NPASS Compound

Natural Product: NPC478730

Natural Product ID	NPC478730
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NNRCWJQQWDANSU-LQMMEGFYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11240233
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0003918] Saccharolipids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 170174 0 0 0 0 0 0 0 0999 V2000 -10.6834 -3.7947 -0.4431 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6968 -4.1503 0.6377 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2630 -3.9567 0.0904 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0440 -2.5521 -0.3086 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8308 -2.1167 -0.9768 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4629 -2.2844 -0.3896 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1321 -3.7105 -0.2271 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6369 -3.8943 0.1741 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5276 -5.3632 0.4365 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1820 -5.8590 0.7544 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2570 -5.7250 -0.4422 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0817 -6.5997 -0.1783 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7426 -6.1559 0.9840 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4732 -4.9216 0.6057 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3908 -4.3843 1.7269 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1016 -3.2611 1.0646 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2816 -3.4388 0.7129 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4738 -2.0916 0.8507 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9285 -0.9430 0.2437 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7096 -0.0989 1.2235 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8389 0.8687 1.9909 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5297 1.0299 3.3559 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5696 0.4619 2.2459 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8979 -0.2078 1.2463 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6623 -0.1156 -0.0449 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0050 -0.5556 -1.1772 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9116 0.2016 -2.3195 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4671 1.3366 -2.2587 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2148 -0.2563 -3.5553 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3012 0.7872 -4.6504 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0330 -1.4600 -4.0496 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4411 0.0453 1.1621 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8394 1.3342 1.3443 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3092 1.6753 2.7394 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6681 3.1350 2.7166 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3115 3.6335 1.4786 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7541 5.0532 1.2541 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4210 5.7665 0.2707 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7399 6.1392 0.2562 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4382 5.7891 1.2632 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4238 6.8990 -0.7981 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4642 6.2199 -2.1351 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7751 7.3845 -0.3350 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4525 8.1632 -1.4581 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5893 6.3472 0.1053 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1709 2.9323 0.3270 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0975 1.5812 0.4675 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9899 0.8495 -0.6950 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2002 0.4293 -1.2480 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9493 1.5717 -1.8644 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4100 1.4696 -1.5678 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5739 1.2183 -0.1062 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0270 1.3877 0.3172 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9919 0.0740 0.3595 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9980 -0.4810 -0.3928 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5024 -1.5796 -1.1159 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9718 2.7559 -1.8041 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7171 1.6783 -3.2409 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5444 3.3494 3.7951 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3477 1.4679 3.7157 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5523 0.7032 0.4086 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8997 0.4496 0.6301 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5284 -0.1697 -0.6281 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3879 0.9056 -1.3049 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5352 1.2403 -0.3710 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9650 1.2274 1.0472 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7402 2.2021 1.9155 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6254 1.5852 0.9528 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5958 0.3224 -0.5001 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8727 0.7222 -0.8550 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1528 1.9266 -1.0801 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9560 -0.2917 -0.9768 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2688 0.3261 -1.3486 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0538 -1.0376 0.3307 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7269 -1.7089 0.5969 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2545 -0.1050 1.3519 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5604 2.0053 -1.4705 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3890 -1.2146 -0.3010 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6031 -4.4166 -0.4070 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0024 -2.7438 -0.4100 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2361 -3.9512 -1.4639 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8413 -3.5437 1.5500 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8515 -5.2064 0.9074 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6737 -4.1110 1.0597 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9666 -4.7404 -0.5870 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9724 -2.2770 -0.9416 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1880 -1.9036 0.6274 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9708 -1.0130 -1.2537 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8445 -2.6103 -2.0225 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5128 -1.7625 0.6269 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6786 -4.2761 0.5440 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2547 -4.2885 -1.1883 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0781 -3.5650 -0.7138 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4479 -3.3129 1.0711 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2774 -5.6556 1.2409 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9493 -5.9183 -0.4758 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7271 -5.2802 1.6172 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1922 -6.9128 1.1334 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7699 -5.9869 -1.3848 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9389 -4.6617 -0.5609 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4412 -7.6559 -0.0504 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5355 -6.6130 -1.1277 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1289 -5.9970 1.8840 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5170 -6.9458 1.1843 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7361 -4.1069 0.4524 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1134 -5.0941 -0.2959 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7108 -4.0518 2.5341 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0982 -5.1664 2.0645 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5183 -1.0889 -0.6735 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3133 -0.7448 1.8884 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8918 1.9142 1.5615 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2571 0.2344 4.0493 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2477 2.0062 3.8194 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6257 1.0937 3.1953 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9565 -1.3012 1.5623 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0470 0.9057 -0.2320 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8385 -0.5064 -3.4044 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6861 1.0697 -5.0225 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9778 0.4869 -5.4800 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7605 1.6972 -4.2109 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8374 -1.1058 -4.7573 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5517 -1.9293 -3.2045 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4175 -2.1674 -4.6333 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0501 2.0286 1.0288 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2320 1.0797 2.9323 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7502 3.7144 2.9678 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4318 3.7315 1.6516 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6524 5.5923 2.2329 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6998 4.9061 0.9127 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7992 7.8365 -0.9511 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1091 5.3346 -2.1457 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4480 5.9839 -2.4558 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9015 6.9453 -2.8527 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6232 8.1469 0.4824 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9134 7.4606 -2.2010 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2854 8.7848 -1.0426 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7379 8.8578 -1.9389 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1486 5.9570 -0.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9381 1.1999 1.0604 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8670 -0.2087 -2.1388 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6174 2.5609 -1.4478 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9546 0.8107 -2.2451 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0431 2.0786 0.4098 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7022 1.1577 -0.5393 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2532 2.4062 0.6716 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2921 0.6677 1.1237 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2858 -0.9564 0.3579 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9541 2.6265 -1.9104 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7856 2.6325 -3.5381 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4907 4.2827 4.1180 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2342 2.2483 4.2815 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0348 -0.2915 1.4105 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7830 -0.5570 -1.3239 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7681 0.4902 -2.2471 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8649 2.2690 -0.5927 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0979 0.2245 1.5014 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7035 1.7506 2.1507 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1666 2.4042 2.8182 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8933 3.1102 1.2899 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6744 -0.9893 -1.8130 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1772 1.3747 -1.7025 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9679 0.3619 -0.4812 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8116 -0.2385 -2.1358 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8788 -1.7774 0.2949 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8928 -2.6687 1.1446 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0774 -1.1051 1.2733 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1759 -1.9344 -0.3533 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2172 0.0122 1.5448 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0013 2.8292 -1.1167 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0354 -2.0945 -0.5972 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 29 30 1 0 29 31 1 0 24 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 2 0 39 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 43 45 1 0 36 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 54 55 1 0 55 56 1 0 51 57 1 0 50 58 1 0 35 59 1 0 34 60 1 0 20 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 66 68 1 0 65 69 1 0 69 70 1 0 70 71 2 0 70 72 1 0 72 73 1 0 72 74 1 0 74 75 1 0 74 76 1 0 64 77 1 0 63 78 1 0 56 6 1 0 68 62 1 0 25 19 1 0 47 33 1 0 55 49 1 0 1 79 1 0 1 80 1 0 1 81 1 0 2 82 1 0 2 83 1 0 3 84 1 0 3 85 1 0 4 86 1 0 4 87 1 0 5 88 1 0 5 89 1 0 6 90 1 1 7 91 1 0 7 92 1 0 8 93 1 0 8 94 1 0 9 95 1 0 9 96 1 0 10 97 1 0 10 98 1 0 11 99 1 0 11100 1 0 12101 1 0 12102 1 0 13103 1 0 13104 1 0 14105 1 0 14106 1 0 15107 1 0 15108 1 0 19109 1 6 20110 1 1 21111 1 6 22112 1 0 22113 1 0 22114 1 0 24115 1 1 25116 1 6 29117 1 0 30118 1 0 30119 1 0 30120 1 0 31121 1 0 31122 1 0 31123 1 0 33124 1 6 34125 1 1 35126 1 1 36127 1 1 37128 1 0 37129 1 0 41130 1 0 42131 1 0 42132 1 0 42133 1 0 43134 1 0 44135 1 0 44136 1 0 44137 1 0 45138 1 0 47139 1 1 49140 1 6 50141 1 1 51142 1 6 52143 1 1 53144 1 0 53145 1 0 53146 1 0 55147 1 1 57148 1 0 58149 1 0 59150 1 0 60151 1 0 62152 1 1 63153 1 6 64154 1 6 65155 1 6 66156 1 1 67157 1 0 67158 1 0 67159 1 0 72160 1 0 73161 1 0 73162 1 0 73163 1 0 74164 1 0 75165 1 0 75166 1 0 75167 1 0 76168 1 0 77169 1 0 78170 1 0 M END

Standard InCHIKey	NNRCWJQQWDANSU-LQMMEGFYSA-N
Standard InCHI	InChI=1S/C54H92O24/c1-11-12-18-21-33-22-19-16-14-13-15-17-20-23-35(57)73-46-43(76-51-41(63)40(62)42(31(9)69-51)74-50(66)27(5)29(7)56)32(10)70-54(47(46)75-48(64)25(2)3)78-45-39(61)37(59)34(24-67-49(65)26(4)28(6)55)72-53(45)77-44-38(60)36(58)30(8)68-52(44)71-33/h25-34,36-47,51-56,58-63H,11-24H2,1-10H3/t26?,27?,28?,29?,30-,31-,32+,33+,34-,36-,37-,38+,39+,40-,41-,42-,43+,44-,45-,46-,47-,51+,52+,53+,54+/m1/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)O[C@@H]2[C@H]([C@H](C)O[C@H]([C@@H]2OC(=O)C(C)C)O[C@@H]2[C@H]([C@@H]([C@@H](COC(=O)C(C)C(C)O)O[C@H]2O[C@@H]2[C@H]([C@@H]([C@@H](C)O[C@H]2O1)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C)O1)OC(=O)C(C)C(C)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3955	Ipomoea stans	Species	Convolvulaceae	Eukaryota	Roots	n.a.	n.a.	PMID[15387658]
NPO3955	Ipomoea stans	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8594150]
NPO3955	Ipomoea stans	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT148	Cell line	HCT-15	Homo sapiens	ED50	>	24.0	ug ml-1	PMID[15387658]
NPT382	Cell line	OVCAR-5	Homo sapiens	ED50	>	25.0	ug ml-1	PMID[15387658]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478730 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22675
0.1-0.2	24741
0.2-0.3	2266
0.3-0.4	48
0.4-0.5	29
0.5-0.6	45
0.6-0.7	34
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	8
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9241	High Similarity	NPC478732
0.9125	High Similarity	NPC475270
0.9125	High Similarity	NPC475327
0.9114	High Similarity	NPC476087
0.9114	High Similarity	NPC475667
0.9012	High Similarity	NPC475525
0.9012	High Similarity	NPC475540
0.9	High Similarity	NPC478731
0.8902	High Similarity	NPC476066
0.8471	Intermediate Similarity	NPC473605
0.8471	Intermediate Similarity	NPC475375
0.8353	Intermediate Similarity	NPC475164
0.7857	Intermediate Similarity	NPC186992
0.7738	Intermediate Similarity	NPC297768
0.7738	Intermediate Similarity	NPC173328
0.75	Intermediate Similarity	NPC478733
0.7262	Intermediate Similarity	NPC478734
0.7215	Intermediate Similarity	NPC606819
0.7209	Intermediate Similarity	NPC60849
0.7126	Intermediate Similarity	NPC479058
0.6977	Remote Similarity	NPC477344
0.6915	Remote Similarity	NPC475241
0.6889	Remote Similarity	NPC115013
0.6818	Remote Similarity	NPC267592
0.6778	Remote Similarity	NPC238264
0.6778	Remote Similarity	NPC477345
0.6703	Remote Similarity	NPC290012
0.6667	Remote Similarity	NPC119583
0.6591	Remote Similarity	NPC158302
0.6591	Remote Similarity	NPC479059
0.6484	Remote Similarity	NPC143421
0.6452	Remote Similarity	NPC224953
0.6413	Remote Similarity	NPC483170
0.6374	Remote Similarity	NPC477319
0.6316	Remote Similarity	NPC269318
0.6316	Remote Similarity	NPC44782
0.6304	Remote Similarity	NPC307400
0.6304	Remote Similarity	NPC27289
0.6277	Remote Similarity	NPC126685
0.625	Remote Similarity	NPC113745
0.625	Remote Similarity	NPC477320
0.625	Remote Similarity	NPC477323
0.625	Remote Similarity	NPC477325
0.625	Remote Similarity	NPC609436
0.6207	Remote Similarity	NPC281563
0.6154	Remote Similarity	NPC109887
0.6111	Remote Similarity	NPC89843
0.6105	Remote Similarity	NPC183888
0.6105	Remote Similarity	NPC184915
0.6067	Remote Similarity	NPC22742
0.6067	Remote Similarity	NPC477346
0.6044	Remote Similarity	NPC477326
0.6042	Remote Similarity	NPC123204
0.6	Remote Similarity	NPC238056
0.587	Remote Similarity	NPC600446
0.587	Remote Similarity	NPC605013
0.5862	Remote Similarity	NPC477350
0.5849	Remote Similarity	NPC610996
0.5795	Remote Similarity	NPC146380
0.5789	Remote Similarity	NPC294748
0.5773	Remote Similarity	NPC259294
0.5761	Remote Similarity	NPC477332
0.5758	Remote Similarity	NPC478728
0.5741	Remote Similarity	NPC600721
0.5741	Remote Similarity	NPC605872
0.5714	Remote Similarity	NPC477349
0.57	Remote Similarity	NPC478727
0.567	Remote Similarity	NPC169345
0.567	Remote Similarity	NPC477317
0.567	Remote Similarity	NPC477318
0.5625	Remote Similarity	NPC472204
0.5607	Remote Similarity	NPC611287
0.5579	Remote Similarity	NPC146992
0.5579	Remote Similarity	NPC85759
0.5579	Remote Similarity	NPC478722
0.5579	Remote Similarity	NPC479061
0.5579	Remote Similarity	NPC478725
0.5556	Remote Similarity	NPC472200
0.5521	Remote Similarity	NPC478723
0.5521	Remote Similarity	NPC478724
0.5521	Remote Similarity	NPC479060
0.5484	Remote Similarity	NPC604005
0.5484	Remote Similarity	NPC605014
0.5446	Remote Similarity	NPC472352
0.5444	Remote Similarity	NPC475425
0.5408	Remote Similarity	NPC478726
0.5361	Remote Similarity	NPC472205
0.5357	Remote Similarity	NPC600940
0.5357	Remote Similarity	NPC610997
0.5347	Remote Similarity	NPC477347
0.53	Remote Similarity	NPC479057
0.5273	Remote Similarity	NPC600672
0.5233	Remote Similarity	NPC479056
0.514	Remote Similarity	NPC124878
0.514	Remote Similarity	NPC231888
0.5111	Remote Similarity	NPC478729
0.5104	Remote Similarity	NPC477331
0.5098	Remote Similarity	NPC163409
0.5051	Remote Similarity	NPC44682

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478730 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7156
0.1-0.2	1942
0.2-0.3	52
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data