NPASS Compound

Natural Product: NPC297768

Natural Product ID	NPC297768
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Orizabin V
IUPAC Name	n.a.
Synonyms	Orizabin V
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL309074
PubChem CID	21635817
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 158162 0 0 0 0 0 0 0 0999 V2000 -9.8614 2.0978 2.1564 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9615 3.1809 1.1165 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2493 2.7078 -0.1416 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7614 2.4667 0.3097 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0248 2.0059 -0.8420 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5932 1.6337 -0.8641 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5324 2.6101 -0.5881 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7861 3.4277 0.6024 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8777 4.4278 1.1452 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5519 4.1393 1.6715 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4693 3.8702 0.6973 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2407 3.3988 1.4968 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0595 4.3955 2.5555 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2993 4.1352 3.3195 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5203 2.8193 3.9396 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0177 1.8054 2.9971 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3095 1.8238 2.8333 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3159 0.8659 2.2890 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9566 -0.0193 1.4408 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0617 -1.0758 0.8193 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0496 -0.4886 0.0407 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3839 -1.1320 -1.1382 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9897 -2.3351 -1.0351 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4004 -2.4339 -1.5445 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2294 -1.3508 -1.3251 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5529 -1.7341 -1.2714 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5380 -0.6780 -1.0202 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3715 0.3936 -0.2248 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7119 -1.4019 -0.5401 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2756 -2.1090 -1.5657 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5753 -2.7106 -1.0759 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3287 -3.2162 -2.0557 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0686 -2.4503 -2.5019 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2445 -3.2095 -3.2277 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9223 -3.8795 -3.1026 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9188 -3.5837 -0.9971 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2767 -4.7468 -1.2207 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5618 -5.7510 -0.1053 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8981 -6.9426 -0.3436 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8111 -4.7387 -1.4437 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2480 -3.4174 -1.8636 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1039 -3.3456 -1.7756 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4004 -5.7745 -2.3215 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3157 0.8166 -0.3353 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6319 0.8147 -0.8296 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8302 2.1067 -1.5839 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6254 0.7281 0.3105 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7180 0.0118 -0.1891 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9086 0.6908 -0.1594 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4597 0.8559 -1.4566 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5491 1.7283 -1.2531 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9689 2.4466 -2.4964 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6912 0.8986 -0.6857 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2684 0.4312 0.6858 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9039 -0.2082 0.5602 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4481 -0.6419 1.7868 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1343 -0.5092 1.2273 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9102 1.6004 -0.6513 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0159 1.1373 -1.3404 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8673 0.0618 -1.9907 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3174 1.8044 -1.3603 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2466 3.2112 -1.9176 C 0 0 2 0 0 0 0 0 0 0 0 0 10.3910 4.0146 -1.1576 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9379 3.2523 -3.3857 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9402 1.9075 0.0183 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6460 -1.9047 1.8888 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0888 -3.1918 2.0527 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9076 -3.6444 1.1970 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6716 -4.0789 3.1602 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3445 -5.4192 3.1220 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0883 -6.2176 1.8857 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8345 -4.2299 3.2189 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8319 1.0663 1.7036 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7648 2.1739 2.7969 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9614 2.2179 2.7705 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9906 3.5005 0.8900 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4387 4.1081 1.4956 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1880 3.5551 -0.8254 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6518 1.7752 -0.5264 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9578 1.6500 1.0902 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4880 3.3267 0.9024 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6234 1.1474 -1.3088 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1420 2.7974 -1.6667 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4875 1.3126 -1.9754 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4476 3.2718 -1.5067 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5739 1.9981 -0.5113 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6807 4.1073 0.2445 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2894 2.8002 1.3960 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7398 5.2961 0.3893 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4877 5.0015 1.9431 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5382 3.4319 2.5433 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2247 5.1227 2.1938 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6384 3.1493 -0.0863 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1326 4.8169 0.1778 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5670 2.4301 1.9710 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5812 3.2061 0.8040 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8138 4.4743 3.2958 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1106 5.3997 2.0528 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4349 4.9365 4.1212 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1635 4.3441 2.6077 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5937 2.3824 4.4029 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2776 2.9299 4.7764 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7269 -0.5861 2.0448 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7725 -1.6345 0.1391 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9274 -0.3785 0.7115 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9347 -2.6943 0.0146 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2749 -2.4690 -2.6695 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6655 -2.4977 -0.4259 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8376 -0.2691 -2.0439 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4759 -1.4663 -2.4444 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4925 -3.8147 -1.1481 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7727 -2.4544 -0.0116 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4301 -2.3880 -1.7270 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0987 -3.8506 -1.1816 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4868 -1.6462 -3.1825 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5478 -4.1283 -3.3018 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1439 -4.8034 -2.7598 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7349 -5.2246 -2.1344 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6533 -5.9488 -0.0223 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1927 -5.3381 0.8581 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5461 -7.6873 -0.3166 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3101 -4.9989 -0.4703 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6019 -3.2404 -2.9225 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4899 -2.8512 -2.5472 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4960 -5.5485 -3.2579 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7499 -0.0619 -1.5276 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8420 2.5510 -1.8156 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4428 1.9574 -2.5011 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3556 2.8050 -0.9121 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9141 1.7358 0.6266 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8675 1.6973 0.2538 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2217 2.4782 -0.4860 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9072 1.9918 -2.9156 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1968 3.5043 -2.2896 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1892 2.4225 -3.2871 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8071 -0.0192 -1.3212 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1660 1.2809 1.3950 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0402 -1.0790 -0.1502 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6211 -1.6168 1.8321 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6163 -1.2308 1.6625 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0279 1.2440 -1.9939 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2736 3.6477 -1.7807 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8364 4.3530 -0.3385 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3800 2.3492 -3.6667 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8844 3.2784 -3.9790 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3805 4.1799 -3.6579 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1944 2.1286 0.7976 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6722 2.7350 -0.0195 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5167 0.9880 0.2527 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9899 -3.5896 4.1039 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4439 -5.2477 3.2062 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0637 -5.9887 4.0322 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7887 -5.9603 1.0613 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3156 -7.3007 2.1106 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0499 -6.2106 1.5542 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3365 -3.6600 2.4151 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0622 -5.3070 2.9963 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1940 -4.0206 4.2261 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 24 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 21 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 53 58 1 0 58 59 1 0 59 60 2 0 59 61 1 0 61 62 1 0 62 63 1 0 62 64 1 0 61 65 1 0 20 66 1 0 66 67 1 0 67 68 2 0 67 69 1 0 69 70 1 0 70 71 1 0 69 72 1 0 28 6 1 0 55 49 1 0 47 19 1 0 41 23 1 0 33 26 1 0 1 73 1 0 1 74 1 0 1 75 1 0 2 76 1 0 2 77 1 0 3 78 1 0 3 79 1 0 4 80 1 0 4 81 1 0 5 82 1 0 5 83 1 0 6 84 1 6 7 85 1 0 7 86 1 0 8 87 1 0 8 88 1 0 9 89 1 0 9 90 1 0 10 91 1 0 10 92 1 0 11 93 1 0 11 94 1 0 12 95 1 0 12 96 1 0 13 97 1 0 13 98 1 0 14 99 1 0 14100 1 0 15101 1 0 15102 1 0 19103 1 1 20104 1 6 21105 1 1 23106 1 1 24107 1 6 26108 1 1 27109 1 6 30110 1 6 31111 1 0 31112 1 0 31113 1 0 32114 1 1 33115 1 6 34116 1 0 35117 1 0 37118 1 6 38119 1 0 38120 1 0 39121 1 0 40122 1 1 41123 1 6 42124 1 0 43125 1 0 45126 1 6 46127 1 0 46128 1 0 46129 1 0 47130 1 1 49131 1 1 51132 1 1 52133 1 0 52134 1 0 52135 1 0 53136 1 6 54137 1 1 55138 1 6 56139 1 0 57140 1 0 61141 1 6 62142 1 6 63143 1 0 64144 1 0 64145 1 0 64146 1 0 65147 1 0 65148 1 0 65149 1 0 69150 1 1 70151 1 0 70152 1 0 71153 1 0 71154 1 0 71155 1 0 72156 1 0 72157 1 0 72158 1 0 M END

Standard InCHIKey	VTCACSFZWLHMDR-PIQVQLGRSA-N
Standard InCHI	InChI=1S/C50H86O22/c1-9-11-17-20-30-21-18-15-13-12-14-16-19-22-32(53)67-43-40(70-47-38(59)37(58)39(28(7)63-47)68-46(61)25(4)26(5)52)29(8)64-50(44(43)69-45(60)24(3)10-2)72-42-36(57)34(55)31(23-51)66-49(42)71-41-35(56)33(54)27(6)62-48(41)65-30/h24-31,33-44,47-52,54-59H,9-23H2,1-8H3/t24-,25+,26+,27+,28+,29-,30-,31+,33+,34+,35-,36-,37+,38+,39+,40-,41+,42+,43+,44+,47-,48-,49-,50-/m0/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@H]([C@H](O[C@H]3[C@H](O[C@H]4[C@H](O1)O[C@H](C)[C@H]([C@@H]4O)O)O[C@H](CO)[C@H]([C@@H]3O)O)O[C@@H](C)[C@@H]2O[C@@H]1O[C@H](C)[C@H]([C@@H]([C@H]1O)O)OC(=O)[C@@H]([C@H](O)C)C)OC(=O)[C@H](CC)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1038.56	Volume:	1016.049 ? Van der Waals volume.
Dense:	1.022	LogP:	3.02 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.66 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.938 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	45.0
TPSA:	314.58 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	8.0	Rings:	5.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.074	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.596	Fsp³:	0.94
MCE-18:	109.979 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.972	Fluc inhibitor:	0.064 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.01 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.002 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.52	Promiscuous compounds:	0.295

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.79	MDCK Permeability:	-5.011
Pgp-inhibitor:	0.0	Pgp-substrate:	0.826
PAMPA:	0.984 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.006	30% Bioavailability (F30%):	0.993
50% Bioavailability (F50%):	0.993

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.539
Plasma Protein Binding (PPB):	70.517%	Volume Distribution (VD):	-0.354
Fu:	20.554% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.011

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.013
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.995
HLM stability:	0.997 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.846

Half-life (T1/2):

3.291

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.029
Human Hepatotoxicity (H-HT):	0.704	Drug-induced Liver Injury (DILI):	0.997
AMES Toxicity:	0.894	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.004	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.654	Drug-induced Nephrotoxicity:	0.98
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.582
A549 Cytotoxicity:	0.984	Hek293 Cytotoxicity:	0.181
BCF:	0.404 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.242 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.074 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.008 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	Roots	Mexican	n.a.	PMID[10479311]
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	crude resin	Mexican	n.a.	PMID[16562846]
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	4

Activity Type	# Activity
Cell line	3
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	=	7.0	ug ml-1	PMID[7381856]
NPT5198	Cell line	OVCAR	Homo sapiens	ED50	>	15.0	ug ml-1	PMID[7381856]
NPT148	Cell line	HCT-15	Homo sapiens	ED50	>	15.0	ug ml-1	DOI[10.1007/s00044-010-9328-z]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	>	15.0	ug ml-1	PMID[10479311]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC297768 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22294
0.1-0.2	24375
0.2-0.3	2974
0.3-0.4	85
0.4-0.5	14
0.5-0.6	27
0.6-0.7	48
0.7-0.8	0
0.8-0.85	7
0.85-0.9	2
0.9-0.95	3
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9459	High Similarity	NPC478734
0.9211	High Similarity	NPC478733
0.9079	High Similarity	NPC477344
0.875	High Similarity	NPC238264
0.875	High Similarity	NPC477345
0.8415	Intermediate Similarity	NPC478732
0.8313	Intermediate Similarity	NPC475270
0.8313	Intermediate Similarity	NPC475327
0.8293	Intermediate Similarity	NPC476087
0.8293	Intermediate Similarity	NPC475667
0.8161	Intermediate Similarity	NPC475241
0.8095	Intermediate Similarity	NPC224953
0.7975	Intermediate Similarity	NPC22742
0.7975	Intermediate Similarity	NPC477346
0.7882	Intermediate Similarity	NPC184915
0.7882	Intermediate Similarity	NPC126685
0.7738	Intermediate Similarity	NPC478730
0.7701	Intermediate Similarity	NPC44782
0.7674	Intermediate Similarity	NPC183888
0.7614	Intermediate Similarity	NPC475164
0.7529	Intermediate Similarity	NPC119583
0.7528	Intermediate Similarity	NPC473605
0.7528	Intermediate Similarity	NPC475375
0.7471	Intermediate Similarity	NPC259294
0.7356	Intermediate Similarity	NPC238056
0.7356	Intermediate Similarity	NPC478731
0.7356	Intermediate Similarity	NPC115013
0.7326	Intermediate Similarity	NPC143421
0.7308	Intermediate Similarity	NPC606819
0.7241	Intermediate Similarity	NPC483170
0.7209	Intermediate Similarity	NPC477319
0.7159	Intermediate Similarity	NPC290012
0.7126	Intermediate Similarity	NPC307400
0.7126	Intermediate Similarity	NPC472204
0.7126	Intermediate Similarity	NPC27289
0.7111	Intermediate Similarity	NPC476066
0.7045	Intermediate Similarity	NPC478726
0.7011	Intermediate Similarity	NPC173328
0.7	Intermediate Similarity	NPC472200
0.7	Intermediate Similarity	NPC475525
0.7	Intermediate Similarity	NPC475540
0.6977	Remote Similarity	NPC109887
0.6941	Remote Similarity	NPC89843
0.6932	Remote Similarity	NPC186992
0.6914	Remote Similarity	NPC477350
0.69	Remote Similarity	NPC600721
0.69	Remote Similarity	NPC605872
0.6897	Remote Similarity	NPC146992
0.6897	Remote Similarity	NPC85759
0.686	Remote Similarity	NPC477326
0.6818	Remote Similarity	NPC472205
0.6813	Remote Similarity	NPC123204
0.6742	Remote Similarity	NPC294748
0.6739	Remote Similarity	NPC477347
0.6706	Remote Similarity	NPC477349
0.67	Remote Similarity	NPC610996
0.6667	Remote Similarity	NPC479059
0.6667	Remote Similarity	NPC600446
0.6667	Remote Similarity	NPC605013
0.6552	Remote Similarity	NPC477331
0.6552	Remote Similarity	NPC477332
0.6517	Remote Similarity	NPC478722
0.6517	Remote Similarity	NPC267592
0.6517	Remote Similarity	NPC478725
0.6489	Remote Similarity	NPC478728
0.6444	Remote Similarity	NPC478723
0.6444	Remote Similarity	NPC478724
0.6421	Remote Similarity	NPC478727
0.6413	Remote Similarity	NPC169345
0.6413	Remote Similarity	NPC477317
0.6413	Remote Similarity	NPC477318
0.6333	Remote Similarity	NPC479061
0.6333	Remote Similarity	NPC60849
0.6322	Remote Similarity	NPC113745
0.6322	Remote Similarity	NPC477320
0.6322	Remote Similarity	NPC477323
0.6322	Remote Similarity	NPC477325
0.6322	Remote Similarity	NPC609436
0.6286	Remote Similarity	NPC600940
0.6279	Remote Similarity	NPC281563
0.6275	Remote Similarity	NPC611287
0.6264	Remote Similarity	NPC479058
0.6264	Remote Similarity	NPC479060
0.625	Remote Similarity	NPC604005
0.625	Remote Similarity	NPC605014
0.6132	Remote Similarity	NPC610997
0.6117	Remote Similarity	NPC290276
0.6111	Remote Similarity	NPC158302
0.602	Remote Similarity	NPC477348
0.5926	Remote Similarity	NPC472352
0.5905	Remote Similarity	NPC600672
0.5882	Remote Similarity	NPC478729
0.5876	Remote Similarity	NPC269318
0.5862	Remote Similarity	NPC146380
0.5789	Remote Similarity	NPC206823
0.5739	Remote Similarity	NPC147032
0.5618	Remote Similarity	NPC477328
0.5618	Remote Similarity	NPC477330
0.5577	Remote Similarity	NPC63404
0.5556	Remote Similarity	NPC477329
0.5536	Remote Similarity	NPC471024
0.5524	Remote Similarity	NPC77651
0.5514	Remote Similarity	NPC10121
0.5514	Remote Similarity	NPC198918
0.5514	Remote Similarity	NPC10883
0.551	Remote Similarity	NPC479057
0.5429	Remote Similarity	NPC35338
0.5429	Remote Similarity	NPC204214
0.5429	Remote Similarity	NPC92283
0.5377	Remote Similarity	NPC28069
0.53	Remote Similarity	NPC163409
0.5165	Remote Similarity	NPC475425
0.5135	Remote Similarity	NPC471025
0.5088	Remote Similarity	NPC471026
0.5047	Remote Similarity	NPC124878
0.5047	Remote Similarity	NPC231888

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC297768 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7343
0.1-0.2	1732
0.2-0.3	75
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data