NPASS Compound

Natural Product: NPC158302

Natural Product ID	NPC158302
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Tricolorin D
IUPAC Name	n.a.
Synonyms	Tricolorin D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL450741
PubChem CID	44575282
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0003918] Saccharolipids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 157161 0 0 0 0 0 0 0 0999 V2000 8.2953 3.8508 -1.3684 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5322 4.9677 -0.7470 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1358 4.6012 -0.3837 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9067 3.5377 0.5969 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2964 2.1449 0.3428 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6377 1.3672 -0.7213 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3124 -0.0170 -0.7478 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3214 -0.7052 0.5678 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9960 -2.0730 0.3330 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1700 -2.7366 1.7093 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8391 -4.0590 1.5442 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9810 -5.0414 0.7994 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7937 -5.3578 1.6433 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8483 -6.3661 1.1052 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1560 -6.0396 -0.1663 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3384 -4.7993 -0.0784 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6942 -3.7114 -0.6441 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1414 -4.7507 0.6252 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3834 -3.5193 0.6705 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2009 -2.3859 1.2502 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6720 -1.7956 2.5058 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8179 -0.5574 2.3303 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4675 -0.5095 0.8359 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7720 -0.3971 0.1309 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5963 -1.4859 0.2725 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5940 0.0772 -1.1404 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0332 1.4195 -1.2637 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1387 2.0944 -2.2334 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8551 2.9474 -3.2425 C 0 0 2 0 0 0 0 0 0 0 0 0 3.0340 3.5583 -2.5381 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6514 4.4580 -1.4189 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9316 2.5624 -2.2374 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4901 1.4848 -1.5788 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2756 1.2030 -0.4750 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0297 3.9809 -3.6725 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1865 2.9145 -1.5996 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3487 0.5419 0.4947 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5927 0.1362 0.0330 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7625 0.8479 0.6433 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8296 0.9677 -0.4728 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7867 -0.3952 -1.1548 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5342 -0.3911 -2.0050 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0660 -1.7809 -2.3249 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5614 0.3782 -1.3685 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9369 -0.7042 -1.8780 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7832 -1.7674 -1.6150 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4745 -2.5069 -0.6376 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0018 -2.0361 -2.4393 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6073 -2.2747 -3.8657 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6515 -3.2936 -1.8973 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0600 -3.1457 -0.4443 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0816 1.1590 0.0157 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7077 2.3140 -0.4449 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9229 2.0423 -1.2828 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1620 2.5964 -0.5738 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9083 4.0986 -0.4362 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6119 4.3032 0.3254 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7060 5.2841 -0.3841 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9814 3.1071 0.6421 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0024 4.6704 0.1582 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2799 2.3933 -1.3719 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8587 2.7723 -2.4929 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3982 0.1978 1.7009 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6725 0.7809 2.9216 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3319 1.9665 3.1011 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3615 -0.0454 3.9474 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6213 -0.5934 3.3207 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4607 -1.1938 4.3112 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0959 -2.0970 5.3483 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3050 -0.6093 3.1136 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6960 -1.5256 3.4363 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6542 3.1046 -1.8160 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0286 3.4276 -0.6283 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9408 4.2939 -2.2021 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5204 5.8257 -1.4970 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0888 5.4145 0.1205 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5242 4.4579 -1.3180 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6652 5.5472 0.0567 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4579 3.8480 1.5483 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8288 3.6205 0.9340 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4108 2.0559 0.2961 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0905 1.6051 1.3541 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7629 1.7632 -1.7109 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3792 0.2070 -1.0226 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9108 -0.6750 -1.5118 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9100 -0.1702 1.3605 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3392 -0.9304 0.9932 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9560 -1.9619 -0.1736 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2511 -2.6817 -0.2121 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7861 -2.0178 2.3046 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1866 -2.7646 2.1969 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9835 -4.4634 2.5967 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8533 -3.9768 1.0956 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5938 -5.9793 0.6946 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7360 -4.6578 -0.2022 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2090 -5.7950 2.6032 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2161 -4.4737 1.9934 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1117 -6.6139 1.9008 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4278 -7.3049 0.9381 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8568 -6.0105 -1.0238 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4460 -6.8722 -0.3850 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4758 -3.7662 1.2590 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0299 -3.2818 -0.3652 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1816 -2.8782 1.5559 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0297 -2.5553 3.0176 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4595 0.3048 2.5875 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0672 -1.4413 0.5835 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3231 0.4358 0.6852 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8577 1.8542 -0.2569 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5334 1.3543 -2.8370 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2176 2.3046 -4.0498 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5535 4.1916 -3.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5998 4.7657 -1.4978 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3160 5.3713 -1.4568 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8992 3.9868 -0.4461 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6807 0.5968 -2.2697 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6330 4.7621 -3.8721 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6656 2.9311 -2.0671 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6356 -0.9773 0.1735 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4544 1.8965 0.9175 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4564 1.7613 -1.1476 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6931 -1.1459 -0.3353 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7808 0.1174 -2.9561 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9839 -1.7409 -2.5515 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5902 -2.1033 -3.2609 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3211 -2.5047 -1.5208 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7070 -1.1937 -2.3568 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9184 -3.1313 -3.9470 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5634 -2.4449 -4.4411 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1457 -1.3591 -4.3022 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9753 -4.1601 -2.0065 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5786 -3.4410 -2.4848 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1037 -3.4916 -0.2755 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9131 -2.1068 -0.0786 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4079 -3.7961 0.1774 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9541 2.8016 -1.1246 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1006 1.0068 -1.5424 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2659 2.1769 0.4391 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7956 4.4763 -1.4884 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8938 4.7735 1.2984 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3102 6.0600 0.3308 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8352 4.8197 -0.8541 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3310 5.8856 -1.1084 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5658 5.0920 -0.5487 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0485 1.7054 -2.0349 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2526 2.3145 -3.1140 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6008 0.5870 4.8440 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9536 -0.0160 2.4200 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4450 -0.6907 4.0600 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3948 -1.6092 2.9318 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2530 -1.7785 3.3983 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4770 -0.8127 4.6776 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8324 -3.1404 5.0831 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1907 -1.9301 5.2874 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6679 -1.7889 6.3278 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5227 -1.5796 3.2804 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9809 -2.3499 3.8729 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 33 34 1 0 29 35 1 0 28 36 1 0 23 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 41 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 48 49 1 0 48 50 1 0 50 51 1 0 40 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 56 60 1 0 55 61 1 0 54 62 1 0 39 63 1 0 63 64 1 0 64 65 2 0 64 66 1 0 66 67 1 0 66 68 1 0 68 69 1 0 22 70 1 0 21 71 1 0 34 6 1 0 44 38 1 0 59 53 1 0 25 20 1 0 33 27 1 0 1 72 1 0 1 73 1 0 1 74 1 0 2 75 1 0 2 76 1 0 3 77 1 0 3 78 1 0 4 79 1 0 4 80 1 0 5 81 1 0 5 82 1 0 6 83 1 6 7 84 1 0 7 85 1 0 8 86 1 0 8 87 1 0 9 88 1 0 9 89 1 0 10 90 1 0 10 91 1 0 11 92 1 0 11 93 1 0 12 94 1 0 12 95 1 0 13 96 1 0 13 97 1 0 14 98 1 0 14 99 1 0 15100 1 0 15101 1 0 19102 1 0 19103 1 0 20104 1 1 21105 1 1 22106 1 1 23107 1 6 24108 1 1 27109 1 1 28110 1 6 29111 1 6 30112 1 6 31113 1 0 31114 1 0 31115 1 0 33116 1 6 35117 1 0 36118 1 0 38119 1 6 39120 1 1 40121 1 6 41122 1 1 42123 1 6 43124 1 0 43125 1 0 43126 1 0 48127 1 6 49128 1 0 49129 1 0 49130 1 0 50131 1 0 50132 1 0 51133 1 0 51134 1 0 51135 1 0 53136 1 6 54137 1 6 55138 1 1 56139 1 6 57140 1 1 58141 1 0 58142 1 0 58143 1 0 60144 1 0 61145 1 0 62146 1 0 66147 1 1 67148 1 0 67149 1 0 67150 1 0 68151 1 0 68152 1 0 69153 1 0 69154 1 0 69155 1 0 70156 1 0 71157 1 0 M END

Standard InCHIKey	UBRLBRKLLFOEPE-RGKUUGFNSA-N
Standard InCHI	InChI=1S/C50H86O21/c1-9-12-18-21-30-22-19-16-14-13-15-17-20-23-32(51)61-24-31-35(54)38(57)42(49(66-31)69-41-37(56)34(53)28(7)63-48(41)65-30)70-50-44(68-46(60)26(5)11-3)43(40(29(8)64-50)67-45(59)25(4)10-2)71-47-39(58)36(55)33(52)27(6)62-47/h25-31,33-44,47-50,52-58H,9-24H2,1-8H3/t25-,26-,27-,28+,29-,30-,31+,33-,34-,35+,36+,37-,38-,39+,40-,41+,42+,43+,44+,47-,48-,49-,50-/m0/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O[C@@H]2[C@H]([C@H]([C@@H](C)O[C@H]2O1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)OC(=O)[C@@H](C)CC)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)OC(=O)[C@@H](C)CC)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1022.57	Volume:	1007.259 ? Van der Waals volume.
Dense:	1.015	LogP:	3.176 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.414 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.659 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	44.0
TPSA:	294.35 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	7.0	Rings:	5.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.075	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.454	Fsp³:	0.94
MCE-18:	108.206 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.991	Fluc inhibitor:	0.333 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.466	Promiscuous compounds:	0.108

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.855	MDCK Permeability:	-5.049
Pgp-inhibitor:	0.0	Pgp-substrate:	0.988
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.001	30% Bioavailability (F30%):	0.326
50% Bioavailability (F50%):	0.886

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.931
Plasma Protein Binding (PPB):	75.753%	Volume Distribution (VD):	-0.299
Fu:	16.408% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.0
BSEP inhibitor:	0.022

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.009
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.998
HLM stability:	0.999 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.562

Half-life (T1/2):

2.811

ADMET: Toxicity

hERG Blockers:	0.017	hERG Blockers (10um):	0.222
Human Hepatotoxicity (H-HT):	0.394	Drug-induced Liver Injury (DILI):	0.936
AMES Toxicity:	0.754	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.003	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.042	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.99
Hematotoxicity:	0.727	Drug-induced Nephrotoxicity:	0.964
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.701
A549 Cytotoxicity:	0.884	Hek293 Cytotoxicity:	0.241
BCF:	0.559 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.34 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.239 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.34 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	crude resin	Mexican	n.a.	DOI[10.1016/S0040-4020(97)00607-8]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	crude resin	Mexican	n.a.	PMID[16562846]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8496705]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO24622	Ipomoea tricolor	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	6

Activity Type	# Activity
Organism	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT88	Organism	Mycobacterium tuberculosis	Mycobacterium tuberculosis	MIC	=	16.0	ug.mL-1	PMID[2832544]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	16.0	ug.mL-1	PMID[12392745]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	32.0	ug.mL-1	PMID[23434030]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	1.0	ug.mL-1	PMID[10397494]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC158302 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21065
0.1-0.2	24819
0.2-0.3	3680
0.3-0.4	166
0.4-0.5	24
0.5-0.6	49
0.6-0.7	40
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.859	High Similarity	NPC173328
0.825	Intermediate Similarity	NPC186992
0.7595	Intermediate Similarity	NPC22742
0.7595	Intermediate Similarity	NPC477346
0.7561	Intermediate Similarity	NPC146992
0.7561	Intermediate Similarity	NPC85759
0.7407	Intermediate Similarity	NPC89843
0.7381	Intermediate Similarity	NPC294748
0.7294	Intermediate Similarity	NPC476087
0.7294	Intermediate Similarity	NPC475667
0.7209	Intermediate Similarity	NPC238056
0.7209	Intermediate Similarity	NPC478732
0.7126	Intermediate Similarity	NPC475270
0.7126	Intermediate Similarity	NPC475327
0.6977	Remote Similarity	NPC119583
0.6966	Remote Similarity	NPC269318
0.6889	Remote Similarity	NPC475164
0.6875	Remote Similarity	NPC475425
0.686	Remote Similarity	NPC477319
0.6818	Remote Similarity	NPC115013
0.6782	Remote Similarity	NPC143421
0.6782	Remote Similarity	NPC472204
0.6705	Remote Similarity	NPC483170
0.663	Remote Similarity	NPC473605
0.663	Remote Similarity	NPC475375
0.6629	Remote Similarity	NPC169345
0.6629	Remote Similarity	NPC290012
0.6591	Remote Similarity	NPC307400
0.6591	Remote Similarity	NPC27289
0.6591	Remote Similarity	NPC478730
0.6543	Remote Similarity	NPC477350
0.6408	Remote Similarity	NPC472352
0.6395	Remote Similarity	NPC478734
0.6374	Remote Similarity	NPC184915
0.6374	Remote Similarity	NPC224953
0.6304	Remote Similarity	NPC123204
0.6304	Remote Similarity	NPC475525
0.6304	Remote Similarity	NPC475540
0.6265	Remote Similarity	NPC146380
0.6264	Remote Similarity	NPC478731
0.625	Remote Similarity	NPC478733
0.6237	Remote Similarity	NPC476066
0.6237	Remote Similarity	NPC44782
0.6196	Remote Similarity	NPC126685
0.6163	Remote Similarity	NPC477349
0.6136	Remote Similarity	NPC477344
0.6118	Remote Similarity	NPC281563
0.6111	Remote Similarity	NPC297768
0.6087	Remote Similarity	NPC477317
0.6087	Remote Similarity	NPC477318
0.6061	Remote Similarity	NPC63404
0.6022	Remote Similarity	NPC183888
0.6022	Remote Similarity	NPC259294
0.6	Remote Similarity	NPC267592
0.5978	Remote Similarity	NPC238264
0.5978	Remote Similarity	NPC477345
0.5977	Remote Similarity	NPC113745
0.5977	Remote Similarity	NPC477320
0.5977	Remote Similarity	NPC477323
0.5977	Remote Similarity	NPC477325
0.5977	Remote Similarity	NPC609436
0.5909	Remote Similarity	NPC604005
0.5909	Remote Similarity	NPC605014
0.59	Remote Similarity	NPC35338
0.59	Remote Similarity	NPC204214
0.59	Remote Similarity	NPC92283
0.5849	Remote Similarity	NPC600940
0.5843	Remote Similarity	NPC477331
0.5825	Remote Similarity	NPC10883
0.5825	Remote Similarity	NPC611287
0.5806	Remote Similarity	NPC478726
0.5778	Remote Similarity	NPC600446
0.5778	Remote Similarity	NPC605013
0.5761	Remote Similarity	NPC44682
0.5714	Remote Similarity	NPC606819
0.5625	Remote Similarity	NPC163409
0.5619	Remote Similarity	NPC610996
0.5591	Remote Similarity	NPC472205
0.5543	Remote Similarity	NPC109887
0.5524	Remote Similarity	NPC10121
0.5524	Remote Similarity	NPC198918
0.5514	Remote Similarity	NPC600721
0.5514	Remote Similarity	NPC605872
0.551	Remote Similarity	NPC478728
0.55	Remote Similarity	NPC475241
0.549	Remote Similarity	NPC124878
0.549	Remote Similarity	NPC231888
0.5464	Remote Similarity	NPC472200
0.5455	Remote Similarity	NPC478727
0.5435	Remote Similarity	NPC477326
0.5426	Remote Similarity	NPC478724
0.5377	Remote Similarity	NPC290276
0.5349	Remote Similarity	NPC478729
0.5319	Remote Similarity	NPC60849
0.5319	Remote Similarity	NPC478725
0.5301	Remote Similarity	NPC479056
0.5263	Remote Similarity	NPC479058
0.5263	Remote Similarity	NPC478723
0.5222	Remote Similarity	NPC477329
0.5185	Remote Similarity	NPC600672
0.5161	Remote Similarity	NPC477332
0.5111	Remote Similarity	NPC477328
0.5111	Remote Similarity	NPC477330

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC158302 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6945
0.1-0.2	2129
0.2-0.3	73
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data