NPASS Compound

Natural Product: NPC477348

Natural Product ID	NPC477348
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Thyrianthinic acid II
IUPAC Name	(11R)-11-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4S,5S,6R)-3-[(2S,3R,4R,5R,6S)-5-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-methyl-5-[(E)-2-methylbut-2-enoyl]oxyoxan-2-yl]oxy-4-hydroxy-6-methyl-3-(2-methylbutanoyloxy)oxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5-dihydroxy-6-methyloxan-2-yl]oxyhexadecanoic acid
Synonyms	Thyrianthinic acid II
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	25135430
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 158161 0 0 0 0 0 0 0 0999 V2000 1.4935 6.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0065 5.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5195 3.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0325 2.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5456 0.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0586 -0.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4681 0.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8777 0.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2872 1.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6968 1.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1063 2.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5158 2.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.9254 3.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3349 3.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.7445 4.1661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1540 4.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.3031 3.7150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 18.4145 6.1564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 -0.9642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 1.2990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4895 2.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 0.9642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1595 -1.8121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4895 -2.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6386 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4895 -4.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -6.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 -6.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3086 -5.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0481 -4.2535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0586 -7.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8086 -8.3287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4095 -7.9939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -6.1818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2605 -3.4056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7605 -3.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -4.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 -5.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0586 -5.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3191 -3.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1700 -2.8925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7286 -4.3698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3191 -6.8111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7286 -7.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9786 -8.6232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7286 -9.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2286 -9.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9786 -8.6232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2286 -7.3242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1277 -9.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9681 -11.3995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1172 -12.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5268 -11.8506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8567 -13.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0058 -14.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7453 -16.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4472 -14.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3191 -10.4353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8296 -7.6590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -6.8111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0905 -4.3698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0586 -5.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3449 -6.8064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4681 -4.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9551 -3.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8777 -4.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2872 -3.7948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9030 7.1096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0839 6.0835 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9804 8.0061 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4160 5.7000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5969 4.6740 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9291 4.2905 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1830 3.0964 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4421 2.8810 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6230 1.8549 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8821 1.6394 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0458 0.9847 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7396 -1.7876 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9812 -1.3477 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1308 1.5234 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3647 1.9844 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3907 -0.8346 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8003 -0.3216 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7742 2.4975 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1837 3.0105 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2098 0.1914 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5933 3.5235 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6193 0.7045 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0289 1.2175 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0028 4.0366 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4123 4.5496 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4384 1.7305 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 15.8479 2.2436 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8219 5.0626 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 16.2314 5.5757 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.2575 2.7566 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 19.8240 6.6694 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5230 1.0971 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2418 -1.4558 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8547 -2.7954 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 -0.9642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0865 1.9801 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9449 2.3377 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9240 3.2148 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2291 4.2535 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7538 2.4605 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0832 -2.9940 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5413 -2.5425 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7540 -5.5435 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3114 -7.6163 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1825 -7.7919 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7702 -5.3933 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8607 -7.9325 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3576 -6.2797 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3086 -8.3287 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1595 -9.2929 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9845 -7.6634 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8652 -1.9092 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0866 -6.3247 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0624 -7.2889 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5586 -5.3339 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0691 -2.5577 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2416 -2.9602 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5719 -5.8615 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1382 -4.8828 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3388 -5.9539 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8296 -9.5874 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9891 -11.3995 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5651 -10.6033 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1277 -7.6590 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0919 -8.4383 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3108 -10.8454 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2768 -10.5516 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4153 -14.2920 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2225 -16.5427 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2474 -16.2038 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4849 -17.7595 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7846 -15.8155 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9342 -12.9444 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0377 -14.8669 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0586 -11.9125 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4931 -8.3401 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7605 -8.2884 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3070 -6.0644 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2916 -2.7303 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5456 -3.9244 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6177 -1.9498 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5403 -2.8463 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5587 -5.6444 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8003 -5.2044 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9498 -2.3333 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6968 -3.2818 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 6 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 23 27 1 0 22 28 1 0 21 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 33 38 1 0 32 39 1 0 31 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 44 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 1 0 52 56 1 0 56 57 1 0 57 58 2 0 57 59 1 0 59 60 2 0 60 61 1 0 59 62 1 0 51 63 1 0 50 64 1 0 43 65 1 0 42 66 1 0 66 67 1 0 67 68 2 0 67 69 1 0 69 70 1 0 69 71 1 0 71 72 1 0 25 20 1 0 35 30 1 0 46 41 1 0 54 49 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 0 2 77 1 0 3 78 1 0 3 79 1 0 4 80 1 0 4 81 1 0 5 82 1 0 5 83 1 0 6 84 1 1 7 85 1 0 7 86 1 0 8 87 1 0 8 88 1 0 9 89 1 0 9 90 1 0 10 91 1 0 10 92 1 0 11 93 1 0 11 94 1 0 12 95 1 0 12 96 1 0 13 97 1 0 13 98 1 0 14 99 1 0 14100 1 0 15101 1 0 15102 1 0 18103 1 0 20104 1 6 21105 1 1 22106 1 6 23107 1 1 24108 1 6 26109 1 0 26110 1 0 26111 1 0 27112 1 0 28113 1 0 30114 1 1 31115 1 6 32116 1 1 33117 1 6 34118 1 1 36119 1 0 36120 1 0 37121 1 0 38122 1 0 39123 1 0 41124 1 6 42125 1 1 43126 1 1 44127 1 6 45128 1 1 47129 1 0 47130 1 0 47131 1 0 49132 1 6 50133 1 1 51134 1 6 52135 1 1 53136 1 6 55137 1 0 55138 1 0 55139 1 0 60140 1 0 61141 1 0 61142 1 0 61143 1 0 62144 1 0 62145 1 0 62146 1 0 63147 1 0 64148 1 0 65149 1 0 69150 1 0 70151 1 0 70152 1 0 70153 1 0 71154 1 0 71155 1 0 72156 1 0 72157 1 0 72158 1 0 M END

Standard InCHIKey	JOEODRFAFPATFF-ZPDOANOZSA-N
Standard InCHI	InChI=1S/C50H86O22/c1-9-12-18-21-30(22-19-16-14-13-15-17-20-23-32(52)53)66-48-42(35(56)33(54)27(6)63-48)72-50-43(36(57)34(55)31(24-51)67-50)71-49-44(69-46(62)26(5)11-3)39(60)41(29(8)65-49)70-47-38(59)37(58)40(28(7)64-47)68-45(61)25(4)10-2/h10,26-31,33-44,47-51,54-60H,9,11-24H2,1-8H3,(H,52,53)/b25-10+/t26?,27-,28-,29+,30-,31-,33-,34-,35+,36+,37-,38-,39-,40-,41+,42-,43-,44-,47+,48+,49+,50+/m1/s1
SMILES	CCCCC[C@H](CCCCCCCCCC(=O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C)OC(=O)/C(=C/C)/C)O)O)O)OC(=O)C(C)CC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1038.56	Volume:	1021.969 ? Van der Waals volume.
Dense:	1.016	LogP:	3.655 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.44 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.026 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	30.0	Rigid Bonds:	28.0
TPSA:	325.58 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	9.0	Rings:	4.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.031	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.302	Fsp³:	0.9
MCE-18:	92.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.909	Fluc inhibitor:	0.254 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.005 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.472	Promiscuous compounds:	0.187

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.621	MDCK Permeability:	-5.287
Pgp-inhibitor:	0.0	Pgp-substrate:	0.98
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.999
20% Bioavailability (F20%):	0.987	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.957
Plasma Protein Binding (PPB):	90.545%	Volume Distribution (VD):	-0.394
Fu:	7.4% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.991
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.958
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.678

Half-life (T1/2):

2.497

ADMET: Toxicity

hERG Blockers:	0.008	hERG Blockers (10um):	0.02
Human Hepatotoxicity (H-HT):	0.509	Drug-induced Liver Injury (DILI):	0.957
AMES Toxicity:	0.411	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.011	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.006
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.626	Drug-induced Nephrotoxicity:	0.951
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.195
A549 Cytotoxicity:	0.891	Hek293 Cytotoxicity:	0.243
BCF:	0.371 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.079 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.811 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.103 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	roots	n.a.	n.a.	PMID[17309299]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	Roots	states of Puebla, Morelos, and Distrito Federal, Mexico	2000-2005	PMID[18826278]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4441	Ipomoea tyrianthina	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	1
ED50	4
Activity	1

Activity Type	# Activity
Cell line	3
Organism	2
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	=	2.8	ug/ml	PMID[18826278]
NPT382	Cell line	OVCAR-5	Homo sapiens	ED50	>	5	ug/ml	PMID[18826278]
NPT148	Cell line	HCT-15	Homo sapiens	ED50	>	5	ug/ml	PMID[18826278]
NPT88	Organism	Mycobacterium tuberculosis	Mycobacterium tuberculosis	MIC	=	25	ug/ml	PMID[18826278]
NPT2	Others	Unspecified	n.a.	ED50	>	5	ug/ml	PMID[18826278]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT32	Organism	Mus musculus	Mus musculus	Activity	=	70	%	PMID[18826278]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477348 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20372
0.1-0.2	25799
0.2-0.3	3430
0.3-0.4	138
0.4-0.5	60
0.5-0.6	42
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8736	High Similarity	NPC477347
0.6915	Remote Similarity	NPC238264
0.6915	Remote Similarity	NPC477345
0.6774	Remote Similarity	NPC479061
0.6702	Remote Similarity	NPC479060
0.6214	Remote Similarity	NPC475241
0.6211	Remote Similarity	NPC477344
0.6146	Remote Similarity	NPC478733
0.6105	Remote Similarity	NPC478734
0.61	Remote Similarity	NPC224953
0.602	Remote Similarity	NPC297768
0.598	Remote Similarity	NPC44782
0.5941	Remote Similarity	NPC184915
0.5938	Remote Similarity	NPC477331
0.5769	Remote Similarity	NPC475164
0.5743	Remote Similarity	NPC483170
0.5686	Remote Similarity	NPC115013
0.5644	Remote Similarity	NPC119583
0.5619	Remote Similarity	NPC478728
0.5566	Remote Similarity	NPC473605
0.5566	Remote Similarity	NPC475375
0.55	Remote Similarity	NPC109887
0.5484	Remote Similarity	NPC478729
0.5481	Remote Similarity	NPC479057
0.5455	Remote Similarity	NPC477332
0.5429	Remote Similarity	NPC475525
0.5429	Remote Similarity	NPC475540
0.5417	Remote Similarity	NPC477330
0.5392	Remote Similarity	NPC472205
0.5333	Remote Similarity	NPC183888
0.5333	Remote Similarity	NPC126685
0.53	Remote Similarity	NPC89843
0.5288	Remote Similarity	NPC478726
0.5283	Remote Similarity	NPC472200
0.5258	Remote Similarity	NPC477328
0.5253	Remote Similarity	NPC22742
0.5253	Remote Similarity	NPC477349
0.5253	Remote Similarity	NPC477346
0.5234	Remote Similarity	NPC476066
0.5234	Remote Similarity	NPC269318
0.5204	Remote Similarity	NPC477329
0.5189	Remote Similarity	NPC259294
0.5146	Remote Similarity	NPC478722
0.5146	Remote Similarity	NPC60849
0.5143	Remote Similarity	NPC476087
0.5143	Remote Similarity	NPC475667
0.514	Remote Similarity	NPC163409
0.5094	Remote Similarity	NPC169345
0.5094	Remote Similarity	NPC478732
0.5048	Remote Similarity	NPC294748
0.5047	Remote Similarity	NPC475270
0.5047	Remote Similarity	NPC475327
0.5043	Remote Similarity	NPC600672

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477348 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6331
0.1-0.2	2699
0.2-0.3	120
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data