NPASS Compound

Natural Product: NPC477325

Natural Product ID	NPC477325
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	[(2S,3R,4R,5S,6S)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-octanoyloxyoxan-2-yl]oxy-6-methyl-2-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] decanoate
IUPAC Name	[(2S,3R,4R,5S,6S)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-octanoyloxyoxan-2-yl]oxy-6-methyl-2-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] decanoate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	118716655
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 200205 0 0 0 0 0 0 0 0999 V2000 -13.0849 -0.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.6754 -1.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2658 -1.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8563 -2.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4468 -2.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0372 -3.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6277 -3.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2181 -4.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8086 -4.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3991 -5.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1386 -6.6949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -4.2535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 -4.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3086 -5.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7181 -5.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9786 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8296 -2.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4200 -3.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 -1.8121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3086 -0.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 0.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4200 1.5935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8296 2.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9786 1.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7181 -0.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8402 -1.3303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2247 -1.9075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0638 -3.3989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7216 -2.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1687 -1.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4092 -0.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3086 0.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7695 1.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7419 3.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2289 4.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2860 5.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0154 6.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5548 7.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0624 6.9254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7000 6.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6153 5.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9257 3.9296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1757 5.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8209 7.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9056 8.1765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3452 7.7552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5706 9.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9889 8.3887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6788 5.5867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4542 8.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3536 9.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2530 10.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1524 11.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0518 13.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3882 0.6293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 0.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3882 -4.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9786 -6.6949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3882 -7.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6382 -8.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3882 -9.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8882 -9.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6382 -8.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8882 -7.2079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7872 -7.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2977 -10.3190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5582 -11.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4091 -12.7604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9677 -12.3092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3772 -12.8223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7868 -13.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.1963 -13.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6059 -14.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.0154 -14.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4249 -15.3874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6486 -11.2832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4891 -9.4711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 -6.6949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4200 -8.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9200 -8.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1700 -9.4711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9200 -10.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4200 -10.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1700 -9.4711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8296 -11.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1805 -12.2474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9791 -10.4353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4895 -7.6590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.4945 -0.0873 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5979 -2.0099 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5719 0.8092 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0373 -1.8237 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8547 -1.8901 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7528 -0.2169 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7789 -3.0360 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1753 -0.8030 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5189 -0.6779 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9598 -4.0620 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9337 -1.2430 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5503 -4.5751 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5242 -1.7560 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1407 -5.0881 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1147 -2.2690 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7312 -5.6011 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7051 -2.7820 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3216 -6.1142 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2956 -3.2951 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2568 -5.9644 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0586 -7.0297 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2181 -5.2176 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7286 -2.4414 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9200 -3.2893 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3507 -1.9268 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4095 -1.1827 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7248 3.6029 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7286 2.4414 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0664 -0.9923 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0320 -3.3360 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5153 -3.2767 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1315 -3.1086 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3327 -2.5552 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8609 -2.1960 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8173 -1.2826 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2003 -0.7714 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8082 0.4030 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0045 1.0109 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1982 2.3191 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1865 2.9578 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9449 4.2580 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7264 4.8583 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0757 6.0096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6742 6.5064 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8582 7.3246 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2558 7.5786 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1063 8.2325 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6630 8.2829 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3526 7.6483 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3184 4.5081 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8302 4.2234 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3840 6.7099 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6970 9.0649 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2356 10.8656 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2260 10.1861 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9151 8.8561 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4920 8.2923 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7010 6.7242 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3723 9.3162 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8366 7.6949 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1532 10.3770 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5540 8.5782 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4534 9.7786 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0526 11.5774 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9520 12.7779 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3529 10.9790 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9513 14.2793 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2523 12.1795 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8514 13.9783 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5372 1.5935 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6595 1.1424 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2370 -0.7802 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2630 2.0389 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7977 -4.7665 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0692 -2.9170 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2314 -5.7453 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9983 -5.8376 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4891 -7.5427 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9786 -10.3190 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8097 -11.3039 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7872 -9.4711 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9363 -6.5786 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7514 -8.6918 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8230 -6.3937 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4547 -13.7188 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4807 -10.8997 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8903 -11.4127 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8642 -14.2318 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2738 -14.7448 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2998 -11.9258 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7094 -12.4388 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6833 -15.2579 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0928 -15.7709 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.1189 -12.9518 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 18.5284 -13.4648 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5024 -16.2839 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 20.8345 -15.9004 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 18.9119 -16.7970 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.9380 -13.9779 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9851 -11.9642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5676 -10.9691 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8296 -7.6590 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9985 -6.6741 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0880 -8.6542 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4895 -11.2832 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 -12.2474 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2391 -11.7962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3165 -12.6927 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8033 -9.7834 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0314 -13.2115 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3886 -9.9223 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7476 -8.4760 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 44 48 1 0 43 49 1 0 38 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 24 55 1 0 21 56 1 0 16 57 1 0 15 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 63 65 1 0 62 66 1 0 66 67 1 0 67 68 2 0 67 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 61 76 1 0 60 77 1 0 14 78 1 0 78 79 1 0 79 80 1 0 80 81 1 0 81 82 1 0 82 83 1 0 83 84 1 0 83 85 1 0 82 86 1 0 81 87 1 0 80 88 1 0 18 13 1 0 25 20 1 0 42 23 1 0 46 40 1 0 64 59 1 0 84 79 1 0 1 89 1 0 1 90 1 0 1 91 1 0 2 92 1 0 2 93 1 0 3 94 1 0 3 95 1 0 4 96 1 0 4 97 1 0 5 98 1 0 5 99 1 0 6100 1 0 6101 1 0 7102 1 0 7103 1 0 8104 1 0 8105 1 0 9106 1 0 9107 1 0 13108 1 6 14109 1 6 15110 1 1 16111 1 6 18112 1 1 20113 1 6 21114 1 1 23115 1 6 24116 1 1 25117 1 1 29118 1 0 29119 1 0 30120 1 0 30121 1 0 31122 1 0 31123 1 0 32124 1 0 32125 1 0 33126 1 0 33127 1 0 34128 1 0 34129 1 0 35130 1 0 35131 1 0 36132 1 0 36133 1 0 37134 1 0 37135 1 0 38136 1 6 40137 1 6 41138 1 1 43139 1 6 44140 1 6 45141 1 6 47142 1 0 47143 1 0 47144 1 0 48145 1 0 49146 1 0 50147 1 0 50148 1 0 51149 1 0 51150 1 0 52151 1 0 52152 1 0 53153 1 0 53154 1 0 54155 1 0 54156 1 0 54157 1 0 55158 1 0 56159 1 0 56160 1 0 56161 1 0 57162 1 0 57163 1 0 57164 1 0 59165 1 1 60166 1 6 61167 1 6 62168 1 1 63169 1 6 65170 1 0 65171 1 0 65172 1 0 69173 1 0 69174 1 0 70175 1 0 70176 1 0 71177 1 0 71178 1 0 72179 1 0 72180 1 0 73181 1 0 73182 1 0 74183 1 0 74184 1 0 75185 1 0 75186 1 0 75187 1 0 76188 1 0 77189 1 0 79190 1 1 80191 1 6 81192 1 6 82193 1 1 83194 1 6 85195 1 0 85196 1 0 85197 1 0 86198 1 0 87199 1 0 88200 1 0 M END

Standard InCHIKey	JEMWDSYXQWEUBC-OVRXSPRISA-N
Standard InCHI	InChI=1S/C64H112O24/c1-9-12-15-17-19-24-30-35-44(67)84-59-58(88-60-50(73)47(70)45(68)36(4)76-60)55(85-61-51(74)49(72)53(38(6)78-61)82-42(65)33-28-22-16-13-10-2)40(8)80-64(59)86-54-39(7)79-62-52(75)56(54)83-43(66)34-29-25-21-18-20-23-27-32-41(31-26-14-11-3)81-63-57(87-62)48(71)46(69)37(5)77-63/h36-41,45-64,68-75H,9-35H2,1-8H3/t36-,37+,38-,39-,40-,41-,45-,46-,47+,48-,49-,50+,51+,52+,53-,54-,55-,56-,57+,58+,59+,60-,61-,62-,63-,64-/m0/s1
SMILES	CCCCCCCCCC(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H](O[C@@H]3[C@@H]([C@@H]2OC(=O)CCCCCCCCC[C@@H](O[C@H]4[C@H](O3)[C@H]([C@H]([C@H](O4)C)O)O)CCCCC)O)C)C)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC(=O)CCCCCCC)O)O)O[C@H]6[C@@H]([C@@H]([C@H]([C@@H](O6)C)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1264.75	Volume:	1267.217 ? Van der Waals volume.
Dense:	0.998	LogP:	5.589 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.852 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.447 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	28.0	Rigid Bonds:	49.0
TPSA:	333.04 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	8.0	Rings:	6.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.029	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.91	Fsp³:	0.953
MCE-18:	120.32 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.999	Fluc inhibitor:	0.333 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.54	Promiscuous compounds:	0.035

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.558	MDCK Permeability:	-5.037
Pgp-inhibitor:	0.0	Pgp-substrate:	0.995
PAMPA:	0.998 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.463
20% Bioavailability (F20%):	0.25	30% Bioavailability (F30%):	0.82
50% Bioavailability (F50%):	0.995

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.999
Plasma Protein Binding (PPB):	95.742%	Volume Distribution (VD):	0.133
Fu:	3.707% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.825
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.36

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.251
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.65
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.982 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.955

Half-life (T1/2):

3.208

ADMET: Toxicity

hERG Blockers:	0.066	hERG Blockers (10um):	0.362
Human Hepatotoxicity (H-HT):	0.348	Drug-induced Liver Injury (DILI):	0.985
AMES Toxicity:	0.506	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.005	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.616	Drug-induced Nephrotoxicity:	0.959
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.724
A549 Cytotoxicity:	1.0	Hek293 Cytotoxicity:	0.407
BCF:	1.039 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.888 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.137 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.945 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20837	Ipomoea aquatica	Species	Convolvulaceae	Eukaryota	Whole Plant	Dongshan, Nanjing, Jiangsu Province, China	2012-NOV	PMID[25314138]
NPO20837	Ipomoea aquatica	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[38192648]
NPO20837	Ipomoea aquatica	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20837	Ipomoea aquatica	Species	Convolvulaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO20837	Ipomoea aquatica	Species	Convolvulaceae	Eukaryota	Plant	n.a.	n.a.	Database[FooDB]
NPO20837	Ipomoea aquatica	Species	Convolvulaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO20837	Ipomoea aquatica	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO20837	Ipomoea aquatica	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	6

Activity Type	# Activity
Cell line	4
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT659	Cell line	SMMC-7721	Homo sapiens	IC50	>	10000	nM	PMID[25314138]
NPT65	Cell line	HepG2	Homo sapiens	IC50	=	4900	nM	PMID[25314138]
NPT1045	Cell line	U2OS	Homo sapiens	IC50	>	10000	nM	PMID[25314138]
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	9800	nM	PMID[25314138]
NPT2	Others	Unspecified	n.a.	IC50	=	6000	nM	PMID[25314138]
NPT2	Others	Unspecified	n.a.	IC50	>	10000	nM	PMID[25314138]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477325 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25434
0.1-0.2	21258
0.2-0.3	2881
0.3-0.4	146
0.4-0.5	24
0.5-0.6	40
0.6-0.7	42
0.7-0.8	0
0.8-0.85	4
0.85-0.9	6
0.9-0.95	5
0.95-1	4

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC113745
1.0	High Similarity	NPC477320
1.0	High Similarity	NPC477323
1.0	High Similarity	NPC609436
0.9412	High Similarity	NPC146380
0.9315	High Similarity	NPC267592
0.9067	High Similarity	NPC307400
0.9067	High Similarity	NPC27289
0.9041	High Similarity	NPC477326
0.8933	High Similarity	NPC477319
0.8816	High Similarity	NPC143421
0.8767	High Similarity	NPC604005
0.8767	High Similarity	NPC605014
0.8608	High Similarity	NPC123204
0.859	High Similarity	NPC290012
0.8356	Intermediate Similarity	NPC281563
0.825	Intermediate Similarity	NPC183888
0.825	Intermediate Similarity	NPC259294
0.8025	Intermediate Similarity	NPC126685
0.7917	Intermediate Similarity	NPC606819
0.7875	Intermediate Similarity	NPC472204
0.7821	Intermediate Similarity	NPC600446
0.7821	Intermediate Similarity	NPC605013
0.7561	Intermediate Similarity	NPC483170
0.75	Intermediate Similarity	NPC109887
0.7237	Intermediate Similarity	NPC477350
0.7229	Intermediate Similarity	NPC119583
0.7059	Intermediate Similarity	NPC115013
0.7033	Intermediate Similarity	NPC124878
0.7033	Intermediate Similarity	NPC231888
0.6957	Remote Similarity	NPC35338
0.6957	Remote Similarity	NPC204214
0.6957	Remote Similarity	NPC92283
0.686	Remote Similarity	NPC169345
0.6842	Remote Similarity	NPC10121
0.6842	Remote Similarity	NPC198918
0.6829	Remote Similarity	NPC89843
0.6774	Remote Similarity	NPC63404
0.6747	Remote Similarity	NPC477344
0.6667	Remote Similarity	NPC477317
0.6667	Remote Similarity	NPC477318
0.6627	Remote Similarity	NPC478734
0.6591	Remote Similarity	NPC184915
0.6591	Remote Similarity	NPC224953
0.6585	Remote Similarity	NPC22742
0.6585	Remote Similarity	NPC477349
0.6585	Remote Similarity	NPC477346
0.6512	Remote Similarity	NPC472205
0.6471	Remote Similarity	NPC478733
0.6444	Remote Similarity	NPC44782
0.6395	Remote Similarity	NPC146992
0.6395	Remote Similarity	NPC85759
0.6322	Remote Similarity	NPC297768
0.6292	Remote Similarity	NPC478731
0.625	Remote Similarity	NPC294748
0.625	Remote Similarity	NPC478730
0.618	Remote Similarity	NPC238264
0.618	Remote Similarity	NPC476087
0.618	Remote Similarity	NPC475667
0.618	Remote Similarity	NPC477345
0.6162	Remote Similarity	NPC10883
0.6154	Remote Similarity	NPC163409
0.6145	Remote Similarity	NPC477329
0.6136	Remote Similarity	NPC173328
0.6125	Remote Similarity	NPC478729
0.6111	Remote Similarity	NPC238056
0.6111	Remote Similarity	NPC478732
0.6067	Remote Similarity	NPC186992
0.6044	Remote Similarity	NPC475270
0.6044	Remote Similarity	NPC475327
0.6024	Remote Similarity	NPC477330
0.602	Remote Similarity	NPC77651
0.5978	Remote Similarity	NPC475525
0.5978	Remote Similarity	NPC475540
0.5977	Remote Similarity	NPC158302
0.5914	Remote Similarity	NPC476066
0.5859	Remote Similarity	NPC28069
0.5851	Remote Similarity	NPC475164
0.5843	Remote Similarity	NPC479061
0.5833	Remote Similarity	NPC477328
0.5806	Remote Similarity	NPC472200
0.5795	Remote Similarity	NPC479059
0.5789	Remote Similarity	NPC473605
0.5789	Remote Similarity	NPC475375
0.5778	Remote Similarity	NPC479060
0.5766	Remote Similarity	NPC147032
0.5728	Remote Similarity	NPC471025
0.567	Remote Similarity	NPC475241
0.566	Remote Similarity	NPC472352
0.5604	Remote Similarity	NPC479058
0.5591	Remote Similarity	NPC162925
0.5579	Remote Similarity	NPC269318
0.5529	Remote Similarity	NPC475425
0.5506	Remote Similarity	NPC477331
0.5506	Remote Similarity	NPC477332
0.5495	Remote Similarity	NPC60849
0.5435	Remote Similarity	NPC44682
0.5422	Remote Similarity	NPC169085
0.5413	Remote Similarity	NPC471024
0.5385	Remote Similarity	NPC290276
0.5361	Remote Similarity	NPC478728
0.5306	Remote Similarity	NPC478727
0.5269	Remote Similarity	NPC478724
0.5244	Remote Similarity	NPC9763
0.5161	Remote Similarity	NPC478722
0.5161	Remote Similarity	NPC478725
0.5106	Remote Similarity	NPC478723
0.5094	Remote Similarity	NPC611287
0.5093	Remote Similarity	NPC600721
0.5093	Remote Similarity	NPC605872
0.5091	Remote Similarity	NPC471026
0.5047	Remote Similarity	NPC600672

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477325 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7650
0.1-0.2	1431
0.2-0.3	68
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data