NPASS Compound

Natural Product: NPC475540

Natural Product ID	NPC475540
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Orizabin Xii
IUPAC Name	n.a.
Synonyms	Orizabin XII
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL507742
PubChem CID	10396403
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0003918] Saccharolipids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 167171 0 0 0 0 0 0 0 0999 V2000 -7.7457 -6.5292 1.3601 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0174 -5.3822 2.2907 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7926 -4.5349 2.4023 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4492 -4.0058 1.0002 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2074 -3.1536 1.1124 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8235 -2.5901 -0.2216 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5662 -3.7358 -1.1801 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4143 -4.5475 -0.6398 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9403 -5.5917 -1.6375 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7972 -6.3891 -0.9807 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8030 -5.4216 -0.4447 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4631 -6.0813 0.1325 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2036 -4.8822 0.7497 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4966 -5.3016 1.3662 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1384 -4.1231 2.0847 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3698 -3.0145 1.1538 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4173 -2.9220 0.5130 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3809 -2.0394 0.9942 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6182 -0.9385 0.1021 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3389 -0.3570 -0.3892 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4773 -0.0221 0.7746 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8388 0.1773 0.5191 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2720 1.3292 -0.0807 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7926 1.2869 0.1100 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2116 0.0665 -0.2759 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0590 -0.1076 -1.3367 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4334 -0.3870 -0.8542 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7455 -1.7176 -0.6468 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4793 0.1363 -1.6244 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2198 1.4580 -1.8701 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5009 2.0115 -2.5273 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0775 1.6307 -2.8498 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8888 0.8035 -2.4914 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5625 0.0954 -3.6850 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8351 2.9850 -2.9737 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4837 2.3595 -0.3121 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0646 3.5196 0.3258 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8699 4.7149 -0.0690 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4704 5.9231 0.5452 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1762 7.0727 0.2252 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1407 6.9371 -0.6038 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9003 8.3989 0.7575 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.9868 8.5164 2.2628 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6894 9.8700 2.5513 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9280 7.7036 2.9594 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5719 8.9694 0.3010 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6091 3.7715 0.1031 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7509 2.6024 0.5179 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5596 2.8918 0.0817 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2399 4.8482 0.9176 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0482 0.9149 1.5711 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3656 0.8733 1.8558 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4582 0.2747 3.2788 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2805 0.0951 0.9995 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9590 0.9857 0.1319 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3249 0.9527 0.3874 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7765 2.1948 0.8403 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0828 1.9900 1.3085 C 0 0 2 0 0 0 0 0 0 0 0 0 7.5088 3.1934 2.0873 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9658 1.7913 0.1137 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2579 1.3737 -1.1333 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0363 0.5195 -0.8570 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5003 -0.7843 -0.6582 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7923 2.5431 -1.7544 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8988 0.7740 0.4346 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2584 0.9656 0.5174 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7319 2.1206 0.2950 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1301 -0.1456 0.8560 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4430 0.0516 0.9379 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2843 -1.1151 1.2862 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5227 -1.4781 1.0993 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6941 -1.0705 -1.4088 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5053 -0.5964 -2.7094 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9808 0.5686 -2.9078 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1789 -1.3509 -3.7807 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1770 -0.4896 -5.0278 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6767 -2.5739 -4.1191 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1437 -6.3356 0.3570 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2250 -7.4302 1.8075 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6460 -6.6747 1.2503 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8680 -4.7432 1.9505 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2476 -5.7636 3.3191 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9358 -3.6655 3.0768 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9158 -5.1153 2.7540 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3073 -4.8764 0.3596 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2586 -3.3696 0.6023 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3744 -2.3270 1.8668 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3948 -3.7526 1.5754 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8056 -2.1024 -0.0090 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4761 -4.3075 -1.3367 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2416 -3.3902 -2.1857 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5313 -3.8821 -0.4503 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6825 -5.0307 0.2935 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7701 -6.3018 -1.7733 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5321 -5.1600 -2.5516 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1892 -7.0076 -0.1455 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3988 -7.0834 -1.7282 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2251 -4.9031 0.4793 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4465 -4.6913 -1.1935 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0756 -6.5199 -0.6745 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2410 -6.7918 0.9311 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4091 -4.1852 -0.1028 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5275 -4.3608 1.4393 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2863 -6.1299 2.0822 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1661 -5.6895 0.5797 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1082 -4.5139 2.4956 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5383 -3.8280 2.9728 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3028 -1.2501 -0.7183 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6346 0.6217 -0.8908 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4901 -0.9786 1.4136 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0147 1.3257 -1.1642 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8837 1.2950 1.2477 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7105 -1.1260 -1.7415 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5418 0.1164 0.1519 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0913 1.9980 -0.9222 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3739 3.0273 -2.8978 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8026 1.3006 -3.3501 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2943 1.9201 -1.7576 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5410 1.3388 -3.8435 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0283 1.4959 -2.4044 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4143 -0.3983 -3.9066 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2204 3.4120 -3.7575 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2124 3.3357 1.4146 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8894 4.8293 -1.1924 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9518 4.5690 0.1936 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6809 9.1093 0.3694 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0020 8.3418 2.6318 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5945 10.4215 1.7600 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2894 8.3266 3.6544 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2597 7.1660 2.2666 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4534 6.9769 3.6108 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7062 9.8247 -0.4153 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9661 9.3665 1.1390 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0586 8.1764 -0.2650 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3901 4.0756 -0.9475 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7881 2.5307 1.6262 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8390 3.6859 0.6194 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6046 5.4235 0.4358 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7873 1.9209 2.0362 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9446 0.9035 4.0151 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5239 0.2206 3.5780 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0536 -0.7516 3.2717 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0411 -0.4009 1.6630 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5281 0.2230 1.2139 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1217 1.1259 2.0115 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6155 3.2383 2.2102 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1142 4.1067 1.6026 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0481 3.1626 3.0998 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4899 2.7745 -0.0717 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9527 0.8977 -1.8417 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3421 0.4910 -1.7080 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4928 -0.8110 -0.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6700 3.2480 -1.0731 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8131 1.0383 0.7464 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9200 -1.6399 2.1693 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2994 -0.7002 1.5404 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4685 -1.7738 0.3986 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7999 -1.6991 0.2711 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3592 -2.2207 1.0093 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0448 -1.5200 2.0847 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1826 -1.6896 -3.5354 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9705 -0.7838 -5.7448 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7903 -0.5545 -5.5815 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2925 0.5908 -4.7705 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3807 -2.3585 -4.9505 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3272 -2.8166 -3.2442 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0426 -3.4285 -4.4189 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 24 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 2 0 40 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 42 46 1 0 37 47 1 0 47 48 1 0 48 49 1 0 47 50 1 0 21 51 1 0 51 52 1 0 52 53 1 0 52 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 61 64 1 0 60 65 1 0 65 66 1 0 66 67 2 0 66 68 1 0 68 69 2 0 69 70 1 0 68 71 1 0 20 72 1 0 72 73 1 0 73 74 2 0 73 75 1 0 75 76 1 0 75 77 1 0 28 6 1 0 62 56 1 0 54 19 1 0 48 23 1 0 33 26 1 0 1 78 1 0 1 79 1 0 1 80 1 0 2 81 1 0 2 82 1 0 3 83 1 0 3 84 1 0 4 85 1 0 4 86 1 0 5 87 1 0 5 88 1 0 6 89 1 1 7 90 1 0 7 91 1 0 8 92 1 0 8 93 1 0 9 94 1 0 9 95 1 0 10 96 1 0 10 97 1 0 11 98 1 0 11 99 1 0 12100 1 0 12101 1 0 13102 1 0 13103 1 0 14104 1 0 14105 1 0 15106 1 0 15107 1 0 19108 1 6 20109 1 6 21110 1 1 23111 1 6 24112 1 1 26113 1 6 27114 1 1 30115 1 1 31116 1 0 31117 1 0 31118 1 0 32119 1 6 33120 1 1 34121 1 0 35122 1 0 37123 1 1 38124 1 0 38125 1 0 42126 1 6 43127 1 1 44128 1 0 45129 1 0 45130 1 0 45131 1 0 46132 1 0 46133 1 0 46134 1 0 47135 1 6 48136 1 1 49137 1 0 50138 1 0 52139 1 1 53140 1 0 53141 1 0 53142 1 0 54143 1 1 56144 1 1 58145 1 1 59146 1 0 59147 1 0 59148 1 0 60149 1 6 61150 1 6 62151 1 6 63152 1 0 64153 1 0 69154 1 0 70155 1 0 70156 1 0 70157 1 0 71158 1 0 71159 1 0 71160 1 0 75161 1 0 76162 1 0 76163 1 0 76164 1 0 77165 1 0 77166 1 0 77167 1 0 M END

Standard InCHIKey	IEOQKAZHMCCLDM-YLWMHKLNSA-N
Standard InCHI	InChI=1S/C54H90O23/c1-11-13-19-22-33-23-20-17-15-14-16-18-21-24-35(56)72-46-43(75-51-41(62)40(61)42(31(9)68-51)73-49(64)27(5)12-2)32(10)69-54(47(46)74-48(63)26(3)4)77-45-39(60)37(58)34(25-66-50(65)28(6)29(7)55)71-53(45)76-44-38(59)36(57)30(8)67-52(44)70-33/h12,26,28-34,36-47,51-55,57-62H,11,13-25H2,1-10H3/b27-12+/t28-,29-,30-,31-,32+,33+,34-,36-,37-,38+,39+,40-,41-,42-,43+,44-,45-,46-,47-,51+,52+,53+,54+/m1/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@H]([C@H](O[C@H]3[C@H](O[C@H]4[C@H](O1)O[C@H](C)[C@H]([C@@H]4O)O)O[C@H](COC(=O)[C@@H]([C@H](O)C)C)[C@H]([C@@H]3O)O)O[C@@H](C)[C@@H]2O[C@@H]1O[C@H](C)[C@H]([C@@H]([C@H]1O)O)OC(=O)/C(=C/C)/C)OC(=O)C(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1106.59	Volume:	1088.75 ? Van der Waals volume.
Dense:	1.016	LogP:	3.206 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.832 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.837 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	17.0	Rigid Bonds:	47.0
TPSA:	320.65 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	7.0	Rings:	5.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.057	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.781	Fsp³:	0.889
MCE-18:	113.882 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.983	Fluc inhibitor:	0.122 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.021 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.002 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.462	Promiscuous compounds:	0.187

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.601	MDCK Permeability:	-5.054
Pgp-inhibitor:	0.027	Pgp-substrate:	0.456
PAMPA:	0.815 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.467	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.939
Plasma Protein Binding (PPB):	90.195%	Volume Distribution (VD):	-0.344
Fu:	6.409% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.997
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.998

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.005
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.945
HLM stability:	0.995 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.71

Half-life (T1/2):

3.206

ADMET: Toxicity

hERG Blockers:	0.005	hERG Blockers (10um):	0.034
Human Hepatotoxicity (H-HT):	0.667	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.922	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.694	Drug-induced Nephrotoxicity:	0.993
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.67
A549 Cytotoxicity:	0.996	Hek293 Cytotoxicity:	0.469
BCF:	0.401 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.274 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.096 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.172 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	Roots	Mexican	n.a.	PMID[10479311]
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	crude resin	Mexican	n.a.	PMID[16562846]
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	4
ED50	1

Activity Type	# Activity
Cell line	1
Organism	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	=	1.0	ug ml-1	PMID[29126728]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	>	512.0	ug.mL-1	PMID[18332172]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	256.0	ug.mL-1	PMID[12036352]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	512.0	ug.mL-1	PMID[18332172]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475540 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21696
0.1-0.2	25302
0.2-0.3	2671
0.3-0.4	62
0.4-0.5	33
0.5-0.6	56
0.6-0.7	19
0.7-0.8	0
0.8-0.85	6
0.85-0.9	0
0.9-0.95	4
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC475525
0.963	High Similarity	NPC476066
0.9277	High Similarity	NPC475164
0.9167	High Similarity	NPC473605
0.9167	High Similarity	NPC475375
0.9012	High Similarity	NPC478730
0.8452	Intermediate Similarity	NPC476087
0.8452	Intermediate Similarity	NPC475667
0.8353	Intermediate Similarity	NPC478732
0.8256	Intermediate Similarity	NPC475270
0.8256	Intermediate Similarity	NPC475327
0.814	Intermediate Similarity	NPC478731
0.7614	Intermediate Similarity	NPC238264
0.7614	Intermediate Similarity	NPC477345
0.7386	Intermediate Similarity	NPC173328
0.734	Intermediate Similarity	NPC475241
0.7303	Intermediate Similarity	NPC186992
0.7	Intermediate Similarity	NPC297768
0.6966	Remote Similarity	NPC478733
0.6867	Remote Similarity	NPC606819
0.6742	Remote Similarity	NPC478734
0.6522	Remote Similarity	NPC60849
0.6484	Remote Similarity	NPC477344
0.6452	Remote Similarity	NPC479058
0.6421	Remote Similarity	NPC115013
0.6344	Remote Similarity	NPC479061
0.6344	Remote Similarity	NPC267592
0.6333	Remote Similarity	NPC477349
0.6304	Remote Similarity	NPC158302
0.6277	Remote Similarity	NPC479060
0.625	Remote Similarity	NPC290012
0.6211	Remote Similarity	NPC119583
0.6162	Remote Similarity	NPC478728
0.6105	Remote Similarity	NPC477319
0.6061	Remote Similarity	NPC269318
0.6042	Remote Similarity	NPC143421
0.602	Remote Similarity	NPC224953
0.5979	Remote Similarity	NPC483170
0.5978	Remote Similarity	NPC113745
0.5978	Remote Similarity	NPC477320
0.5978	Remote Similarity	NPC477323
0.5978	Remote Similarity	NPC477325
0.5978	Remote Similarity	NPC609436
0.5957	Remote Similarity	NPC479059
0.5934	Remote Similarity	NPC281563
0.59	Remote Similarity	NPC44782
0.5895	Remote Similarity	NPC109887
0.5882	Remote Similarity	NPC479056
0.5876	Remote Similarity	NPC307400
0.5876	Remote Similarity	NPC27289
0.5859	Remote Similarity	NPC126685
0.5851	Remote Similarity	NPC89843
0.5806	Remote Similarity	NPC22742
0.5806	Remote Similarity	NPC477346
0.5789	Remote Similarity	NPC477326
0.5773	Remote Similarity	NPC44682
0.57	Remote Similarity	NPC479057
0.57	Remote Similarity	NPC183888
0.57	Remote Similarity	NPC184915
0.5644	Remote Similarity	NPC163409
0.5644	Remote Similarity	NPC123204
0.5625	Remote Similarity	NPC600446
0.5625	Remote Similarity	NPC605013
0.5604	Remote Similarity	NPC477350
0.56	Remote Similarity	NPC238056
0.5556	Remote Similarity	NPC294748
0.5543	Remote Similarity	NPC146380
0.5481	Remote Similarity	NPC478727
0.5446	Remote Similarity	NPC169345
0.5446	Remote Similarity	NPC477317
0.5446	Remote Similarity	NPC477318
0.5429	Remote Similarity	NPC477348
0.54	Remote Similarity	NPC472204
0.5392	Remote Similarity	NPC259294
0.5357	Remote Similarity	NPC610996
0.5354	Remote Similarity	NPC146992
0.5354	Remote Similarity	NPC85759
0.5268	Remote Similarity	NPC611287
0.5263	Remote Similarity	NPC600721
0.5263	Remote Similarity	NPC605872
0.5259	Remote Similarity	NPC472352
0.5258	Remote Similarity	NPC604005
0.5258	Remote Similarity	NPC605014
0.5213	Remote Similarity	NPC475425
0.5204	Remote Similarity	NPC477332
0.52	Remote Similarity	NPC478725
0.5192	Remote Similarity	NPC472200
0.5149	Remote Similarity	NPC478723
0.5149	Remote Similarity	NPC478724
0.5091	Remote Similarity	NPC124878
0.5091	Remote Similarity	NPC231888
0.505	Remote Similarity	NPC478722
0.5049	Remote Similarity	NPC478726

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475540 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7177
0.1-0.2	1916
0.2-0.3	57
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data