NPASS Compound

Natural Product: NPC473605

Natural Product ID	NPC473605
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Orizabin Xiv
IUPAC Name	n.a.
Synonyms	Orizabin XIV
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL446984
PubChem CID	11051455
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0003918] Saccharolipids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 170174 0 0 0 0 0 0 0 0999 V2000 -3.3613 -3.6662 3.9450 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7256 -4.0168 3.3318 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9623 -3.0126 2.2163 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2747 -3.2381 1.5279 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5332 -2.2681 0.4465 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5023 -2.2768 -0.6973 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5163 -3.6965 -1.3031 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4484 -3.8306 -2.3447 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0716 -3.8939 -1.8189 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0581 -3.7277 -2.9332 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6645 -4.0714 -2.4259 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4362 -3.6097 -3.3598 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5861 -2.1050 -3.2756 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6450 -1.6509 -4.2312 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9652 -0.1671 -4.0023 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6007 -0.1030 -2.6646 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8503 -0.2517 -2.5192 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8721 0.1160 -1.5471 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4290 0.1923 -0.2336 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4245 0.5745 0.8279 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1417 -0.0112 0.3451 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0167 0.4249 0.8919 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8393 1.1626 -0.0061 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2580 0.7874 0.1170 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8074 -0.0677 -0.7618 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0708 0.1583 -2.0425 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4828 -0.4097 -2.3111 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7615 -1.4388 -1.6311 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4440 -0.6420 -3.7347 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6904 0.5669 -4.3372 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2881 0.3600 -5.8187 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9349 1.7098 -3.8103 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0976 1.5377 -2.5857 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8205 2.0285 -2.9166 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8432 2.7877 -3.6426 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1720 1.8114 0.3403 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7436 2.8587 1.0934 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8635 3.8849 1.1730 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3558 4.9336 1.9877 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0978 6.0790 2.2646 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2424 6.2098 1.7875 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5513 7.1487 3.1193 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4978 8.3079 3.2422 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8092 8.9368 1.8965 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1934 7.5836 2.6658 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6659 3.5492 0.2426 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5055 2.6058 0.2198 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6087 3.0941 -0.7281 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2470 4.7250 0.8594 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3442 -1.3938 0.3669 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5584 -1.8446 0.7631 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6177 -3.3519 0.4021 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7796 -1.2646 0.1088 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7808 -1.2763 1.0920 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9830 -1.7873 0.6854 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3885 -2.8963 1.4642 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4997 -3.4360 0.7865 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6767 -4.8998 1.1227 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6859 -2.6070 1.0601 C 0 0 2 0 0 0 0 0 0 0 0 0 7.3701 -1.1601 1.1879 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0074 -0.6935 0.7957 C 0 0 1 0 0 0 0 0 0 0 0 0 6.1184 -0.0934 -0.4843 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6387 -0.7268 2.5111 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6869 -2.7534 0.0366 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9683 -3.1819 0.3575 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2107 -3.4219 1.5657 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0362 -3.3663 -0.6296 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8453 -3.1383 -1.9220 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9132 -3.3194 -2.9422 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3913 -3.8147 -0.2174 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4659 1.9024 1.1923 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7163 2.3393 2.4895 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9076 1.4003 3.3326 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7786 3.7159 2.9600 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0252 3.7061 4.4627 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2216 3.0634 4.7900 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9001 2.9803 5.1376 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8187 4.5501 2.2626 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9532 -4.5216 4.4999 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6777 -3.3811 3.0950 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5090 -2.7542 4.5368 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5218 -4.0164 4.0747 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6158 -5.0152 2.8602 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9850 -1.9862 2.6744 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0799 -3.0095 1.5309 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4370 -4.3014 1.2436 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0583 -3.0715 2.3323 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5333 -2.4823 0.0013 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6165 -1.2524 0.8864 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5434 -2.1569 -0.1881 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4931 -3.8113 -1.7922 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4119 -4.4393 -0.5004 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6451 -4.8313 -2.8418 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5122 -3.1037 -3.1674 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8204 -3.1156 -1.0708 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9276 -4.8824 -1.2965 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0884 -2.6975 -3.3013 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3760 -4.4293 -3.7333 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5233 -3.6641 -1.3997 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6378 -5.1751 -2.3150 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3725 -4.0523 -2.9611 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2771 -3.9768 -4.3687 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4059 -1.6403 -3.5148 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7998 -1.8408 -2.2332 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5318 -2.2844 -4.1171 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2313 -1.7575 -5.2642 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6498 0.1409 -4.7933 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0238 0.4166 -3.9497 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3107 0.8423 -0.2461 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6439 -0.0046 1.7950 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0882 0.2264 -0.7651 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4033 0.8810 -1.0032 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3167 0.2211 1.1214 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4177 -0.4416 -2.7563 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2089 0.4681 -2.2565 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7878 0.7982 -4.3773 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1761 0.1436 -5.8270 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4317 1.3020 -6.3611 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7769 -0.5177 -6.2382 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2361 2.0569 -4.6426 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5530 2.2416 -1.8176 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8262 2.5650 -3.7225 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4142 3.4257 -3.0381 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2967 2.6270 2.0639 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7525 3.4077 1.5782 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9591 4.3112 0.1583 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4644 6.7197 4.1622 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0619 9.0538 3.9197 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4409 7.9482 3.7195 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7330 10.0499 1.9839 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8516 8.6929 1.5976 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0644 8.6259 1.1580 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9660 8.6124 3.0167 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0775 7.5987 1.5615 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4188 6.9090 3.1227 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0214 3.7135 -0.7825 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0048 2.7504 1.2273 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3742 4.0295 -0.5252 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9024 4.4791 1.7538 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6575 -1.9057 1.8976 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7429 -3.3824 -0.6942 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4993 -3.8120 0.8957 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6627 -3.8054 0.6717 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1168 -1.7394 -0.8083 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9488 -2.0922 -0.4021 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2317 -3.3527 -0.3023 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2867 -5.0540 2.1537 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0685 -5.4837 0.4073 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7236 -5.1812 1.0073 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1240 -2.9276 2.0429 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1271 -0.5447 0.5855 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6445 0.1110 1.5122 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2735 0.8712 -0.3221 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9100 -1.4799 3.0866 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8412 -2.8012 -2.2044 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5150 -2.9854 -3.9245 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2707 -4.3725 -2.9539 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7511 -2.6506 -2.6571 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1655 -3.2190 -0.7426 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4607 -3.6168 0.8920 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5395 -4.9048 -0.3393 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7522 4.1587 2.8373 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0458 4.7351 4.8819 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7710 2.8285 3.9970 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0022 2.8864 4.4823 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2314 1.9916 5.4812 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5358 3.5115 6.0672 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7635 4.5166 2.8569 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9928 4.2473 1.2066 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4673 5.5992 2.2839 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 24 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 2 0 40 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 37 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 21 50 1 0 50 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 60 63 1 0 59 64 1 0 64 65 1 0 65 66 2 0 65 67 1 0 67 68 2 0 68 69 1 0 67 70 1 0 20 71 1 0 71 72 1 0 72 73 2 0 72 74 1 0 74 75 1 0 75 76 1 0 75 77 1 0 74 78 1 0 28 6 1 0 61 55 1 0 53 19 1 0 47 23 1 0 33 26 1 0 1 79 1 0 1 80 1 0 1 81 1 0 2 82 1 0 2 83 1 0 3 84 1 0 3 85 1 0 4 86 1 0 4 87 1 0 5 88 1 0 5 89 1 0 6 90 1 1 7 91 1 0 7 92 1 0 8 93 1 0 8 94 1 0 9 95 1 0 9 96 1 0 10 97 1 0 10 98 1 0 11 99 1 0 11100 1 0 12101 1 0 12102 1 0 13103 1 0 13104 1 0 14105 1 0 14106 1 0 15107 1 0 15108 1 0 19109 1 6 20110 1 1 21111 1 6 23112 1 6 24113 1 1 26114 1 6 27115 1 6 30116 1 6 31117 1 0 31118 1 0 31119 1 0 32120 1 6 33121 1 1 34122 1 0 35123 1 0 37124 1 1 38125 1 0 38126 1 0 42127 1 1 43128 1 0 43129 1 0 44130 1 0 44131 1 0 44132 1 0 45133 1 0 45134 1 0 45135 1 0 46136 1 6 47137 1 1 48138 1 0 49139 1 0 51140 1 1 52141 1 0 52142 1 0 52143 1 0 53144 1 6 55145 1 6 57146 1 6 58147 1 0 58148 1 0 58149 1 0 59150 1 1 60151 1 6 61152 1 1 62153 1 0 63154 1 0 68155 1 0 69156 1 0 69157 1 0 69158 1 0 70159 1 0 70160 1 0 70161 1 0 74162 1 1 75163 1 1 76164 1 0 77165 1 0 77166 1 0 77167 1 0 78168 1 0 78169 1 0 78170 1 0 M END

Standard InCHIKey	XWFYNUFRBKFXIY-CKNIESFISA-N
Standard InCHI	InChI=1S/C55H92O23/c1-11-14-20-23-34-24-21-18-16-15-17-19-22-25-36(57)73-47-44(76-52-42(63)41(62)43(32(9)69-52)74-50(65)28(5)13-3)33(10)70-55(48(47)75-51(66)29(6)30(7)56)78-46-40(61)38(59)35(26-67-49(64)27(4)12-2)72-54(46)77-45-39(60)37(58)31(8)68-53(45)71-34/h13,27,29-35,37-48,52-56,58-63H,11-12,14-26H2,1-10H3/b28-13+/t27-,29+,30+,31+,32+,33-,34-,35+,37+,38+,39-,40-,41+,42+,43+,44-,45+,46+,47+,48+,52-,53-,54-,55-/m0/s1
SMILES	CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@H]([C@H](O[C@H]3[C@H](O[C@H]4[C@H](O1)O[C@H](C)[C@H]([C@@H]4O)O)O[C@H](COC(=O)[C@H](CC)C)[C@H]([C@@H]3O)O)O[C@@H](C)[C@@H]2O[C@@H]1O[C@H](C)[C@H]([C@@H]([C@H]1O)O)OC(=O)/C(=C/C)/C)OC(=O)[C@@H]([C@H](O)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1120.6	Volume:	1106.046 ? Van der Waals volume.
Dense:	1.013	LogP:	3.437 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.867 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.916 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	18.0	Rigid Bonds:	47.0
TPSA:	320.65 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	7.0	Rings:	5.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.054	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.841	Fsp³:	0.891
MCE-18:	113.385 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.988	Fluc inhibitor:	0.232 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.017 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.004 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.478	Promiscuous compounds:	0.276

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.69	MDCK Permeability:	-5.09
Pgp-inhibitor:	0.002	Pgp-substrate:	0.91
PAMPA:	0.99 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.071	30% Bioavailability (F30%):	0.986
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.652
Plasma Protein Binding (PPB):	87.985%	Volume Distribution (VD):	-0.389
Fu:	8.381% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.97

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.618
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.989
HLM stability:	0.997 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.704

Half-life (T1/2):

2.968

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.027
Human Hepatotoxicity (H-HT):	0.641	Drug-induced Liver Injury (DILI):	0.998
AMES Toxicity:	0.907	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.733	Drug-induced Nephrotoxicity:	0.994
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.709
A549 Cytotoxicity:	0.988	Hek293 Cytotoxicity:	0.395
BCF:	0.397 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.27 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.132 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.202 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	Roots	Mexican	n.a.	PMID[10479311]
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	crude resin	Mexican	n.a.	PMID[16562846]
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19009	Ipomoea orizabensis	Species	Convolvulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	4
IC50	1
ED50	1

Activity Type	# Activity
Cell line	2
Organism	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	1.5	ug.mL-1	PMID[21376582]
NPT91	Cell line	KB	Homo sapiens	ED50	=	1.0	ug ml-1	PMID[29126728]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	16.0	ug.mL-1	PMID[23999040]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	64.0	ug.mL-1	PMID[23822611]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	8.0	ug.mL-1	PMID[22682920]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC473605 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21766
0.1-0.2	25430
0.2-0.3	2479
0.3-0.4	57
0.4-0.5	21
0.5-0.6	56
0.6-0.7	27
0.7-0.8	0
0.8-0.85	3
0.85-0.9	3
0.9-0.95	5
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC475375
0.9639	High Similarity	NPC475164
0.9286	High Similarity	NPC476066
0.9167	High Similarity	NPC475525
0.9167	High Similarity	NPC475540
0.9048	High Similarity	NPC475270
0.9048	High Similarity	NPC475327
0.8929	High Similarity	NPC478732
0.881	High Similarity	NPC476087
0.881	High Similarity	NPC475667
0.8471	Intermediate Similarity	NPC478730
0.8068	Intermediate Similarity	NPC478731
0.8046	Intermediate Similarity	NPC186992
0.7955	Intermediate Similarity	NPC238264
0.7955	Intermediate Similarity	NPC477345
0.7849	Intermediate Similarity	NPC475241
0.7727	Intermediate Similarity	NPC173328
0.7528	Intermediate Similarity	NPC297768
0.7079	Intermediate Similarity	NPC478734
0.6923	Remote Similarity	NPC478733
0.6813	Remote Similarity	NPC477344
0.663	Remote Similarity	NPC158302
0.6628	Remote Similarity	NPC606819
0.6526	Remote Similarity	NPC119583
0.6489	Remote Similarity	NPC60849
0.6421	Remote Similarity	NPC479058
0.6421	Remote Similarity	NPC477319
0.6392	Remote Similarity	NPC115013
0.6364	Remote Similarity	NPC269318
0.6354	Remote Similarity	NPC143421
0.6327	Remote Similarity	NPC224953
0.6289	Remote Similarity	NPC483170
0.6224	Remote Similarity	NPC290012
0.6186	Remote Similarity	NPC307400
0.6186	Remote Similarity	NPC27289
0.617	Remote Similarity	NPC89843
0.6162	Remote Similarity	NPC126685
0.6146	Remote Similarity	NPC479061
0.6139	Remote Similarity	NPC478728
0.6129	Remote Similarity	NPC22742
0.6129	Remote Similarity	NPC477349
0.6129	Remote Similarity	NPC477346
0.6082	Remote Similarity	NPC479060
0.6061	Remote Similarity	NPC238056
0.6	Remote Similarity	NPC183888
0.6	Remote Similarity	NPC184915
0.5941	Remote Similarity	NPC123204
0.5938	Remote Similarity	NPC479059
0.5882	Remote Similarity	NPC44782
0.5816	Remote Similarity	NPC267592
0.5789	Remote Similarity	NPC113745
0.5789	Remote Similarity	NPC477320
0.5789	Remote Similarity	NPC477323
0.5789	Remote Similarity	NPC477325
0.5789	Remote Similarity	NPC609436
0.5766	Remote Similarity	NPC610996
0.5745	Remote Similarity	NPC281563
0.5743	Remote Similarity	NPC169345
0.5743	Remote Similarity	NPC477317
0.5743	Remote Similarity	NPC477318
0.5714	Remote Similarity	NPC109887
0.57	Remote Similarity	NPC472204
0.5686	Remote Similarity	NPC479057
0.5686	Remote Similarity	NPC259294
0.5682	Remote Similarity	NPC479056
0.5664	Remote Similarity	NPC600721
0.5664	Remote Similarity	NPC605872
0.5657	Remote Similarity	NPC146992
0.5657	Remote Similarity	NPC85759
0.5612	Remote Similarity	NPC477326
0.56	Remote Similarity	NPC44682
0.5566	Remote Similarity	NPC477348
0.5545	Remote Similarity	NPC294748
0.5536	Remote Similarity	NPC611287
0.5517	Remote Similarity	NPC472352
0.549	Remote Similarity	NPC478726
0.5481	Remote Similarity	NPC163409
0.5481	Remote Similarity	NPC472200
0.5472	Remote Similarity	NPC478727
0.5455	Remote Similarity	NPC600446
0.5455	Remote Similarity	NPC605013
0.5426	Remote Similarity	NPC477350
0.5368	Remote Similarity	NPC146380
0.5299	Remote Similarity	NPC600940
0.5299	Remote Similarity	NPC610997
0.5294	Remote Similarity	NPC472205
0.5217	Remote Similarity	NPC600672
0.52	Remote Similarity	NPC477332
0.5196	Remote Similarity	NPC478725
0.5179	Remote Similarity	NPC63404
0.5146	Remote Similarity	NPC478723
0.5146	Remote Similarity	NPC478724
0.514	Remote Similarity	NPC477347
0.513	Remote Similarity	NPC10883
0.51	Remote Similarity	NPC604005
0.51	Remote Similarity	NPC605014
0.5052	Remote Similarity	NPC475425
0.505	Remote Similarity	NPC477331
0.5049	Remote Similarity	NPC478722
0.5044	Remote Similarity	NPC35338
0.5044	Remote Similarity	NPC204214
0.5044	Remote Similarity	NPC92283

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC473605 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7240
0.1-0.2	1859
0.2-0.3	51
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data