NPASS Compound

Natural Product: NPC143421

Natural Product ID	NPC143421
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Stoloniferin I
IUPAC Name	n.a.
Synonyms	Stoloniferin I
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL504970
PubChem CID	44593586
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 176181 0 0 0 0 0 0 0 0999 V2000 13.1689 8.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9131 7.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6574 6.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4016 5.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1459 5.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8901 4.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1459 3.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0672 2.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5543 0.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5543 -0.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0672 -1.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1459 -3.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8901 -3.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4360 -4.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9412 -4.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5675 -3.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7471 -4.8899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4639 -2.6182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4639 2.9793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5675 3.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9412 4.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4360 4.7216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1062 6.0886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8975 6.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0656 8.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5239 6.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3589 4.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6939 3.5390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0270 6.2780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 1.2990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 -0.9642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4895 -2.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6386 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4895 -4.7046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -6.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4895 -7.6590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1595 -6.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3086 -5.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0481 -4.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3086 -2.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7181 -2.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7411 -3.3603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9786 -0.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2391 0.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4996 2.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4558 -1.0465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7181 -5.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8672 -6.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6172 -4.8828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1172 -4.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5268 -4.3698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8672 -6.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1172 -7.4809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6172 -7.4809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2077 -7.9939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8567 -8.9581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0163 -7.1460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3086 -7.6590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0481 -9.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5481 -9.1362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2981 -10.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4472 -11.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5481 -11.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0481 -11.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2981 -10.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1491 -9.4711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6386 -12.2474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2877 -13.2115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4367 -14.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7732 -13.4947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1763 -15.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9158 -17.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6553 -18.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6535 -15.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 0.9642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.4246 9.2759 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9893 7.1997 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3485 9.7112 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7336 6.3793 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0927 8.8908 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8370 8.0704 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4778 5.5589 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2221 4.7385 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5812 7.2500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7304 4.6318 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4847 6.5202 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4647 5.7918 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9187 3.7286 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7435 4.9088 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5660 2.4085 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0791 3.4565 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9911 0.4999 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7735 1.8043 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7735 -1.4433 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9911 -0.1389 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9366 -3.2106 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5660 -2.0475 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5713 -4.6103 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5443 -3.7147 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8254 -5.4910 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0365 -4.9597 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8883 -5.7570 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2062 -5.6478 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8376 -5.2526 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2516 -5.7042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7920 -2.3780 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 -0.9642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1634 2.7410 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1343 3.5526 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0163 5.6437 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9823 8.0130 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2337 9.4733 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3138 9.0571 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7253 7.5516 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9940 7.7777 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0807 5.3049 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8030 3.4426 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8050 7.5262 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 0.9642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7981 -1.9284 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3066 0.3840 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9916 -2.3124 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1595 -1.8121 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6806 -2.6615 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -6.1818 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2291 -9.1362 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9877 -7.3986 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8598 -8.2692 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4095 -7.9939 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8947 -7.1114 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5481 -4.2535 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5442 -0.3474 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7370 0.6127 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8046 1.1298 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7600 3.6456 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0223 2.4289 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9768 1.9079 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9330 -1.3070 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8944 0.3880 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3774 -2.5444 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8442 -7.2789 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8567 -3.4056 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9363 -3.8567 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0137 -2.9602 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2078 -5.7062 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1252 -5.3649 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5268 -7.9939 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0558 -8.9153 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3124 -9.4902 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0058 -9.9223 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4258 -6.6330 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5563 -8.9795 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5562 -9.6184 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5963 -12.3636 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4114 -10.2504 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6303 -12.6575 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8846 -12.4153 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3086 -13.2115 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1491 -11.3995 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2605 -9.9841 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3781 -13.7246 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6990 -15.3925 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3502 -17.5687 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4386 -16.8697 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3948 -20.0846 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1781 -18.3469 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1325 -18.8678 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1307 -16.1739 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5750 -17.4113 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0921 -14.4790 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0586 0.4512 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 29 32 1 0 21 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 40 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 48 49 1 0 49 50 1 0 48 51 1 0 43 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 42 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 66 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 69 72 1 0 68 73 1 0 73 74 1 0 74 75 2 0 74 76 1 0 76 77 1 0 77 78 1 0 76 79 1 0 20 80 1 0 25 6 1 0 44 38 1 0 59 53 1 0 70 64 1 0 36 19 1 0 30 23 1 0 1 81 1 0 1 82 1 0 1 83 1 0 2 84 1 0 2 85 1 0 3 86 1 0 3 87 1 0 4 88 1 0 4 89 1 0 5 90 1 0 5 91 1 0 6 92 1 6 7 93 1 0 7 94 1 0 8 95 1 0 8 96 1 0 9 97 1 0 9 98 1 0 10 99 1 0 10100 1 0 11101 1 0 11102 1 0 12103 1 0 12104 1 0 13105 1 0 13106 1 0 14107 1 0 14108 1 0 15109 1 0 15110 1 0 19111 1 1 20112 1 1 21113 1 6 23114 1 1 24115 1 6 27116 1 6 28117 1 0 28118 1 0 28119 1 0 29120 1 6 30121 1 6 31122 1 0 32123 1 0 34124 1 1 35125 1 0 35126 1 0 35127 1 0 36128 1 6 38129 1 1 40130 1 6 41131 1 0 41132 1 0 41133 1 0 42134 1 1 43135 1 6 44136 1 6 48137 1 6 49138 1 0 49139 1 0 50140 1 0 50141 1 0 50142 1 0 51143 1 0 51144 1 0 51145 1 0 53146 1 6 55147 1 1 56148 1 0 56149 1 0 56150 1 0 57151 1 6 58152 1 1 59153 1 1 60154 1 0 61155 1 0 62156 1 0 64157 1 6 66158 1 1 67159 1 0 67160 1 0 67161 1 0 68162 1 6 69163 1 1 70164 1 1 71165 1 0 72166 1 0 76167 1 1 77168 1 0 77169 1 0 78170 1 0 78171 1 0 78172 1 0 79173 1 0 79174 1 0 79175 1 0 80176 1 0 M END

Standard InCHIKey	MKGGCMNXVOUKHJ-QLFFLOGESA-N
Standard InCHI	InChI=1S/C56H96O24/c1-11-14-20-23-33-24-21-18-16-15-17-19-22-25-34(57)74-46-42(65)54(79-47-38(61)36(59)29(7)69-55(47)73-33)71-31(9)44(46)78-56-49(76-51(67)27(5)13-3)48(80-52-40(63)37(60)35(58)28(6)68-52)45(32(10)72-56)77-53-41(64)39(62)43(30(8)70-53)75-50(66)26(4)12-2/h26-33,35-49,52-56,58-65H,11-25H2,1-10H3/t26-,27-,28-,29+,30-,31-,32-,33-,35-,36-,37+,38-,39-,40+,41+,42+,43-,44-,45-,46-,47+,48+,49+,52-,53-,54-,55-,56-/m0/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@H]([C@H](O[C@H]3[C@H](O1)O[C@H](C)[C@@H]([C@@H]3O)O)O[C@@H](C)[C@@H]2O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1OC(=O)[C@H](CC)C)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)OC(=O)[C@H](CC)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1152.63	Volume:	1128.849 ? Van der Waals volume.
Dense:	1.021	LogP:	3.344 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.349 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.864 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	18.0	Rigid Bonds:	49.0
TPSA:	333.04 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	8.0	Rings:	6.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.063	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.908	Fsp³:	0.946
MCE-18:	129.468 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.991	Fluc inhibitor:	0.333 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.548	Promiscuous compounds:	0.04

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.091	MDCK Permeability:	-5.074
Pgp-inhibitor:	0.0	Pgp-substrate:	0.997
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.001	30% Bioavailability (F30%):	0.088
50% Bioavailability (F50%):	0.956

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.991
Plasma Protein Binding (PPB):	74.311%	Volume Distribution (VD):	-0.26
Fu:	17.559% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.993
OATP1B3 inhibitor:	0.997	BCRP inhibitor:	0.0
BSEP inhibitor:	0.137

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.005
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.99 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.512

Half-life (T1/2):

3.002

ADMET: Toxicity

hERG Blockers:	0.01	hERG Blockers (10um):	0.15
Human Hepatotoxicity (H-HT):	0.281	Drug-induced Liver Injury (DILI):	0.966
AMES Toxicity:	0.631	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.691	Drug-induced Nephrotoxicity:	0.942
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.681
A549 Cytotoxicity:	0.911	Hek293 Cytotoxicity:	0.18
BCF:	0.739 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.41 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.195 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.225 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	Roots	Ixpantepec, in the state of Oaxaca, Mexico	1996-DEC	PMID[16124750]
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	flowers	n.a.	n.a.	PMID[16643033]
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[18500841]
NPO2520	Ipomoea murucoides	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	4
ED50	4

Activity Type	# Activity
Cell line	4
Organism	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	>	20.0	ug ml-1	PMID[19506060]
NPT1171	Cell line	HEp-2	Homo sapiens	ED50	>	20.0	ug ml-1	DOI[10.6019/CHEMBL1201861]
NPT165	Cell line	HeLa	Homo sapiens	ED50	>	20.0	ug ml-1	PMID[22765894]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	>	512.0	ug.mL-1	DrugMatrix in vitro pharmacology data
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	512.0	ug.mL-1	DrugMatrix in vitro pharmacology data
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	256.0	ug.mL-1	PMID[19506060]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	64.0	ug.mL-1	PMID[22115593]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC143421 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23320
0.1-0.2	23478
0.2-0.3	2801
0.3-0.4	127
0.4-0.5	16
0.5-0.6	35
0.6-0.7	27
0.7-0.8	0
0.8-0.85	5
0.85-0.9	9
0.9-0.95	2
0.95-1	4

Similarity Score	Similarity Level	Natural Product ID
0.9867	High Similarity	NPC477319
0.974	High Similarity	NPC290012
0.9737	High Similarity	NPC307400
0.9737	High Similarity	NPC27289
0.925	High Similarity	NPC123204
0.9125	High Similarity	NPC126685
0.8974	High Similarity	NPC267592
0.8889	High Similarity	NPC183888
0.8889	High Similarity	NPC259294
0.8816	High Similarity	NPC113745
0.8816	High Similarity	NPC477320
0.8816	High Similarity	NPC477323
0.8816	High Similarity	NPC477325
0.8816	High Similarity	NPC609436
0.875	High Similarity	NPC472204
0.8293	Intermediate Similarity	NPC119583
0.8289	Intermediate Similarity	NPC146380
0.8193	Intermediate Similarity	NPC483170
0.8095	Intermediate Similarity	NPC115013
0.8025	Intermediate Similarity	NPC477326
0.7778	Intermediate Similarity	NPC604005
0.7778	Intermediate Similarity	NPC605014
0.7683	Intermediate Similarity	NPC478734
0.7683	Intermediate Similarity	NPC89843
0.7586	Intermediate Similarity	NPC184915
0.7586	Intermediate Similarity	NPC224953
0.7527	Intermediate Similarity	NPC63404
0.75	Intermediate Similarity	NPC478733
0.7471	Intermediate Similarity	NPC477317
0.7471	Intermediate Similarity	NPC477318
0.7439	Intermediate Similarity	NPC22742
0.7439	Intermediate Similarity	NPC477346
0.7416	Intermediate Similarity	NPC44782
0.7407	Intermediate Similarity	NPC281563
0.7396	Intermediate Similarity	NPC10121
0.7396	Intermediate Similarity	NPC198918
0.7381	Intermediate Similarity	NPC477344
0.734	Intermediate Similarity	NPC35338
0.734	Intermediate Similarity	NPC204214
0.734	Intermediate Similarity	NPC92283
0.7326	Intermediate Similarity	NPC297768
0.7326	Intermediate Similarity	NPC472205
0.7273	Intermediate Similarity	NPC169345
0.7209	Intermediate Similarity	NPC146992
0.7209	Intermediate Similarity	NPC85759
0.7159	Intermediate Similarity	NPC476087
0.7159	Intermediate Similarity	NPC475667
0.7079	Intermediate Similarity	NPC478732
0.7045	Intermediate Similarity	NPC294748
0.7	Intermediate Similarity	NPC475270
0.7	Intermediate Similarity	NPC475327
0.7	Intermediate Similarity	NPC606819
0.6977	Remote Similarity	NPC600446
0.6977	Remote Similarity	NPC605013
0.6966	Remote Similarity	NPC238264
0.6966	Remote Similarity	NPC477345
0.6932	Remote Similarity	NPC173328
0.6889	Remote Similarity	NPC238056
0.6875	Remote Similarity	NPC124878
0.6875	Remote Similarity	NPC231888
0.6782	Remote Similarity	NPC158302
0.6739	Remote Similarity	NPC472200
0.6705	Remote Similarity	NPC109887
0.6667	Remote Similarity	NPC186992
0.6596	Remote Similarity	NPC475164
0.6562	Remote Similarity	NPC475241
0.6535	Remote Similarity	NPC10883
0.6484	Remote Similarity	NPC478730
0.6429	Remote Similarity	NPC477350
0.6354	Remote Similarity	NPC473605
0.6354	Remote Similarity	NPC475375
0.6321	Remote Similarity	NPC472352
0.6292	Remote Similarity	NPC477331
0.625	Remote Similarity	NPC147032
0.617	Remote Similarity	NPC478731
0.6146	Remote Similarity	NPC269318
0.6067	Remote Similarity	NPC477349
0.6042	Remote Similarity	NPC475525
0.6042	Remote Similarity	NPC475540
0.5979	Remote Similarity	NPC476066
0.5905	Remote Similarity	NPC290276
0.5905	Remote Similarity	NPC611287
0.5888	Remote Similarity	NPC600721
0.5888	Remote Similarity	NPC605872
0.5876	Remote Similarity	NPC163409
0.578	Remote Similarity	NPC600940
0.5766	Remote Similarity	NPC471024
0.5701	Remote Similarity	NPC600672
0.5699	Remote Similarity	NPC479059
0.5667	Remote Similarity	NPC477329
0.5632	Remote Similarity	NPC478729
0.5619	Remote Similarity	NPC77651
0.5591	Remote Similarity	NPC477332
0.5579	Remote Similarity	NPC479061
0.5579	Remote Similarity	NPC60849
0.5567	Remote Similarity	NPC478726
0.5556	Remote Similarity	NPC477330
0.5556	Remote Similarity	NPC610996
0.5521	Remote Similarity	NPC479058
0.5521	Remote Similarity	NPC479060
0.5472	Remote Similarity	NPC28069
0.5385	Remote Similarity	NPC477328
0.5364	Remote Similarity	NPC471025
0.5357	Remote Similarity	NPC610997
0.5354	Remote Similarity	NPC162925
0.5294	Remote Similarity	NPC478728
0.5258	Remote Similarity	NPC478722
0.5243	Remote Similarity	NPC478727
0.5204	Remote Similarity	NPC44682
0.5204	Remote Similarity	NPC478724
0.5109	Remote Similarity	NPC475425
0.5102	Remote Similarity	NPC478725
0.5051	Remote Similarity	NPC478723
0.5049	Remote Similarity	NPC477347

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC143421 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7492
0.1-0.2	1598
0.2-0.3	59
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data