339 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2313 -5.1446 -2.0168 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2418 -4.3979 -0.6866 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4614 -3.4245 -1.5648 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8425 -3.7417 -2.8996 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9368 -5.7208 -0.9787 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9635 -2.1897 -0.7271 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1419 -2.7090 -0.1291 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1977 -3.8858 0.7271 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9573 -1.6355 0.6671 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0302 -1.0700 1.6417 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2810 -1.8513 2.7350 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4016 -0.6975 -0.1785 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5913 -0.6378 -0.7312 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6797 -0.0508 -1.9675 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8159 1.3494 -1.8870 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5606 1.8749 -3.2793 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3272 1.6015 -1.6161 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7906 0.4606 -0.7343 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5600 0.2062 0.1769 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8545 -0.4234 1.3583 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5132 0.0496 2.6182 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8917 1.1342 2.6286 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8925 -0.7283 3.8012 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3922 -0.9029 3.8594 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1551 0.3788 3.9321 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3751 -0.0353 5.0559 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9607 -0.7010 -1.4606 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1514 -1.3864 -1.2180 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7443 -2.6137 -0.6724 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5226 -3.6777 -1.0327 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3435 -4.8689 -0.1356 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9749 -3.2041 -0.9805 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1922 -2.3538 -2.1973 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9302 -1.5840 -2.4925 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2836 -0.3025 -2.9781 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2324 -1.4399 -2.0264 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8211 -4.3083 -1.0799 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6151 2.8117 -1.0839 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9132 3.8269 -1.9998 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3205 5.0238 -1.7255 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6510 5.5207 -0.4665 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6189 6.6121 -0.1538 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0358 6.1193 -0.5587 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7029 5.5526 -1.7991 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4338 4.0446 -1.8529 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0890 3.5887 -2.9902 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2271 6.1549 -2.9419 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8039 5.8624 0.5837 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3261 5.7286 0.1391 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1699 4.1974 0.4015 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3416 4.2142 0.0858 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6454 5.0442 -1.8098 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9298 5.2566 -2.2068 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8103 3.3081 -3.3116 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5136 2.8682 -2.1550 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5114 2.7391 -1.6366 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2293 2.2613 -0.5038 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7919 1.1112 -3.2922 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3113 0.7284 -2.4192 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0449 -0.9903 -2.5505 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7858 1.2604 -1.4264 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9443 0.2866 -2.8716 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6429 -0.6034 -1.7399 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3974 -1.7650 -1.2934 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4662 0.5717 0.3440 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9328 -1.1326 0.5131 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2378 0.2549 1.1597 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5198 -1.5301 1.2427 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2672 0.5676 2.7173 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4325 -1.1789 2.7978 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4117 -0.2310 4.8365 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4974 -1.5051 4.0367 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8204 1.4452 3.5387 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3293 0.5456 5.0615 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7092 -0.7387 2.3894 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1090 -1.0433 4.0249 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5222 1.4942 2.3621 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7718 0.9899 3.9496 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9037 0.0800 0.1249 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3083 -2.5764 0.7016 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0899 -1.5398 -2.2233 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0867 -2.4549 0.4457 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2711 -4.4217 -0.0040 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4835 -4.5730 -2.9516 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1863 -5.6080 -1.6784 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5228 -5.9724 -2.2360 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0517 -4.2343 0.3851 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4169 -3.6850 -1.4889 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5792 -4.6750 -3.0340 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9619 -6.2644 -0.1544 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8054 -3.0945 -0.9459 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6965 -4.3211 1.2287 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6517 -4.7177 0.1471 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9155 -3.6835 1.5455 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7854 -2.2362 1.0298 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4833 -0.1270 2.0238 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7406 -1.2626 3.4160 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0859 -1.6543 -0.7247 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1598 1.8494 -1.2178 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1926 2.9108 -3.3005 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7561 1.2491 -3.7409 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4451 1.7199 -3.9390 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7294 1.5280 -2.6355 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6249 0.6568 -0.1020 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0529 1.1354 0.3457 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4299 -1.7273 3.7065 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6261 -1.5078 4.7660 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6967 -1.4854 2.9673 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5189 0.7082 2.9316 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4928 1.1634 4.3819 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0484 0.2339 4.5574 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2488 1.0574 4.7977 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1276 -0.1097 5.8638 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3754 -0.4164 5.3543 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7587 -0.8685 -0.4705 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2931 -3.9278 -2.0966 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2107 -5.8307 -0.7027 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2304 -4.9810 0.5261 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4771 -4.6777 0.5308 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1583 -2.5902 -0.0788 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4104 -3.0624 -3.0384 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3027 -2.0783 -3.2825 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4420 0.3240 -2.2012 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1390 -0.6950 -2.6633 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7648 -3.9795 -1.0573 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7915 3.5368 -3.0518 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5577 4.7693 0.3249 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9232 7.4739 -0.8080 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5994 6.8508 0.9150 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6520 6.2562 -0.5536 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9007 7.2219 -0.6270 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7850 5.6843 -1.6900 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8568 3.5085 -1.0045 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5420 3.6879 -3.8162 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1120 7.1391 -2.7276 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5051 6.5867 0.6000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 20 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 2 0 47 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 44 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 58 63 1 0 43 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 67 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 70 73 1 0 69 74 1 0 24 6 1 0 45 39 1 0 60 54 1 0 71 65 1 0 36 19 1 0 29 22 1 0 1 75 1 0 1 76 1 0 1 77 1 0 2 78 1 0 2 79 1 0 3 80 1 0 3 81 1 0 4 82 1 0 4 83 1 0 5 84 1 0 5 85 1 0 6 86 1 6 7 87 1 0 7 88 1 0 8 89 1 0 8 90 1 0 9 91 1 0 9 92 1 0 10 93 1 0 10 94 1 0 11 95 1 0 11 96 1 0 12 97 1 0 12 98 1 0 13 99 1 0 13100 1 0 14101 1 0 14102 1 0 15103 1 0 15104 1 0 19105 1 6 20106 1 1 22107 1 6 23108 1 1 26109 1 1 27110 1 0 27111 1 0 27112 1 0 28113 1 1 29114 1 6 30115 1 0 31116 1 0 33117 1 6 34118 1 0 34119 1 0 34120 1 0 35121 1 1 36122 1 1 37123 1 0 39124 1 6 41125 1 1 42126 1 0 42127 1 0 42128 1 0 43129 1 6 44130 1 1 45131 1 1 49132 1 6 50133 1 0 50134 1 0 51135 1 0 51136 1 0 51137 1 0 52138 1 0 52139 1 0 52140 1 0 54141 1 1 56142 1 6 57143 1 0 57144 1 0 57145 1 0 58146 1 1 59147 1 6 60148 1 6 61149 1 0 62150 1 0 63151 1 0 65152 1 6 67153 1 1 68154 1 0 68155 1 0 68156 1 0 69157 1 6 70158 1 1 71159 1 1 72160 1 0 73161 1 0 74162 1 0 M END

Standard InCHIKey	JFUPYRTZBHJNLX-DPRLMCIYSA-N
Standard InCHI	InChI=1S/C51H88O23/c1-9-11-17-20-29-21-18-15-13-12-14-16-19-22-30(52)69-43-39(61)40(27(7)66-50(43)73-42-36(58)33(55)26(6)65-49(42)68-29)71-51-45(70-46(62)23(3)10-2)44(74-48-38(60)35(57)32(54)25(5)64-48)41(28(8)67-51)72-47-37(59)34(56)31(53)24(4)63-47/h23-29,31-45,47-51,53-61H,9-22H2,1-8H3/t23-,24-,25-,26+,27-,28-,29-,31-,32-,33-,34+,35+,36-,37+,38+,39+,40-,41-,42+,43+,44+,45+,47-,48-,49-,50-,51-/m0/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@H](O[C@H]3[C@H](O1)O[C@H](C)[C@@H]([C@@H]3O)O)O[C@@H](C)[C@@H]([C@H]2O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1OC(=O)[C@H](CC)C)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1068.57	Volume:	1036.215 ? Van der Waals volume.
Dense:	1.031	LogP:	2.462 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.685 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.22 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	48.0
TPSA:	326.97 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	9.0	Rings:	6.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.091	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.01	Fsp³:	0.961
MCE-18:	126.9 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.956	Fluc inhibitor:	0.334 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.555	Promiscuous compounds:	0.045

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.086	MDCK Permeability:	-4.992
Pgp-inhibitor:	0.0	Pgp-substrate:	0.994
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.005
50% Bioavailability (F50%):	0.726

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.958
Plasma Protein Binding (PPB):	71.336%	Volume Distribution (VD):	-0.274
Fu:	18.871% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.996
OATP1B3 inhibitor:	0.997	BCRP inhibitor:	0.0
BSEP inhibitor:	0.005

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.99
HLM stability:	0.512 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.254

Half-life (T1/2):

2.933

ADMET: Toxicity

hERG Blockers:	0.011	hERG Blockers (10um):	0.185
Human Hepatotoxicity (H-HT):	0.268	Drug-induced Liver Injury (DILI):	0.966
AMES Toxicity:	0.788	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.519	Drug-induced Nephrotoxicity:	0.915
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.649
A549 Cytotoxicity:	0.969	Hek293 Cytotoxicity:	0.211
BCF:	1.153 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.394 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.946 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.026 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	Roots	Ixpantepec, in the state of Oaxaca, Mexico	1996-DEC	PMID[16124750]
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	flowers	n.a.	n.a.	PMID[16643033]
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18500841]
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	4
ED50	4

Activity Type	# Activity
Cell line	4
Organism	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	>	20.0	ug ml-1	PMID[19845338]
NPT1171	Cell line	HEp-2	Homo sapiens	ED50	>	20.0	ug ml-1	PMID[23347584]
NPT165	Cell line	HeLa	Homo sapiens	ED50	>	20.0	ug ml-1	PMID[18313805]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	>	512.0	ug.mL-1	PMID[16792425]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	32.0	ug.mL-1	PMID[8254346]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	256.0	ug.mL-1	PMID[23822611]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	512.0	ug.mL-1	PMID[16792425]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC89843 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21365
0.1-0.2	24827
0.2-0.3	3366
0.3-0.4	170
0.4-0.5	11
0.5-0.6	26
0.6-0.7	54
0.7-0.8	0
0.8-0.85	5
0.85-0.9	4
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9333	High Similarity	NPC119583
0.9091	High Similarity	NPC115013
0.8846	High Similarity	NPC169345
0.8718	High Similarity	NPC483170
0.85	High Similarity	NPC184915
0.85	High Similarity	NPC224953
0.8293	Intermediate Similarity	NPC44782
0.8158	Intermediate Similarity	NPC22742
0.8158	Intermediate Similarity	NPC477346
0.8148	Intermediate Similarity	NPC477317
0.8148	Intermediate Similarity	NPC477318
0.7875	Intermediate Similarity	NPC146992
0.7875	Intermediate Similarity	NPC85759
0.7778	Intermediate Similarity	NPC477319
0.7722	Intermediate Similarity	NPC477331
0.7683	Intermediate Similarity	NPC143421
0.7683	Intermediate Similarity	NPC294748
0.7561	Intermediate Similarity	NPC173328
0.7531	Intermediate Similarity	NPC109887
0.75	Intermediate Similarity	NPC238056
0.75	Intermediate Similarity	NPC290012
0.747	Intermediate Similarity	NPC307400
0.747	Intermediate Similarity	NPC472204
0.747	Intermediate Similarity	NPC27289
0.7419	Intermediate Similarity	NPC10883
0.7407	Intermediate Similarity	NPC158302
0.7326	Intermediate Similarity	NPC472200
0.7284	Intermediate Similarity	NPC478734
0.7262	Intermediate Similarity	NPC186992
0.7241	Intermediate Similarity	NPC269318
0.7237	Intermediate Similarity	NPC478729
0.7215	Intermediate Similarity	NPC281563
0.7176	Intermediate Similarity	NPC478726
0.7126	Intermediate Similarity	NPC123204
0.7108	Intermediate Similarity	NPC478733
0.7053	Intermediate Similarity	NPC290276
0.7051	Intermediate Similarity	NPC477350
0.7011	Intermediate Similarity	NPC126685
0.7	Intermediate Similarity	NPC477329
0.6988	Remote Similarity	NPC477344
0.6962	Remote Similarity	NPC146380
0.6941	Remote Similarity	NPC297768
0.6932	Remote Similarity	NPC163409
0.6875	Remote Similarity	NPC477328
0.6875	Remote Similarity	NPC477330
0.6867	Remote Similarity	NPC477332
0.6829	Remote Similarity	NPC113745
0.6829	Remote Similarity	NPC477320
0.6829	Remote Similarity	NPC477323
0.6829	Remote Similarity	NPC477325
0.6829	Remote Similarity	NPC609436
0.6824	Remote Similarity	NPC267592
0.6818	Remote Similarity	NPC183888
0.6818	Remote Similarity	NPC259294
0.6786	Remote Similarity	NPC600446
0.6786	Remote Similarity	NPC605013
0.6782	Remote Similarity	NPC238264
0.6782	Remote Similarity	NPC476087
0.6782	Remote Similarity	NPC475667
0.6782	Remote Similarity	NPC477345
0.6778	Remote Similarity	NPC478728
0.6744	Remote Similarity	NPC478724
0.6705	Remote Similarity	NPC478732
0.6703	Remote Similarity	NPC478727
0.6701	Remote Similarity	NPC10121
0.6701	Remote Similarity	NPC198918
0.6629	Remote Similarity	NPC475270
0.6629	Remote Similarity	NPC475327
0.6628	Remote Similarity	NPC478722
0.6628	Remote Similarity	NPC478725
0.6627	Remote Similarity	NPC477349
0.6582	Remote Similarity	NPC606819
0.6562	Remote Similarity	NPC28069
0.6559	Remote Similarity	NPC475241
0.6552	Remote Similarity	NPC478723
0.6548	Remote Similarity	NPC604005
0.6548	Remote Similarity	NPC605014
0.6458	Remote Similarity	NPC63404
0.6413	Remote Similarity	NPC475164
0.6392	Remote Similarity	NPC77651
0.6289	Remote Similarity	NPC35338
0.6289	Remote Similarity	NPC204214
0.6289	Remote Similarity	NPC92283
0.6214	Remote Similarity	NPC600940
0.6207	Remote Similarity	NPC477326
0.617	Remote Similarity	NPC473605
0.617	Remote Similarity	NPC475375
0.6154	Remote Similarity	NPC472352
0.6111	Remote Similarity	NPC478730
0.6091	Remote Similarity	NPC147032
0.604	Remote Similarity	NPC611287
0.6	Remote Similarity	NPC471026
0.6	Remote Similarity	NPC472205
0.598	Remote Similarity	NPC610996
0.5914	Remote Similarity	NPC479057
0.5889	Remote Similarity	NPC479061
0.5888	Remote Similarity	NPC471024
0.5859	Remote Similarity	NPC124878
0.5859	Remote Similarity	NPC231888
0.5851	Remote Similarity	NPC475525
0.5851	Remote Similarity	NPC475540
0.5824	Remote Similarity	NPC479060
0.5806	Remote Similarity	NPC478731
0.5789	Remote Similarity	NPC476066
0.5714	Remote Similarity	NPC60849
0.5682	Remote Similarity	NPC87153
0.5667	Remote Similarity	NPC479059
0.5652	Remote Similarity	NPC44682
0.5581	Remote Similarity	NPC475425
0.5566	Remote Similarity	NPC600721
0.5566	Remote Similarity	NPC605872
0.5524	Remote Similarity	NPC600672
0.5474	Remote Similarity	NPC162925
0.5472	Remote Similarity	NPC471025
0.5463	Remote Similarity	NPC610997
0.5306	Remote Similarity	NPC477347
0.53	Remote Similarity	NPC477348
0.5263	Remote Similarity	NPC206823
0.5158	Remote Similarity	NPC479058

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC89843 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7165
0.1-0.2	1896
0.2-0.3	88
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data