NPASS Compound

Natural Product: NPC477347

Natural Product ID	NPC477347
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Thyrianthinic acid I
IUPAC Name	(11R)-11-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4S,5S,6R)-3-[(2S,3R,4R,5R,6S)-5-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-5-(3-hydroxy-2-methylbutanoyl)oxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyl-3-(2-methylbutanoyloxy)oxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5-dihydroxy-6-methyloxan-2-yl]oxyhexadecanoic acid
Synonyms	Thyrianthinic Acid I
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	25137616
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 161164 0 0 0 0 0 0 0 0999 V2000 -8.4338 -4.5063 -0.3157 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2203 -4.0330 0.5058 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2691 -3.4309 -0.4717 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0122 -2.8856 0.0258 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8518 -1.7561 0.9321 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2086 -0.3860 0.5042 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6131 -0.1059 0.1733 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5515 -0.2775 1.3499 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9840 -0.0674 0.9408 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3112 1.2453 0.3598 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1055 2.4535 1.1975 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4495 3.7330 0.4893 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8240 3.8775 -0.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.9367 3.8130 0.9746 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2835 3.9827 0.2651 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.3687 3.9115 1.2579 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.0795 3.7249 2.4773 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.7040 4.0358 0.9523 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4751 -0.1071 -0.6939 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5522 0.8883 -0.4805 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2446 0.6297 -1.1144 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3948 1.8320 -1.4027 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1776 3.0675 -1.6466 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3565 3.1495 -0.7127 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1716 2.0482 -1.0615 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1106 4.4231 -0.9033 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3910 4.2177 -1.5392 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5874 1.5466 -2.5156 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4900 -0.2867 -0.3386 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1930 -1.4341 -1.0232 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2604 -1.7440 -1.1963 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3316 -2.7253 -2.3793 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9050 -3.5572 -2.4613 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6275 -3.7167 -1.1426 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7498 -2.5691 -0.4089 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0345 -4.8012 -0.2919 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9081 -4.9936 0.8000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7787 -3.1500 -3.4920 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4336 -3.5663 -2.2086 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1001 -0.6859 -1.3758 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1781 -0.7426 -0.4866 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4665 -0.8319 -1.2934 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1252 0.5391 -1.2129 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5710 0.7258 0.2234 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3252 0.5252 1.0740 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1766 0.3864 0.3152 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5443 -0.5565 2.0864 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1897 1.9306 0.4365 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4981 1.8707 0.8421 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3462 2.5407 -0.2013 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4682 3.3502 0.3735 C 0 0 2 0 0 0 0 0 0 0 0 0 9.0492 2.6139 1.5513 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0149 2.1877 2.5426 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7063 2.4073 2.1108 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2440 2.7466 3.9265 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8587 1.5635 1.0652 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2481 1.5859 1.2245 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7616 2.5739 1.8137 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0473 0.4766 0.7086 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6261 -0.8224 1.3928 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8782 0.3654 -0.7855 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3226 1.6428 -1.4229 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5544 0.1037 -1.1073 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8823 4.5516 0.8367 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8731 1.5907 -1.0663 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1763 0.5202 -2.1130 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3031 -1.8483 -0.8267 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7367 -2.8512 -1.6689 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3595 -2.8231 -2.8676 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6123 -3.9317 -1.2108 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9051 -3.3656 -0.6931 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9403 -4.8385 -0.2052 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4913 -4.1339 1.0360 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8095 -3.6209 -0.8621 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1760 -5.3514 -0.9764 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2163 -4.7698 0.4275 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6341 -3.3884 1.2750 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8209 -4.9968 0.9373 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9682 -4.3543 -1.1320 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8547 -2.8540 -1.2019 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4313 -2.5748 -0.9433 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3145 -3.7610 0.3399 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2808 -1.9751 1.9714 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7354 -1.7062 1.1959 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7990 0.3298 1.2870 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7346 0.9521 -0.2415 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9595 -0.7262 -0.6622 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4329 -1.2650 1.7631 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2627 0.4203 2.1873 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1802 -0.8379 0.1355 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6263 -0.3772 1.7843 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4186 1.2114 0.1221 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8463 1.4097 -0.6457 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0042 2.5322 1.4334 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5901 2.3780 2.1955 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0979 4.5629 1.1394 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7606 3.7734 -0.4060 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0130 3.1802 -0.8638 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8851 4.8963 -0.4983 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9006 4.5535 1.7695 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9705 2.7532 1.3702 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3044 4.9048 -0.3479 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3786 3.0852 -0.3985 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.4789 3.7062 1.4968 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4776 1.1643 0.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4325 0.1505 -2.1295 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6975 2.0200 -0.5499 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6077 3.0888 -2.6885 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0657 2.9923 0.3502 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2555 4.9864 0.0625 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5837 5.1463 -1.5806 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1291 4.2784 -1.3384 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4538 4.0045 -1.2698 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5014 2.2949 -3.1284 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6768 -1.3230 -2.0431 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6117 -2.3481 -0.3362 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4265 -2.1422 -3.3176 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6050 -4.5993 -2.7639 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6616 -4.0681 -1.4207 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0465 -4.5904 0.1137 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0372 -5.7343 -0.9217 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8582 -4.2066 1.3979 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2863 -2.5806 -4.1617 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2628 -4.3384 -2.8341 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1335 -1.6355 0.1562 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2588 -1.0097 -2.3689 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4136 1.3081 -1.5071 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2923 -0.0757 0.4440 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2042 1.4888 1.6421 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8313 -1.3795 2.0555 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5740 -1.0182 2.0053 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5011 -0.1702 3.1484 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8222 0.8110 0.9143 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7413 3.2295 -0.8423 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2068 3.6371 -0.3707 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7544 3.3544 2.0431 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1024 1.0645 2.6405 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2044 1.9415 4.7119 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2865 3.1591 4.0188 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5094 3.4976 4.2226 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1075 0.6666 0.9833 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9083 -0.5749 2.1783 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5198 -1.3620 1.7534 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0672 -1.4227 0.6238 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5338 -0.4893 -1.1270 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6818 1.4963 -2.4621 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5299 2.4018 -1.3777 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1924 2.0214 -0.8288 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3726 0.2546 -2.0561 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5027 4.9262 1.5156 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2350 2.1291 -1.8418 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8004 0.6602 -3.0252 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8879 -4.5979 -2.0716 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6795 -4.1333 -0.4960 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7791 -2.7851 0.2454 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2715 -2.6305 -1.4490 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6827 -5.6216 0.0732 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0978 -5.3668 -0.7000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4217 -4.8592 1.8610 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4666 -3.7452 0.8503 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1351 -3.3027 1.3258 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 6 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 23 27 1 0 22 28 1 0 21 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 33 38 1 0 32 39 1 0 31 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 44 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 1 0 52 56 1 0 56 57 1 0 57 58 2 0 57 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 61 63 1 0 51 64 1 0 50 65 1 0 43 66 1 0 42 67 1 0 67 68 1 0 68 69 2 0 68 70 1 0 70 71 1 0 70 72 1 0 72 73 1 0 25 20 1 0 35 30 1 0 46 41 1 0 54 49 1 0 1 74 1 0 1 75 1 0 1 76 1 0 2 77 1 0 2 78 1 0 3 79 1 0 3 80 1 0 4 81 1 0 4 82 1 0 5 83 1 0 5 84 1 0 6 85 1 1 7 86 1 0 7 87 1 0 8 88 1 0 8 89 1 0 9 90 1 0 9 91 1 0 10 92 1 0 10 93 1 0 11 94 1 0 11 95 1 0 12 96 1 0 12 97 1 0 13 98 1 0 13 99 1 0 14100 1 0 14101 1 0 15102 1 0 15103 1 0 18104 1 0 20105 1 1 21106 1 6 22107 1 1 23108 1 6 24109 1 1 26110 1 0 26111 1 0 26112 1 0 27113 1 0 28114 1 0 30115 1 6 31116 1 1 32117 1 6 33118 1 6 34119 1 6 36120 1 0 36121 1 0 37122 1 0 38123 1 0 39124 1 0 41125 1 1 42126 1 6 43127 1 6 44128 1 1 45129 1 1 47130 1 0 47131 1 0 47132 1 0 49133 1 1 50134 1 6 51135 1 6 52136 1 1 53137 1 1 55138 1 0 55139 1 0 55140 1 0 59141 1 0 60142 1 0 60143 1 0 60144 1 0 61145 1 0 62146 1 0 62147 1 0 62148 1 0 63149 1 0 64150 1 0 65151 1 0 66152 1 0 70153 1 0 71154 1 0 71155 1 0 71156 1 0 72157 1 0 72158 1 0 73159 1 0 73160 1 0 73161 1 0 M END

Standard InCHIKey	INEYXFPANCJADM-XMNBAWMDSA-N
Standard InCHI	InChI=1S/C50H88O23/c1-9-11-17-20-30(21-18-15-13-12-14-16-19-22-32(53)54)67-48-42(35(57)33(55)27(6)64-48)73-50-43(36(58)34(56)31(23-51)68-50)72-49-44(70-45(62)24(3)10-2)39(61)41(29(8)66-49)71-47-38(60)37(59)40(28(7)65-47)69-46(63)25(4)26(5)52/h24-31,33-44,47-52,55-61H,9-23H2,1-8H3,(H,53,54)/t24?,25?,26?,27-,28-,29+,30-,31-,33-,34-,35+,36+,37-,38-,39-,40-,41+,42-,43-,44-,47+,48+,49+,50+/m1/s1
SMILES	CCCCC[C@H](CCCCCCCCCC(=O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C)OC(=O)C(C)C(C)O)O)O)O)OC(=O)C(C)CC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1056.57	Volume:	1033.396 ? Van der Waals volume.
Dense:	1.022	LogP:	2.886 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.889 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.91 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	31.0	Rigid Bonds:	27.0
TPSA:	345.81 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	10.0	Rings:	4.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.037	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.384	Fsp³:	0.94
MCE-18:	94.082 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.763	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.003 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.429	Promiscuous compounds:	0.092

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.632	MDCK Permeability:	-5.254
Pgp-inhibitor:	0.0	Pgp-substrate:	0.996
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.99
20% Bioavailability (F20%):	0.915	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.966
Plasma Protein Binding (PPB):	85.436%	Volume Distribution (VD):	-0.329
Fu:	10.22% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.935
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.745
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.654

Half-life (T1/2):

2.592

ADMET: Toxicity

hERG Blockers:	0.008	hERG Blockers (10um):	0.02
Human Hepatotoxicity (H-HT):	0.544	Drug-induced Liver Injury (DILI):	0.913
AMES Toxicity:	0.354	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.007	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.625	Drug-induced Nephrotoxicity:	0.9
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.165
A549 Cytotoxicity:	0.854	Hek293 Cytotoxicity:	0.154
BCF:	0.259 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.926 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.8 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.034 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	roots	n.a.	n.a.	PMID[17309299]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	Roots	states of Puebla, Morelos, and Distrito Federal, Mexico	2000-2005	PMID[18826278]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	4
MIC	1
Activity	1

Activity Type	# Activity
Cell line	3
Organism	2
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	=	2.6	ug/ml	PMID[18826278]
NPT148	Cell line	HCT-15	Homo sapiens	ED50	>	5	ug/ml	PMID[18826278]
NPT382	Cell line	OVCAR-5	Homo sapiens	ED50	>	5	ug/ml	PMID[18826278]
NPT88	Organism	Mycobacterium tuberculosis	Mycobacterium tuberculosis	MIC	=	25	ug/ml	PMID[18826278]
NPT2	Others	Unspecified	n.a.	ED50	>	5	ug/ml	PMID[18826278]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT32	Organism	Mus musculus	Mus musculus	Activity	=	70	%	PMID[18826278]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477347 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23436
0.1-0.2	23691
0.2-0.3	2550
0.3-0.4	65
0.4-0.5	46
0.5-0.6	57
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8736	High Similarity	NPC477348
0.6739	Remote Similarity	NPC297768
0.6413	Remote Similarity	NPC477344
0.6344	Remote Similarity	NPC478733
0.6304	Remote Similarity	NPC478734
0.6289	Remote Similarity	NPC224953
0.6162	Remote Similarity	NPC44782
0.6129	Remote Similarity	NPC477331
0.6129	Remote Similarity	NPC477332
0.6122	Remote Similarity	NPC184915
0.5922	Remote Similarity	NPC475241
0.5918	Remote Similarity	NPC238264
0.5918	Remote Similarity	NPC483170
0.5918	Remote Similarity	NPC477345
0.5859	Remote Similarity	NPC115013
0.5816	Remote Similarity	NPC119583
0.5773	Remote Similarity	NPC478722
0.5773	Remote Similarity	NPC479061
0.5773	Remote Similarity	NPC60849
0.5758	Remote Similarity	NPC478726
0.5714	Remote Similarity	NPC479060
0.57	Remote Similarity	NPC478732
0.5644	Remote Similarity	NPC475270
0.5644	Remote Similarity	NPC475327
0.56	Remote Similarity	NPC476087
0.56	Remote Similarity	NPC475667
0.5556	Remote Similarity	NPC472205
0.5534	Remote Similarity	NPC269318
0.5526	Remote Similarity	NPC610997
0.551	Remote Similarity	NPC109887
0.5495	Remote Similarity	NPC478729
0.549	Remote Similarity	NPC183888
0.549	Remote Similarity	NPC126685
0.5455	Remote Similarity	NPC478725
0.5446	Remote Similarity	NPC610996
0.5437	Remote Similarity	NPC472200
0.5426	Remote Similarity	NPC477330
0.5408	Remote Similarity	NPC479059
0.5392	Remote Similarity	NPC238056
0.5351	Remote Similarity	NPC600721
0.5351	Remote Similarity	NPC605872
0.5347	Remote Similarity	NPC478730
0.534	Remote Similarity	NPC259294
0.5333	Remote Similarity	NPC478728
0.5306	Remote Similarity	NPC89843
0.5283	Remote Similarity	NPC478727
0.5263	Remote Similarity	NPC477328
0.5258	Remote Similarity	NPC22742
0.5258	Remote Similarity	NPC477346
0.5248	Remote Similarity	NPC479058
0.5248	Remote Similarity	NPC478723
0.5248	Remote Similarity	NPC478724
0.5208	Remote Similarity	NPC477329
0.5192	Remote Similarity	NPC479057
0.5189	Remote Similarity	NPC475164
0.5175	Remote Similarity	NPC600672
0.514	Remote Similarity	NPC473605
0.514	Remote Similarity	NPC475375
0.5128	Remote Similarity	NPC600940
0.5096	Remote Similarity	NPC169345
0.5096	Remote Similarity	NPC290012
0.5096	Remote Similarity	NPC478731
0.5088	Remote Similarity	NPC611287
0.5049	Remote Similarity	NPC143421
0.5049	Remote Similarity	NPC307400
0.5049	Remote Similarity	NPC27289
0.5049	Remote Similarity	NPC294748

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477347 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6521
0.1-0.2	2523
0.2-0.3	104
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data